+++ /dev/null
-[submodule "libpicofe"]
- path = frontend/libpicofe
- url = git://notaz.gp2x.de/~notaz/libpicofe.git
-[submodule "warm"]
- path = frontend/warm
- url = git://notaz.gp2x.de/~notaz/warm.git
before_install:
- sudo apt-get update -qq
- sudo apt-get install -y libsdl1.2-dev libasound2-dev libpng-dev libz-dev
-script: ./configure && make
+script: ./configure --platform=libretro && make
# default stuff goes here, so that config can override
TARGET ?= pcsx
-CFLAGS += -Wall -ggdb -Iinclude -ffast-math
-ifndef DEBUG
+CFLAGS += -Wall -Iinclude -ffast-math
+ifeq ($(DEBUG), 1)
+CFLAGS += -O0 -ggdb
+else
+ifeq ($(platform), vita)
+CFLAGS += -O3 -DNDEBUG
+else
CFLAGS += -O2 -DNDEBUG
endif
+endif
CXXFLAGS += $(CFLAGS)
#DRC_DBG = 1
#PCNT = 1
libpcsxcore/psxhw.o libpcsxcore/psxinterpreter.o libpcsxcore/psxmem.o libpcsxcore/r3000a.o \
libpcsxcore/sio.o libpcsxcore/socket.o libpcsxcore/spu.o
OBJS += libpcsxcore/gte.o libpcsxcore/gte_nf.o libpcsxcore/gte_divider.o
+ifeq ($(WANT_ZLIB),1)
+CFLAGS += -Ideps/zlib
+OBJS += deps/zlib/adler32.o \
+ deps/zlib/compress.o \
+ deps/zlib/crc32.o \
+ deps/zlib/deflate.o \
+ deps/zlib/gzclose.o \
+ deps/zlib/gzlib.o \
+ deps/zlib/gzread.o \
+ deps/zlib/gzwrite.o \
+ deps/zlib/inffast.o \
+ deps/zlib/inflate.o \
+ deps/zlib/inftrees.o \
+ deps/zlib/trees.o \
+ deps/zlib/uncompr.o \
+ deps/zlib/zutil.o
+endif
ifeq "$(ARCH)" "arm"
OBJS += libpcsxcore/gte_arm.o
endif
# dynarec
ifeq "$(USE_DYNAREC)" "1"
-OBJS += libpcsxcore/new_dynarec/new_dynarec.o libpcsxcore/new_dynarec/linkage_arm.o
-OBJS += libpcsxcore/new_dynarec/pcsxmem.o
+OBJS += libpcsxcore/new_dynarec/new_dynarec.o libpcsxcore/new_dynarec/arm/linkage_arm.o
+OBJS += libpcsxcore/new_dynarec/backends/psx/pcsxmem.o
else
-libpcsxcore/new_dynarec/emu_if.o: CFLAGS += -DDRC_DISABLE
+libpcsxcore/new_dynarec/backends/psx/emu_if.o: CFLAGS += -DDRC_DISABLE
frontend/libretro.o: CFLAGS += -DDRC_DISABLE
endif
-OBJS += libpcsxcore/new_dynarec/emu_if.o
-libpcsxcore/new_dynarec/new_dynarec.o: libpcsxcore/new_dynarec/assem_arm.c \
- libpcsxcore/new_dynarec/pcsxmem_inline.c
+OBJS += libpcsxcore/new_dynarec/backends/psx/emu_if.o
+libpcsxcore/new_dynarec/new_dynarec.o: libpcsxcore/new_dynarec/arm/assem_arm.c \
+ libpcsxcore/new_dynarec/backends/psx/pcsxmem_inline.c
ifdef DRC_DBG
-libpcsxcore/new_dynarec/emu_if.o: CFLAGS += -D_FILE_OFFSET_BITS=64
+libpcsxcore/new_dynarec/backends/psx/emu_if.o: CFLAGS += -D_FILE_OFFSET_BITS=64
CFLAGS += -DDRC_DBG
endif
ifeq "$(DRC_CACHE_BASE)" "1"
libpcsxcore/new_dynarec/%.o: CFLAGS += -DBASE_ADDR_FIXED=1
+libpcsxcore/new_dynarec/backends/psx/%.o: CFLAGS += -DBASE_ADDR_FIXED=1
+libpcsxcore/new_dynarec/arm/%.o: CFLAGS += -DBASE_ADDR_FIXED=1
endif
# spu
ifeq "$(PLATFORM)" "libretro"
OBJS += frontend/libretro.o
CFLAGS += -DFRONTEND_SUPPORTS_RGB565
+CFLAGS += -DHAVE_LIBRETRO
ifeq ($(MMAP_WIN32),1)
OBJS += libpcsxcore/memmap_win32.o
%.o: %.S
$(CC_AS) $(CFLAGS) -c $^ -o $@
+%.o: %.cpp
+ $(CXX) $(CXXFLAGS) -c -o $@ $<
+
+%.o: %.c
+ $(CC) $(CFLAGS) -c -o $@ $<
target_: $(TARGET)
$(TARGET): $(OBJS)
+ @echo "** BUILDING $(TARGET) FOR PLATFORM $(PLATFORM) **"
+ifeq ($(STATIC_LINKING), 1)
+ $(AR) rcs $@ $(OBJS)
+else
$(CC_LINK) -o $@ $^ $(LDFLAGS) $(LDLIBS) $(EXTRA_LDFLAGS)
+endif
+ @echo "** BUILD SUCCESSFUL! GG NO RE **"
clean: $(PLAT_CLEAN) clean_plugins
$(RM) $(TARGET) $(OBJS) $(TARGET).map frontend/revision.h
# Makefile for PCSX ReARMed (libretro)
+DEBUG=0
+WANT_ZLIB=1
+
ifeq ($(platform),)
platform = unix
ifeq ($(shell uname -a),)
CFLAGS ?=
TARGET_NAME := pcsx_rearmed
-
+GIT_VERSION := " $(shell git rev-parse --short HEAD || echo unknown)"
+ifneq ($(GIT_VERSION)," unknown")
+ CFLAGS += -DGIT_VERSION=\"$(GIT_VERSION)\"
+endif
+ifneq ($(WANT_ZLIB),1)
+LIBZ := -lz
+endif
+LIBPTHREAD := -lpthread
+ifneq ($(findstring Haiku,$(shell uname -s)),)
+LIBDL := -lroot -lnetwork
+else
+LIBDL := -ldl
+endif
+LIBM := -lm
MMAP_WIN32=0
+EXTRA_LDFLAGS =
# Unix
ifeq ($(platform), unix)
TARGET := $(TARGET_NAME)_libretro.so
fpic := -fPIC
- SHARED := -shared -Wl,--version-script=libretro/link.T
+ifneq ($(findstring SunOS,$(shell uname -s)),)
+ CC = gcc
+endif
+
+else ifeq ($(platform), linux-portable)
+ TARGET := $(TARGET_NAME)_libretro.so
+ fpic := -fPIC -nostdlib
+ EXTRA_LDFLAGS += -fPIC -nostdlib
+ LIBZ :=
+ LIBPTHREAD :=
+ LIBDL :=
+ LIBM :=
+ NO_UNDEF_CHECK = 1
# OS X
else ifeq ($(platform), osx)
+ USE_DYNAREC ?= 1
TARGET := $(TARGET_NAME)_libretro.dylib
fpic := -fPIC
- SHARED := -dynamiclib
- OSXVER = `sw_vers -productVersion | cut -d. -f 2`
- OSX_LT_MAVERICKS = `(( $(OSXVER) <= 9)) && echo "YES"`
- ifeq ($(OSX_LT_MAVERICKS),"YES")
- fpic += -mmacosx-version-min=10.5
- endif
+ fpic += -mmacosx-version-min=10.1
+ifeq ($(USE_DYNAREC),0)
+ # Override
+ TARGET := $(TARGET_NAME)_interpreter_libretro.dylib
+endif
# iOS
-else ifeq ($(platform), ios)
+else ifeq ($(platform),$(filter $(platform),ios-arm64))
+ ARCH := arm64
+ USE_DYNAREC = 0
+ HAVE_NEON = 0
+ BUILTIN_GPU = peops
+ TARGET := $(TARGET_NAME)_libretro_ios.dylib
+
+else ifneq (,$(findstring ios,$(platform)))
ARCH := arm
+ USE_DYNAREC ?= 1
+ HAVE_NEON = 1
+ BUILTIN_GPU = neon
TARGET := $(TARGET_NAME)_libretro_ios.dylib
+ifeq ($(USE_DYNAREC),0)
+ # Override
+ TARGET := $(TARGET_NAME)_interpreter_libretro_ios.dylib
+endif
fpic := -fPIC
- SHARED := -dynamiclib
ifeq ($(IOSSDK),)
- IOSSDK := $(shell xcrun -sdk iphoneos -show-sdk-path)
+ IOSSDK := $(shell xcodebuild -version -sdk iphoneos Path)
endif
CC = clang -arch armv7 -isysroot $(IOSSDK)
CC_AS = perl ./tools/gas-preprocessor.pl $(CC)
CFLAGS += -mcpu=cortex-a8 -mtune=cortex-a8 -mfpu=neon -marm
ASFLAGS += -mcpu=cortex-a8 -mtune=cortex-a8 -mfpu=neon
- HAVE_NEON = 1
- BUILTIN_GPU = neon
- USE_DYNAREC = 1
CFLAGS += -DIOS
- OSXVER = `sw_vers -productVersion | cut -d. -f 2`
- OSX_LT_MAVERICKS = `(( $(OSXVER) <= 9)) && echo "YES"`
- ifeq ($(OSX_LT_MAVERICKS),"YES")
- CC += -miphoneos-version-min=5.0
- CXX += -miphoneos-version-min=5.0
- CC_AS += -miphoneos-version-min=5.0
- CFLAGS += -miphoneos-version-min=5.0
- endif
+ifeq ($(platform),ios9)
+ CC += -miphoneos-version-min=8.0
+ CXX += -miphoneos-version-min=8.0
+ CC_AS += -miphoneos-version-min=8.0
+ CFLAGS += -miphoneos-version-min=8.0
+else
+ CC += -miphoneos-version-min=5.0
+ CXX += -miphoneos-version-min=5.0
+ CC_AS += -miphoneos-version-min=5.0
+ CFLAGS += -miphoneos-version-min=5.0
+endif
# PS3
else ifeq ($(platform), ps3)
AR = psp-ar$(EXE_EXT)
CFLAGS += -DPSP -G0
+# Vita
+else ifeq ($(platform), vita)
+ TARGET := $(TARGET_NAME)_libretro_vita.a
+ CC = arm-vita-eabi-gcc$(EXE_EXT)
+ AR = arm-vita-eabi-ar$(EXE_EXT)
+ CFLAGS += -DVITA
+ CFLAGS += -mcpu=cortex-a8 -mtune=cortex-a8 -mfpu=neon -marm
+ CFLAGS += -fsingle-precision-constant -mword-relocations -fno-unwind-tables
+ CFLAGS += -fno-asynchronous-unwind-tables -ftree-vectorize -funroll-loops
+ CFLAGS += -fno-optimize-sibling-calls
+ CFLAGS += -I$(VITASDK)/include -Ifrontend/vita
+ CFLAGS += -DNO_SOCKET -DNO_OS -DNO_DYLIB
+ ASFLAGS += -mcpu=cortex-a8 -mtune=cortex-a8 -mfpu=neon
+
+# CFLAGS += -U__ARM_NEON__
+ HAVE_NEON = 1
+ BUILTIN_GPU = neon
+
+ USE_DYNAREC = 1
+ DRC_CACHE_BASE = 0
+
+ ARCH = arm
+ STATIC_LINKING = 1
+
+# CTR(3DS)
+else ifeq ($(platform), ctr)
+ TARGET := $(TARGET_NAME)_libretro_ctr.a
+ CC = $(DEVKITARM)/bin/arm-none-eabi-gcc$(EXE_EXT)
+ CXX = $(DEVKITARM)/bin/arm-none-eabi-g++$(EXE_EXT)
+ AR = $(DEVKITARM)/bin/arm-none-eabi-ar$(EXE_EXT)
+ CFLAGS += -DARM11 -D_3DS -DNO_OS -DNO_DYLIB -DNO_SOCKET
+ CFLAGS += -march=armv6k -mtune=mpcore -mfloat-abi=hard -marm -mfpu=vfp -mtp=soft
+ CFLAGS += -Wall -mword-relocations
+ CFLAGS += -fomit-frame-pointer -ffast-math
+ CFLAGS += -Ifrontend/3ds
+ CFLAGS += -Werror=implicit-function-declaration
+
+# CFLAGS += -DPCSX
+# BUILTIN_GPU = unai
+ USE_DYNAREC = 1
+ DRC_CACHE_BASE = 0
+ ARCH = arm
+ HAVE_NEON = 0
+
+ STATIC_LINKING = 1
+
# Xbox 360
else ifeq ($(platform), xenon)
TARGET := $(TARGET_NAME)_libretro_xenon360.a
# QNX
else ifeq ($(platform), qnx)
TARGET := $(TARGET_NAME)_libretro_qnx.so
+ fpic := -fPIC
CC = qcc -Vgcc_ntoarmv7le
CC_AS = $(CC)
HAVE_NEON = 1
ARCH = arm
CFLAGS += -D__BLACKBERRY_QNX__ -marm -mcpu=cortex-a9 -mtune=cortex-a9 -mfpu=neon -mfloat-abi=softfp
ASFLAGS += -mcpu=cortex-a9 -mfpu=neon -mfloat-abi=softfp
+ MAIN_LDLIBS += -lsocket
+ LIBPTHREAD :=
+ LIBDL :=
+ LIBM :=
+
+#Raspberry Pi 2
+else ifeq ($(platform), rpi2)
+ TARGET := $(TARGET_NAME)_libretro.so
+ fpic := -fPIC
+ CFLAGS += -marm -mcpu=cortex-a7 -mfpu=neon-vfpv4 -mfloat-abi=hard
+ ASFLAGS += -mcpu=cortex-a7 -mfpu=neon-vfpv4 -mfloat-abi=hard
+ HAVE_NEON = 1
+ ARCH = arm
+ BUILTIN_GPU = neon
+ USE_DYNAREC = 1
+
+#Raspberry Pi 3
+else ifeq ($(platform), rpi3)
+ TARGET := $(TARGET_NAME)_libretro.so
+ fpic := -fPIC
+ CFLAGS += -marm -mcpu=cortex-a53 -mfpu=neon-fp-armv8 -mfloat-abi=hard
+ ASFLAGS += -mcpu=cortex-a53 -mfpu=neon-fp-armv8 -mfloat-abi=hard
+ HAVE_NEON = 1
+ ARCH = arm
+ BUILTIN_GPU = neon
+ USE_DYNAREC = 1
+
+# Classic Platforms ####################
+# Platform affix = classic_<ISA>_<µARCH>
+# Help at https://modmyclassic.com/comp
+
+# (armv7 a7, hard point, neon based) ###
+# NESC, SNESC, C64 mini
+else ifeq ($(platform), classic_armv7_a7)
+ TARGET := $(TARGET_NAME)_libretro.so
+ fpic := -fPIC
+ CFLAGS += -Ofast \
+ -flto=4 -fwhole-program -fuse-linker-plugin \
+ -fdata-sections -ffunction-sections -Wl,--gc-sections \
+ -fno-stack-protector -fno-ident -fomit-frame-pointer \
+ -falign-functions=1 -falign-jumps=1 -falign-loops=1 \
+ -fno-unwind-tables -fno-asynchronous-unwind-tables -fno-unroll-loops \
+ -fmerge-all-constants -fno-math-errno \
+ -marm -mtune=cortex-a7 -mfpu=neon-vfpv4 -mfloat-abi=hard
+ CXXFLAGS += $(CFLAGS)
+ CPPFLAGS += $(CFLAGS)
+ ASFLAGS += $(CFLAGS)
+ HAVE_NEON = 1
+ ARCH = arm
+ BUILTIN_GPU = neon
+ USE_DYNAREC = 1
+ ifeq ($(shell echo `$(CC) -dumpversion` "< 4.9" | bc -l), 1)
+ CFLAGS += -march=armv7-a
+ else
+ CFLAGS += -march=armv7ve
+ # If gcc is 5.0 or later
+ ifeq ($(shell echo `$(CC) -dumpversion` ">= 5" | bc -l), 1)
+ LDFLAGS += -static-libgcc -static-libstdc++
+ endif
+ endif
+#######################################
# ARM
else ifneq (,$(findstring armv,$(platform)))
TARGET := $(TARGET_NAME)_libretro.so
- SHARED := -shared -Wl,--no-undefined
+ fpic := -fPIC
+ HAVE_NEON = 0
DRC_CACHE_BASE = 0
+ BUILTIN_GPU = peops
ifneq (,$(findstring cortexa8,$(platform)))
CFLAGS += -marm -mcpu=cortex-a8
ASFLAGS += -mcpu=cortex-a8
+ else ifneq (,$(findstring cortexa7,$(platform)))
+ CFLAGS += -marm -mcpu=cortex-a7
+ ASFLAGS += -mcpu=cortex-a7
+ LIBZ :=
else ifneq (,$(findstring cortexa9,$(platform)))
CFLAGS += -marm -mcpu=cortex-a9
ASFLAGS += -mcpu=cortex-a9
# Windows
else
TARGET := $(TARGET_NAME)_libretro.dll
- CC = gcc
- fpic := -fPIC
- LD_FLAGS := -fPIC
- SHARED := -shared -static-libgcc -static-libstdc++ -s -Wl,--version-script=libretro/link.T
- CFLAGS += -D__WIN32__ -D__WIN32_LIBRETRO__
+ BUILTIN_GPU = peops
+ PLATFORM = libretro
+ MAIN_LDFLAGS += -static-libgcc -static-libstdc++ -s
+ CFLAGS += -D__WIN32__ -DNO_DYLIB
MMAP_WIN32=1
-endif
-
-CFLAGS += -fPIC
-ifeq ($(platform),win)
MAIN_LDLIBS += -lws2_32
-else ifneq ($(platform),qnx)
- LDLIBS += -lpthread
- MAIN_LDLIBS += -ldl
+ LIBPTHREAD :=
+ LIBDL :=
+ LIBM :=
endif
+
+CFLAGS += $(fpic)
MAIN_LDFLAGS += -shared
-MAIN_LDLIBS += -lm -lz
-EXTRA_LDFLAGS =
+MAIN_LDLIBS += $(LIBPTHREAD) $(LIBM) $(LIBDL) $(LIBZ)
+
+# try to autodetect stuff for the lazy
+ifndef ARCH
+ARCH = $(shell $(CC) -dumpmachine | awk -F- '{print $$1}')
+endif
+ifndef HAVE_NEON
+HAVE_NEON = $(shell $(CC) -E -dD - < /dev/null 2> /dev/null | grep -q __ARM_NEON__ && echo 1 || echo 0)
+endif
+ifeq ($(NO_UNDEF_CHECK)$(shell ld -v 2> /dev/null | awk '{print $$1}'),GNU)
+MAIN_LDFLAGS += -Wl,--no-undefined
+endif
# try to autodetect stuff for the lazy
ifndef ARCH
PLUGINS =
NO_CONFIG_MAK = yes
+# what does this do
+#libretro_all: all
+#ifeq ($(platform),ios)
+#ifeq ($(USE_DYNAREC),1)
+# make -f Makefile.libretro USE_DYNAREC=0 platform=$(platform) clean
+# make -f Makefile.libretro USE_DYNAREC=0 platform=$(platform)
+#endif
+#endif
+
include Makefile
# no special AS needed for gpu_neon
PCSX-ReARMed - yet another PCSX fork
====================================
-[](https://travis-ci.org/notaz/pcsx_rearmed)
+[](https://travis-ci.org/libretro/pcsx_rearmed)
*see [readme.txt](readme.txt) for more complete documentation*
+++ /dev/null
-<?xml version="1.0" encoding="UTF-8" standalone="no"?>
-<?fileVersion 4.0.0?>
-
-<cproject storage_type_id="org.eclipse.cdt.core.XmlProjectDescriptionStorage">
- <storageModule moduleId="org.eclipse.cdt.core.settings">
- <cconfiguration id="com.qnx.qcc.toolChain.1762498539">
- <storageModule buildSystemId="org.eclipse.cdt.managedbuilder.core.configurationDataProvider" id="com.qnx.qcc.toolChain.1762498539" moduleId="org.eclipse.cdt.core.settings" name="Device-Debug">
- <externalSettings/>
- <extensions>
- <extension id="com.qnx.tools.ide.qde.core.QDEBynaryParser" point="org.eclipse.cdt.core.BinaryParser"/>
- <extension id="org.eclipse.cdt.core.GmakeErrorParser" point="org.eclipse.cdt.core.ErrorParser"/>
- <extension id="org.eclipse.cdt.core.CWDLocator" point="org.eclipse.cdt.core.ErrorParser"/>
- <extension id="org.eclipse.cdt.core.GCCErrorParser" point="org.eclipse.cdt.core.ErrorParser"/>
- </extensions>
- </storageModule>
- <storageModule moduleId="cdtBuildSystem" version="4.0.0">
- <configuration artifactName="${ProjName}" buildProperties="" description="" id="com.qnx.qcc.toolChain.1762498539" name="Device-Debug" parent="org.eclipse.cdt.build.core.emptycfg">
- <folderInfo id="com.qnx.qcc.toolChain.1762498539.1561488424" name="/" resourcePath="">
- <toolChain id="com.qnx.qcc.toolChain.682312592" name="com.qnx.qcc.toolChain" superClass="com.qnx.qcc.toolChain">
- <option id="com.qnx.qcc.option.os.1720929524" name="Target OS:" superClass="com.qnx.qcc.option.os"/>
- <option id="com.qnx.qcc.option.cpu.2107899725" name="Target CPU:" superClass="com.qnx.qcc.option.cpu" value="com.qnx.qcc.option.gen.cpu.armle-v7" valueType="enumerated"/>
- <option id="com.qnx.qcc.option.compiler.596535986" name="Compiler:" superClass="com.qnx.qcc.option.compiler"/>
- <option id="com.qnx.qcc.option.runtime.742171011" name="Runtime:" superClass="com.qnx.qcc.option.runtime"/>
- <targetPlatform archList="all" binaryParser="com.qnx.tools.ide.qde.core.QDEBynaryParser" id="com.qnx.qcc.targetPlatform.982231418" osList="all" superClass="com.qnx.qcc.targetPlatform"/>
- <builder arguments="-C .. -f Makefile.libretro platform=qnx" command="make" id="com.qnx.qcc.toolChain.1762498539.480897078" keepEnvironmentInBuildfile="false" managedBuildOn="false" name="Gnu Make Builder" superClass="org.eclipse.cdt.build.core.settings.default.builder"/>
- <tool id="com.qnx.qcc.tool.compiler.267897021" name="QCC Compiler" superClass="com.qnx.qcc.tool.compiler">
- <option id="com.qnx.qcc.option.compiler.optlevel.1293751119" name="Optimization Level" superClass="com.qnx.qcc.option.compiler.optlevel" value="com.qnx.qcc.option.compiler.optlevel.0" valueType="enumerated"/>
- <option id="com.qnx.qcc.option.compiler.includePath.365274483" name="Include Directories (-I)" superClass="com.qnx.qcc.option.compiler.includePath" valueType="includePath">
- <listOptionValue builtIn="false" value="${QNX_TARGET}/usr/include/freetype2"/>
- <listOptionValue builtIn="false" value="${QNX_TARGET}/../target-override/usr/include"/>
- </option>
- <inputType id="com.qnx.qcc.inputType.compiler.116424583" superClass="com.qnx.qcc.inputType.compiler"/>
- </tool>
- <tool id="com.qnx.qcc.tool.assembler.1307903249" name="QCC Assembler" superClass="com.qnx.qcc.tool.assembler">
- <inputType id="com.qnx.qcc.inputType.assembler.1838739065" superClass="com.qnx.qcc.inputType.assembler"/>
- </tool>
- <tool id="com.qnx.qcc.tool.linker.1852803277" name="QCC Linker" superClass="com.qnx.qcc.tool.linker"/>
- <tool id="com.qnx.qcc.tool.archiver.1682937256" name="QCC Archiver" superClass="com.qnx.qcc.tool.archiver"/>
- </toolChain>
- </folderInfo>
- </configuration>
- </storageModule>
- <storageModule moduleId="org.eclipse.cdt.core.externalSettings"/>
- </cconfiguration>
- <cconfiguration id="com.qnx.qcc.toolChain.1815033502">
- <storageModule buildSystemId="org.eclipse.cdt.managedbuilder.core.configurationDataProvider" id="com.qnx.qcc.toolChain.1815033502" moduleId="org.eclipse.cdt.core.settings" name="Device-Release">
- <externalSettings/>
- <extensions>
- <extension id="com.qnx.tools.ide.qde.core.QDEBynaryParser" point="org.eclipse.cdt.core.BinaryParser"/>
- <extension id="org.eclipse.cdt.core.GmakeErrorParser" point="org.eclipse.cdt.core.ErrorParser"/>
- <extension id="org.eclipse.cdt.core.CWDLocator" point="org.eclipse.cdt.core.ErrorParser"/>
- <extension id="org.eclipse.cdt.core.GCCErrorParser" point="org.eclipse.cdt.core.ErrorParser"/>
- </extensions>
- </storageModule>
- <storageModule moduleId="cdtBuildSystem" version="4.0.0">
- <configuration artifactName="${ProjName}" buildProperties="" description="" id="com.qnx.qcc.toolChain.1815033502" name="Device-Release" parent="org.eclipse.cdt.build.core.emptycfg">
- <folderInfo id="com.qnx.qcc.toolChain.1815033502.1093640979" name="/" resourcePath="">
- <toolChain id="com.qnx.qcc.toolChain.1811843468" name="com.qnx.qcc.toolChain" superClass="com.qnx.qcc.toolChain">
- <option id="com.qnx.qcc.option.os.66936807" name="Target OS:" superClass="com.qnx.qcc.option.os"/>
- <option id="com.qnx.qcc.option.cpu.1884625209" name="Target CPU:" superClass="com.qnx.qcc.option.cpu" value="com.qnx.qcc.option.gen.cpu.armle-v7" valueType="enumerated"/>
- <option id="com.qnx.qcc.option.compiler.903071639" name="Compiler:" superClass="com.qnx.qcc.option.compiler"/>
- <option id="com.qnx.qcc.option.runtime.901433789" name="Runtime:" superClass="com.qnx.qcc.option.runtime"/>
- <targetPlatform archList="all" binaryParser="com.qnx.tools.ide.qde.core.QDEBynaryParser" id="com.qnx.qcc.targetPlatform.1169345860" osList="all" superClass="com.qnx.qcc.targetPlatform"/>
- <builder id="com.qnx.qcc.toolChain.1815033502.1831895405" keepEnvironmentInBuildfile="false" managedBuildOn="false" name="Gnu Make Builder" superClass="org.eclipse.cdt.build.core.settings.default.builder"/>
- <tool id="com.qnx.qcc.tool.compiler.401658009" name="QCC Compiler" superClass="com.qnx.qcc.tool.compiler">
- <option id="com.qnx.qcc.option.compiler.optlevel.20820451" name="Optimization Level" superClass="com.qnx.qcc.option.compiler.optlevel" value="com.qnx.qcc.option.compiler.optlevel.0" valueType="enumerated"/>
- <option id="com.qnx.qcc.option.compiler.includePath.2022402746" name="Include Directories (-I)" superClass="com.qnx.qcc.option.compiler.includePath" valueType="includePath">
- <listOptionValue builtIn="false" value="${QNX_TARGET}/usr/include/freetype2"/>
- <listOptionValue builtIn="false" value="${QNX_TARGET}/../target-override/usr/include"/>
- </option>
- <inputType id="com.qnx.qcc.inputType.compiler.1180700251" superClass="com.qnx.qcc.inputType.compiler"/>
- </tool>
- <tool id="com.qnx.qcc.tool.assembler.1403530230" name="QCC Assembler" superClass="com.qnx.qcc.tool.assembler">
- <inputType id="com.qnx.qcc.inputType.assembler.1360707586" superClass="com.qnx.qcc.inputType.assembler"/>
- </tool>
- <tool id="com.qnx.qcc.tool.linker.577346665" name="QCC Linker" superClass="com.qnx.qcc.tool.linker"/>
- <tool id="com.qnx.qcc.tool.archiver.637344581" name="QCC Archiver" superClass="com.qnx.qcc.tool.archiver"/>
- </toolChain>
- </folderInfo>
- </configuration>
- </storageModule>
- <storageModule moduleId="org.eclipse.cdt.core.externalSettings"/>
- </cconfiguration>
- <cconfiguration id="com.qnx.qcc.toolChain.1271074456">
- <storageModule buildSystemId="org.eclipse.cdt.managedbuilder.core.configurationDataProvider" id="com.qnx.qcc.toolChain.1271074456" moduleId="org.eclipse.cdt.core.settings" name="Simulator-Debug">
- <externalSettings/>
- <extensions>
- <extension id="com.qnx.tools.ide.qde.core.QDEBynaryParser" point="org.eclipse.cdt.core.BinaryParser"/>
- <extension id="org.eclipse.cdt.core.GmakeErrorParser" point="org.eclipse.cdt.core.ErrorParser"/>
- <extension id="org.eclipse.cdt.core.CWDLocator" point="org.eclipse.cdt.core.ErrorParser"/>
- <extension id="org.eclipse.cdt.core.GCCErrorParser" point="org.eclipse.cdt.core.ErrorParser"/>
- </extensions>
- </storageModule>
- <storageModule moduleId="cdtBuildSystem" version="4.0.0">
- <configuration artifactName="${ProjName}" buildProperties="" description="" id="com.qnx.qcc.toolChain.1271074456" name="Simulator-Debug" parent="org.eclipse.cdt.build.core.emptycfg">
- <folderInfo id="com.qnx.qcc.toolChain.1271074456.2095507025" name="/" resourcePath="">
- <toolChain id="com.qnx.qcc.toolChain.563285451" name="com.qnx.qcc.toolChain" superClass="com.qnx.qcc.toolChain">
- <option id="com.qnx.qcc.option.os.2028959839" name="Target OS:" superClass="com.qnx.qcc.option.os"/>
- <option id="com.qnx.qcc.option.cpu.460119393" name="Target CPU:" superClass="com.qnx.qcc.option.cpu"/>
- <option id="com.qnx.qcc.option.compiler.318948553" name="Compiler:" superClass="com.qnx.qcc.option.compiler"/>
- <option id="com.qnx.qcc.option.runtime.1244314155" name="Runtime:" superClass="com.qnx.qcc.option.runtime"/>
- <targetPlatform archList="all" binaryParser="com.qnx.tools.ide.qde.core.QDEBynaryParser" id="com.qnx.qcc.targetPlatform.2005367550" osList="all" superClass="com.qnx.qcc.targetPlatform"/>
- <builder id="com.qnx.qcc.toolChain.1271074456.325666051" keepEnvironmentInBuildfile="false" managedBuildOn="false" name="Gnu Make Builder" superClass="org.eclipse.cdt.build.core.settings.default.builder"/>
- <tool id="com.qnx.qcc.tool.compiler.821983732" name="QCC Compiler" superClass="com.qnx.qcc.tool.compiler">
- <option id="com.qnx.qcc.option.compiler.optlevel.1701209030" name="Optimization Level" superClass="com.qnx.qcc.option.compiler.optlevel" value="com.qnx.qcc.option.compiler.optlevel.0" valueType="enumerated"/>
- <option id="com.qnx.qcc.option.compiler.includePath.1616908655" name="Include Directories (-I)" superClass="com.qnx.qcc.option.compiler.includePath" valueType="includePath">
- <listOptionValue builtIn="false" value="${QNX_TARGET}/usr/include/freetype2"/>
- <listOptionValue builtIn="false" value="${QNX_TARGET}/../target-override/usr/include"/>
- </option>
- <inputType id="com.qnx.qcc.inputType.compiler.1059435667" superClass="com.qnx.qcc.inputType.compiler"/>
- </tool>
- <tool id="com.qnx.qcc.tool.assembler.1920350417" name="QCC Assembler" superClass="com.qnx.qcc.tool.assembler">
- <inputType id="com.qnx.qcc.inputType.assembler.618235584" superClass="com.qnx.qcc.inputType.assembler"/>
- </tool>
- <tool id="com.qnx.qcc.tool.linker.1321150712" name="QCC Linker" superClass="com.qnx.qcc.tool.linker"/>
- <tool id="com.qnx.qcc.tool.archiver.1860233844" name="QCC Archiver" superClass="com.qnx.qcc.tool.archiver"/>
- </toolChain>
- </folderInfo>
- </configuration>
- </storageModule>
- <storageModule moduleId="org.eclipse.cdt.core.externalSettings"/>
- </cconfiguration>
- </storageModule>
- <storageModule moduleId="cdtBuildSystem" version="4.0.0">
- <project id="pcsx_rearmed.null.446260429" name="pcsx_rearmed"/>
- </storageModule>
- <storageModule moduleId="scannerConfiguration">
- <autodiscovery enabled="true" problemReportingEnabled="true" selectedProfileId="com.qnx.tools.ide.qde.managedbuilder.core.qccScannerInfo"/>
- <scannerConfigBuildInfo instanceId="com.qnx.qcc.toolChain.1815033502">
- <autodiscovery enabled="true" problemReportingEnabled="true" selectedProfileId="com.qnx.tools.ide.qde.managedbuilder.core.qccScannerInfo"/>
- </scannerConfigBuildInfo>
- <scannerConfigBuildInfo instanceId="com.qnx.qcc.toolChain.1762498539">
- <autodiscovery enabled="true" problemReportingEnabled="true" selectedProfileId="com.qnx.tools.ide.qde.managedbuilder.core.qccScannerInfo"/>
- </scannerConfigBuildInfo>
- <scannerConfigBuildInfo instanceId="com.qnx.qcc.toolChain.1271074456">
- <autodiscovery enabled="true" problemReportingEnabled="true" selectedProfileId="com.qnx.tools.ide.qde.managedbuilder.core.qccScannerInfo"/>
- </scannerConfigBuildInfo>
- </storageModule>
- <storageModule moduleId="refreshScope" versionNumber="1">
- <resource resourceType="PROJECT" workspacePath="/pcsx_rearmed"/>
- </storageModule>
-</cproject>
+++ /dev/null
-<?xml version="1.0" encoding="UTF-8"?>
-<projectDescription>
- <name>pcsx_rearmed</name>
- <comment></comment>
- <projects>
- </projects>
- <buildSpec>
- <buildCommand>
- <name>org.eclipse.cdt.managedbuilder.core.genmakebuilder</name>
- <triggers>clean,full,incremental,</triggers>
- <arguments>
- <dictionary>
- <key>?name?</key>
- <value></value>
- </dictionary>
- <dictionary>
- <key>org.eclipse.cdt.make.core.append_environment</key>
- <value>true</value>
- </dictionary>
- <dictionary>
- <key>org.eclipse.cdt.make.core.autoBuildTarget</key>
- <value>all</value>
- </dictionary>
- <dictionary>
- <key>org.eclipse.cdt.make.core.buildArguments</key>
- <value>-C .. -f Makefile.libretro platform=qnx</value>
- </dictionary>
- <dictionary>
- <key>org.eclipse.cdt.make.core.buildCommand</key>
- <value>make</value>
- </dictionary>
- <dictionary>
- <key>org.eclipse.cdt.make.core.cleanBuildTarget</key>
- <value>clean</value>
- </dictionary>
- <dictionary>
- <key>org.eclipse.cdt.make.core.contents</key>
- <value>org.eclipse.cdt.make.core.activeConfigSettings</value>
- </dictionary>
- <dictionary>
- <key>org.eclipse.cdt.make.core.enableAutoBuild</key>
- <value>false</value>
- </dictionary>
- <dictionary>
- <key>org.eclipse.cdt.make.core.enableCleanBuild</key>
- <value>true</value>
- </dictionary>
- <dictionary>
- <key>org.eclipse.cdt.make.core.enableFullBuild</key>
- <value>true</value>
- </dictionary>
- <dictionary>
- <key>org.eclipse.cdt.make.core.fullBuildTarget</key>
- <value>all</value>
- </dictionary>
- <dictionary>
- <key>org.eclipse.cdt.make.core.stopOnError</key>
- <value>true</value>
- </dictionary>
- <dictionary>
- <key>org.eclipse.cdt.make.core.useDefaultBuildCmd</key>
- <value>false</value>
- </dictionary>
- </arguments>
- </buildCommand>
- <buildCommand>
- <name>org.eclipse.cdt.managedbuilder.core.ScannerConfigBuilder</name>
- <triggers>full,incremental,</triggers>
- <arguments>
- </arguments>
- </buildCommand>
- <buildCommand>
- <name>com.qnx.tools.bbt.xml.core.bbtXMLValidationBuilder</name>
- <arguments>
- </arguments>
- </buildCommand>
- </buildSpec>
- <natures>
- <nature>org.eclipse.cdt.core.cnature</nature>
- <nature>org.eclipse.cdt.managedbuilder.core.managedBuildNature</nature>
- <nature>org.eclipse.cdt.managedbuilder.core.ScannerConfigNature</nature>
- <nature>com.qnx.tools.ide.bbt.core.bbtnature</nature>
- </natures>
-</projectDescription>
+++ /dev/null
-#!/bin/bash -e
-
-NAME=`head debian/changelog -n1 | sed -n 's/^\(.*\) (\(.*\)) .*/\1-\2/p'`
-[[ -z $NAME ]] && { echo "Could not extract package name and version from debian/changelog" 2>&1; exit 1; }
-
-rm -rf ../$NAME
-cp -r ../`basename $PWD` ../$NAME
-cd ../$NAME
-rm -rf .git*
-find . -depth -name .svn -type d -exec rm -r {} \;
-find . -name '*~' -exec rm {} \;
-
-LD_LIBRARY_PATH=/usr/lib dpkg-buildpackage -rfakeroot $*
+++ /dev/null
-pcsxrearmed (0.4.0.14.13) unstable; urgency=low
-
- * Updated source to notaz git version
-
- -- sakya <sakya_tg@yahoo.it> Fri, 15 Feb 2013 12:50:28 +0200
-
-pcsxrearmed (0.4.0.14.12) unstable; urgency=low
-
- * Fixed a problem with controller and vibration (Gran Turismo 2, Wipeout 3)
- * Added dependency to libts
-
- -- sakya <sakya_tg@yahoo.it> Wed, 16 May 2012 17:09:33 +0200
-
-pcsxrearmed (0.4.0.14.11) unstable; urgency=low
-
- * Added option -guncon and -gunnotrigger to activate guncon controller type
-
- -- sakya <sakya_tg@yahoo.it> Wed, 16 May 2012 09:37:12 +0200
-
-pcsxrearmed (0.4.0.14.10) unstable; urgency=low
-
- * Added option -corners to set action to execute when clicking on display corners
- * Fixed problem with notification using gles plugin
- * Fixed controller problem with game "Heart Of Darkness" (maybe others?)
-
- -- sakya <sakya_tg@yahoo.it> Fri, 11 May 2012 16:38:29 +0200
-
-pcsxrearmed (0.4.0.14.9) unstable; urgency=low
-
- * Added support to .mdf extension
- * Added option -vibration to activate vibration
-
- -- sakya <sakya_tg@yahoo.it> Tue, 1 May 2012 12:19:49 +0200
-
-pcsxrearmed (0.4.0.14.8) unstable; urgency=low
-
- * Added option -disc to set the initial disc in multi discs images (used when loading a savestate with -load)
- * Added option -autosave
- * Fixed disc change for multi discs images (PBP)
- * Merged commits from Notaz git
- * drc: inv: fix ram ofset and mirror handling
- * support emulated RAM mapped at offset
-
- -- sakya <sakya_tg@yahoo.it> Fri, 20 Apr 2012 20:27:19 +0200
-
-pcsxrearmed (0.4.0.14.7) unstable; urgency=low
-
- * Fixed -displayon
-
- -- sakya <sakya_tg@yahoo.it> Sun, 15 Apr 2012 17:22:08 +0200
-
-pcsxrearmed (0.4.0.14.6) unstable; urgency=low
-
- * Added option -keys to set the keys config file
- * Fixed L1/L2/R1/R2
- * Added autopause on incoming call
-
- -- sakya <sakya_tg@yahoo.it> Wed, 13 Apr 2012 12:51:35 +0200
-
-pcsxrearmed (0.4.0.14.5) unstable; urgency=low
-
- * Fixed accelerometer using gles
- * Added -analog option to use the accelerometer as the analog pad
- * Added options to set accelerometer sens, max value, y_def
- * Added -displayon option to keep the display on (useful when playing using the accelerometer)
-
- -- sakya <sakya_tg@yahoo.it> Tue, 10 Apr 2012 15:34:11 +0200
-
-pcsxrearmed (0.4.0.14.4) unstable; urgency=low
-
- * Fixed -load option
- * Added disc change (configured a new key)
-
- -- sakya <sakya_tg@yahoo.it> Fri, 06 Apr 2012 13:54:56 +0200
-
-pcsxrearmed (0.4.0.14.3) unstable; urgency=low
-
- * Added options to set various gles settings
- * Fixed save state slot selection
- * Added notification on save state slot change
-
- -- sakya <sakya_tg@yahoo.it> Wed, 04 Apr 2012 10:20:18 +0200
-
-pcsxrearmed (0.4.0.14.2) unstable; urgency=low
-
- * Fixed fullscreen using gpu-gles
- * Fixed crash when saving savestate using gpu-gles
- * Added options to set spu reverb and interpolation (disabled by default)
-
- -- sakya <sakya_tg@yahoo.it> Sun, 01 Apr 2012 11:42:20 +0200
-
-pcsxrearmed (0.4.0.14.1) unstable; urgency=low
-
- * Added option to set psx region (NTSC/PAL/Auto)
- * Use PulseAudio (better audio)
-
- -- sakya <sakya_tg@yahoo.it> Wed, 30 Mar 2012 09:44:51 +0200
-
-pcsxrearmed (0.4.0.14) unstable; urgency=low
-
- * Updated to r14
- * Added --help
- * PCSX4All
-
- -- sakya <sakya_tg@yahoo.it> Sun, 27 Dec 2011 00:02:27 +0200
-
-pcsxrearmed (0.4.0.12.2) unstable; urgency=low
-
- * gpu-gles
-
-
- -- Bonapart <bonapart@programist.ru> Sun, 27 Dec 2011 00:02:27 +0200
+++ /dev/null
-Source: pcsxrearmed
-Section: user/games
-Priority: extra
-Maintainer: Bonapart <bonapart@programist.ru>
-Build-Depends: debhelper (>= 5), zlib1g-dev, libhildon1-dev, libpulse-dev, libasound2-dev, libbz2-dev, libgles1-sgx-img-dev, opengles-sgx-img-common-dev, libosso-dev, libdbus-1-dev, libhildonfm2-dev, libts-dev
-Standards-Version: 3.7.3
-
-Package: pcsxrearmed
-Architecture: armel
-Depends: ${shlibs:Depends}, libts-0.0-0
-Description: Sony PlayStation emulator
-XSBC-Homepage: http://notaz.gp2x.de/pcsx_rearmed.php
-XSBC-Bugtracker: http://notaz.gp2x.de/pcsx_rearmed.php
-XB-Maemo-Display-Name: PCSX-ReArmed
-XB-Maemo-Icon-26:
- iVBORw0KGgoAAAANSUhEUgAAADAAAAAwCAYAAABXAvmHAAAAAXNSR0IArs4c
- 6QAAEStJREFUaN7Fmn+wXVV1xz9r733uufe+e9+DJIRESEICEQghAUQBI8Uo
- ik7jrxm1o+3ooB2RkWrtONqZlhn7Y8bRUVudqVZsoTjFH2CrSKsVEFIQIr8C
- JARC0CDkBwkkIcl7L7n3nLP36h97n3Pvo07/7c2cOfeenB9rr/Vd3/Vd6zxh
- 7DM52b9isj+5YcGC+a9bunTpOVNTU91WK5Msy1ECIgYRMGKxzmGtQQBrHSZ9
- R8C5DOcc1hiMtTjrsM4hAtZYWq1W/H9nyZzDZVk6x9LKWmSteH2rlZNlLhw/
- fnzXszt3fmHjxo13bH74oReBwbbtO6r0ODht5UpnfXXdytOXX+mswVcl1hqc
- swjgQ0BV8T7gfSCEQFBQFFQJqqhquptpHCJiMGIQKxhjsdZircMai8kczibj
- XUaWZdi0d1lGlrVwmdN2nsvypUtZvmwpw7LY8dSTT37yX264/sGgOrNl67ZS
- AFavPudTF5y76u9fOniQZ3/7PLPHjuG9Z8wSJO7QeAABVIW0DFAFBEVANF0j
- AGh9XBWV9L3eRFAx6dr6XFDiMWMNy049VS9Yu4o/et+7xBj78u5duz78lS9/
- 8U6UoZx59lnZ2StXbMP7lT+7cyNFUWCsbQwmyLhTo1EiydvpSFogIpiIMQST
- zhOMMSAmnmcMIhYxgogFYxBjEYnnYOIWn2OjA4IiRjhj+TL98uc/K5X3W7Zs
- 2fKBf/72Pz5tZmdmz5jodJZtfeppyqqK+LQx3EYtpm0wRChYazBWMCYaasRg
- TFwAUu/TsgyIiecytkAxBjG1sTZuzfe4GIwDk4GxqMmQLAdx7PjNs/KNG75H
- 3srWLFmy5E3P79rj7Omnr7is08o+8Otnn6MYFtGIErQCyZXsqxW6B3S3gQqw
- /I6PNgEZwSPmQAMVYxERVCSSQTI8et4iYtF6MckhcXECJuWSGPbvf1EvumCN
- nDA1taIoypuNr6pFg6JgMEjGe2Ch0vpmSXdnQeuqQPeeivZtBbI6oIWiKJqS
- WLU2vM6POh2SIZjEXpIMtglGdSTib9IxEsSoFy9mBFtjmTleyJ33bMIYOevQ
- oUMnuLIs5w+LkuCr+HAP+dcqWu8PFD8SZAEwA9kGxawuOXZeBjMGXJ0BNMk4
- gpIZYbr2ZvJ6hJBrftcLEGPTfVJ+EBcfUo6pgohQhMCBgwdB4fDhw5MG6JdV
- RQgKQZAO2IuVMIDB+xzhcWF4lWP4FUPYZJATf1dCp0ROxps69LXR1mGsTZtD
- TNrbWE/i9/jbmFEiRx6oCSCRRHJZURTMzMx0nUK7LD2KIgZ0CPoM2KWQf8tj
- TlPkZGX4GRdNdiTvzzW+Nrg2voaIqb1uHUYsYm2KRNxURnBSTfdB4k5r6q0x
- qogIIShFWVKWZWa8962y8g0eRGH4GYd/Usg/GsjerHQ2VnRuK7GvC6iXhjpH
- xo+MyPOcdruNsTZyughiXFxI42mHuAyswzgLNrGRNWANYg1gUCOoMQ2DYUZ5
- JgKqahxI5n0Y4cJBeMxw7LwM+6ZA62880o454C4rmb1U4AkLrXHjY6UNqpx6
- ymKm+n2qEBgUFUemZzk8PYsPinMxIsa6xDAR71rXjFj/CJo8WdNDXeQTY4iA
- tZHVnKo61VBfCW3FXqzoUCl/bnB/ECj+0uGurGj/bcBdESifcBGLKQIN5oFu
- p8OCBfPpdDp0u13yvI1X5fnd+9jx210cOjJDnmUY4yLOE9xACEmamHoRQZtF
- aar0oBgxOJfFBYgxTjXxeGVgnqdzd4nuh9mLshizFkieHDKcyzam5nNjICjt
- djS81+sxMTHB5OQkvV6P89euoZXn3Pfgo9y16RGKMiDWRu8bQVTQEEAiPQsh
- KoAwqjApDBgjZM5F54mIa5IwA31OKL5kMYthYkeJe2ege39Bfm3Ab4fqJy7i
- PVjEW/AGCel3sHTb0fh+v8/k5CQ+KEemZ+h0u8yfN48PvvddXPvpq5ma6qMK
- 1goGk2qdIKYmZlMrLiBE+ISAAkaELMswxohx1mZSaxgBnFD8hePYBx3V92PW
- hEeFwecyjr+lA7stsgDMUkWWhLidGpBXBWRxQPvKZH+yWcA9v9rMN2+8mWd2
- Pk+/36fX6/G615zHtZ++GucsqpIkR6obgJFXVPfa+QliYgwuy7DW4sQYGdFg
- UsMC1fct1Q8c+ZdKqq9lhBds1D3WYt8zwP3JMNFc/RTBiPLcXdtZ9/LFdHtd
- +v0+/ck+Yi0vHXyZXq9Ht9ul3W5z2bqLeNsb13HrHffQytvUVdSIRPyPVfna
- +HpJxiSpL4LTEDAxHFFC12IssUz51y2oBNOSVPqF8MMu1X90QWykR7EY46iq
- ite89VImzp6Ixvf7tLIW1rbodDtMTEzQ6XTI85w8z7nowvP54U/vJs9Hyanq
- myKpKKIpAppEsWqCXhRlTlUxSbvXJTtSlYyS1tTcnKrt0CKFbSqqcZHnfeVY
- 0DupMb7X65HlOVhD3mo33s/znCzLWLl8Ka08IxBtUA1NUBVFJeoukdg0ee+Z
- mZllMBwgCM45cSGEEPHX0OzcRqaWv4y+R/GVqmqSCJJ6iM5Ep2GeXq9H1soR
- sWSt1hzjsyxj3oknMJG3KGqmqTsmiaCvo1BWnmJYUJRDKu9HjZIqzhijseSb
- RlXW+zoqkSJMoyZreWDHKms8Bt1urzG+1+vhsgwjllaWkef5qB+2lsoHfEj8
- PoZ3QQjeU5QFRVFSlRUh+Oa8qIK1gVAwxozEWLpN3Tr6oIhRjIJY0yhHsbEB
- qQWaMRapPN1uh36/z8TEBN1ul8xliAHrsjnGG2PY88I+Zo4dZ6I3EVnHB4qy
- ZDgYUpYVGkJqbUO0SAEJqAYq72MEAG+SFtc6DwREU6+bIhCA4AMWgzhpEnek
- c2KE6iJWV+I4jbA4Z2vubqK96aHHokQuo5eHRYEGT0hDBG0wLU0VltRi+qqK
- CxARX+uKV+J/1HhHcRXVo+C9EvB4FWwAYwLz5p+IwZC1crrdLp1Oh3a7jRhD
- 5QODwSAZBoPhkLvv/RXfuP4mPIbS+5iA49t4m9QcjwUt+EBRFrV0I4y8ImOV
- Q5qOKiZzrUINKlBVnrzlWLFsCWefdQbr113CLx94BCNCp9Oh0+nQarWoqujZ
- m370U3bs3MWik+Zx5OhRfnHPJnrdLsOyZPr4MarKY63BGtMYKnXhIsKmXogP
- nqIogajuGwjVTKQyd+yROnQCUJYVJ05NsWb1Kt74hks4c+XpnPKqxfT7fZ58
- 5lmyVqsxPsuilsqtsPrMM7jktWs5/bRl9HtdrvnYh7HWMhgMefHAQR7c/Dg/
- u3Mjj27djnEWI6aJQNJ0zcd7T1EMI4RUtaqTamxWMoJOUoo+KKcsWsglF13I
- 773hEk6av4B+vzcnYV8+fKQpUs45nHMcPTrNT757Heede04zwfhfcAXeuv5S
- Pvepj3PHXffw2c9/kWd378Vg0DAXRqrgK89gMCSEMJbEafxBrVoZNS55nnP5
- G9dx+frLmgJVU+TR6Vnu+O/7+Pdb/4vHt2zjfe/ZEKdsaTRTVSWLTl6Ic5ay
- qjg2e4ytTz3NDf96C4889jjHBkP+/E+v5sMfeC/tPOcdb38LU/0+7//jT3J0
- enpsXDDKCx88xTAtQKFsIKRjA6t6WqZw9qvP4PL1lzE5OcnExATtdocHHn6M
- +x/azP0PPkorb7P23HO4MG8nre6oqdmK4cCBg+zavYc77v4lP7/rHrZse4oz
- Vqxg7bnn8o4r1vPmy9Y1zATw4oGDBO/RkPJRx1pKjRAaDCMpOIGqSWIZTdqU
- URIfPjpNnrdHnncZe/e/xAknnMDVH/0Q6y+9hFVnvZp/+s73CaqM15V+v8s1
- n72W5/fsY3Z2lt9/y3o+9fErOX/NOSxfthTnRoOmF/bt58bv3sz1N93CzOzs
- qJGRxEAoSCB4z3A4yoFiVAdovB6naQYV4bnd+/jCV7/BuzdcwaVvuJjTly/i
- z675GO12m06n00gDl2WNWhyfXBw9Ms2nr7qSd2+4gkUnL6Tdzkd5oPCrBx/m
- m9d/h433PcjR6RmGRTXWTupcFKnifcWwzgERKWMEatYZCdjxAe2uF/bxtW/d
- yNe/fSNrV69i1dmvZvHCRbSyDLGW/fv38/O77uX1//CVOcl5+MhRbv/xTSw6
- eWGjX7z3TE9P88Nbf8oNN93MY1ufjHoqiUljYncW6sSlrgFRRnhfMSzqHFAt
- jJFGsMXRRuR+bSZjMULORSmxdfuveXzbMzFlxiYS5XDI3n37eenAQebPOzFC
- CeLMCXjpwEGe3P4Mt/zoNv7z9l/w/J59KYKt6NwxxlFlrIAx+h0ghEAxLOIC
- gmpRj/5C7XV5xfiiRkRiVWcdtOq5T2z9xBjaeYu/+uLf8YN/u5ULzlvNhisu
- ZzAcsOnBh9m9dy+3/+JeNm95giNHZ8haGZNT/cjxGtvGKB9CQkpACQRCwkBI
- 8jouoCxLvPfqNIRBnQOicY6TXBvlrMaGew60dCT8JIUcBWMNBw4d5t5ND3Pf
- A4/wvVt+wuzsMbZt/zXT09MMyxJjLZ1Op1GUUmuexsPjsoH4m7lsFEKgrLXQ
- KInndIdzJs9xRhPHHLFKayrtBiQZks4REWxm0QAHXz4MCoNiCBiyzKVnNJiI
- 9wmRYXTMeG2eERKca4qJLBRqNaqqRZ7nWOua1q2REPWKAs1UTALxfVkawMYb
- +9F8RxQNZvz9B6iMTbLjTUMIc7yu9Z4wFoUR89T72ODXL0oEZ4yUcQFWVcbZ
- TZtmRhtRFXm4rtIRXqnZVghGRzYzPmtPhKraDK8aVtG52J/LOjp6hUVI3lVE
- RK2NswsHlK34llCa7BeNuKd2uU0tTkA1hiJG1qNqmh6C1F01EJyzklFyJspJ
- JBNSDigStDlWGz96AZGco4qNr31qOS1F1spod9ujKXP9Uq5OgWa0B0ZHN2s8
- Qz3XTBBibpvYxLSBgI4aljpx0Yb3m1eHiaHGtZ8I5O0cUMqy9KaqyuPe+4OL
- Fy4kc07rmzH2kDjqCOnBPr4F0YCGufuAJwSPBo+G6hVbOlc9IV2j9bWEdN8k
- F9SPYEZgjH5oOdHFCxcwHBb7q6oqzNGj00cOHjz05No1q1lw4qSoD801UlfC
- Bn5a3yfOMTUWn7gF8CkR/4+NEFknfq/vXz9z9LwRtBI0gxK8Z+H8E2XtmtXs
- 3bv38enp6VlzbHb25W3bnnhANQzeseFtKBWVL0bYk9jU61jySTP1Do2XGsrT
- MOa5sU1HXZXq+LFRtyK11yXMmciB4qsCoeRd73w7RVEc37x586YjR44ctsba
- 7NChQ3m73T7ltRe+Zumac1ax9Yltenx6RsSmF26M6aRxlkpo1zQASEgevQTU
- MRgSKTJomHMMJb7pb/7RRDbWBk91/DiTUxN6zVUfkWVLlnDvvffed//99/8Y
- +I0VkWCtMc/s2DHw3i9at+71C996+Xrp9Sd01/O7ZHD8GASP+gpClfbxt097
- rY/7ilAlvPt4bHwLVUmo4n1COten65rzqmL0PXgmum3eueEK/ciH/lBOmJrU
- 2267bevtt9/+XeBRYJ8Att3OT6oqf6b3/pJ58+a96ROf+MRFZ5115sTk5JTp
- 93vSzttYF//OwaU/2siyLPatiSqNiXI8TjhoeoIRe0gjr4MGqjI6oKoqyqKk
- KAqGxRBf+TQIGFKWJbMzszozOxt27tw5e9111z1w4MCBO4H7gKeBlwWg3c5b
- 3of5VVWtUNVzgfMvvvji80477bQFS5Ys6VprTd301IaNG2iMaWBR9wKNwa/Y
- 69j8sqoqQhpeeR8Nr+V22sKePXuO7969+6WHHnroseT1x4GdwCGgbFzU7XSy
- wXDYDyGcDKwAlgOLgUmgzf/PZwgcAV4Ank2G7wemgRLgfwDIFWZCNtkwCgAA
- AABJRU5ErkJggg==
+++ /dev/null
-this package was maemonized by Roman Deninberg <bonapart@programist.ru>
-Mon, 10 Jan 2011 02:00:13 +0100
+++ /dev/null
-pcsxrearmed_0.4.0.14.13_armel.deb user/games extra
+++ /dev/null
-pcsx opt/maemo/usr/games/
-plugins/spunull/spunull.so opt/maemo/usr/games/plugins
-plugins/gpu_unai/gpu_unai.so opt/maemo/usr/games/plugins
-#plugins/gpu_unai/gpuPCSX4ALL.so opt/maemo/usr/games/plugins
-plugins/dfxvideo/gpu_peops.so opt/maemo/usr/games/plugins
-plugins/gpu-gles/gpu_gles.so opt/maemo/usr/games/plugins
+++ /dev/null
-#!/usr/bin/make -f
-# -*- makefile -*-
-
-#export DH_VERBOSE=1
-
-DEB_HOST_GNU_TYPE ?= $(shell dpkg-architecture -qDEB_HOST_GNU_TYPE)
-DEB_BUILD_GNU_TYPE ?= $(shell dpkg-architecture -qDEB_BUILD_GNU_TYPE)
-DEB_HOST_ARCH ?= $(shell dpkg-architecture -qDEB_HOST_ARCH)
-
-#GAME_VERSION := $(shell head debian/changelog -n1 | sed -n 's/.* (\(.*\)) .*/\1/p')
-CFLAGS = -Wall -g
-
-ifneq (,$(findstring noopt,$(DEB_BUILD_OPTIONS)))
- CFLAGS += -O0
-else
- CFLAGS += -O2
-endif
-
-build: build-stamp
-
-build-stamp:
- dh_testdir
- ./configure --platform=maemo --gpu=neon --sound-drivers=pulseaudio --enable-neon
- $(MAKE)
- strip pcsx
- strip plugins/gpu_unai/gpu_unai.so
- strip plugins/gpu-gles/gpu_gles.so
- strip plugins/spunull/spunull.so
- touch build-stamp
-
-clean:
- dh_testdir
- dh_testroot
- rm -f build-stamp
- dh_clean
- $(MAKE) clean clean_plugins
-
-install: build
- dh_testdir
- dh_testroot
- dh_installdirs
- mkdir -p "$(CURDIR)"/debian/pcsxrearmed/opt/maemo/usr/games/screenshots
- chmod 777 "$(CURDIR)"/debian/pcsxrearmed/opt/maemo/usr/games/screenshots
- chown user "$(CURDIR)"/debian/pcsxrearmed/opt/maemo/usr/games/screenshots
- dh_install
-
-binary-indep: build install
-
-binary-arch: build install
- dh_testdir
- dh_testroot
- dh_installchangelogs
- dh_installdocs
- #dh_installmenu
- dh_link
- dh_strip
- dh_compress
- dh_fixperms
- dh_installdeb
- dh_makeshlibs
- dh_shlibdeps
- dh_gencontrol
- #maemo-optify
- dh_md5sums
- dh_builddeb
-
-binary: binary-indep binary-arch
-.PHONY: build clean binary-indep binary-arch binary install
--- /dev/null
+/* adler32.c -- compute the Adler-32 checksum of a data stream
+ * Copyright (C) 1995-2003 Mark Adler
+ * For conditions of distribution and use, see copyright notice in zlib.h
+ */
+
+/* @(#) $Id$ */
+
+#define ZLIB_INTERNAL
+#include <stdint.h>
+#include <stddef.h>
+#include "zutil.h"
+
+#define BASE 65521UL /* largest prime smaller than 65536 */
+#define NMAX 5552
+/* NMAX is the largest n such that 255n(n+1)/2 + (n+1)(BASE-1) <= 2^32-1 */
+
+#define DO1(buf,i) {s1 += buf[i]; s2 += s1;}
+#define DO2(buf,i) DO1(buf,i); DO1(buf,i+1);
+#define DO4(buf,i) DO2(buf,i); DO2(buf,i+2);
+#define DO8(buf,i) DO4(buf,i); DO4(buf,i+4);
+#define DO16(buf) DO8(buf,0); DO8(buf,8);
+
+#ifdef NO_DIVIDE
+# define MOD(a) \
+ do { \
+ if (a >= (BASE << 16)) a -= (BASE << 16); \
+ if (a >= (BASE << 15)) a -= (BASE << 15); \
+ if (a >= (BASE << 14)) a -= (BASE << 14); \
+ if (a >= (BASE << 13)) a -= (BASE << 13); \
+ if (a >= (BASE << 12)) a -= (BASE << 12); \
+ if (a >= (BASE << 11)) a -= (BASE << 11); \
+ if (a >= (BASE << 10)) a -= (BASE << 10); \
+ if (a >= (BASE << 9)) a -= (BASE << 9); \
+ if (a >= (BASE << 8)) a -= (BASE << 8); \
+ if (a >= (BASE << 7)) a -= (BASE << 7); \
+ if (a >= (BASE << 6)) a -= (BASE << 6); \
+ if (a >= (BASE << 5)) a -= (BASE << 5); \
+ if (a >= (BASE << 4)) a -= (BASE << 4); \
+ if (a >= (BASE << 3)) a -= (BASE << 3); \
+ if (a >= (BASE << 2)) a -= (BASE << 2); \
+ if (a >= (BASE << 1)) a -= (BASE << 1); \
+ if (a >= BASE) a -= BASE; \
+ } while (0)
+#else
+# define MOD(a) a %= BASE
+#endif
+
+/* ========================================================================= */
+uLong adler32(uLong adler, const Bytef *buf, uInt len)
+{
+ uint32_t s1 = adler & 0xffff;
+ uint32_t s2 = (adler >> 16) & 0xffff;
+ int k;
+
+ if (buf == NULL)
+ return 1L;
+
+ while (len > 0) {
+ k = len < NMAX ? (int)len : NMAX;
+ len -= k;
+ while (k >= 16) {
+ DO16(buf);
+ buf += 16;
+ k -= 16;
+ }
+ if (k != 0) do {
+ s1 += *buf++;
+ s2 += s1;
+ } while (--k);
+ MOD(s1);
+ MOD(s2);
+ }
+ return (s2 << 16) | s1;
+}
+
--- /dev/null
+/* compress.c -- compress a memory buffer
+ * Copyright (C) 1995-2005 Jean-loup Gailly.
+ * For conditions of distribution and use, see copyright notice in zlib.h
+ */
+
+/* @(#) $Id$ */
+
+#define ZLIB_INTERNAL
+#include "zlib.h"
+
+/* ===========================================================================
+ Compresses the source buffer into the destination buffer. The level
+ parameter has the same meaning as in deflateInit. sourceLen is the byte
+ length of the source buffer. Upon entry, destLen is the total size of the
+ destination buffer, which must be at least 0.1% larger than sourceLen plus
+ 12 bytes. Upon exit, destLen is the actual size of the compressed buffer.
+
+ compress2 returns Z_OK if success, Z_MEM_ERROR if there was not enough
+ memory, Z_BUF_ERROR if there was not enough room in the output buffer,
+ Z_STREAM_ERROR if the level parameter is invalid.
+ */
+int ZEXPORT compress2 (Bytef *dest, uLongf *destLen, const Bytef *source, uLong sourceLen, int level)
+{
+ z_stream stream;
+ int err;
+
+ stream.next_in = (Bytef *)source;
+ stream.avail_in = (uInt)sourceLen;
+#ifdef MAXSEG_64K
+ /* Check for source > 64K on 16-bit machine: */
+ if ((uLong)stream.avail_in != sourceLen) return Z_BUF_ERROR;
+#endif
+ stream.next_out = dest;
+ stream.avail_out = (uInt)*destLen;
+ if ((uLong)stream.avail_out != *destLen) return Z_BUF_ERROR;
+
+ stream.zalloc = Z_NULL;
+ stream.zfree = Z_NULL;
+ stream.opaque = (voidpf)0;
+
+ err = deflateInit(&stream, level);
+ if (err != Z_OK) return err;
+
+ err = deflate(&stream, Z_FINISH);
+ if (err != Z_STREAM_END) {
+ deflateEnd(&stream);
+ return err == Z_OK ? Z_BUF_ERROR : err;
+ }
+ *destLen = stream.total_out;
+
+ err = deflateEnd(&stream);
+ return err;
+}
+
+/* ===========================================================================
+*/
+int ZEXPORT compress (Bytef *dest, uLongf *destLen, const Bytef *source, uLong sourceLen)
+{
+ return compress2(dest, destLen, source, sourceLen, Z_DEFAULT_COMPRESSION);
+}
+
+/* ===========================================================================
+ If the default memLevel or windowBits for deflateInit() is changed, then
+ this function needs to be updated.
+ */
+uLong ZEXPORT compressBound (uLong sourceLen)
+{
+ return sourceLen + (sourceLen >> 12) + (sourceLen >> 14) +
+ (sourceLen >> 25) + 13;
+}
--- /dev/null
+#ifndef _S_CRC32_H
+#define _S_CRC32_H
+
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+ static const unsigned long crc_table[256] = {
+ 0x00000000L, 0x77073096L, 0xee0e612cL, 0x990951baL, 0x076dc419L,
+ 0x706af48fL, 0xe963a535L, 0x9e6495a3L, 0x0edb8832L, 0x79dcb8a4L,
+ 0xe0d5e91eL, 0x97d2d988L, 0x09b64c2bL, 0x7eb17cbdL, 0xe7b82d07L,
+ 0x90bf1d91L, 0x1db71064L, 0x6ab020f2L, 0xf3b97148L, 0x84be41deL,
+ 0x1adad47dL, 0x6ddde4ebL, 0xf4d4b551L, 0x83d385c7L, 0x136c9856L,
+ 0x646ba8c0L, 0xfd62f97aL, 0x8a65c9ecL, 0x14015c4fL, 0x63066cd9L,
+ 0xfa0f3d63L, 0x8d080df5L, 0x3b6e20c8L, 0x4c69105eL, 0xd56041e4L,
+ 0xa2677172L, 0x3c03e4d1L, 0x4b04d447L, 0xd20d85fdL, 0xa50ab56bL,
+ 0x35b5a8faL, 0x42b2986cL, 0xdbbbc9d6L, 0xacbcf940L, 0x32d86ce3L,
+ 0x45df5c75L, 0xdcd60dcfL, 0xabd13d59L, 0x26d930acL, 0x51de003aL,
+ 0xc8d75180L, 0xbfd06116L, 0x21b4f4b5L, 0x56b3c423L, 0xcfba9599L,
+ 0xb8bda50fL, 0x2802b89eL, 0x5f058808L, 0xc60cd9b2L, 0xb10be924L,
+ 0x2f6f7c87L, 0x58684c11L, 0xc1611dabL, 0xb6662d3dL, 0x76dc4190L,
+ 0x01db7106L, 0x98d220bcL, 0xefd5102aL, 0x71b18589L, 0x06b6b51fL,
+ 0x9fbfe4a5L, 0xe8b8d433L, 0x7807c9a2L, 0x0f00f934L, 0x9609a88eL,
+ 0xe10e9818L, 0x7f6a0dbbL, 0x086d3d2dL, 0x91646c97L, 0xe6635c01L,
+ 0x6b6b51f4L, 0x1c6c6162L, 0x856530d8L, 0xf262004eL, 0x6c0695edL,
+ 0x1b01a57bL, 0x8208f4c1L, 0xf50fc457L, 0x65b0d9c6L, 0x12b7e950L,
+ 0x8bbeb8eaL, 0xfcb9887cL, 0x62dd1ddfL, 0x15da2d49L, 0x8cd37cf3L,
+ 0xfbd44c65L, 0x4db26158L, 0x3ab551ceL, 0xa3bc0074L, 0xd4bb30e2L,
+ 0x4adfa541L, 0x3dd895d7L, 0xa4d1c46dL, 0xd3d6f4fbL, 0x4369e96aL,
+ 0x346ed9fcL, 0xad678846L, 0xda60b8d0L, 0x44042d73L, 0x33031de5L,
+ 0xaa0a4c5fL, 0xdd0d7cc9L, 0x5005713cL, 0x270241aaL, 0xbe0b1010L,
+ 0xc90c2086L, 0x5768b525L, 0x206f85b3L, 0xb966d409L, 0xce61e49fL,
+ 0x5edef90eL, 0x29d9c998L, 0xb0d09822L, 0xc7d7a8b4L, 0x59b33d17L,
+ 0x2eb40d81L, 0xb7bd5c3bL, 0xc0ba6cadL, 0xedb88320L, 0x9abfb3b6L,
+ 0x03b6e20cL, 0x74b1d29aL, 0xead54739L, 0x9dd277afL, 0x04db2615L,
+ 0x73dc1683L, 0xe3630b12L, 0x94643b84L, 0x0d6d6a3eL, 0x7a6a5aa8L,
+ 0xe40ecf0bL, 0x9309ff9dL, 0x0a00ae27L, 0x7d079eb1L, 0xf00f9344L,
+ 0x8708a3d2L, 0x1e01f268L, 0x6906c2feL, 0xf762575dL, 0x806567cbL,
+ 0x196c3671L, 0x6e6b06e7L, 0xfed41b76L, 0x89d32be0L, 0x10da7a5aL,
+ 0x67dd4accL, 0xf9b9df6fL, 0x8ebeeff9L, 0x17b7be43L, 0x60b08ed5L,
+ 0xd6d6a3e8L, 0xa1d1937eL, 0x38d8c2c4L, 0x4fdff252L, 0xd1bb67f1L,
+ 0xa6bc5767L, 0x3fb506ddL, 0x48b2364bL, 0xd80d2bdaL, 0xaf0a1b4cL,
+ 0x36034af6L, 0x41047a60L, 0xdf60efc3L, 0xa867df55L, 0x316e8eefL,
+ 0x4669be79L, 0xcb61b38cL, 0xbc66831aL, 0x256fd2a0L, 0x5268e236L,
+ 0xcc0c7795L, 0xbb0b4703L, 0x220216b9L, 0x5505262fL, 0xc5ba3bbeL,
+ 0xb2bd0b28L, 0x2bb45a92L, 0x5cb36a04L, 0xc2d7ffa7L, 0xb5d0cf31L,
+ 0x2cd99e8bL, 0x5bdeae1dL, 0x9b64c2b0L, 0xec63f226L, 0x756aa39cL,
+ 0x026d930aL, 0x9c0906a9L, 0xeb0e363fL, 0x72076785L, 0x05005713L,
+ 0x95bf4a82L, 0xe2b87a14L, 0x7bb12baeL, 0x0cb61b38L, 0x92d28e9bL,
+ 0xe5d5be0dL, 0x7cdcefb7L, 0x0bdbdf21L, 0x86d3d2d4L, 0xf1d4e242L,
+ 0x68ddb3f8L, 0x1fda836eL, 0x81be16cdL, 0xf6b9265bL, 0x6fb077e1L,
+ 0x18b74777L, 0x88085ae6L, 0xff0f6a70L, 0x66063bcaL, 0x11010b5cL,
+ 0x8f659effL, 0xf862ae69L, 0x616bffd3L, 0x166ccf45L, 0xa00ae278L,
+ 0xd70dd2eeL, 0x4e048354L, 0x3903b3c2L, 0xa7672661L, 0xd06016f7L,
+ 0x4969474dL, 0x3e6e77dbL, 0xaed16a4aL, 0xd9d65adcL, 0x40df0b66L,
+ 0x37d83bf0L, 0xa9bcae53L, 0xdebb9ec5L, 0x47b2cf7fL, 0x30b5ffe9L,
+ 0xbdbdf21cL, 0xcabac28aL, 0x53b39330L, 0x24b4a3a6L, 0xbad03605L,
+ 0xcdd70693L, 0x54de5729L, 0x23d967bfL, 0xb3667a2eL, 0xc4614ab8L,
+ 0x5d681b02L, 0x2a6f2b94L, 0xb40bbe37L, 0xc30c8ea1L, 0x5a05df1bL,
+ 0x2d02ef8dL
+ };
+
+#define DO1_CRC32(buf) crc = crc_table[((int)crc ^ (*buf++)) & 0xff] ^ (crc >> 8);
+#define DO2_CRC32(buf) DO1_CRC32(buf); DO1_CRC32(buf);
+#define DO4_CRC32(buf) DO2_CRC32(buf); DO2_CRC32(buf);
+#define DO8_CRC32(buf) DO4_CRC32(buf); DO4_CRC32(buf);
+
+ unsigned long crc32(unsigned long crc, const unsigned char *buf, unsigned int len)
+ {
+ if (buf == 0) return 0L;
+ crc = crc ^ 0xffffffffL;
+ while (len >= 8)
+ {
+ DO8_CRC32(buf);
+ len -= 8;
+ }
+ if (len) do {
+ DO1_CRC32(buf);
+ } while (--len);
+ return crc ^ 0xffffffffL;
+ }
+
+#ifdef __cplusplus
+}
+#endif
+
+#endif
+
--- /dev/null
+/* deflate.c -- compress data using the deflation algorithm
+ * Copyright (C) 1995-2013 Jean-loup Gailly and Mark Adler
+ * For conditions of distribution and use, see copyright notice in zlib.h
+ */
+
+/*
+ * ALGORITHM
+ *
+ * The "deflation" process depends on being able to identify portions
+ * of the input text which are identical to earlier input (within a
+ * sliding window trailing behind the input currently being processed).
+ *
+ * The most straightforward technique turns out to be the fastest for
+ * most input files: try all possible matches and select the longest.
+ * The key feature of this algorithm is that insertions into the string
+ * dictionary are very simple and thus fast, and deletions are avoided
+ * completely. Insertions are performed at each input character, whereas
+ * string matches are performed only when the previous match ends. So it
+ * is preferable to spend more time in matches to allow very fast string
+ * insertions and avoid deletions. The matching algorithm for small
+ * strings is inspired from that of Rabin & Karp. A brute force approach
+ * is used to find longer strings when a small match has been found.
+ * A similar algorithm is used in comic (by Jan-Mark Wams) and freeze
+ * (by Leonid Broukhis).
+ * A previous version of this file used a more sophisticated algorithm
+ * (by Fiala and Greene) which is guaranteed to run in linear amortized
+ * time, but has a larger average cost, uses more memory and is patented.
+ * However the F&G algorithm may be faster for some highly redundant
+ * files if the parameter max_chain_length (described below) is too large.
+ *
+ * ACKNOWLEDGEMENTS
+ *
+ * The idea of lazy evaluation of matches is due to Jan-Mark Wams, and
+ * I found it in 'freeze' written by Leonid Broukhis.
+ * Thanks to many people for bug reports and testing.
+ *
+ * REFERENCES
+ *
+ * Deutsch, L.P.,"DEFLATE Compressed Data Format Specification".
+ * Available in http://tools.ietf.org/html/rfc1951
+ *
+ * A description of the Rabin and Karp algorithm is given in the book
+ * "Algorithms" by R. Sedgewick, Addison-Wesley, p252.
+ *
+ * Fiala,E.R., and Greene,D.H.
+ * Data Compression with Finite Windows, Comm.ACM, 32,4 (1989) 490-595
+ *
+ */
+
+/* @(#) $Id$ */
+
+#include "deflate.h"
+
+const char deflate_copyright[] =
+" deflate 1.2.8 Copyright 1995-2013 Jean-loup Gailly and Mark Adler ";
+/*
+ If you use the zlib library in a product, an acknowledgment is welcome
+ in the documentation of your product. If for some reason you cannot
+ include such an acknowledgment, I would appreciate that you keep this
+ copyright string in the executable of your product.
+ */
+
+/* ===========================================================================
+ * Function prototypes.
+ */
+typedef enum {
+ need_more, /* block not completed, need more input or more output */
+ block_done, /* block flush performed */
+ finish_started, /* finish started, need only more output at next deflate */
+ finish_done /* finish done, accept no more input or output */
+} block_state;
+
+typedef block_state (*compress_func) OF((deflate_state *s, int flush));
+/* Compression function. Returns the block state after the call. */
+
+local void fill_window OF((deflate_state *s));
+local block_state deflate_stored OF((deflate_state *s, int flush));
+local block_state deflate_fast OF((deflate_state *s, int flush));
+#ifndef FASTEST
+local block_state deflate_slow OF((deflate_state *s, int flush));
+#endif
+local block_state deflate_rle OF((deflate_state *s, int flush));
+local block_state deflate_huff OF((deflate_state *s, int flush));
+local void lm_init OF((deflate_state *s));
+local void putShortMSB OF((deflate_state *s, uInt b));
+local void flush_pending OF((z_streamp strm));
+local int read_buf OF((z_streamp strm, Bytef *buf, unsigned size));
+#ifdef ASMV
+void match_init OF((void)); /* asm code initialization */
+uInt longest_match OF((deflate_state *s, IPos cur_match));
+#else
+local uInt longest_match OF((deflate_state *s, IPos cur_match));
+#endif
+
+#ifdef DEBUG
+local void check_match OF((deflate_state *s, IPos start, IPos match,
+ int length));
+#endif
+
+/* ===========================================================================
+ * Local data
+ */
+
+#define NIL 0
+/* Tail of hash chains */
+
+#ifndef TOO_FAR
+# define TOO_FAR 4096
+#endif
+/* Matches of length 3 are discarded if their distance exceeds TOO_FAR */
+
+/* Values for max_lazy_match, good_match and max_chain_length, depending on
+ * the desired pack level (0..9). The values given below have been tuned to
+ * exclude worst case performance for pathological files. Better values may be
+ * found for specific files.
+ */
+typedef struct config_s {
+ ush good_length; /* reduce lazy search above this match length */
+ ush max_lazy; /* do not perform lazy search above this match length */
+ ush nice_length; /* quit search above this match length */
+ ush max_chain;
+ compress_func func;
+} config;
+
+#ifdef FASTEST
+local const config configuration_table[2] = {
+ /* good lazy nice chain */
+ /* 0 */ {0, 0, 0, 0, deflate_stored}, /* store only */
+ /* 1 */ {4, 4, 8, 4, deflate_fast}}; /* max speed, no lazy matches */
+#else
+local const config configuration_table[10] = {
+ /* good lazy nice chain */
+ /* 0 */ {0, 0, 0, 0, deflate_stored}, /* store only */
+ /* 1 */ {4, 4, 8, 4, deflate_fast}, /* max speed, no lazy matches */
+ /* 2 */ {4, 5, 16, 8, deflate_fast},
+ /* 3 */ {4, 6, 32, 32, deflate_fast},
+
+ /* 4 */ {4, 4, 16, 16, deflate_slow}, /* lazy matches */
+ /* 5 */ {8, 16, 32, 32, deflate_slow},
+ /* 6 */ {8, 16, 128, 128, deflate_slow},
+ /* 7 */ {8, 32, 128, 256, deflate_slow},
+ /* 8 */ {32, 128, 258, 1024, deflate_slow},
+ /* 9 */ {32, 258, 258, 4096, deflate_slow}}; /* max compression */
+#endif
+
+/* Note: the deflate() code requires max_lazy >= MIN_MATCH and max_chain >= 4
+ * For deflate_fast() (levels <= 3) good is ignored and lazy has a different
+ * meaning.
+ */
+
+#define EQUAL 0
+/* result of memcmp for equal strings */
+
+/* rank Z_BLOCK between Z_NO_FLUSH and Z_PARTIAL_FLUSH */
+#define RANK(f) (((f) << 1) - ((f) > 4 ? 9 : 0))
+
+/* ===========================================================================
+ * Update a hash value with the given input byte
+ * IN assertion: all calls to to UPDATE_HASH are made with consecutive
+ * input characters, so that a running hash key can be computed from the
+ * previous key instead of complete recalculation each time.
+ */
+#define UPDATE_HASH(s,h,c) (h = (((h)<<s->hash_shift) ^ (c)) & s->hash_mask)
+
+
+/* ===========================================================================
+ * Insert string str in the dictionary and set match_head to the previous head
+ * of the hash chain (the most recent string with same hash key). Return
+ * the previous length of the hash chain.
+ * If this file is compiled with -DFASTEST, the compression level is forced
+ * to 1, and no hash chains are maintained.
+ * IN assertion: all calls to to INSERT_STRING are made with consecutive
+ * input characters and the first MIN_MATCH bytes of str are valid
+ * (except for the last MIN_MATCH-1 bytes of the input file).
+ */
+#ifdef FASTEST
+#define INSERT_STRING(s, str, match_head) \
+ (UPDATE_HASH(s, s->ins_h, s->window[(str) + (MIN_MATCH-1)]), \
+ match_head = s->head[s->ins_h], \
+ s->head[s->ins_h] = (Pos)(str))
+#else
+#define INSERT_STRING(s, str, match_head) \
+ (UPDATE_HASH(s, s->ins_h, s->window[(str) + (MIN_MATCH-1)]), \
+ match_head = s->prev[(str) & s->w_mask] = s->head[s->ins_h], \
+ s->head[s->ins_h] = (Pos)(str))
+#endif
+
+/* ===========================================================================
+ * Initialize the hash table (avoiding 64K overflow for 16 bit systems).
+ * prev[] will be initialized on the fly.
+ */
+#define CLEAR_HASH(s) \
+ s->head[s->hash_size-1] = NIL; \
+zmemzero((Bytef *)s->head, (unsigned)(s->hash_size-1)*sizeof(*s->head));
+
+int ZEXPORT deflateResetKeep (z_streamp strm);
+
+int ZEXPORT deflatePending (z_streamp strm, unsigned *pending, int *bits);
+
+/* ========================================================================= */
+int ZEXPORT deflateInit_(z_streamp strm, int level, const char *version, int stream_size)
+{
+ return deflateInit2_(strm, level, Z_DEFLATED, MAX_WBITS, DEF_MEM_LEVEL,
+ Z_DEFAULT_STRATEGY, version, stream_size);
+ /* To do: ignore strm->next_in if we use it as window */
+}
+
+/* ========================================================================= */
+int ZEXPORT deflateInit2_(z_streamp strm, int level, int method, int windowBits, int memLevel, int strategy,
+ const char *version, int stream_size)
+{
+ deflate_state *s;
+ int wrap = 1;
+ static const char my_version[] = ZLIB_VERSION;
+
+ ushf *overlay;
+ /* We overlay pending_buf and d_buf+l_buf. This works since the average
+ * output size for (length,distance) codes is <= 24 bits.
+ */
+
+ if (version == Z_NULL || version[0] != my_version[0] ||
+ stream_size != sizeof(z_stream)) {
+ return Z_VERSION_ERROR;
+ }
+ if (strm == Z_NULL) return Z_STREAM_ERROR;
+
+ strm->msg = Z_NULL;
+ if (strm->zalloc == (alloc_func)0) {
+#ifdef Z_SOLO
+ return Z_STREAM_ERROR;
+#else
+ strm->zalloc = zcalloc;
+ strm->opaque = (voidpf)0;
+#endif
+ }
+ if (strm->zfree == NULL)
+#ifdef Z_SOLO
+ return Z_STREAM_ERROR;
+#else
+ strm->zfree = zcfree;
+#endif
+
+#ifdef FASTEST
+ if (level != 0) level = 1;
+#else
+ if (level == Z_DEFAULT_COMPRESSION) level = 6;
+#endif
+
+ if (windowBits < 0) { /* suppress zlib wrapper */
+ wrap = 0;
+ windowBits = -windowBits;
+ }
+#ifdef GZIP
+ else if (windowBits > 15) {
+ wrap = 2; /* write gzip wrapper instead */
+ windowBits -= 16;
+ }
+#endif
+ if (memLevel < 1 || memLevel > MAX_MEM_LEVEL || method != Z_DEFLATED ||
+ windowBits < 8 || windowBits > 15 || level < 0 || level > 9 ||
+ strategy < 0 || strategy > Z_FIXED) {
+ return Z_STREAM_ERROR;
+ }
+ if (windowBits == 8) windowBits = 9; /* until 256-byte window bug fixed */
+ s = (deflate_state *) ZALLOC(strm, 1, sizeof(deflate_state));
+ if (s == Z_NULL) return Z_MEM_ERROR;
+ strm->state = (struct internal_state*)s;
+ s->strm = strm;
+
+ s->wrap = wrap;
+ s->gzhead = Z_NULL;
+ s->w_bits = windowBits;
+ s->w_size = 1 << s->w_bits;
+ s->w_mask = s->w_size - 1;
+
+ s->hash_bits = memLevel + 7;
+ s->hash_size = 1 << s->hash_bits;
+ s->hash_mask = s->hash_size - 1;
+ s->hash_shift = ((s->hash_bits+MIN_MATCH-1)/MIN_MATCH);
+
+ s->window = (Bytef *) ZALLOC(strm, s->w_size, 2*sizeof(Byte));
+ s->prev = (Posf *) ZALLOC(strm, s->w_size, sizeof(Pos));
+ s->head = (Posf *) ZALLOC(strm, s->hash_size, sizeof(Pos));
+
+ s->high_water = 0; /* nothing written to s->window yet */
+
+ s->lit_bufsize = 1 << (memLevel + 6); /* 16K elements by default */
+
+ overlay = (ushf *) ZALLOC(strm, s->lit_bufsize, sizeof(ush)+2);
+ s->pending_buf = (uchf *) overlay;
+ s->pending_buf_size = (ulg)s->lit_bufsize * (sizeof(ush)+2L);
+
+ if (s->window == Z_NULL || s->prev == Z_NULL || s->head == Z_NULL ||
+ s->pending_buf == Z_NULL) {
+ s->status = FINISH_STATE;
+ strm->msg = ERR_MSG(Z_MEM_ERROR);
+ deflateEnd (strm);
+ return Z_MEM_ERROR;
+ }
+ s->d_buf = overlay + s->lit_bufsize/sizeof(ush);
+ s->l_buf = s->pending_buf + (1+sizeof(ush))*s->lit_bufsize;
+
+ s->level = level;
+ s->strategy = strategy;
+ s->method = (Byte)method;
+
+ return deflateReset(strm);
+}
+
+/* ========================================================================= */
+int ZEXPORT deflateSetDictionary (z_streamp strm, const Bytef *dictionary, uInt dictLength)
+{
+ deflate_state *s;
+ uInt str, n;
+ int wrap;
+ unsigned avail;
+ unsigned char *next;
+
+ if (strm == Z_NULL || strm->state == Z_NULL || dictionary == Z_NULL)
+ return Z_STREAM_ERROR;
+ s = (deflate_state*)strm->state;
+ wrap = s->wrap;
+ if (wrap == 2 || (wrap == 1 && s->status != INIT_STATE) || s->lookahead)
+ return Z_STREAM_ERROR;
+
+ /* when using zlib wrappers, compute Adler-32 for provided dictionary */
+ if (wrap == 1)
+ strm->adler = adler32(strm->adler, dictionary, dictLength);
+ s->wrap = 0; /* avoid computing Adler-32 in read_buf */
+
+ /* if dictionary would fill window, just replace the history */
+ if (dictLength >= s->w_size) {
+ if (wrap == 0) { /* already empty otherwise */
+ CLEAR_HASH(s);
+ s->strstart = 0;
+ s->block_start = 0L;
+ s->insert = 0;
+ }
+ dictionary += dictLength - s->w_size; /* use the tail */
+ dictLength = s->w_size;
+ }
+
+ /* insert dictionary into window and hash */
+ avail = strm->avail_in;
+ next = strm->next_in;
+ strm->avail_in = dictLength;
+ strm->next_in = (Bytef *)dictionary;
+ fill_window(s);
+ while (s->lookahead >= MIN_MATCH) {
+ str = s->strstart;
+ n = s->lookahead - (MIN_MATCH-1);
+ do {
+ UPDATE_HASH(s, s->ins_h, s->window[str + MIN_MATCH-1]);
+#ifndef FASTEST
+ s->prev[str & s->w_mask] = s->head[s->ins_h];
+#endif
+ s->head[s->ins_h] = (Pos)str;
+ str++;
+ } while (--n);
+ s->strstart = str;
+ s->lookahead = MIN_MATCH-1;
+ fill_window(s);
+ }
+ s->strstart += s->lookahead;
+ s->block_start = (long)s->strstart;
+ s->insert = s->lookahead;
+ s->lookahead = 0;
+ s->match_length = s->prev_length = MIN_MATCH-1;
+ s->match_available = 0;
+ strm->next_in = next;
+ strm->avail_in = avail;
+ s->wrap = wrap;
+ return Z_OK;
+}
+
+/* ========================================================================= */
+int ZEXPORT deflateResetKeep (z_streamp strm)
+{
+ deflate_state *s;
+
+ if (strm == Z_NULL || strm->state == Z_NULL ||
+ strm->zalloc == Z_NULL || strm->zfree == Z_NULL) {
+ return Z_STREAM_ERROR;
+ }
+
+ strm->total_in = strm->total_out = 0;
+ strm->msg = Z_NULL; /* use zfree if we ever allocate msg dynamically */
+ strm->data_type = Z_UNKNOWN;
+
+ s = (deflate_state *)strm->state;
+ s->pending = 0;
+ s->pending_out = s->pending_buf;
+
+ if (s->wrap < 0) {
+ s->wrap = -s->wrap; /* was made negative by deflate(..., Z_FINISH); */
+ }
+ s->status = s->wrap ? INIT_STATE : BUSY_STATE;
+ strm->adler =
+#ifdef GZIP
+ s->wrap == 2 ? crc32(0L, Z_NULL, 0) :
+#endif
+ adler32(0L, Z_NULL, 0);
+ s->last_flush = Z_NO_FLUSH;
+
+ _tr_init(s);
+
+ return Z_OK;
+}
+
+/* ========================================================================= */
+int ZEXPORT deflateReset (z_streamp strm)
+{
+ int ret;
+
+ ret = deflateResetKeep(strm);
+ if (ret == Z_OK)
+ lm_init((deflate_state*)strm->state);
+ return ret;
+}
+
+/* ========================================================================= */
+int ZEXPORT deflateSetHeader (z_streamp strm, gz_headerp head)
+{
+ struct internal_state_deflate *state = (struct internal_state_deflate*)strm->state;
+ if (strm == Z_NULL || strm->state == Z_NULL) return Z_STREAM_ERROR;
+ if (state->wrap != 2)
+ return Z_STREAM_ERROR;
+ state->gzhead = head;
+ return Z_OK;
+}
+
+/* ========================================================================= */
+int ZEXPORT deflatePending (z_streamp strm, unsigned *pending, int *bits)
+{
+ struct internal_state_deflate *state = (struct internal_state_deflate*)strm->state;
+ if (strm == Z_NULL || strm->state == Z_NULL) return Z_STREAM_ERROR;
+ if (pending != Z_NULL)
+ *pending = state->pending;
+ if (bits != Z_NULL)
+ *bits = state->bi_valid;
+ return Z_OK;
+}
+
+/* ========================================================================= */
+int ZEXPORT deflatePrime (z_streamp strm, int bits, int value)
+{
+ deflate_state *s;
+ int put;
+
+ if (strm == Z_NULL || strm->state == Z_NULL) return Z_STREAM_ERROR;
+ s = (deflate_state*)strm->state;
+ if ((Bytef *)(s->d_buf) < s->pending_out + ((Buf_size + 7) >> 3))
+ return Z_BUF_ERROR;
+ do {
+ put = Buf_size - s->bi_valid;
+ if (put > bits)
+ put = bits;
+ s->bi_buf |= (ush)((value & ((1 << put) - 1)) << s->bi_valid);
+ s->bi_valid += put;
+ _tr_flush_bits(s);
+ value >>= put;
+ bits -= put;
+ } while (bits);
+ return Z_OK;
+}
+
+/* ========================================================================= */
+int ZEXPORT deflateParams(z_streamp strm, int level, int strategy)
+{
+ deflate_state *s;
+ compress_func func;
+ int err = Z_OK;
+
+ if (strm == Z_NULL || strm->state == Z_NULL) return Z_STREAM_ERROR;
+ s = (deflate_state*)strm->state;
+
+#ifdef FASTEST
+ if (level != 0) level = 1;
+#else
+ if (level == Z_DEFAULT_COMPRESSION) level = 6;
+#endif
+ if (level < 0 || level > 9 || strategy < 0 || strategy > Z_FIXED) {
+ return Z_STREAM_ERROR;
+ }
+ func = configuration_table[s->level].func;
+
+ if ((strategy != s->strategy || func != configuration_table[level].func) &&
+ strm->total_in != 0) {
+ /* Flush the last buffer: */
+ err = deflate(strm, Z_BLOCK);
+ if (err == Z_BUF_ERROR && s->pending == 0)
+ err = Z_OK;
+ }
+ if (s->level != level) {
+ s->level = level;
+ s->max_lazy_match = configuration_table[level].max_lazy;
+ s->good_match = configuration_table[level].good_length;
+ s->nice_match = configuration_table[level].nice_length;
+ s->max_chain_length = configuration_table[level].max_chain;
+ }
+ s->strategy = strategy;
+ return err;
+}
+
+/* ========================================================================= */
+int ZEXPORT deflateTune(z_streamp strm, int good_length, int max_lazy, int nice_length, int max_chain)
+{
+ deflate_state *s;
+
+ if (strm == Z_NULL || strm->state == Z_NULL) return Z_STREAM_ERROR;
+ s = (deflate_state*)strm->state;
+ s->good_match = good_length;
+ s->max_lazy_match = max_lazy;
+ s->nice_match = nice_length;
+ s->max_chain_length = max_chain;
+ return Z_OK;
+}
+
+/* =========================================================================
+ * For the default windowBits of 15 and memLevel of 8, this function returns
+ * a close to exact, as well as small, upper bound on the compressed size.
+ * They are coded as constants here for a reason--if the #define's are
+ * changed, then this function needs to be changed as well. The return
+ * value for 15 and 8 only works for those exact settings.
+ *
+ * For any setting other than those defaults for windowBits and memLevel,
+ * the value returned is a conservative worst case for the maximum expansion
+ * resulting from using fixed blocks instead of stored blocks, which deflate
+ * can emit on compressed data for some combinations of the parameters.
+ *
+ * This function could be more sophisticated to provide closer upper bounds for
+ * every combination of windowBits and memLevel. But even the conservative
+ * upper bound of about 14% expansion does not seem onerous for output buffer
+ * allocation.
+ */
+uLong ZEXPORT deflateBound(z_streamp strm, uLong sourceLen)
+{
+ deflate_state *s;
+ uLong complen, wraplen;
+ Bytef *str;
+
+ /* conservative upper bound for compressed data */
+ complen = sourceLen +
+ ((sourceLen + 7) >> 3) + ((sourceLen + 63) >> 6) + 5;
+
+ /* if can't get parameters, return conservative bound plus zlib wrapper */
+ if (strm == Z_NULL || strm->state == Z_NULL)
+ return complen + 6;
+
+ /* compute wrapper length */
+ s = (deflate_state*)strm->state;
+ switch (s->wrap) {
+ case 0: /* raw deflate */
+ wraplen = 0;
+ break;
+ case 1: /* zlib wrapper */
+ wraplen = 6 + (s->strstart ? 4 : 0);
+ break;
+ case 2: /* gzip wrapper */
+ wraplen = 18;
+ if (s->gzhead != Z_NULL) { /* user-supplied gzip header */
+ if (s->gzhead->extra != Z_NULL)
+ wraplen += 2 + s->gzhead->extra_len;
+ str = s->gzhead->name;
+ if (str != Z_NULL)
+ do {
+ wraplen++;
+ } while (*str++);
+ str = s->gzhead->comment;
+ if (str != Z_NULL)
+ do {
+ wraplen++;
+ } while (*str++);
+ if (s->gzhead->hcrc)
+ wraplen += 2;
+ }
+ break;
+ default: /* for compiler happiness */
+ wraplen = 6;
+ }
+
+ /* if not default parameters, return conservative bound */
+ if (s->w_bits != 15 || s->hash_bits != 8 + 7)
+ return complen + wraplen;
+
+ /* default settings: return tight bound for that case */
+ return sourceLen + (sourceLen >> 12) + (sourceLen >> 14) +
+ (sourceLen >> 25) + 13 - 6 + wraplen;
+}
+
+/* =========================================================================
+ * Put a short in the pending buffer. The 16-bit value is put in MSB order.
+ * IN assertion: the stream state is correct and there is enough room in
+ * pending_buf.
+ */
+local void putShortMSB (deflate_state *s, uInt b)
+{
+ put_byte(s, (Byte)(b >> 8));
+ put_byte(s, (Byte)(b & 0xff));
+}
+
+/* =========================================================================
+ * Flush as much pending output as possible. All deflate() output goes
+ * through this function so some applications may wish to modify it
+ * to avoid allocating a large strm->next_out buffer and copying into it.
+ * (See also read_buf()).
+ */
+local void flush_pending(z_streamp strm)
+{
+ unsigned len;
+ deflate_state *s = (deflate_state*)strm->state;
+
+ _tr_flush_bits(s);
+ len = s->pending;
+ if (len > strm->avail_out) len = strm->avail_out;
+ if (len == 0) return;
+
+ zmemcpy(strm->next_out, s->pending_out, len);
+ strm->next_out += len;
+ s->pending_out += len;
+ strm->total_out += len;
+ strm->avail_out -= len;
+ s->pending -= len;
+ if (s->pending == 0) {
+ s->pending_out = s->pending_buf;
+ }
+}
+
+/* ========================================================================= */
+int ZEXPORT deflate (z_streamp strm, int flush)
+{
+ int old_flush; /* value of flush param for previous deflate call */
+ deflate_state *s;
+
+ if (strm == Z_NULL || strm->state == Z_NULL ||
+ flush > Z_BLOCK || flush < 0) {
+ return Z_STREAM_ERROR;
+ }
+ s = (deflate_state*)strm->state;
+
+ if (strm->next_out == Z_NULL ||
+ (strm->next_in == Z_NULL && strm->avail_in != 0) ||
+ (s->status == FINISH_STATE && flush != Z_FINISH)) {
+ ERR_RETURN(strm, Z_STREAM_ERROR);
+ }
+ if (strm->avail_out == 0) ERR_RETURN(strm, Z_BUF_ERROR);
+
+ s->strm = strm; /* just in case */
+ old_flush = s->last_flush;
+ s->last_flush = flush;
+
+ /* Write the header */
+ if (s->status == INIT_STATE) {
+#ifdef GZIP
+ if (s->wrap == 2) {
+ strm->adler = crc32(0L, Z_NULL, 0);
+ put_byte(s, 31);
+ put_byte(s, 139);
+ put_byte(s, 8);
+ if (s->gzhead == Z_NULL) {
+ put_byte(s, 0);
+ put_byte(s, 0);
+ put_byte(s, 0);
+ put_byte(s, 0);
+ put_byte(s, 0);
+ put_byte(s, s->level == 9 ? 2 :
+ (s->strategy >= Z_HUFFMAN_ONLY || s->level < 2 ?
+ 4 : 0));
+ put_byte(s, OS_CODE);
+ s->status = BUSY_STATE;
+ }
+ else {
+ put_byte(s, (s->gzhead->text ? 1 : 0) +
+ (s->gzhead->hcrc ? 2 : 0) +
+ (s->gzhead->extra == Z_NULL ? 0 : 4) +
+ (s->gzhead->name == Z_NULL ? 0 : 8) +
+ (s->gzhead->comment == Z_NULL ? 0 : 16)
+ );
+ put_byte(s, (Byte)(s->gzhead->time & 0xff));
+ put_byte(s, (Byte)((s->gzhead->time >> 8) & 0xff));
+ put_byte(s, (Byte)((s->gzhead->time >> 16) & 0xff));
+ put_byte(s, (Byte)((s->gzhead->time >> 24) & 0xff));
+ put_byte(s, s->level == 9 ? 2 :
+ (s->strategy >= Z_HUFFMAN_ONLY || s->level < 2 ?
+ 4 : 0));
+ put_byte(s, s->gzhead->os & 0xff);
+ if (s->gzhead->extra != Z_NULL) {
+ put_byte(s, s->gzhead->extra_len & 0xff);
+ put_byte(s, (s->gzhead->extra_len >> 8) & 0xff);
+ }
+ if (s->gzhead->hcrc)
+ strm->adler = crc32(strm->adler, s->pending_buf,
+ s->pending);
+ s->gzindex = 0;
+ s->status = EXTRA_STATE;
+ }
+ }
+ else
+#endif
+ {
+ uInt header = (Z_DEFLATED + ((s->w_bits-8)<<4)) << 8;
+ uInt level_flags;
+
+ if (s->strategy >= Z_HUFFMAN_ONLY || s->level < 2)
+ level_flags = 0;
+ else if (s->level < 6)
+ level_flags = 1;
+ else if (s->level == 6)
+ level_flags = 2;
+ else
+ level_flags = 3;
+ header |= (level_flags << 6);
+ if (s->strstart != 0) header |= PRESET_DICT;
+ header += 31 - (header % 31);
+
+ s->status = BUSY_STATE;
+ putShortMSB(s, header);
+
+ /* Save the adler32 of the preset dictionary: */
+ if (s->strstart != 0) {
+ putShortMSB(s, (uInt)(strm->adler >> 16));
+ putShortMSB(s, (uInt)(strm->adler & 0xffff));
+ }
+ strm->adler = adler32(0L, Z_NULL, 0);
+ }
+ }
+#ifdef GZIP
+ if (s->status == EXTRA_STATE) {
+ if (s->gzhead->extra != Z_NULL) {
+ uInt beg = s->pending; /* start of bytes to update crc */
+
+ while (s->gzindex < (s->gzhead->extra_len & 0xffff)) {
+ if (s->pending == s->pending_buf_size) {
+ if (s->gzhead->hcrc && s->pending > beg)
+ strm->adler = crc32(strm->adler, s->pending_buf + beg,
+ s->pending - beg);
+ flush_pending(strm);
+ beg = s->pending;
+ if (s->pending == s->pending_buf_size)
+ break;
+ }
+ put_byte(s, s->gzhead->extra[s->gzindex]);
+ s->gzindex++;
+ }
+ if (s->gzhead->hcrc && s->pending > beg)
+ strm->adler = crc32(strm->adler, s->pending_buf + beg,
+ s->pending - beg);
+ if (s->gzindex == s->gzhead->extra_len) {
+ s->gzindex = 0;
+ s->status = NAME_STATE;
+ }
+ }
+ else
+ s->status = NAME_STATE;
+ }
+ if (s->status == NAME_STATE) {
+ if (s->gzhead->name != Z_NULL) {
+ uInt beg = s->pending; /* start of bytes to update crc */
+ int val;
+
+ do {
+ if (s->pending == s->pending_buf_size) {
+ if (s->gzhead->hcrc && s->pending > beg)
+ strm->adler = crc32(strm->adler, s->pending_buf + beg,
+ s->pending - beg);
+ flush_pending(strm);
+ beg = s->pending;
+ if (s->pending == s->pending_buf_size) {
+ val = 1;
+ break;
+ }
+ }
+ val = s->gzhead->name[s->gzindex++];
+ put_byte(s, val);
+ } while (val != 0);
+ if (s->gzhead->hcrc && s->pending > beg)
+ strm->adler = crc32(strm->adler, s->pending_buf + beg,
+ s->pending - beg);
+ if (val == 0) {
+ s->gzindex = 0;
+ s->status = COMMENT_STATE;
+ }
+ }
+ else
+ s->status = COMMENT_STATE;
+ }
+ if (s->status == COMMENT_STATE) {
+ if (s->gzhead->comment != Z_NULL) {
+ uInt beg = s->pending; /* start of bytes to update crc */
+ int val;
+
+ do {
+ if (s->pending == s->pending_buf_size) {
+ if (s->gzhead->hcrc && s->pending > beg)
+ strm->adler = crc32(strm->adler, s->pending_buf + beg,
+ s->pending - beg);
+ flush_pending(strm);
+ beg = s->pending;
+ if (s->pending == s->pending_buf_size) {
+ val = 1;
+ break;
+ }
+ }
+ val = s->gzhead->comment[s->gzindex++];
+ put_byte(s, val);
+ } while (val != 0);
+ if (s->gzhead->hcrc && s->pending > beg)
+ strm->adler = crc32(strm->adler, s->pending_buf + beg,
+ s->pending - beg);
+ if (val == 0)
+ s->status = HCRC_STATE;
+ }
+ else
+ s->status = HCRC_STATE;
+ }
+ if (s->status == HCRC_STATE) {
+ if (s->gzhead->hcrc) {
+ if (s->pending + 2 > s->pending_buf_size)
+ flush_pending(strm);
+ if (s->pending + 2 <= s->pending_buf_size) {
+ put_byte(s, (Byte)(strm->adler & 0xff));
+ put_byte(s, (Byte)((strm->adler >> 8) & 0xff));
+ strm->adler = crc32(0L, Z_NULL, 0);
+ s->status = BUSY_STATE;
+ }
+ }
+ else
+ s->status = BUSY_STATE;
+ }
+#endif
+
+ /* Flush as much pending output as possible */
+ if (s->pending != 0) {
+ flush_pending(strm);
+ if (strm->avail_out == 0) {
+ /* Since avail_out is 0, deflate will be called again with
+ * more output space, but possibly with both pending and
+ * avail_in equal to zero. There won't be anything to do,
+ * but this is not an error situation so make sure we
+ * return OK instead of BUF_ERROR at next call of deflate:
+ */
+ s->last_flush = -1;
+ return Z_OK;
+ }
+
+ /* Make sure there is something to do and avoid duplicate consecutive
+ * flushes. For repeated and useless calls with Z_FINISH, we keep
+ * returning Z_STREAM_END instead of Z_BUF_ERROR.
+ */
+ } else if (strm->avail_in == 0 && RANK(flush) <= RANK(old_flush) &&
+ flush != Z_FINISH) {
+ ERR_RETURN(strm, Z_BUF_ERROR);
+ }
+
+ /* User must not provide more input after the first FINISH: */
+ if (s->status == FINISH_STATE && strm->avail_in != 0) {
+ ERR_RETURN(strm, Z_BUF_ERROR);
+ }
+
+ /* Start a new block or continue the current one.
+ */
+ if (strm->avail_in != 0 || s->lookahead != 0 ||
+ (flush != Z_NO_FLUSH && s->status != FINISH_STATE)) {
+ block_state bstate;
+
+ bstate = s->strategy == Z_HUFFMAN_ONLY ? deflate_huff(s, flush) :
+ (s->strategy == Z_RLE ? deflate_rle(s, flush) :
+ (*(configuration_table[s->level].func))(s, flush));
+
+ if (bstate == finish_started || bstate == finish_done) {
+ s->status = FINISH_STATE;
+ }
+ if (bstate == need_more || bstate == finish_started) {
+ if (strm->avail_out == 0) {
+ s->last_flush = -1; /* avoid BUF_ERROR next call, see above */
+ }
+ return Z_OK;
+ /* If flush != Z_NO_FLUSH && avail_out == 0, the next call
+ * of deflate should use the same flush parameter to make sure
+ * that the flush is complete. So we don't have to output an
+ * empty block here, this will be done at next call. This also
+ * ensures that for a very small output buffer, we emit at most
+ * one empty block.
+ */
+ }
+ if (bstate == block_done) {
+ if (flush == Z_PARTIAL_FLUSH) {
+ _tr_align(s);
+ } else if (flush != Z_BLOCK) { /* FULL_FLUSH or SYNC_FLUSH */
+ _tr_stored_block(s, (char*)0, 0L, 0);
+ /* For a full flush, this empty block will be recognized
+ * as a special marker by inflate_sync().
+ */
+ if (flush == Z_FULL_FLUSH) {
+ CLEAR_HASH(s); /* forget history */
+ if (s->lookahead == 0) {
+ s->strstart = 0;
+ s->block_start = 0L;
+ s->insert = 0;
+ }
+ }
+ }
+ flush_pending(strm);
+ if (strm->avail_out == 0) {
+ s->last_flush = -1; /* avoid BUF_ERROR at next call, see above */
+ return Z_OK;
+ }
+ }
+ }
+ Assert(strm->avail_out > 0, "bug2");
+
+ if (flush != Z_FINISH) return Z_OK;
+ if (s->wrap <= 0) return Z_STREAM_END;
+
+ /* Write the trailer */
+#ifdef GZIP
+ if (s->wrap == 2) {
+ put_byte(s, (Byte)(strm->adler & 0xff));
+ put_byte(s, (Byte)((strm->adler >> 8) & 0xff));
+ put_byte(s, (Byte)((strm->adler >> 16) & 0xff));
+ put_byte(s, (Byte)((strm->adler >> 24) & 0xff));
+ put_byte(s, (Byte)(strm->total_in & 0xff));
+ put_byte(s, (Byte)((strm->total_in >> 8) & 0xff));
+ put_byte(s, (Byte)((strm->total_in >> 16) & 0xff));
+ put_byte(s, (Byte)((strm->total_in >> 24) & 0xff));
+ }
+ else
+#endif
+ {
+ putShortMSB(s, (uInt)(strm->adler >> 16));
+ putShortMSB(s, (uInt)(strm->adler & 0xffff));
+ }
+ flush_pending(strm);
+ /* If avail_out is zero, the application will call deflate again
+ * to flush the rest.
+ */
+ if (s->wrap > 0) s->wrap = -s->wrap; /* write the trailer only once! */
+ return s->pending != 0 ? Z_OK : Z_STREAM_END;
+}
+
+/* ========================================================================= */
+int ZEXPORT deflateEnd (z_streamp strm)
+{
+ struct internal_state_deflate *state;
+ int status;
+
+ if (strm == Z_NULL || strm->state == Z_NULL) return Z_STREAM_ERROR;
+ state = (struct internal_state_deflate*)strm->state;
+
+ status = state->status;
+ if (status != INIT_STATE &&
+ status != EXTRA_STATE &&
+ status != NAME_STATE &&
+ status != COMMENT_STATE &&
+ status != HCRC_STATE &&
+ status != BUSY_STATE &&
+ status != FINISH_STATE) {
+ return Z_STREAM_ERROR;
+ }
+
+ /* Deallocate in reverse order of allocations: */
+ TRY_FREE(strm, state->pending_buf);
+ TRY_FREE(strm, state->head);
+ TRY_FREE(strm, state->prev);
+ TRY_FREE(strm, state->window);
+
+ ZFREE(strm, state);
+ state = Z_NULL;
+
+ return status == BUSY_STATE ? Z_DATA_ERROR : Z_OK;
+}
+
+/* =========================================================================
+ * Copy the source state to the destination state.
+ * To simplify the source, this is not supported for 16-bit MSDOS (which
+ * doesn't have enough memory anyway to duplicate compression states).
+ */
+int ZEXPORT deflateCopy (z_streamp dest, z_streamp source)
+{
+#ifdef MAXSEG_64K
+ return Z_STREAM_ERROR;
+#else
+ deflate_state *ds;
+ deflate_state *ss;
+ ushf *overlay;
+
+
+ if (source == Z_NULL || dest == Z_NULL || source->state == Z_NULL) {
+ return Z_STREAM_ERROR;
+ }
+
+ ss = (deflate_state*)source->state;
+
+ zmemcpy((voidpf)dest, (voidpf)source, sizeof(z_stream));
+
+ ds = (deflate_state *) ZALLOC(dest, 1, sizeof(deflate_state));
+ if (ds == Z_NULL) return Z_MEM_ERROR;
+ dest->state = (struct internal_state FAR *) ds;
+ zmemcpy((voidpf)ds, (voidpf)ss, sizeof(deflate_state));
+ ds->strm = dest;
+
+ ds->window = (Bytef *) ZALLOC(dest, ds->w_size, 2*sizeof(Byte));
+ ds->prev = (Posf *) ZALLOC(dest, ds->w_size, sizeof(Pos));
+ ds->head = (Posf *) ZALLOC(dest, ds->hash_size, sizeof(Pos));
+ overlay = (ushf *) ZALLOC(dest, ds->lit_bufsize, sizeof(ush)+2);
+ ds->pending_buf = (uchf *) overlay;
+
+ if (ds->window == Z_NULL || ds->prev == Z_NULL || ds->head == Z_NULL ||
+ ds->pending_buf == Z_NULL) {
+ deflateEnd (dest);
+ return Z_MEM_ERROR;
+ }
+ /* following zmemcpy do not work for 16-bit MSDOS */
+ zmemcpy(ds->window, ss->window, ds->w_size * 2 * sizeof(Byte));
+ zmemcpy((voidpf)ds->prev, (voidpf)ss->prev, ds->w_size * sizeof(Pos));
+ zmemcpy((voidpf)ds->head, (voidpf)ss->head, ds->hash_size * sizeof(Pos));
+ zmemcpy(ds->pending_buf, ss->pending_buf, (uInt)ds->pending_buf_size);
+
+ ds->pending_out = ds->pending_buf + (ss->pending_out - ss->pending_buf);
+ ds->d_buf = overlay + ds->lit_bufsize/sizeof(ush);
+ ds->l_buf = ds->pending_buf + (1+sizeof(ush))*ds->lit_bufsize;
+
+ ds->l_desc.dyn_tree = ds->dyn_ltree;
+ ds->d_desc.dyn_tree = ds->dyn_dtree;
+ ds->bl_desc.dyn_tree = ds->bl_tree;
+
+ return Z_OK;
+#endif /* MAXSEG_64K */
+}
+
+/* ===========================================================================
+ * Read a new buffer from the current input stream, update the adler32
+ * and total number of bytes read. All deflate() input goes through
+ * this function so some applications may wish to modify it to avoid
+ * allocating a large strm->next_in buffer and copying from it.
+ * (See also flush_pending()).
+ */
+local int read_buf(z_streamp strm, Bytef *buf, unsigned size)
+{
+ struct internal_state_deflate *state = (struct internal_state_deflate*)strm->state;
+ unsigned len = strm->avail_in;
+
+ if (len > size) len = size;
+ if (len == 0) return 0;
+
+ strm->avail_in -= len;
+
+ zmemcpy(buf, strm->next_in, len);
+ if (state->wrap == 1) {
+ strm->adler = adler32(strm->adler, buf, len);
+ }
+#ifdef GZIP
+ else if (state->wrap == 2) {
+ strm->adler = crc32(strm->adler, buf, len);
+ }
+#endif
+ strm->next_in += len;
+ strm->total_in += len;
+
+ return (int)len;
+}
+
+/* ===========================================================================
+ * Initialize the "longest match" routines for a new zlib stream
+ */
+local void lm_init (deflate_state *s)
+{
+ s->window_size = (ulg)2L*s->w_size;
+
+ CLEAR_HASH(s);
+
+ /* Set the default configuration parameters:
+ */
+ s->max_lazy_match = configuration_table[s->level].max_lazy;
+ s->good_match = configuration_table[s->level].good_length;
+ s->nice_match = configuration_table[s->level].nice_length;
+ s->max_chain_length = configuration_table[s->level].max_chain;
+
+ s->strstart = 0;
+ s->block_start = 0L;
+ s->lookahead = 0;
+ s->insert = 0;
+ s->match_length = s->prev_length = MIN_MATCH-1;
+ s->match_available = 0;
+ s->ins_h = 0;
+#ifndef FASTEST
+#ifdef ASMV
+ match_init(); /* initialize the asm code */
+#endif
+#endif
+}
+
+#ifndef FASTEST
+/* ===========================================================================
+ * Set match_start to the longest match starting at the given string and
+ * return its length. Matches shorter or equal to prev_length are discarded,
+ * in which case the result is equal to prev_length and match_start is
+ * garbage.
+ * IN assertions: cur_match is the head of the hash chain for the current
+ * string (strstart) and its distance is <= MAX_DIST, and prev_length >= 1
+ * OUT assertion: the match length is not greater than s->lookahead.
+ */
+#ifndef ASMV
+/* For 80x86 and 680x0, an optimized version will be provided in match.asm or
+ * match.S. The code will be functionally equivalent.
+ */
+local uInt longest_match(deflate_state *s, IPos cur_match)
+{
+ unsigned chain_length = s->max_chain_length;/* max hash chain length */
+ register Bytef *scan = s->window + s->strstart; /* current string */
+ register Bytef *match; /* matched string */
+ register int len; /* length of current match */
+ int best_len = s->prev_length; /* best match length so far */
+ int nice_match = s->nice_match; /* stop if match long enough */
+ IPos limit = s->strstart > (IPos)MAX_DIST(s) ?
+ s->strstart - (IPos)MAX_DIST(s) : NIL;
+ /* Stop when cur_match becomes <= limit. To simplify the code,
+ * we prevent matches with the string of window index 0.
+ */
+ Posf *prev = s->prev;
+ uInt wmask = s->w_mask;
+
+#ifdef UNALIGNED_OK
+ /* Compare two bytes at a time. Note: this is not always beneficial.
+ * Try with and without -DUNALIGNED_OK to check.
+ */
+ register Bytef *strend = s->window + s->strstart + MAX_MATCH - 1;
+ register ush scan_start = *(ushf*)scan;
+ register ush scan_end = *(ushf*)(scan+best_len-1);
+#else
+ register Bytef *strend = s->window + s->strstart + MAX_MATCH;
+ register Byte scan_end1 = scan[best_len-1];
+ register Byte scan_end = scan[best_len];
+#endif
+
+ /* The code is optimized for HASH_BITS >= 8 and MAX_MATCH-2 multiple of 16.
+ * It is easy to get rid of this optimization if necessary.
+ */
+ Assert(s->hash_bits >= 8 && MAX_MATCH == 258, "Code too clever");
+
+ /* Do not waste too much time if we already have a good match: */
+ if (s->prev_length >= s->good_match) {
+ chain_length >>= 2;
+ }
+ /* Do not look for matches beyond the end of the input. This is necessary
+ * to make deflate deterministic.
+ */
+ if ((uInt)nice_match > s->lookahead) nice_match = s->lookahead;
+
+ Assert((ulg)s->strstart <= s->window_size-MIN_LOOKAHEAD, "need lookahead");
+
+ do {
+ Assert(cur_match < s->strstart, "no future");
+ match = s->window + cur_match;
+
+ /* Skip to next match if the match length cannot increase
+ * or if the match length is less than 2. Note that the checks below
+ * for insufficient lookahead only occur occasionally for performance
+ * reasons. Therefore uninitialized memory will be accessed, and
+ * conditional jumps will be made that depend on those values.
+ * However the length of the match is limited to the lookahead, so
+ * the output of deflate is not affected by the uninitialized values.
+ */
+#if (defined(UNALIGNED_OK) && MAX_MATCH == 258)
+ /* This code assumes sizeof(unsigned short) == 2. Do not use
+ * UNALIGNED_OK if your compiler uses a different size.
+ */
+ if (*(ushf*)(match+best_len-1) != scan_end ||
+ *(ushf*)match != scan_start) continue;
+
+ /* It is not necessary to compare scan[2] and match[2] since they are
+ * always equal when the other bytes match, given that the hash keys
+ * are equal and that HASH_BITS >= 8. Compare 2 bytes at a time at
+ * strstart+3, +5, ... up to strstart+257. We check for insufficient
+ * lookahead only every 4th comparison; the 128th check will be made
+ * at strstart+257. If MAX_MATCH-2 is not a multiple of 8, it is
+ * necessary to put more guard bytes at the end of the window, or
+ * to check more often for insufficient lookahead.
+ */
+ Assert(scan[2] == match[2], "scan[2]?");
+ scan++, match++;
+ do {
+ } while (*(ushf*)(scan+=2) == *(ushf*)(match+=2) &&
+ *(ushf*)(scan+=2) == *(ushf*)(match+=2) &&
+ *(ushf*)(scan+=2) == *(ushf*)(match+=2) &&
+ *(ushf*)(scan+=2) == *(ushf*)(match+=2) &&
+ scan < strend);
+ /* The funny "do {}" generates better code on most compilers */
+
+ /* Here, scan <= window+strstart+257 */
+ Assert(scan <= s->window+(unsigned)(s->window_size-1), "wild scan");
+ if (*scan == *match) scan++;
+
+ len = (MAX_MATCH - 1) - (int)(strend-scan);
+ scan = strend - (MAX_MATCH-1);
+
+#else /* UNALIGNED_OK */
+
+ if (match[best_len] != scan_end ||
+ match[best_len-1] != scan_end1 ||
+ *match != *scan ||
+ *++match != scan[1]) continue;
+
+ /* The check at best_len-1 can be removed because it will be made
+ * again later. (This heuristic is not always a win.)
+ * It is not necessary to compare scan[2] and match[2] since they
+ * are always equal when the other bytes match, given that
+ * the hash keys are equal and that HASH_BITS >= 8.
+ */
+ scan += 2, match++;
+ Assert(*scan == *match, "match[2]?");
+
+ /* We check for insufficient lookahead only every 8th comparison;
+ * the 256th check will be made at strstart+258.
+ */
+ do {
+ } while (*++scan == *++match && *++scan == *++match &&
+ *++scan == *++match && *++scan == *++match &&
+ *++scan == *++match && *++scan == *++match &&
+ *++scan == *++match && *++scan == *++match &&
+ scan < strend);
+
+ Assert(scan <= s->window+(unsigned)(s->window_size-1), "wild scan");
+
+ len = MAX_MATCH - (int)(strend - scan);
+ scan = strend - MAX_MATCH;
+
+#endif /* UNALIGNED_OK */
+
+ if (len > best_len) {
+ s->match_start = cur_match;
+ best_len = len;
+ if (len >= nice_match) break;
+#ifdef UNALIGNED_OK
+ scan_end = *(ushf*)(scan+best_len-1);
+#else
+ scan_end1 = scan[best_len-1];
+ scan_end = scan[best_len];
+#endif
+ }
+ } while ((cur_match = prev[cur_match & wmask]) > limit
+ && --chain_length != 0);
+
+ if ((uInt)best_len <= s->lookahead) return (uInt)best_len;
+ return s->lookahead;
+}
+#endif /* ASMV */
+
+#else /* FASTEST */
+
+/* ---------------------------------------------------------------------------
+ * Optimized version for FASTEST only
+ */
+local uInt longest_match(s, cur_match)
+ deflate_state *s;
+ IPos cur_match; /* current match */
+{
+ register Bytef *scan = s->window + s->strstart; /* current string */
+ register Bytef *match; /* matched string */
+ register int len; /* length of current match */
+ register Bytef *strend = s->window + s->strstart + MAX_MATCH;
+
+ /* The code is optimized for HASH_BITS >= 8 and MAX_MATCH-2 multiple of 16.
+ * It is easy to get rid of this optimization if necessary.
+ */
+ Assert(s->hash_bits >= 8 && MAX_MATCH == 258, "Code too clever");
+
+ Assert((ulg)s->strstart <= s->window_size-MIN_LOOKAHEAD, "need lookahead");
+
+ Assert(cur_match < s->strstart, "no future");
+
+ match = s->window + cur_match;
+
+ /* Return failure if the match length is less than 2:
+ */
+ if (match[0] != scan[0] || match[1] != scan[1]) return MIN_MATCH-1;
+
+ /* The check at best_len-1 can be removed because it will be made
+ * again later. (This heuristic is not always a win.)
+ * It is not necessary to compare scan[2] and match[2] since they
+ * are always equal when the other bytes match, given that
+ * the hash keys are equal and that HASH_BITS >= 8.
+ */
+ scan += 2, match += 2;
+ Assert(*scan == *match, "match[2]?");
+
+ /* We check for insufficient lookahead only every 8th comparison;
+ * the 256th check will be made at strstart+258.
+ */
+ do {
+ } while (*++scan == *++match && *++scan == *++match &&
+ *++scan == *++match && *++scan == *++match &&
+ *++scan == *++match && *++scan == *++match &&
+ *++scan == *++match && *++scan == *++match &&
+ scan < strend);
+
+ Assert(scan <= s->window+(unsigned)(s->window_size-1), "wild scan");
+
+ len = MAX_MATCH - (int)(strend - scan);
+
+ if (len < MIN_MATCH) return MIN_MATCH - 1;
+
+ s->match_start = cur_match;
+ return (uInt)len <= s->lookahead ? (uInt)len : s->lookahead;
+}
+
+#endif /* FASTEST */
+
+#ifdef DEBUG
+/* ===========================================================================
+ * Check that the match at match_start is indeed a match.
+ */
+local void check_match(s, start, match, length)
+ deflate_state *s;
+ IPos start, match;
+ int length;
+{
+ /* check that the match is indeed a match */
+ if (zmemcmp(s->window + match,
+ s->window + start, length) != EQUAL) {
+ fprintf(stderr, " start %u, match %u, length %d\n",
+ start, match, length);
+ do {
+ fprintf(stderr, "%c%c", s->window[match++], s->window[start++]);
+ } while (--length != 0);
+ z_error("invalid match");
+ }
+ if (z_verbose > 1) {
+ fprintf(stderr,"\\[%d,%d]", start-match, length);
+ do { putc(s->window[start++], stderr); } while (--length != 0);
+ }
+}
+#else
+# define check_match(s, start, match, length)
+#endif /* DEBUG */
+
+/* ===========================================================================
+ * Fill the window when the lookahead becomes insufficient.
+ * Updates strstart and lookahead.
+ *
+ * IN assertion: lookahead < MIN_LOOKAHEAD
+ * OUT assertions: strstart <= window_size-MIN_LOOKAHEAD
+ * At least one byte has been read, or avail_in == 0; reads are
+ * performed for at least two bytes (required for the zip translate_eol
+ * option -- not supported here).
+ */
+local void fill_window(deflate_state *s)
+{
+ register unsigned n, m;
+ register Posf *p;
+ unsigned more; /* Amount of free space at the end of the window. */
+ uInt wsize = s->w_size;
+
+ Assert(s->lookahead < MIN_LOOKAHEAD, "already enough lookahead");
+
+ do {
+ more = (unsigned)(s->window_size -(ulg)s->lookahead -(ulg)s->strstart);
+
+ /* Deal with !@#$% 64K limit: */
+ if (sizeof(int) <= 2) {
+ if (more == 0 && s->strstart == 0 && s->lookahead == 0) {
+ more = wsize;
+
+ } else if (more == (unsigned)(-1)) {
+ /* Very unlikely, but possible on 16 bit machine if
+ * strstart == 0 && lookahead == 1 (input done a byte at time)
+ */
+ more--;
+ }
+ }
+
+ /* If the window is almost full and there is insufficient lookahead,
+ * move the upper half to the lower one to make room in the upper half.
+ */
+ if (s->strstart >= wsize+MAX_DIST(s)) {
+
+ zmemcpy(s->window, s->window+wsize, (unsigned)wsize);
+ s->match_start -= wsize;
+ s->strstart -= wsize; /* we now have strstart >= MAX_DIST */
+ s->block_start -= (long) wsize;
+
+ /* Slide the hash table (could be avoided with 32 bit values
+ at the expense of memory usage). We slide even when level == 0
+ to keep the hash table consistent if we switch back to level > 0
+ later. (Using level 0 permanently is not an optimal usage of
+ zlib, so we don't care about this pathological case.)
+ */
+ n = s->hash_size;
+ p = &s->head[n];
+ do {
+ m = *--p;
+ *p = (Pos)(m >= wsize ? m-wsize : NIL);
+ } while (--n);
+
+ n = wsize;
+#ifndef FASTEST
+ p = &s->prev[n];
+ do {
+ m = *--p;
+ *p = (Pos)(m >= wsize ? m-wsize : NIL);
+ /* If n is not on any hash chain, prev[n] is garbage but
+ * its value will never be used.
+ */
+ } while (--n);
+#endif
+ more += wsize;
+ }
+ if (s->strm->avail_in == 0) break;
+
+ /* If there was no sliding:
+ * strstart <= WSIZE+MAX_DIST-1 && lookahead <= MIN_LOOKAHEAD - 1 &&
+ * more == window_size - lookahead - strstart
+ * => more >= window_size - (MIN_LOOKAHEAD-1 + WSIZE + MAX_DIST-1)
+ * => more >= window_size - 2*WSIZE + 2
+ * In the BIG_MEM or MMAP case (not yet supported),
+ * window_size == input_size + MIN_LOOKAHEAD &&
+ * strstart + s->lookahead <= input_size => more >= MIN_LOOKAHEAD.
+ * Otherwise, window_size == 2*WSIZE so more >= 2.
+ * If there was sliding, more >= WSIZE. So in all cases, more >= 2.
+ */
+ Assert(more >= 2, "more < 2");
+
+ n = read_buf(s->strm, s->window + s->strstart + s->lookahead, more);
+ s->lookahead += n;
+
+ /* Initialize the hash value now that we have some input: */
+ if (s->lookahead + s->insert >= MIN_MATCH) {
+ uInt str = s->strstart - s->insert;
+ s->ins_h = s->window[str];
+ UPDATE_HASH(s, s->ins_h, s->window[str + 1]);
+#if MIN_MATCH != 3
+ Call UPDATE_HASH() MIN_MATCH-3 more times
+#endif
+ while (s->insert) {
+ UPDATE_HASH(s, s->ins_h, s->window[str + MIN_MATCH-1]);
+#ifndef FASTEST
+ s->prev[str & s->w_mask] = s->head[s->ins_h];
+#endif
+ s->head[s->ins_h] = (Pos)str;
+ str++;
+ s->insert--;
+ if (s->lookahead + s->insert < MIN_MATCH)
+ break;
+ }
+ }
+ /* If the whole input has less than MIN_MATCH bytes, ins_h is garbage,
+ * but this is not important since only literal bytes will be emitted.
+ */
+
+ } while (s->lookahead < MIN_LOOKAHEAD && s->strm->avail_in != 0);
+
+ /* If the WIN_INIT bytes after the end of the current data have never been
+ * written, then zero those bytes in order to avoid memory check reports of
+ * the use of uninitialized (or uninitialised as Julian writes) bytes by
+ * the longest match routines. Update the high water mark for the next
+ * time through here. WIN_INIT is set to MAX_MATCH since the longest match
+ * routines allow scanning to strstart + MAX_MATCH, ignoring lookahead.
+ */
+ if (s->high_water < s->window_size) {
+ ulg curr = s->strstart + (ulg)(s->lookahead);
+ ulg init;
+
+ if (s->high_water < curr) {
+ /* Previous high water mark below current data -- zero WIN_INIT
+ * bytes or up to end of window, whichever is less.
+ */
+ init = s->window_size - curr;
+ if (init > WIN_INIT)
+ init = WIN_INIT;
+ zmemzero(s->window + curr, (unsigned)init);
+ s->high_water = curr + init;
+ }
+ else if (s->high_water < (ulg)curr + WIN_INIT) {
+ /* High water mark at or above current data, but below current data
+ * plus WIN_INIT -- zero out to current data plus WIN_INIT, or up
+ * to end of window, whichever is less.
+ */
+ init = (ulg)curr + WIN_INIT - s->high_water;
+ if (init > s->window_size - s->high_water)
+ init = s->window_size - s->high_water;
+ zmemzero(s->window + s->high_water, (unsigned)init);
+ s->high_water += init;
+ }
+ }
+
+ Assert((ulg)s->strstart <= s->window_size - MIN_LOOKAHEAD,
+ "not enough room for search");
+}
+
+/* ===========================================================================
+ * Flush the current block, with given end-of-file flag.
+ * IN assertion: strstart is set to the end of the current match.
+ */
+#define FLUSH_BLOCK_ONLY(s, last) { \
+ _tr_flush_block(s, (s->block_start >= 0L ? \
+ (charf *)&s->window[(unsigned)s->block_start] : \
+ (charf *)Z_NULL), \
+ (ulg)((long)s->strstart - s->block_start), \
+ (last)); \
+ s->block_start = s->strstart; \
+ flush_pending(s->strm); \
+ Tracev((stderr,"[FLUSH]")); \
+}
+
+/* Same but force premature exit if necessary. */
+#define FLUSH_BLOCK(s, last) { \
+ FLUSH_BLOCK_ONLY(s, last); \
+ if (s->strm->avail_out == 0) return (last) ? finish_started : need_more; \
+}
+
+/* ===========================================================================
+ * Copy without compression as much as possible from the input stream, return
+ * the current block state.
+ * This function does not insert new strings in the dictionary since
+ * uncompressible data is probably not useful. This function is used
+ * only for the level=0 compression option.
+ * NOTE: this function should be optimized to avoid extra copying from
+ * window to pending_buf.
+ */
+local block_state deflate_stored(deflate_state *s, int flush)
+{
+ /* Stored blocks are limited to 0xffff bytes, pending_buf is limited
+ * to pending_buf_size, and each stored block has a 5 byte header:
+ */
+ ulg max_block_size = 0xffff;
+ ulg max_start;
+
+ if (max_block_size > s->pending_buf_size - 5) {
+ max_block_size = s->pending_buf_size - 5;
+ }
+
+ /* Copy as much as possible from input to output: */
+ for (;;) {
+ /* Fill the window as much as possible: */
+ if (s->lookahead <= 1) {
+
+ Assert(s->strstart < s->w_size+MAX_DIST(s) ||
+ s->block_start >= (long)s->w_size, "slide too late");
+
+ fill_window(s);
+ if (s->lookahead == 0 && flush == Z_NO_FLUSH) return need_more;
+
+ if (s->lookahead == 0) break; /* flush the current block */
+ }
+ Assert(s->block_start >= 0L, "block gone");
+
+ s->strstart += s->lookahead;
+ s->lookahead = 0;
+
+ /* Emit a stored block if pending_buf will be full: */
+ max_start = s->block_start + max_block_size;
+ if (s->strstart == 0 || (ulg)s->strstart >= max_start) {
+ /* strstart == 0 is possible when wraparound on 16-bit machine */
+ s->lookahead = (uInt)(s->strstart - max_start);
+ s->strstart = (uInt)max_start;
+ FLUSH_BLOCK(s, 0);
+ }
+ /* Flush if we may have to slide, otherwise block_start may become
+ * negative and the data will be gone:
+ */
+ if (s->strstart - (uInt)s->block_start >= MAX_DIST(s)) {
+ FLUSH_BLOCK(s, 0);
+ }
+ }
+ s->insert = 0;
+ if (flush == Z_FINISH) {
+ FLUSH_BLOCK(s, 1);
+ return finish_done;
+ }
+ if ((long)s->strstart > s->block_start)
+ FLUSH_BLOCK(s, 0);
+ return block_done;
+}
+
+/* ===========================================================================
+ * Compress as much as possible from the input stream, return the current
+ * block state.
+ * This function does not perform lazy evaluation of matches and inserts
+ * new strings in the dictionary only for unmatched strings or for short
+ * matches. It is used only for the fast compression options.
+ */
+local block_state deflate_fast(deflate_state *s, int flush)
+{
+ IPos hash_head; /* head of the hash chain */
+ int bflush; /* set if current block must be flushed */
+
+ for (;;) {
+ /* Make sure that we always have enough lookahead, except
+ * at the end of the input file. We need MAX_MATCH bytes
+ * for the next match, plus MIN_MATCH bytes to insert the
+ * string following the next match.
+ */
+ if (s->lookahead < MIN_LOOKAHEAD) {
+ fill_window(s);
+ if (s->lookahead < MIN_LOOKAHEAD && flush == Z_NO_FLUSH) {
+ return need_more;
+ }
+ if (s->lookahead == 0) break; /* flush the current block */
+ }
+
+ /* Insert the string window[strstart .. strstart+2] in the
+ * dictionary, and set hash_head to the head of the hash chain:
+ */
+ hash_head = NIL;
+ if (s->lookahead >= MIN_MATCH) {
+ INSERT_STRING(s, s->strstart, hash_head);
+ }
+
+ /* Find the longest match, discarding those <= prev_length.
+ * At this point we have always match_length < MIN_MATCH
+ */
+ if (hash_head != NIL && s->strstart - hash_head <= MAX_DIST(s)) {
+ /* To simplify the code, we prevent matches with the string
+ * of window index 0 (in particular we have to avoid a match
+ * of the string with itself at the start of the input file).
+ */
+ s->match_length = longest_match (s, hash_head);
+ /* longest_match() sets match_start */
+ }
+ if (s->match_length >= MIN_MATCH) {
+ check_match(s, s->strstart, s->match_start, s->match_length);
+
+ _tr_tally_dist(s, s->strstart - s->match_start,
+ s->match_length - MIN_MATCH, bflush);
+
+ s->lookahead -= s->match_length;
+
+ /* Insert new strings in the hash table only if the match length
+ * is not too large. This saves time but degrades compression.
+ */
+#ifndef FASTEST
+ if (s->match_length <= s->max_insert_length &&
+ s->lookahead >= MIN_MATCH) {
+ s->match_length--; /* string at strstart already in table */
+ do {
+ s->strstart++;
+ INSERT_STRING(s, s->strstart, hash_head);
+ /* strstart never exceeds WSIZE-MAX_MATCH, so there are
+ * always MIN_MATCH bytes ahead.
+ */
+ } while (--s->match_length != 0);
+ s->strstart++;
+ } else
+#endif
+ {
+ s->strstart += s->match_length;
+ s->match_length = 0;
+ s->ins_h = s->window[s->strstart];
+ UPDATE_HASH(s, s->ins_h, s->window[s->strstart+1]);
+#if MIN_MATCH != 3
+ Call UPDATE_HASH() MIN_MATCH-3 more times
+#endif
+ /* If lookahead < MIN_MATCH, ins_h is garbage, but it does not
+ * matter since it will be recomputed at next deflate call.
+ */
+ }
+ } else {
+ /* No match, output a literal byte */
+ Tracevv((stderr,"%c", s->window[s->strstart]));
+ _tr_tally_lit (s, s->window[s->strstart], bflush);
+ s->lookahead--;
+ s->strstart++;
+ }
+ if (bflush) FLUSH_BLOCK(s, 0);
+ }
+ s->insert = s->strstart < MIN_MATCH-1 ? s->strstart : MIN_MATCH-1;
+ if (flush == Z_FINISH) {
+ FLUSH_BLOCK(s, 1);
+ return finish_done;
+ }
+ if (s->last_lit)
+ FLUSH_BLOCK(s, 0);
+ return block_done;
+}
+
+#ifndef FASTEST
+/* ===========================================================================
+ * Same as above, but achieves better compression. We use a lazy
+ * evaluation for matches: a match is finally adopted only if there is
+ * no better match at the next window position.
+ */
+local block_state deflate_slow(deflate_state *s, int flush)
+{
+ IPos hash_head; /* head of hash chain */
+ int bflush; /* set if current block must be flushed */
+
+ /* Process the input block. */
+ for (;;) {
+ /* Make sure that we always have enough lookahead, except
+ * at the end of the input file. We need MAX_MATCH bytes
+ * for the next match, plus MIN_MATCH bytes to insert the
+ * string following the next match.
+ */
+ if (s->lookahead < MIN_LOOKAHEAD) {
+ fill_window(s);
+ if (s->lookahead < MIN_LOOKAHEAD && flush == Z_NO_FLUSH) {
+ return need_more;
+ }
+ if (s->lookahead == 0) break; /* flush the current block */
+ }
+
+ /* Insert the string window[strstart .. strstart+2] in the
+ * dictionary, and set hash_head to the head of the hash chain:
+ */
+ hash_head = NIL;
+ if (s->lookahead >= MIN_MATCH) {
+ INSERT_STRING(s, s->strstart, hash_head);
+ }
+
+ /* Find the longest match, discarding those <= prev_length.
+ */
+ s->prev_length = s->match_length, s->prev_match = s->match_start;
+ s->match_length = MIN_MATCH-1;
+
+ if (hash_head != NIL && s->prev_length < s->max_lazy_match &&
+ s->strstart - hash_head <= MAX_DIST(s)) {
+ /* To simplify the code, we prevent matches with the string
+ * of window index 0 (in particular we have to avoid a match
+ * of the string with itself at the start of the input file).
+ */
+ s->match_length = longest_match (s, hash_head);
+ /* longest_match() sets match_start */
+
+ if (s->match_length <= 5 && (s->strategy == Z_FILTERED
+#if TOO_FAR <= 32767
+ || (s->match_length == MIN_MATCH &&
+ s->strstart - s->match_start > TOO_FAR)
+#endif
+ )) {
+
+ /* If prev_match is also MIN_MATCH, match_start is garbage
+ * but we will ignore the current match anyway.
+ */
+ s->match_length = MIN_MATCH-1;
+ }
+ }
+ /* If there was a match at the previous step and the current
+ * match is not better, output the previous match:
+ */
+ if (s->prev_length >= MIN_MATCH && s->match_length <= s->prev_length) {
+ uInt max_insert = s->strstart + s->lookahead - MIN_MATCH;
+ /* Do not insert strings in hash table beyond this. */
+
+ check_match(s, s->strstart-1, s->prev_match, s->prev_length);
+
+ _tr_tally_dist(s, s->strstart -1 - s->prev_match,
+ s->prev_length - MIN_MATCH, bflush);
+
+ /* Insert in hash table all strings up to the end of the match.
+ * strstart-1 and strstart are already inserted. If there is not
+ * enough lookahead, the last two strings are not inserted in
+ * the hash table.
+ */
+ s->lookahead -= s->prev_length-1;
+ s->prev_length -= 2;
+ do {
+ if (++s->strstart <= max_insert) {
+ INSERT_STRING(s, s->strstart, hash_head);
+ }
+ } while (--s->prev_length != 0);
+ s->match_available = 0;
+ s->match_length = MIN_MATCH-1;
+ s->strstart++;
+
+ if (bflush) FLUSH_BLOCK(s, 0);
+
+ } else if (s->match_available) {
+ /* If there was no match at the previous position, output a
+ * single literal. If there was a match but the current match
+ * is longer, truncate the previous match to a single literal.
+ */
+ Tracevv((stderr,"%c", s->window[s->strstart-1]));
+ _tr_tally_lit(s, s->window[s->strstart-1], bflush);
+ if (bflush) {
+ FLUSH_BLOCK_ONLY(s, 0);
+ }
+ s->strstart++;
+ s->lookahead--;
+ if (s->strm->avail_out == 0) return need_more;
+ } else {
+ /* There is no previous match to compare with, wait for
+ * the next step to decide.
+ */
+ s->match_available = 1;
+ s->strstart++;
+ s->lookahead--;
+ }
+ }
+ Assert (flush != Z_NO_FLUSH, "no flush?");
+ if (s->match_available) {
+ Tracevv((stderr,"%c", s->window[s->strstart-1]));
+ _tr_tally_lit(s, s->window[s->strstart-1], bflush);
+ s->match_available = 0;
+ }
+ s->insert = s->strstart < MIN_MATCH-1 ? s->strstart : MIN_MATCH-1;
+ if (flush == Z_FINISH) {
+ FLUSH_BLOCK(s, 1);
+ return finish_done;
+ }
+ if (s->last_lit)
+ FLUSH_BLOCK(s, 0);
+ return block_done;
+}
+#endif /* FASTEST */
+
+/* ===========================================================================
+ * For Z_RLE, simply look for runs of bytes, generate matches only of distance
+ * one. Do not maintain a hash table. (It will be regenerated if this run of
+ * deflate switches away from Z_RLE.)
+ */
+local block_state deflate_rle(deflate_state *s, int flush)
+{
+ int bflush; /* set if current block must be flushed */
+ uInt prev; /* byte at distance one to match */
+ Bytef *scan, *strend; /* scan goes up to strend for length of run */
+
+ for (;;) {
+ /* Make sure that we always have enough lookahead, except
+ * at the end of the input file. We need MAX_MATCH bytes
+ * for the longest run, plus one for the unrolled loop.
+ */
+ if (s->lookahead <= MAX_MATCH) {
+ fill_window(s);
+ if (s->lookahead <= MAX_MATCH && flush == Z_NO_FLUSH) {
+ return need_more;
+ }
+ if (s->lookahead == 0) break; /* flush the current block */
+ }
+
+ /* See how many times the previous byte repeats */
+ s->match_length = 0;
+ if (s->lookahead >= MIN_MATCH && s->strstart > 0) {
+ scan = s->window + s->strstart - 1;
+ prev = *scan;
+ if (prev == *++scan && prev == *++scan && prev == *++scan) {
+ strend = s->window + s->strstart + MAX_MATCH;
+ do {
+ } while (prev == *++scan && prev == *++scan &&
+ prev == *++scan && prev == *++scan &&
+ prev == *++scan && prev == *++scan &&
+ prev == *++scan && prev == *++scan &&
+ scan < strend);
+ s->match_length = MAX_MATCH - (int)(strend - scan);
+ if (s->match_length > s->lookahead)
+ s->match_length = s->lookahead;
+ }
+ Assert(scan <= s->window+(uInt)(s->window_size-1), "wild scan");
+ }
+
+ /* Emit match if have run of MIN_MATCH or longer, else emit literal */
+ if (s->match_length >= MIN_MATCH) {
+ check_match(s, s->strstart, s->strstart - 1, s->match_length);
+
+ _tr_tally_dist(s, 1, s->match_length - MIN_MATCH, bflush);
+
+ s->lookahead -= s->match_length;
+ s->strstart += s->match_length;
+ s->match_length = 0;
+ } else {
+ /* No match, output a literal byte */
+ Tracevv((stderr,"%c", s->window[s->strstart]));
+ _tr_tally_lit (s, s->window[s->strstart], bflush);
+ s->lookahead--;
+ s->strstart++;
+ }
+ if (bflush) FLUSH_BLOCK(s, 0);
+ }
+ s->insert = 0;
+ if (flush == Z_FINISH) {
+ FLUSH_BLOCK(s, 1);
+ return finish_done;
+ }
+ if (s->last_lit)
+ FLUSH_BLOCK(s, 0);
+ return block_done;
+}
+
+/* ===========================================================================
+ * For Z_HUFFMAN_ONLY, do not look for matches. Do not maintain a hash table.
+ * (It will be regenerated if this run of deflate switches away from Huffman.)
+ */
+local block_state deflate_huff(deflate_state *s, int flush)
+{
+ int bflush; /* set if current block must be flushed */
+
+ for (;;) {
+ /* Make sure that we have a literal to write. */
+ if (s->lookahead == 0) {
+ fill_window(s);
+ if (s->lookahead == 0) {
+ if (flush == Z_NO_FLUSH)
+ return need_more;
+ break; /* flush the current block */
+ }
+ }
+
+ /* Output a literal byte */
+ s->match_length = 0;
+ Tracevv((stderr,"%c", s->window[s->strstart]));
+ _tr_tally_lit (s, s->window[s->strstart], bflush);
+ s->lookahead--;
+ s->strstart++;
+ if (bflush) FLUSH_BLOCK(s, 0);
+ }
+ s->insert = 0;
+ if (flush == Z_FINISH) {
+ FLUSH_BLOCK(s, 1);
+ return finish_done;
+ }
+ if (s->last_lit)
+ FLUSH_BLOCK(s, 0);
+ return block_done;
+}
--- /dev/null
+/* deflate.h -- internal compression state
+ * Copyright (C) 1995-2012 Jean-loup Gailly
+ * For conditions of distribution and use, see copyright notice in zlib.h
+ */
+
+/* WARNING: this file should *not* be used by applications. It is
+ part of the implementation of the compression library and is
+ subject to change. Applications should only use zlib.h.
+ */
+
+/* @(#) $Id$ */
+
+#ifndef DEFLATE_H
+#define DEFLATE_H
+
+#include "zutil.h"
+
+/* define NO_GZIP when compiling if you want to disable gzip header and
+ trailer creation by deflate(). NO_GZIP would be used to avoid linking in
+ the crc code when it is not needed. For shared libraries, gzip encoding
+ should be left enabled. */
+#ifndef NO_GZIP
+# define GZIP
+#endif
+
+/* ===========================================================================
+ * Internal compression state.
+ */
+
+#define LENGTH_CODES 29
+/* number of length codes, not counting the special END_BLOCK code */
+
+#define LITERALS 256
+/* number of literal bytes 0..255 */
+
+#define L_CODES (LITERALS+1+LENGTH_CODES)
+/* number of Literal or Length codes, including the END_BLOCK code */
+
+#define D_CODES 30
+/* number of distance codes */
+
+#define BL_CODES 19
+/* number of codes used to transfer the bit lengths */
+
+#define HEAP_SIZE (2*L_CODES+1)
+/* maximum heap size */
+
+#define MAX_BITS 15
+/* All codes must not exceed MAX_BITS bits */
+
+#define Buf_size 16
+/* size of bit buffer in bi_buf */
+
+#define INIT_STATE 42
+#define EXTRA_STATE 69
+#define NAME_STATE 73
+#define COMMENT_STATE 91
+#define HCRC_STATE 103
+#define BUSY_STATE 113
+#define FINISH_STATE 666
+/* Stream status */
+
+
+/* Data structure describing a single value and its code string. */
+typedef struct ct_data_s {
+ union {
+ ush freq; /* frequency count */
+ ush code; /* bit string */
+ } fc;
+ union {
+ ush dad; /* father node in Huffman tree */
+ ush len; /* length of bit string */
+ } dl;
+} FAR ct_data;
+
+#define Freq fc.freq
+#define Code fc.code
+#define Dad dl.dad
+#define Len dl.len
+
+typedef struct static_tree_desc_s static_tree_desc;
+
+typedef struct tree_desc_s {
+ ct_data *dyn_tree; /* the dynamic tree */
+ int max_code; /* largest code with non zero frequency */
+ static_tree_desc *stat_desc; /* the corresponding static tree */
+} FAR tree_desc;
+
+typedef ush Pos;
+typedef Pos FAR Posf;
+typedef unsigned IPos;
+
+/* A Pos is an index in the character window. We use short instead of int to
+ * save space in the various tables. IPos is used only for parameter passing.
+ */
+
+typedef struct internal_state_deflate {
+ z_streamp strm; /* pointer back to this zlib stream */
+ int status; /* as the name implies */
+ Bytef *pending_buf; /* output still pending */
+ ulg pending_buf_size; /* size of pending_buf */
+ Bytef *pending_out; /* next pending byte to output to the stream */
+ uInt pending; /* nb of bytes in the pending buffer */
+ int wrap; /* bit 0 true for zlib, bit 1 true for gzip */
+ gz_headerp gzhead; /* gzip header information to write */
+ uInt gzindex; /* where in extra, name, or comment */
+ Byte method; /* can only be DEFLATED */
+ int last_flush; /* value of flush param for previous deflate call */
+
+ /* used by deflate.c: */
+
+ uInt w_size; /* LZ77 window size (32K by default) */
+ uInt w_bits; /* log2(w_size) (8..16) */
+ uInt w_mask; /* w_size - 1 */
+
+ Bytef *window;
+ /* Sliding window. Input bytes are read into the second half of the window,
+ * and move to the first half later to keep a dictionary of at least wSize
+ * bytes. With this organization, matches are limited to a distance of
+ * wSize-MAX_MATCH bytes, but this ensures that IO is always
+ * performed with a length multiple of the block size. Also, it limits
+ * the window size to 64K, which is quite useful on MSDOS.
+ * To do: use the user input buffer as sliding window.
+ */
+
+ ulg window_size;
+ /* Actual size of window: 2*wSize, except when the user input buffer
+ * is directly used as sliding window.
+ */
+
+ Posf *prev;
+ /* Link to older string with same hash index. To limit the size of this
+ * array to 64K, this link is maintained only for the last 32K strings.
+ * An index in this array is thus a window index modulo 32K.
+ */
+
+ Posf *head; /* Heads of the hash chains or NIL. */
+
+ uInt ins_h; /* hash index of string to be inserted */
+ uInt hash_size; /* number of elements in hash table */
+ uInt hash_bits; /* log2(hash_size) */
+ uInt hash_mask; /* hash_size-1 */
+
+ uInt hash_shift;
+ /* Number of bits by which ins_h must be shifted at each input
+ * step. It must be such that after MIN_MATCH steps, the oldest
+ * byte no longer takes part in the hash key, that is:
+ * hash_shift * MIN_MATCH >= hash_bits
+ */
+
+ long block_start;
+ /* Window position at the beginning of the current output block. Gets
+ * negative when the window is moved backwards.
+ */
+
+ uInt match_length; /* length of best match */
+ IPos prev_match; /* previous match */
+ int match_available; /* set if previous match exists */
+ uInt strstart; /* start of string to insert */
+ uInt match_start; /* start of matching string */
+ uInt lookahead; /* number of valid bytes ahead in window */
+
+ uInt prev_length;
+ /* Length of the best match at previous step. Matches not greater than this
+ * are discarded. This is used in the lazy match evaluation.
+ */
+
+ uInt max_chain_length;
+ /* To speed up deflation, hash chains are never searched beyond this
+ * length. A higher limit improves compression ratio but degrades the
+ * speed.
+ */
+
+ uInt max_lazy_match;
+ /* Attempt to find a better match only when the current match is strictly
+ * smaller than this value. This mechanism is used only for compression
+ * levels >= 4.
+ */
+# define max_insert_length max_lazy_match
+ /* Insert new strings in the hash table only if the match length is not
+ * greater than this length. This saves time but degrades compression.
+ * max_insert_length is used only for compression levels <= 3.
+ */
+
+ int level; /* compression level (1..9) */
+ int strategy; /* favor or force Huffman coding*/
+
+ uInt good_match;
+ /* Use a faster search when the previous match is longer than this */
+
+ int nice_match; /* Stop searching when current match exceeds this */
+
+ /* used by trees.c: */
+ /* Didn't use ct_data typedef below to suppress compiler warning */
+ struct ct_data_s dyn_ltree[HEAP_SIZE]; /* literal and length tree */
+ struct ct_data_s dyn_dtree[2*D_CODES+1]; /* distance tree */
+ struct ct_data_s bl_tree[2*BL_CODES+1]; /* Huffman tree for bit lengths */
+
+ struct tree_desc_s l_desc; /* desc. for literal tree */
+ struct tree_desc_s d_desc; /* desc. for distance tree */
+ struct tree_desc_s bl_desc; /* desc. for bit length tree */
+
+ ush bl_count[MAX_BITS+1];
+ /* number of codes at each bit length for an optimal tree */
+
+ int heap[2*L_CODES+1]; /* heap used to build the Huffman trees */
+ int heap_len; /* number of elements in the heap */
+ int heap_max; /* element of largest frequency */
+ /* The sons of heap[n] are heap[2*n] and heap[2*n+1]. heap[0] is not used.
+ * The same heap array is used to build all trees.
+ */
+
+ uch depth[2*L_CODES+1];
+ /* Depth of each subtree used as tie breaker for trees of equal frequency
+ */
+
+ uchf *l_buf; /* buffer for literals or lengths */
+
+ uInt lit_bufsize;
+ /* Size of match buffer for literals/lengths. There are 4 reasons for
+ * limiting lit_bufsize to 64K:
+ * - frequencies can be kept in 16 bit counters
+ * - if compression is not successful for the first block, all input
+ * data is still in the window so we can still emit a stored block even
+ * when input comes from standard input. (This can also be done for
+ * all blocks if lit_bufsize is not greater than 32K.)
+ * - if compression is not successful for a file smaller than 64K, we can
+ * even emit a stored file instead of a stored block (saving 5 bytes).
+ * This is applicable only for zip (not gzip or zlib).
+ * - creating new Huffman trees less frequently may not provide fast
+ * adaptation to changes in the input data statistics. (Take for
+ * example a binary file with poorly compressible code followed by
+ * a highly compressible string table.) Smaller buffer sizes give
+ * fast adaptation but have of course the overhead of transmitting
+ * trees more frequently.
+ * - I can't count above 4
+ */
+
+ uInt last_lit; /* running index in l_buf */
+
+ ushf *d_buf;
+ /* Buffer for distances. To simplify the code, d_buf and l_buf have
+ * the same number of elements. To use different lengths, an extra flag
+ * array would be necessary.
+ */
+
+ ulg opt_len; /* bit length of current block with optimal trees */
+ ulg static_len; /* bit length of current block with static trees */
+ uInt matches; /* number of string matches in current block */
+ uInt insert; /* bytes at end of window left to insert */
+
+#ifdef DEBUG
+ ulg compressed_len; /* total bit length of compressed file mod 2^32 */
+ ulg bits_sent; /* bit length of compressed data sent mod 2^32 */
+#endif
+
+ ush bi_buf;
+ /* Output buffer. bits are inserted starting at the bottom (least
+ * significant bits).
+ */
+ int bi_valid;
+ /* Number of valid bits in bi_buf. All bits above the last valid bit
+ * are always zero.
+ */
+
+ ulg high_water;
+ /* High water mark offset in window for initialized bytes -- bytes above
+ * this are set to zero in order to avoid memory check warnings when
+ * longest match routines access bytes past the input. This is then
+ * updated to the new high water mark.
+ */
+
+} deflate_state;
+
+/* Output a byte on the stream.
+ * IN assertion: there is enough room in pending_buf.
+ */
+#define put_byte(s, c) {s->pending_buf[s->pending++] = (c);}
+
+
+#define MIN_LOOKAHEAD (MAX_MATCH+MIN_MATCH+1)
+/* Minimum amount of lookahead, except at the end of the input file.
+ * See deflate.c for comments about the MIN_MATCH+1.
+ */
+
+#define MAX_DIST(s) ((s)->w_size-MIN_LOOKAHEAD)
+/* In order to simplify the code, particularly on 16 bit machines, match
+ * distances are limited to MAX_DIST instead of WSIZE.
+ */
+
+#define WIN_INIT MAX_MATCH
+/* Number of bytes after end of data in window to initialize in order to avoid
+ memory checker errors from longest match routines */
+
+ /* in trees.c */
+void ZLIB_INTERNAL _tr_init OF((deflate_state *s));
+int ZLIB_INTERNAL _tr_tally OF((deflate_state *s, unsigned dist, unsigned lc));
+void ZLIB_INTERNAL _tr_flush_block OF((deflate_state *s, charf *buf,
+ ulg stored_len, int last));
+void ZLIB_INTERNAL _tr_flush_bits OF((deflate_state *s));
+void ZLIB_INTERNAL _tr_align OF((deflate_state *s));
+void ZLIB_INTERNAL _tr_stored_block OF((deflate_state *s, charf *buf,
+ ulg stored_len, int last));
+
+#define d_code(dist) \
+ ((dist) < 256 ? _dist_code[dist] : _dist_code[256+((dist)>>7)])
+/* Mapping from a distance to a distance code. dist is the distance - 1 and
+ * must not have side effects. _dist_code[256] and _dist_code[257] are never
+ * used.
+ */
+
+#ifndef DEBUG
+/* Inline versions of _tr_tally for speed: */
+
+#if defined(GEN_TREES_H) || !defined(STDC)
+ extern uch ZLIB_INTERNAL _length_code[];
+ extern uch ZLIB_INTERNAL _dist_code[];
+#else
+ extern const uch ZLIB_INTERNAL _length_code[];
+ extern const uch ZLIB_INTERNAL _dist_code[];
+#endif
+
+# define _tr_tally_lit(s, c, flush) \
+ { uch cc = (c); \
+ s->d_buf[s->last_lit] = 0; \
+ s->l_buf[s->last_lit++] = cc; \
+ s->dyn_ltree[cc].Freq++; \
+ flush = (s->last_lit == s->lit_bufsize-1); \
+ }
+# define _tr_tally_dist(s, distance, length, flush) \
+ { uch len = (length); \
+ ush dist = (distance); \
+ s->d_buf[s->last_lit] = dist; \
+ s->l_buf[s->last_lit++] = len; \
+ dist--; \
+ s->dyn_ltree[_length_code[len]+LITERALS+1].Freq++; \
+ s->dyn_dtree[d_code(dist)].Freq++; \
+ flush = (s->last_lit == s->lit_bufsize-1); \
+ }
+#else
+# define _tr_tally_lit(s, c, flush) flush = _tr_tally(s, 0, c)
+# define _tr_tally_dist(s, distance, length, flush) \
+ flush = _tr_tally(s, distance, length)
+#endif
+
+#endif /* DEFLATE_H */
--- /dev/null
+/* gzclose.c -- zlib gzclose() function
+ * Copyright (C) 2004, 2010 Mark Adler
+ * For conditions of distribution and use, see copyright notice in zlib.h
+ */
+
+#include "gzguts.h"
+
+extern int gzclose_w(gzFile file);
+extern int gzclose_r(gzFile file);
+
+/* gzclose() is in a separate file so that it is linked in only if it is used.
+ That way the other gzclose functions can be used instead to avoid linking in
+ unneeded compression or decompression routines. */
+int gzclose(gzFile file)
+{
+#ifndef NO_GZCOMPRESS
+ gz_statep state;
+
+ if (file == NULL)
+ return Z_STREAM_ERROR;
+ state = (gz_statep)file;
+
+ return state->mode == GZ_READ ? gzclose_r(file) : gzclose_w(file);
+#else
+ return gzclose_r(file);
+#endif
+}
--- /dev/null
+
+#ifndef _GZFILE_H
+#define _GZFILE_H
+
+struct gzFile_s
+{
+ unsigned have;
+ unsigned char *next;
+ z_off64_t pos;
+};
+
+#endif
--- /dev/null
+/* gzguts.h -- zlib internal header definitions for gz* operations
+ * Copyright (C) 2004, 2005, 2010, 2011, 2012, 2013 Mark Adler
+ * For conditions of distribution and use, see copyright notice in zlib.h
+ */
+
+#ifndef _GZGUTS_H
+#define _GZGUTS_H
+
+#ifdef _LARGEFILE64_SOURCE
+# ifndef _LARGEFILE_SOURCE
+# define _LARGEFILE_SOURCE 1
+# endif
+# ifdef _FILE_OFFSET_BITS
+# undef _FILE_OFFSET_BITS
+# endif
+#endif
+
+#ifdef HAVE_HIDDEN
+# define ZLIB_INTERNAL __attribute__((visibility ("hidden")))
+#else
+# define ZLIB_INTERNAL
+#endif
+
+#include <stdio.h>
+#include "zlib.h"
+#ifdef STDC
+# include <string.h>
+# include <stdlib.h>
+# include <limits.h>
+#endif
+#include <fcntl.h>
+
+#ifdef _WIN32
+# include <stddef.h>
+#else
+# include <unistd.h>
+#endif
+
+#if defined(__TURBOC__) || defined(_MSC_VER) || defined(_WIN32)
+# include <io.h>
+#endif
+
+#ifdef WINAPI_FAMILY
+# define open _open
+# define read _read
+# define write _write
+# define close _close
+#endif
+
+#ifdef NO_DEFLATE /* for compatibility with old definition */
+# define NO_GZCOMPRESS
+#endif
+
+#if defined(STDC99) || (defined(__TURBOC__) && __TURBOC__ >= 0x550)
+# ifndef HAVE_VSNPRINTF
+# define HAVE_VSNPRINTF
+# endif
+#endif
+
+#if defined(__CYGWIN__)
+# ifndef HAVE_VSNPRINTF
+# define HAVE_VSNPRINTF
+# endif
+#endif
+
+#if defined(MSDOS) && defined(__BORLANDC__) && (BORLANDC > 0x410)
+# ifndef HAVE_VSNPRINTF
+# define HAVE_VSNPRINTF
+# endif
+#endif
+
+#ifndef HAVE_VSNPRINTF
+# ifdef MSDOS
+/* vsnprintf may exist on some MS-DOS compilers (DJGPP?),
+ but for now we just assume it doesn't. */
+# define NO_vsnprintf
+# endif
+# ifdef __TURBOC__
+# define NO_vsnprintf
+# endif
+# ifdef WIN32
+/* In Win32, vsnprintf is available as the "non-ANSI" _vsnprintf. */
+# if !defined(vsnprintf) && !defined(NO_vsnprintf)
+# if !defined(_MSC_VER) || ( defined(_MSC_VER) && _MSC_VER < 1500 )
+# define vsnprintf _vsnprintf
+# endif
+# endif
+# endif
+# ifdef __SASC
+# define NO_vsnprintf
+# endif
+# ifdef VMS
+# define NO_vsnprintf
+# endif
+# ifdef __OS400__
+# define NO_vsnprintf
+# endif
+# ifdef __MVS__
+# define NO_vsnprintf
+# endif
+#endif
+
+/* unlike snprintf (which is required in C99, yet still not supported by
+ Microsoft more than a decade later!), _snprintf does not guarantee null
+ termination of the result -- however this is only used in gzlib.c where
+ the result is assured to fit in the space provided */
+#ifdef _MSC_VER
+# define snprintf _snprintf
+#endif
+
+#ifndef local
+# define local static
+#endif
+/* compile with -Dlocal if your debugger can't find static symbols */
+
+/* gz* functions always use library allocation functions */
+#ifndef STDC
+ extern voidp malloc OF((uInt size));
+ extern void free OF((voidpf ptr));
+#endif
+
+/* get errno and strerror definition */
+#if defined UNDER_CE
+# include <windows.h>
+# define zstrerror() gz_strwinerror((DWORD)GetLastError())
+#else
+# ifndef NO_STRERROR
+# include <errno.h>
+# define zstrerror() strerror(errno)
+# else
+# define zstrerror() "stdio error (consult errno)"
+# endif
+#endif
+
+/* provide prototypes for these when building zlib without LFS */
+#if !defined(_LARGEFILE64_SOURCE) || _LFS64_LARGEFILE-0 == 0
+#ifndef z_off64_t
+#define z_off64_t z_off_t
+#endif
+
+ gzFile gzopen64 OF((const char *, const char *));
+ z_off64_t gzseek64 OF((gzFile, z_off64_t, int));
+ z_off64_t gztell64 OF((gzFile));
+ z_off64_t gzoffset64 OF((gzFile));
+#endif
+
+/* default memLevel */
+#if MAX_MEM_LEVEL >= 8
+# define DEF_MEM_LEVEL 8
+#else
+# define DEF_MEM_LEVEL MAX_MEM_LEVEL
+#endif
+
+/* default i/o buffer size -- double this for output when reading (this and
+ twice this must be able to fit in an unsigned type) */
+#define GZBUFSIZE 8192
+
+/* gzip modes, also provide a little integrity check on the passed structure */
+#define GZ_NONE 0
+#define GZ_READ 7247
+#define GZ_WRITE 31153
+#define GZ_APPEND 1 /* mode set to GZ_WRITE after the file is opened */
+
+/* values for gz_state how */
+#define LOOK 0 /* look for a gzip header */
+#define MODE_COPY 1 /* copy input directly */
+#define MODE_GZIP 2 /* decompress a gzip stream */
+
+#include "gzfile.h"
+
+/* internal gzip file state data structure */
+typedef struct {
+ /* exposed contents for gzgetc() macro */
+ struct gzFile_s x; /* "x" for exposed */
+ /* x.have: number of bytes available at x.next */
+ /* x.next: next output data to deliver or write */
+ /* x.pos: current position in uncompressed data */
+ /* used for both reading and writing */
+ int mode; /* see gzip modes above */
+ int fd; /* file descriptor */
+ char *path; /* path or fd for error messages */
+ unsigned size; /* buffer size, zero if not allocated yet */
+ unsigned want; /* requested buffer size, default is GZBUFSIZE */
+ unsigned char *in; /* input buffer */
+ unsigned char *out; /* output buffer (double-sized when reading) */
+ int direct; /* 0 if processing gzip, 1 if transparent */
+ /* just for reading */
+ int how; /* 0: get header, 1: copy, 2: decompress */
+ z_off64_t start; /* where the gzip data started, for rewinding */
+ int eof; /* true if end of input file reached */
+ int past; /* true if read requested past end */
+ /* just for writing */
+ int level; /* compression level */
+ int strategy; /* compression strategy */
+ /* seek request */
+ z_off64_t skip; /* amount to skip (already rewound if backwards) */
+ int seek; /* true if seek request pending */
+ /* error information */
+ int err; /* error code */
+ char *msg; /* error message */
+ /* zlib inflate or deflate stream */
+ z_stream strm; /* stream structure in-place (not a pointer) */
+} gz_state;
+typedef gz_state FAR *gz_statep;
+
+/* shared functions */
+void ZLIB_INTERNAL gz_error OF((gz_statep, int, const char *));
+#if defined UNDER_CE
+char ZLIB_INTERNAL *gz_strwinerror OF((DWORD error));
+#endif
+
+/* GT_OFF(x), where x is an unsigned value, is true if x > maximum z_off64_t
+ value -- needed when comparing unsigned to z_off64_t, which is signed
+ (possible z_off64_t types off_t, off64_t, and long are all signed) */
+#ifdef INT_MAX
+# define GT_OFF(x) (sizeof(int) == sizeof(z_off64_t) && (x) > INT_MAX)
+#else
+unsigned ZLIB_INTERNAL gz_intmax OF((void));
+# define GT_OFF(x) (sizeof(int) == sizeof(z_off64_t) && (x) > gz_intmax())
+#endif
+
+#endif
--- /dev/null
+/* gzlib.c -- zlib functions common to reading and writing gzip files
+ * Copyright (C) 2004, 2010, 2011, 2012, 2013 Mark Adler
+ * For conditions of distribution and use, see copyright notice in zlib.h
+ */
+
+#include "gzguts.h"
+
+#if defined(_WIN32) && !defined(__BORLANDC__)
+# define LSEEK _lseeki64
+#else
+#if defined(_LARGEFILE64_SOURCE) && _LFS64_LARGEFILE-0
+# define LSEEK lseek64
+#else
+# define LSEEK lseek
+#endif
+#endif
+
+/* Forward declarations */
+z_off_t ZEXPORT gzoffset(gzFile file);
+int ZEXPORT gzbuffer(gzFile file, unsigned size);
+
+/* Local functions */
+local void gz_reset OF((gz_statep));
+local gzFile gz_open OF((const void *, int, const char *));
+
+#if defined UNDER_CE
+
+/* Map the Windows error number in ERROR to a locale-dependent error message
+ string and return a pointer to it. Typically, the values for ERROR come
+ from GetLastError.
+
+ The string pointed to shall not be modified by the application, but may be
+ overwritten by a subsequent call to gz_strwinerror
+
+ The gz_strwinerror function does not change the current setting of
+ GetLastError. */
+char ZLIB_INTERNAL *gz_strwinerror (error)
+ DWORD error;
+{
+ static char buf[1024];
+
+ wchar_t *msgbuf;
+ DWORD lasterr = GetLastError();
+ DWORD chars = FormatMessage(FORMAT_MESSAGE_FROM_SYSTEM
+ | FORMAT_MESSAGE_ALLOCATE_BUFFER,
+ NULL,
+ error,
+ 0, /* Default language */
+ (LPVOID)&msgbuf,
+ 0,
+ NULL);
+ if (chars != 0) {
+ /* If there is an \r\n appended, zap it. */
+ if (chars >= 2
+ && msgbuf[chars - 2] == '\r' && msgbuf[chars - 1] == '\n') {
+ chars -= 2;
+ msgbuf[chars] = 0;
+ }
+
+ if (chars > sizeof (buf) - 1) {
+ chars = sizeof (buf) - 1;
+ msgbuf[chars] = 0;
+ }
+
+ wcstombs(buf, msgbuf, chars + 1);
+ LocalFree(msgbuf);
+ }
+ else {
+ sprintf(buf, "unknown win32 error (%ld)", error);
+ }
+
+ SetLastError(lasterr);
+ return buf;
+}
+
+#endif /* UNDER_CE */
+
+/* Reset gzip file state */
+local void gz_reset(gz_statep state)
+{
+ state->x.have = 0; /* no output data available */
+ if (state->mode == GZ_READ) { /* for reading ... */
+ state->eof = 0; /* not at end of file */
+ state->past = 0; /* have not read past end yet */
+ state->how = LOOK; /* look for gzip header */
+ }
+ state->seek = 0; /* no seek request pending */
+ gz_error(state, Z_OK, NULL); /* clear error */
+ state->x.pos = 0; /* no uncompressed data yet */
+ state->strm.avail_in = 0; /* no input data yet */
+}
+
+/* Open a gzip file either by name or file descriptor. */
+local gzFile gz_open(const void *path, int fd, const char *mode)
+{
+ gz_statep state;
+ size_t len;
+ int oflag;
+#ifdef O_CLOEXEC
+ int cloexec = 0;
+#endif
+#ifdef O_EXCL
+ int exclusive = 0;
+#endif
+
+ /* check input */
+ if (path == NULL)
+ return NULL;
+
+ /* allocate gzFile structure to return */
+ state = (gz_statep)malloc(sizeof(gz_state));
+ if (state == NULL)
+ return NULL;
+ state->size = 0; /* no buffers allocated yet */
+ state->want = GZBUFSIZE; /* requested buffer size */
+ state->msg = NULL; /* no error message yet */
+
+ /* interpret mode */
+ state->mode = GZ_NONE;
+ state->level = Z_DEFAULT_COMPRESSION;
+ state->strategy = Z_DEFAULT_STRATEGY;
+ state->direct = 0;
+ while (*mode) {
+ if (*mode >= '0' && *mode <= '9')
+ state->level = *mode - '0';
+ else
+ switch (*mode) {
+ case 'r':
+ state->mode = GZ_READ;
+ break;
+#ifndef NO_GZCOMPRESS
+ case 'w':
+ state->mode = GZ_WRITE;
+ break;
+ case 'a':
+ state->mode = GZ_APPEND;
+ break;
+#endif
+ case '+': /* can't read and write at the same time */
+ free(state);
+ return NULL;
+ case 'b': /* ignore -- will request binary anyway */
+ break;
+#ifdef O_CLOEXEC
+ case 'e':
+ cloexec = 1;
+ break;
+#endif
+#ifdef O_EXCL
+ case 'x':
+ exclusive = 1;
+ break;
+#endif
+ case 'f':
+ state->strategy = Z_FILTERED;
+ break;
+ case 'h':
+ state->strategy = Z_HUFFMAN_ONLY;
+ break;
+ case 'R':
+ state->strategy = Z_RLE;
+ break;
+ case 'F':
+ state->strategy = Z_FIXED;
+ break;
+ case 'T':
+ state->direct = 1;
+ break;
+ default: /* could consider as an error, but just ignore */
+ ;
+ }
+ mode++;
+ }
+
+ /* must provide an "r", "w", or "a" */
+ if (state->mode == GZ_NONE) {
+ free(state);
+ return NULL;
+ }
+
+ /* can't force transparent read */
+ if (state->mode == GZ_READ) {
+ if (state->direct) {
+ free(state);
+ return NULL;
+ }
+ state->direct = 1; /* for empty file */
+ }
+
+ /* save the path name for error messages */
+#ifdef _WIN32
+ if (fd == -2) {
+ len = wcstombs(NULL, (const wchar_t*)path, 0);
+ if (len == (size_t)-1)
+ len = 0;
+ }
+ else
+#endif
+ len = strlen((const char *)path);
+ state->path = (char *)malloc(len + 1);
+ if (state->path == NULL) {
+ free(state);
+ return NULL;
+ }
+#ifdef _WIN32
+ if (fd == -2)
+ if (len)
+ wcstombs(state->path, (const wchar_t*)path, len + 1);
+ else
+ *(state->path) = 0;
+ else
+#endif
+#if !defined(NO_snprintf) && !defined(NO_vsnprintf)
+ snprintf(state->path, len + 1, "%s", (const char *)path);
+#else
+ strlcpy(state->path, path, sizeof(state->path));
+#endif
+
+ /* compute the flags for open() */
+ oflag =
+#ifdef O_LARGEFILE
+ O_LARGEFILE |
+#endif
+#ifdef O_BINARY
+ O_BINARY |
+#endif
+#ifdef O_CLOEXEC
+ (cloexec ? O_CLOEXEC : 0) |
+#endif
+ (state->mode == GZ_READ ?
+ O_RDONLY :
+ (O_WRONLY | O_CREAT |
+#ifdef O_EXCL
+ (exclusive ? O_EXCL : 0) |
+#endif
+ (state->mode == GZ_WRITE ?
+ O_TRUNC :
+ O_APPEND)));
+
+ /* open the file with the appropriate flags (or just use fd) */
+ state->fd = fd > -1 ? fd : (
+#ifdef _WIN32
+ fd == -2 ? _wopen((const wchar_t*)path, oflag, 0666) :
+#endif
+ open((const char *)path, oflag, 0666));
+ if (state->fd == -1) {
+ free(state->path);
+ free(state);
+ return NULL;
+ }
+ if (state->mode == GZ_APPEND)
+ state->mode = GZ_WRITE; /* simplify later checks */
+
+ /* save the current position for rewinding (only if reading) */
+ if (state->mode == GZ_READ) {
+ state->start = LSEEK(state->fd, 0, SEEK_CUR);
+ if (state->start == -1) state->start = 0;
+ }
+
+ /* initialize stream */
+ gz_reset(state);
+
+ /* return stream */
+ return (gzFile)state;
+}
+
+/* -- see zlib.h -- */
+gzFile ZEXPORT gzopen(const char *path, const char *mode)
+{
+ return gz_open(path, -1, mode);
+}
+
+/* -- see zlib.h -- */
+gzFile ZEXPORT gzopen64(const char *path, const char *mode)
+{
+ return gz_open(path, -1, mode);
+}
+
+/* -- see zlib.h -- */
+gzFile ZEXPORT gzdopen(int fd, const char *mode)
+{
+ char *path; /* identifier for error messages */
+ gzFile gz;
+
+ if (fd == -1 || (path = (char *)malloc(7 + 3 * sizeof(int))) == NULL)
+ return NULL;
+#if !defined(NO_snprintf) && !defined(NO_vsnprintf)
+ snprintf(path, 7 + 3 * sizeof(int), "<fd:%d>", fd); /* for debugging */
+#else
+ sprintf(path, "<fd:%d>", fd); /* for debugging */
+#endif
+ gz = gz_open(path, fd, mode);
+ free(path);
+ return gz;
+}
+
+/* -- see zlib.h -- */
+#ifdef _WIN32
+gzFile ZEXPORT gzopen_w(const wchar_t *path, const char *mode)
+{
+ return gz_open(path, -2, mode);
+}
+#endif
+
+/* -- see zlib.h -- */
+int ZEXPORT gzbuffer(gzFile file, unsigned size)
+{
+ gz_statep state;
+
+ /* get internal structure and check integrity */
+ if (file == NULL)
+ return -1;
+ state = (gz_statep)file;
+ if (state->mode != GZ_READ && state->mode != GZ_WRITE)
+ return -1;
+
+ /* make sure we haven't already allocated memory */
+ if (state->size != 0)
+ return -1;
+
+ /* check and set requested size */
+ if (size < 2)
+ size = 2; /* need two bytes to check magic header */
+ state->want = size;
+ return 0;
+}
+
+/* -- see zlib.h -- */
+int ZEXPORT gzrewind(gzFile file)
+{
+ gz_statep state;
+
+ /* get internal structure */
+ if (file == NULL)
+ return -1;
+ state = (gz_statep)file;
+
+ /* check that we're reading and that there's no error */
+ if (state->mode != GZ_READ ||
+ (state->err != Z_OK && state->err != Z_BUF_ERROR))
+ return -1;
+
+ /* back up and start over */
+ if (LSEEK(state->fd, state->start, SEEK_SET) == -1)
+ return -1;
+ gz_reset(state);
+ return 0;
+}
+
+/* -- see zlib.h -- */
+z_off64_t ZEXPORT gzseek64(gzFile file, z_off64_t offset, int whence)
+{
+ unsigned n;
+ z_off64_t ret;
+ gz_statep state;
+
+ /* get internal structure and check integrity */
+ if (file == NULL)
+ return -1;
+ state = (gz_statep)file;
+ if (state->mode != GZ_READ && state->mode != GZ_WRITE)
+ return -1;
+
+ /* check that there's no error */
+ if (state->err != Z_OK && state->err != Z_BUF_ERROR)
+ return -1;
+
+ /* can only seek from start or relative to current position */
+ if (whence != SEEK_SET && whence != SEEK_CUR)
+ return -1;
+
+ /* normalize offset to a SEEK_CUR specification */
+ if (whence == SEEK_SET)
+ offset -= state->x.pos;
+ else if (state->seek)
+ offset += state->skip;
+ state->seek = 0;
+
+ /* if within raw area while reading, just go there */
+ if (state->mode == GZ_READ && state->how == MODE_COPY &&
+ state->x.pos + offset >= 0) {
+ ret = LSEEK(state->fd, offset - state->x.have, SEEK_CUR);
+ if (ret == -1)
+ return -1;
+ state->x.have = 0;
+ state->eof = 0;
+ state->past = 0;
+ state->seek = 0;
+ gz_error(state, Z_OK, NULL);
+ state->strm.avail_in = 0;
+ state->x.pos += offset;
+ return state->x.pos;
+ }
+
+ /* calculate skip amount, rewinding if needed for back seek when reading */
+ if (offset < 0) {
+ if (state->mode != GZ_READ) /* writing -- can't go backwards */
+ return -1;
+ offset += state->x.pos;
+ if (offset < 0) /* before start of file! */
+ return -1;
+ if (gzrewind(file) == -1) /* rewind, then skip to offset */
+ return -1;
+ }
+
+ /* if reading, skip what's in output buffer (one less gzgetc() check) */
+ if (state->mode == GZ_READ) {
+ n = GT_OFF(state->x.have) || (z_off64_t)state->x.have > offset ?
+ (unsigned)offset : state->x.have;
+ state->x.have -= n;
+ state->x.next += n;
+ state->x.pos += n;
+ offset -= n;
+ }
+
+ /* request skip (if not zero) */
+ if (offset) {
+ state->seek = 1;
+ state->skip = offset;
+ }
+ return state->x.pos + offset;
+}
+
+/* -- see zlib.h -- */
+z_off_t ZEXPORT gzseek(gzFile file, z_off_t offset, int whence)
+{
+ z_off64_t ret;
+
+ ret = gzseek64(file, (z_off64_t)offset, whence);
+ return ret == (z_off_t)ret ? (z_off_t)ret : -1;
+}
+
+/* -- see zlib.h -- */
+z_off64_t ZEXPORT gztell64(gzFile file)
+{
+ gz_statep state;
+
+ /* get internal structure and check integrity */
+ if (file == NULL)
+ return -1;
+ state = (gz_statep)file;
+ if (state->mode != GZ_READ && state->mode != GZ_WRITE)
+ return -1;
+
+ /* return position */
+ return state->x.pos + (state->seek ? state->skip : 0);
+}
+
+/* -- see zlib.h -- */
+z_off_t ZEXPORT gztell(gzFile file)
+{
+ z_off64_t ret;
+
+ ret = gztell64(file);
+ return ret == (z_off_t)ret ? (z_off_t)ret : -1;
+}
+
+/* -- see zlib.h -- */
+z_off64_t ZEXPORT gzoffset64(gzFile file)
+{
+ z_off64_t offset;
+ gz_statep state;
+
+ /* get internal structure and check integrity */
+ if (file == NULL)
+ return -1;
+ state = (gz_statep)file;
+ if (state->mode != GZ_READ && state->mode != GZ_WRITE)
+ return -1;
+
+ /* compute and return effective offset in file */
+ offset = LSEEK(state->fd, 0, SEEK_CUR);
+ if (offset == -1)
+ return -1;
+ if (state->mode == GZ_READ) /* reading */
+ offset -= state->strm.avail_in; /* don't count buffered input */
+ return offset;
+}
+
+/* -- see zlib.h -- */
+z_off_t ZEXPORT gzoffset(gzFile file)
+{
+ z_off64_t ret = gzoffset64(file);
+ return ret == (z_off_t)ret ? (z_off_t)ret : -1;
+}
+
+/* -- see zlib.h -- */
+int ZEXPORT gzeof(gzFile file)
+{
+ gz_statep state;
+
+ /* get internal structure and check integrity */
+ if (file == NULL)
+ return 0;
+ state = (gz_statep)file;
+ if (state->mode != GZ_READ && state->mode != GZ_WRITE)
+ return 0;
+
+ /* return end-of-file state */
+ return state->mode == GZ_READ ? state->past : 0;
+}
+
+/* -- see zlib.h -- */
+const char * ZEXPORT gzerror(gzFile file, int *errnum)
+{
+ gz_statep state;
+
+ /* get internal structure and check integrity */
+ if (file == NULL)
+ return NULL;
+ state = (gz_statep)file;
+ if (state->mode != GZ_READ && state->mode != GZ_WRITE)
+ return NULL;
+
+ /* return error information */
+ if (errnum != NULL)
+ *errnum = state->err;
+ return state->err == Z_MEM_ERROR ? "out of memory" :
+ (state->msg == NULL ? "" : state->msg);
+}
+
+/* -- see zlib.h -- */
+void ZEXPORT gzclearerr(gzFile file)
+{
+ gz_statep state;
+
+ /* get internal structure and check integrity */
+ if (file == NULL)
+ return;
+ state = (gz_statep)file;
+ if (state->mode != GZ_READ && state->mode != GZ_WRITE)
+ return;
+
+ /* clear error and end-of-file */
+ if (state->mode == GZ_READ) {
+ state->eof = 0;
+ state->past = 0;
+ }
+ gz_error(state, Z_OK, NULL);
+}
+
+/* Create an error message in allocated memory and set state->err and
+ state->msg accordingly. Free any previous error message already there. Do
+ not try to free or allocate space if the error is Z_MEM_ERROR (out of
+ memory). Simply save the error message as a static string. If there is an
+ allocation failure constructing the error message, then convert the error to
+ out of memory. */
+void ZLIB_INTERNAL gz_error(gz_statep state, int err, const char *msg)
+{
+ /* free previously allocated message and clear */
+ if (state->msg != NULL) {
+ if (state->err != Z_MEM_ERROR)
+ free(state->msg);
+ state->msg = NULL;
+ }
+
+ /* if fatal, set state->x.have to 0 so that the gzgetc() macro fails */
+ if (err != Z_OK && err != Z_BUF_ERROR)
+ state->x.have = 0;
+
+ /* set error code, and if no message, then done */
+ state->err = err;
+ if (msg == NULL)
+ return;
+
+ /* for an out of memory error, return literal string when requested */
+ if (err == Z_MEM_ERROR)
+ return;
+
+ /* construct error message with path */
+ if ((state->msg = (char *)malloc(strlen(state->path) + strlen(msg) + 3)) ==
+ NULL) {
+ state->err = Z_MEM_ERROR;
+ return;
+ }
+#if !defined(NO_snprintf) && !defined(NO_vsnprintf)
+ snprintf(state->msg, strlen(state->path) + strlen(msg) + 3,
+ "%s%s%s", state->path, ": ", msg);
+#else
+ strlcpy(state->msg, state->path, sizeof(state->msg));
+ strlcat(state->msg, ": ", sizeof(state->msg));
+ strlcat(state->msg, msg, sizeof(state->msg));
+#endif
+ return;
+}
+
+#ifndef INT_MAX
+/* portably return maximum value for an int (when limits.h presumed not
+ available) -- we need to do this to cover cases where 2's complement not
+ used, since C standard permits 1's complement and sign-bit representations,
+ otherwise we could just use ((unsigned)-1) >> 1 */
+unsigned ZLIB_INTERNAL gz_intmax()
+{
+ unsigned p, q;
+
+ p = 1;
+ do {
+ q = p;
+ p <<= 1;
+ p++;
+ } while (p > q);
+ return q >> 1;
+}
+#endif
--- /dev/null
+/* gzread.c -- zlib functions for reading gzip files
+ * Copyright (C) 2004, 2005, 2010, 2011, 2012, 2013 Mark Adler
+ * For conditions of distribution and use, see copyright notice in zlib.h
+ */
+
+#include "gzguts.h"
+
+/* Local functions */
+local int gz_load OF((gz_statep, unsigned char *, unsigned, unsigned *));
+local int gz_avail OF((gz_statep));
+local int gz_look OF((gz_statep));
+local int gz_decomp OF((gz_statep));
+local int gz_fetch OF((gz_statep));
+local int gz_skip OF((gz_statep, z_off64_t));
+
+int ZEXPORT gzgetc_(gzFile file);
+
+/* Use read() to load a buffer -- return -1 on error, otherwise 0. Read from
+ state->fd, and update state->eof, state->err, and state->msg as appropriate.
+ This function needs to loop on read(), since read() is not guaranteed to
+ read the number of bytes requested, depending on the type of descriptor. */
+local int gz_load(gz_statep state, unsigned char *buf, unsigned len, unsigned *have)
+{
+ int ret;
+
+ *have = 0;
+ do {
+ ret = read(state->fd, buf + *have, len - *have);
+ if (ret <= 0)
+ break;
+ *have += ret;
+ } while (*have < len);
+ if (ret < 0) {
+ gz_error(state, Z_ERRNO, zstrerror());
+ return -1;
+ }
+ if (ret == 0)
+ state->eof = 1;
+ return 0;
+}
+
+/* Load up input buffer and set eof flag if last data loaded -- return -1 on
+ error, 0 otherwise. Note that the eof flag is set when the end of the input
+ file is reached, even though there may be unused data in the buffer. Once
+ that data has been used, no more attempts will be made to read the file.
+ If strm->avail_in != 0, then the current data is moved to the beginning of
+ the input buffer, and then the remainder of the buffer is loaded with the
+ available data from the input file. */
+local int gz_avail(gz_statep state)
+{
+ unsigned got;
+ z_streamp strm = &(state->strm);
+
+ if (state->err != Z_OK && state->err != Z_BUF_ERROR)
+ return -1;
+ if (state->eof == 0) {
+ if (strm->avail_in) { /* copy what's there to the start */
+ unsigned char *p = state->in;
+ unsigned const char *q = strm->next_in;
+ unsigned n = strm->avail_in;
+ do {
+ *p++ = *q++;
+ } while (--n);
+ }
+ if (gz_load(state, state->in + strm->avail_in,
+ state->size - strm->avail_in, &got) == -1)
+ return -1;
+ strm->avail_in += got;
+ strm->next_in = state->in;
+ }
+ return 0;
+}
+
+/* Look for gzip header, set up for inflate or copy. state->x.have must be 0.
+ If this is the first time in, allocate required memory. state->how will be
+ left unchanged if there is no more input data available, will be set to COPY
+ if there is no gzip header and direct copying will be performed, or it will
+ be set to GZIP for decompression. If direct copying, then leftover input
+ data from the input buffer will be copied to the output buffer. In that
+ case, all further file reads will be directly to either the output buffer or
+ a user buffer. If decompressing, the inflate state will be initialized.
+ gz_look() will return 0 on success or -1 on failure. */
+local int gz_look(gz_statep state)
+{
+ z_streamp strm = &(state->strm);
+
+ /* allocate read buffers and inflate memory */
+ if (state->size == 0) {
+ /* allocate buffers */
+ state->in = (unsigned char *)malloc(state->want);
+ state->out = (unsigned char *)malloc(state->want << 1);
+ if (state->in == NULL || state->out == NULL) {
+ if (state->out != NULL)
+ free(state->out);
+ if (state->in != NULL)
+ free(state->in);
+ gz_error(state, Z_MEM_ERROR, "out of memory");
+ return -1;
+ }
+ state->size = state->want;
+
+ /* allocate inflate memory */
+ state->strm.zalloc = Z_NULL;
+ state->strm.zfree = Z_NULL;
+ state->strm.opaque = Z_NULL;
+ state->strm.avail_in = 0;
+ state->strm.next_in = Z_NULL;
+ if (inflateInit2(&(state->strm), 15 + 16) != Z_OK) { /* gunzip */
+ free(state->out);
+ free(state->in);
+ state->size = 0;
+ gz_error(state, Z_MEM_ERROR, "out of memory");
+ return -1;
+ }
+ }
+
+ /* get at least the magic bytes in the input buffer */
+ if (strm->avail_in < 2) {
+ if (gz_avail(state) == -1)
+ return -1;
+ if (strm->avail_in == 0)
+ return 0;
+ }
+
+ /* look for gzip magic bytes -- if there, do gzip decoding (note: there is
+ a logical dilemma here when considering the case of a partially written
+ gzip file, to wit, if a single 31 byte is written, then we cannot tell
+ whether this is a single-byte file, or just a partially written gzip
+ file -- for here we assume that if a gzip file is being written, then
+ the header will be written in a single operation, so that reading a
+ single byte is sufficient indication that it is not a gzip file) */
+ if (strm->avail_in > 1 &&
+ strm->next_in[0] == 31 && strm->next_in[1] == 139) {
+ inflateReset(strm);
+ state->how = MODE_GZIP;
+ state->direct = 0;
+ return 0;
+ }
+
+ /* no gzip header -- if we were decoding gzip before, then this is trailing
+ garbage. Ignore the trailing garbage and finish. */
+ if (state->direct == 0) {
+ strm->avail_in = 0;
+ state->eof = 1;
+ state->x.have = 0;
+ return 0;
+ }
+
+ /* doing raw i/o, copy any leftover input to output -- this assumes that
+ the output buffer is larger than the input buffer, which also assures
+ space for gzungetc() */
+ state->x.next = state->out;
+ if (strm->avail_in) {
+ memcpy(state->x.next, strm->next_in, strm->avail_in);
+ state->x.have = strm->avail_in;
+ strm->avail_in = 0;
+ }
+ state->how = MODE_COPY;
+ state->direct = 1;
+ return 0;
+}
+
+/* Decompress from input to the provided next_out and avail_out in the state.
+ On return, state->x.have and state->x.next point to the just decompressed
+ data. If the gzip stream completes, state->how is reset to LOOK to look for
+ the next gzip stream or raw data, once state->x.have is depleted. Returns 0
+ on success, -1 on failure. */
+local int gz_decomp(gz_statep state)
+{
+ int ret = Z_OK;
+ unsigned had;
+ z_streamp strm = &(state->strm);
+
+ /* fill output buffer up to end of deflate stream */
+ had = strm->avail_out;
+ do {
+ /* get more input for inflate() */
+ if (strm->avail_in == 0 && gz_avail(state) == -1)
+ return -1;
+ if (strm->avail_in == 0) {
+ gz_error(state, Z_BUF_ERROR, "unexpected end of file");
+ break;
+ }
+
+ /* decompress and handle errors */
+ ret = inflate(strm, Z_NO_FLUSH);
+ if (ret == Z_STREAM_ERROR || ret == Z_NEED_DICT) {
+ gz_error(state, Z_STREAM_ERROR,
+ "internal error: inflate stream corrupt");
+ return -1;
+ }
+ if (ret == Z_MEM_ERROR) {
+ gz_error(state, Z_MEM_ERROR, "out of memory");
+ return -1;
+ }
+ if (ret == Z_DATA_ERROR) { /* deflate stream invalid */
+ gz_error(state, Z_DATA_ERROR,
+ strm->msg == NULL ? "compressed data error" : strm->msg);
+ return -1;
+ }
+ } while (strm->avail_out && ret != Z_STREAM_END);
+
+ /* update available output */
+ state->x.have = had - strm->avail_out;
+ state->x.next = strm->next_out - state->x.have;
+
+ /* if the gzip stream completed successfully, look for another */
+ if (ret == Z_STREAM_END)
+ state->how = LOOK;
+
+ /* good decompression */
+ return 0;
+}
+
+/* Fetch data and put it in the output buffer. Assumes state->x.have is 0.
+ Data is either copied from the input file or decompressed from the input
+ file depending on state->how. If state->how is LOOK, then a gzip header is
+ looked for to determine whether to copy or decompress. Returns -1 on error,
+ otherwise 0. gz_fetch() will leave state->how as COPY or GZIP unless the
+ end of the input file has been reached and all data has been processed. */
+local int gz_fetch(gz_statep state)
+{
+ z_streamp strm = &(state->strm);
+
+ do {
+ switch(state->how) {
+ case LOOK: /* -> LOOK, MODE_COPY (only if never GZIP), or MODE_GZIP */
+ if (gz_look(state) == -1)
+ return -1;
+ if (state->how == LOOK)
+ return 0;
+ break;
+ case MODE_COPY: /* -> MODE_COPY */
+ if (gz_load(state, state->out, state->size << 1, &(state->x.have))
+ == -1)
+ return -1;
+ state->x.next = state->out;
+ return 0;
+ case MODE_GZIP: /* -> GZIP or LOOK (if end of gzip stream) */
+ strm->avail_out = state->size << 1;
+ strm->next_out = state->out;
+ if (gz_decomp(state) == -1)
+ return -1;
+ }
+ } while (state->x.have == 0 && (!state->eof || strm->avail_in));
+ return 0;
+}
+
+/* Skip len uncompressed bytes of output. Return -1 on error, 0 on success. */
+local int gz_skip(gz_statep state, z_off64_t len)
+{
+ unsigned n;
+
+ /* skip over len bytes or reach end-of-file, whichever comes first */
+ while (len)
+ /* skip over whatever is in output buffer */
+ if (state->x.have) {
+ n = GT_OFF(state->x.have) || (z_off64_t)state->x.have > len ?
+ (unsigned)len : state->x.have;
+ state->x.have -= n;
+ state->x.next += n;
+ state->x.pos += n;
+ len -= n;
+ }
+
+ /* output buffer empty -- return if we're at the end of the input */
+ else if (state->eof && state->strm.avail_in == 0)
+ break;
+
+ /* need more data to skip -- load up output buffer */
+ else {
+ /* get more output, looking for header if required */
+ if (gz_fetch(state) == -1)
+ return -1;
+ }
+ return 0;
+}
+
+/* -- see zlib.h -- */
+int ZEXPORT gzread(gzFile file, voidp buf, unsigned len)
+{
+ unsigned got, n;
+ gz_statep state;
+ z_streamp strm;
+
+ /* get internal structure */
+ if (file == NULL)
+ return -1;
+ state = (gz_statep)file;
+ strm = &(state->strm);
+
+ /* check that we're reading and that there's no (serious) error */
+ if (state->mode != GZ_READ ||
+ (state->err != Z_OK && state->err != Z_BUF_ERROR))
+ return -1;
+
+ /* since an int is returned, make sure len fits in one, otherwise return
+ with an error (this avoids the flaw in the interface) */
+ if ((int)len < 0) {
+ gz_error(state, Z_DATA_ERROR, "requested length does not fit in int");
+ return -1;
+ }
+
+ /* if len is zero, avoid unnecessary operations */
+ if (len == 0)
+ return 0;
+
+ /* process a skip request */
+ if (state->seek) {
+ state->seek = 0;
+ if (gz_skip(state, state->skip) == -1)
+ return -1;
+ }
+
+ /* get len bytes to buf, or less than len if at the end */
+ got = 0;
+ n = 0;
+ do {
+ /* first just try copying data from the output buffer */
+ if (state->x.have) {
+ n = state->x.have > len ? len : state->x.have;
+ memcpy(buf, state->x.next, n);
+ state->x.next += n;
+ state->x.have -= n;
+ }
+
+ /* output buffer empty -- return if we're at the end of the input */
+ else if (state->eof && strm->avail_in == 0) {
+ state->past = 1; /* tried to read past end */
+ break;
+ }
+
+ /* need output data -- for small len or new stream load up our output
+ buffer */
+ else if (state->how == LOOK || len < (state->size << 1)) {
+ /* get more output, looking for header if required */
+ if (gz_fetch(state) == -1)
+ return -1;
+ continue; /* no progress yet -- go back to copy above */
+ /* the copy above assures that we will leave with space in the
+ output buffer, allowing at least one gzungetc() to succeed */
+ }
+
+ /* large len -- read directly into user buffer */
+ else if (state->how == MODE_COPY) { /* read directly */
+ if (gz_load(state, (unsigned char *)buf, len, &n) == -1)
+ return -1;
+ }
+
+ /* large len -- decompress directly into user buffer */
+ else { /* state->how == GZIP */
+ strm->avail_out = len;
+ strm->next_out = (unsigned char *)buf;
+ if (gz_decomp(state) == -1)
+ return -1;
+ n = state->x.have;
+ state->x.have = 0;
+ }
+
+ /* update progress */
+ len -= n;
+ buf = (char *)buf + n;
+ got += n;
+ state->x.pos += n;
+ } while (len);
+
+ /* return number of bytes read into user buffer (will fit in int) */
+ return (int)got;
+}
+
+/* -- see zlib.h -- */
+#ifdef Z_PREFIX_SET
+# undef z_gzgetc
+#else
+# undef gzgetc
+#endif
+int ZEXPORT gzgetc(gzFile file)
+{
+ int ret;
+ unsigned char buf[1];
+ gz_statep state;
+
+ /* get internal structure */
+ if (file == NULL)
+ return -1;
+ state = (gz_statep)file;
+
+ /* check that we're reading and that there's no (serious) error */
+ if (state->mode != GZ_READ ||
+ (state->err != Z_OK && state->err != Z_BUF_ERROR))
+ return -1;
+
+ /* try output buffer (no need to check for skip request) */
+ if (state->x.have) {
+ state->x.have--;
+ state->x.pos++;
+ return *(state->x.next)++;
+ }
+
+ /* nothing there -- try gzread() */
+ ret = gzread(file, buf, 1);
+ return ret < 1 ? -1 : buf[0];
+}
+
+int ZEXPORT gzgetc_(gzFile file)
+{
+ return gzgetc(file);
+}
+
+/* -- see zlib.h -- */
+int ZEXPORT gzungetc(int c, gzFile file)
+{
+ gz_statep state;
+
+ /* get internal structure */
+ if (file == NULL)
+ return -1;
+ state = (gz_statep)file;
+
+ /* check that we're reading and that there's no (serious) error */
+ if (state->mode != GZ_READ ||
+ (state->err != Z_OK && state->err != Z_BUF_ERROR))
+ return -1;
+
+ /* process a skip request */
+ if (state->seek) {
+ state->seek = 0;
+ if (gz_skip(state, state->skip) == -1)
+ return -1;
+ }
+
+ /* can't push EOF */
+ if (c < 0)
+ return -1;
+
+ /* if output buffer empty, put byte at end (allows more pushing) */
+ if (state->x.have == 0) {
+ state->x.have = 1;
+ state->x.next = state->out + (state->size << 1) - 1;
+ state->x.next[0] = c;
+ state->x.pos--;
+ state->past = 0;
+ return c;
+ }
+
+ /* if no room, give up (must have already done a gzungetc()) */
+ if (state->x.have == (state->size << 1)) {
+ gz_error(state, Z_DATA_ERROR, "out of room to push characters");
+ return -1;
+ }
+
+ /* slide output data if needed and insert byte before existing data */
+ if (state->x.next == state->out) {
+ unsigned char *src = state->out + state->x.have;
+ unsigned char *dest = state->out + (state->size << 1);
+ while (src > state->out)
+ *--dest = *--src;
+ state->x.next = dest;
+ }
+ state->x.have++;
+ state->x.next--;
+ state->x.next[0] = c;
+ state->x.pos--;
+ state->past = 0;
+ return c;
+}
+
+/* -- see zlib.h -- */
+char * ZEXPORT gzgets(gzFile file, char *buf, int len)
+{
+ unsigned left, n;
+ char *str;
+ unsigned char *eol;
+ gz_statep state;
+
+ /* check parameters and get internal structure */
+ if (file == NULL || buf == NULL || len < 1)
+ return NULL;
+ state = (gz_statep)file;
+
+ /* check that we're reading and that there's no (serious) error */
+ if (state->mode != GZ_READ ||
+ (state->err != Z_OK && state->err != Z_BUF_ERROR))
+ return NULL;
+
+ /* process a skip request */
+ if (state->seek) {
+ state->seek = 0;
+ if (gz_skip(state, state->skip) == -1)
+ return NULL;
+ }
+
+ /* copy output bytes up to new line or len - 1, whichever comes first --
+ append a terminating zero to the string (we don't check for a zero in
+ the contents, let the user worry about that) */
+ str = buf;
+ left = (unsigned)len - 1;
+ if (left) do {
+ /* assure that something is in the output buffer */
+ if (state->x.have == 0 && gz_fetch(state) == -1)
+ return NULL; /* error */
+ if (state->x.have == 0) { /* end of file */
+ state->past = 1; /* read past end */
+ break; /* return what we have */
+ }
+
+ /* look for end-of-line in current output buffer */
+ n = state->x.have > left ? left : state->x.have;
+ eol = (unsigned char *)memchr(state->x.next, '\n', n);
+ if (eol != NULL)
+ n = (unsigned)(eol - state->x.next) + 1;
+
+ /* copy through end-of-line, or remainder if not found */
+ memcpy(buf, state->x.next, n);
+ state->x.have -= n;
+ state->x.next += n;
+ state->x.pos += n;
+ left -= n;
+ buf += n;
+ } while (left && eol == NULL);
+
+ /* return terminated string, or if nothing, end of file */
+ if (buf == str)
+ return NULL;
+ buf[0] = 0;
+ return str;
+}
+
+/* -- see zlib.h -- */
+int ZEXPORT gzdirect(gzFile file)
+{
+ gz_statep state;
+
+ /* get internal structure */
+ if (file == NULL)
+ return 0;
+ state = (gz_statep)file;
+
+ /* if the state is not known, but we can find out, then do so (this is
+ mainly for right after a gzopen() or gzdopen()) */
+ if (state->mode == GZ_READ && state->how == LOOK && state->x.have == 0)
+ (void)gz_look(state);
+
+ /* return 1 if transparent, 0 if processing a gzip stream */
+ return state->direct;
+}
+
+/* -- see zlib.h -- */
+int gzclose_r(gzFile file)
+{
+ int ret, err;
+ gz_statep state;
+
+ /* get internal structure */
+ if (file == NULL)
+ return Z_STREAM_ERROR;
+ state = (gz_statep)file;
+
+ /* check that we're reading */
+ if (state->mode != GZ_READ)
+ return Z_STREAM_ERROR;
+
+ /* free memory and close file */
+ if (state->size) {
+ inflateEnd(&(state->strm));
+ free(state->out);
+ free(state->in);
+ }
+ err = state->err == Z_BUF_ERROR ? Z_BUF_ERROR : Z_OK;
+ gz_error(state, Z_OK, NULL);
+ free(state->path);
+ ret = close(state->fd);
+ free(state);
+ return ret ? Z_ERRNO : err;
+}
--- /dev/null
+/* gzwrite.c -- zlib functions for writing gzip files
+ * Copyright (C) 2004, 2005, 2010, 2011, 2012, 2013 Mark Adler
+ * For conditions of distribution and use, see copyright notice in zlib.h
+ */
+
+#include "gzguts.h"
+
+/* Local functions */
+local int gz_init OF((gz_statep));
+local int gz_comp OF((gz_statep, int));
+local int gz_zero OF((gz_statep, z_off64_t));
+
+int ZEXPORTVA gzvprintf(gzFile file, const char *format, va_list va);
+
+/* Initialize state for writing a gzip file. Mark initialization by setting
+ state->size to non-zero. Return -1 on failure or 0 on success. */
+local int gz_init(gz_statep state)
+{
+ int ret;
+ z_streamp strm = &(state->strm);
+
+ /* allocate input buffer */
+ state->in = (unsigned char *)malloc(state->want);
+ if (state->in == NULL) {
+ gz_error(state, Z_MEM_ERROR, "out of memory");
+ return -1;
+ }
+
+ /* only need output buffer and deflate state if compressing */
+ if (!state->direct) {
+ /* allocate output buffer */
+ state->out = (unsigned char *)malloc(state->want);
+ if (state->out == NULL) {
+ free(state->in);
+ gz_error(state, Z_MEM_ERROR, "out of memory");
+ return -1;
+ }
+
+ /* allocate deflate memory, set up for gzip compression */
+ strm->zalloc = Z_NULL;
+ strm->zfree = Z_NULL;
+ strm->opaque = Z_NULL;
+ ret = deflateInit2(strm, state->level, Z_DEFLATED,
+ MAX_WBITS + 16, DEF_MEM_LEVEL, state->strategy);
+ if (ret != Z_OK) {
+ free(state->out);
+ free(state->in);
+ gz_error(state, Z_MEM_ERROR, "out of memory");
+ return -1;
+ }
+ }
+
+ /* mark state as initialized */
+ state->size = state->want;
+
+ /* initialize write buffer if compressing */
+ if (!state->direct) {
+ strm->avail_out = state->size;
+ strm->next_out = state->out;
+ state->x.next = strm->next_out;
+ }
+ return 0;
+}
+
+/* Compress whatever is at avail_in and next_in and write to the output file.
+ Return -1 if there is an error writing to the output file, otherwise 0.
+ flush is assumed to be a valid deflate() flush value. If flush is Z_FINISH,
+ then the deflate() state is reset to start a new gzip stream. If gz->direct
+ is true, then simply write to the output file without compressing, and
+ ignore flush. */
+local int gz_comp(gz_statep state, int flush)
+{
+ int ret, got;
+ unsigned have;
+ z_streamp strm = &(state->strm);
+
+ /* allocate memory if this is the first time through */
+ if (state->size == 0 && gz_init(state) == -1)
+ return -1;
+
+ /* write directly if requested */
+ if (state->direct) {
+ got = write(state->fd, strm->next_in, strm->avail_in);
+ if (got < 0 || (unsigned)got != strm->avail_in) {
+ gz_error(state, Z_ERRNO, zstrerror());
+ return -1;
+ }
+ strm->avail_in = 0;
+ return 0;
+ }
+
+ /* run deflate() on provided input until it produces no more output */
+ ret = Z_OK;
+ do {
+ /* write out current buffer contents if full, or if flushing, but if
+ doing Z_FINISH then don't write until we get to Z_STREAM_END */
+ if (strm->avail_out == 0 || (flush != Z_NO_FLUSH &&
+ (flush != Z_FINISH || ret == Z_STREAM_END))) {
+ have = (unsigned)(strm->next_out - state->x.next);
+ if (have && ((got = write(state->fd, state->x.next, have)) < 0 ||
+ (unsigned)got != have)) {
+ gz_error(state, Z_ERRNO, zstrerror());
+ return -1;
+ }
+ if (strm->avail_out == 0) {
+ strm->avail_out = state->size;
+ strm->next_out = state->out;
+ }
+ state->x.next = strm->next_out;
+ }
+
+ /* compress */
+ have = strm->avail_out;
+ ret = deflate(strm, flush);
+ if (ret == Z_STREAM_ERROR) {
+ gz_error(state, Z_STREAM_ERROR,
+ "internal error: deflate stream corrupt");
+ return -1;
+ }
+ have -= strm->avail_out;
+ } while (have);
+
+ /* if that completed a deflate stream, allow another to start */
+ if (flush == Z_FINISH)
+ deflateReset(strm);
+
+ /* all done, no errors */
+ return 0;
+}
+
+/* Compress len zeros to output. Return -1 on error, 0 on success. */
+local int gz_zero(gz_statep state, z_off64_t len)
+{
+ int first;
+ unsigned n;
+ z_streamp strm = &(state->strm);
+
+ /* consume whatever's left in the input buffer */
+ if (strm->avail_in && gz_comp(state, Z_NO_FLUSH) == -1)
+ return -1;
+
+ /* compress len zeros (len guaranteed > 0) */
+ first = 1;
+ while (len) {
+ n = GT_OFF(state->size) || (z_off64_t)state->size > len ?
+ (unsigned)len : state->size;
+ if (first) {
+ memset(state->in, 0, n);
+ first = 0;
+ }
+ strm->avail_in = n;
+ strm->next_in = state->in;
+ state->x.pos += n;
+ if (gz_comp(state, Z_NO_FLUSH) == -1)
+ return -1;
+ len -= n;
+ }
+ return 0;
+}
+
+/* -- see zlib.h -- */
+int ZEXPORT gzwrite(gzFile file, voidpc buf, unsigned len)
+{
+ unsigned put = len;
+ gz_statep state;
+ z_streamp strm;
+
+ /* get internal structure */
+ if (file == NULL)
+ return 0;
+ state = (gz_statep)file;
+ strm = &(state->strm);
+
+ /* check that we're writing and that there's no error */
+ if (state->mode != GZ_WRITE || state->err != Z_OK)
+ return 0;
+
+ /* since an int is returned, make sure len fits in one, otherwise return
+ with an error (this avoids the flaw in the interface) */
+ if ((int)len < 0) {
+ gz_error(state, Z_DATA_ERROR, "requested length does not fit in int");
+ return 0;
+ }
+
+ /* if len is zero, avoid unnecessary operations */
+ if (len == 0)
+ return 0;
+
+ /* allocate memory if this is the first time through */
+ if (state->size == 0 && gz_init(state) == -1)
+ return 0;
+
+ /* check for seek request */
+ if (state->seek) {
+ state->seek = 0;
+ if (gz_zero(state, state->skip) == -1)
+ return 0;
+ }
+
+ /* for small len, copy to input buffer, otherwise compress directly */
+ if (len < state->size) {
+ /* copy to input buffer, compress when full */
+ do {
+ unsigned have, copy;
+
+ if (strm->avail_in == 0)
+ strm->next_in = state->in;
+ have = (unsigned)((strm->next_in + strm->avail_in) - state->in);
+ copy = state->size - have;
+ if (copy > len)
+ copy = len;
+ memcpy(state->in + have, buf, copy);
+ strm->avail_in += copy;
+ state->x.pos += copy;
+ buf = (const char *)buf + copy;
+ len -= copy;
+ if (len && gz_comp(state, Z_NO_FLUSH) == -1)
+ return 0;
+ } while (len);
+ }
+ else {
+ /* consume whatever's left in the input buffer */
+ if (strm->avail_in && gz_comp(state, Z_NO_FLUSH) == -1)
+ return 0;
+
+ /* directly compress user buffer to file */
+ strm->avail_in = len;
+ strm->next_in = (Bytef *)buf;
+ state->x.pos += len;
+ if (gz_comp(state, Z_NO_FLUSH) == -1)
+ return 0;
+ }
+
+ /* input was all buffered or compressed (put will fit in int) */
+ return (int)put;
+}
+
+/* -- see zlib.h -- */
+int ZEXPORT gzputc(gzFile file, int c)
+{
+ unsigned have;
+ unsigned char buf[1];
+ gz_statep state;
+ z_streamp strm;
+
+ /* get internal structure */
+ if (file == NULL)
+ return -1;
+ state = (gz_statep)file;
+ strm = &(state->strm);
+
+ /* check that we're writing and that there's no error */
+ if (state->mode != GZ_WRITE || state->err != Z_OK)
+ return -1;
+
+ /* check for seek request */
+ if (state->seek) {
+ state->seek = 0;
+ if (gz_zero(state, state->skip) == -1)
+ return -1;
+ }
+
+ /* try writing to input buffer for speed (state->size == 0 if buffer not
+ initialized) */
+ if (state->size) {
+ if (strm->avail_in == 0)
+ strm->next_in = state->in;
+ have = (unsigned)((strm->next_in + strm->avail_in) - state->in);
+ if (have < state->size) {
+ state->in[have] = c;
+ strm->avail_in++;
+ state->x.pos++;
+ return c & 0xff;
+ }
+ }
+
+ /* no room in buffer or not initialized, use gz_write() */
+ buf[0] = c;
+ if (gzwrite(file, buf, 1) != 1)
+ return -1;
+ return c & 0xff;
+}
+
+/* -- see zlib.h -- */
+int ZEXPORT gzputs(gzFile file, const char *str)
+{
+ int ret;
+ unsigned len;
+
+ /* write string */
+ len = (unsigned)strlen(str);
+ ret = gzwrite(file, str, len);
+ return ret == 0 && len != 0 ? -1 : ret;
+}
+
+#if defined(STDC) || defined(Z_HAVE_STDARG_H)
+#include <stdarg.h>
+
+/* -- see zlib.h -- */
+int ZEXPORTVA gzvprintf(gzFile file, const char *format, va_list va)
+{
+ int size, len;
+ gz_statep state;
+ z_streamp strm;
+
+ /* get internal structure */
+ if (file == NULL)
+ return -1;
+ state = (gz_statep)file;
+ strm = &(state->strm);
+
+ /* check that we're writing and that there's no error */
+ if (state->mode != GZ_WRITE || state->err != Z_OK)
+ return 0;
+
+ /* make sure we have some buffer space */
+ if (state->size == 0 && gz_init(state) == -1)
+ return 0;
+
+ /* check for seek request */
+ if (state->seek) {
+ state->seek = 0;
+ if (gz_zero(state, state->skip) == -1)
+ return 0;
+ }
+
+ /* consume whatever's left in the input buffer */
+ if (strm->avail_in && gz_comp(state, Z_NO_FLUSH) == -1)
+ return 0;
+
+ /* do the printf() into the input buffer, put length in len */
+ size = (int)(state->size);
+ state->in[size - 1] = 0;
+#ifdef NO_vsnprintf
+# ifdef HAS_vsprintf_void
+ (void)vsprintf((char *)(state->in), format, va);
+ for (len = 0; len < size; len++)
+ if (state->in[len] == 0) break;
+# else
+ len = vsprintf((char *)(state->in), format, va);
+# endif
+#else
+# ifdef HAS_vsnprintf_void
+ (void)vsnprintf((char *)(state->in), size, format, va);
+ len = strlen((char *)(state->in));
+# else
+ len = vsnprintf((char *)(state->in), size, format, va);
+# endif
+#endif
+
+ /* check that printf() results fit in buffer */
+ if (len <= 0 || len >= (int)size || state->in[size - 1] != 0)
+ return 0;
+
+ /* update buffer and position, defer compression until needed */
+ strm->avail_in = (unsigned)len;
+ strm->next_in = state->in;
+ state->x.pos += len;
+ return len;
+}
+
+int ZEXPORTVA gzprintf(gzFile file, const char *format, ...)
+{
+ va_list va;
+ int ret;
+
+ va_start(va, format);
+ ret = gzvprintf(file, format, va);
+ va_end(va);
+ return ret;
+}
+
+#else /* !STDC && !Z_HAVE_STDARG_H */
+
+/* -- see zlib.h -- */
+int ZEXPORTVA gzprintf (gzFile file, const char *format, int a1, int a2, int a3, int a4, int a5, int a6, int a7, int a8, int a9, int a10,
+ int a11, int a12, int a13, int a14, int a15, int a16, int a17, int a18, int a19, int a20)
+{
+ int size, len;
+ gz_statep state;
+ z_streamp strm;
+
+ /* get internal structure */
+ if (file == NULL)
+ return -1;
+ state = (gz_statep)file;
+ strm = &(state->strm);
+
+ /* check that can really pass pointer in ints */
+ if (sizeof(int) != sizeof(void *))
+ return 0;
+
+ /* check that we're writing and that there's no error */
+ if (state->mode != GZ_WRITE || state->err != Z_OK)
+ return 0;
+
+ /* make sure we have some buffer space */
+ if (state->size == 0 && gz_init(state) == -1)
+ return 0;
+
+ /* check for seek request */
+ if (state->seek) {
+ state->seek = 0;
+ if (gz_zero(state, state->skip) == -1)
+ return 0;
+ }
+
+ /* consume whatever's left in the input buffer */
+ if (strm->avail_in && gz_comp(state, Z_NO_FLUSH) == -1)
+ return 0;
+
+ /* do the printf() into the input buffer, put length in len */
+ size = (int)(state->size);
+ state->in[size - 1] = 0;
+#ifdef NO_snprintf
+# ifdef HAS_sprintf_void
+ sprintf((char *)(state->in), format, a1, a2, a3, a4, a5, a6, a7, a8,
+ a9, a10, a11, a12, a13, a14, a15, a16, a17, a18, a19, a20);
+ for (len = 0; len < size; len++)
+ if (state->in[len] == 0) break;
+# else
+ len = sprintf((char *)(state->in), format, a1, a2, a3, a4, a5, a6, a7, a8,
+ a9, a10, a11, a12, a13, a14, a15, a16, a17, a18, a19, a20);
+# endif
+#else
+# ifdef HAS_snprintf_void
+ snprintf((char *)(state->in), size, format, a1, a2, a3, a4, a5, a6, a7, a8,
+ a9, a10, a11, a12, a13, a14, a15, a16, a17, a18, a19, a20);
+ len = strlen((char *)(state->in));
+# else
+ len = snprintf((char *)(state->in), size, format, a1, a2, a3, a4, a5, a6,
+ a7, a8, a9, a10, a11, a12, a13, a14, a15, a16, a17, a18,
+ a19, a20);
+# endif
+#endif
+
+ /* check that printf() results fit in buffer */
+ if (len <= 0 || len >= (int)size || state->in[size - 1] != 0)
+ return 0;
+
+ /* update buffer and position, defer compression until needed */
+ strm->avail_in = (unsigned)len;
+ strm->next_in = state->in;
+ state->x.pos += len;
+ return len;
+}
+
+#endif
+
+/* -- see zlib.h -- */
+int ZEXPORT gzflush(gzFile file, int flush)
+{
+ gz_statep state;
+
+ /* get internal structure */
+ if (file == NULL)
+ return -1;
+ state = (gz_statep)file;
+
+ /* check that we're writing and that there's no error */
+ if (state->mode != GZ_WRITE || state->err != Z_OK)
+ return Z_STREAM_ERROR;
+
+ /* check flush parameter */
+ if (flush < 0 || flush > Z_FINISH)
+ return Z_STREAM_ERROR;
+
+ /* check for seek request */
+ if (state->seek) {
+ state->seek = 0;
+ if (gz_zero(state, state->skip) == -1)
+ return -1;
+ }
+
+ /* compress remaining data with requested flush */
+ gz_comp(state, flush);
+ return state->err;
+}
+
+/* -- see zlib.h -- */
+int ZEXPORT gzsetparams(gzFile file, int level, int strategy)
+{
+ gz_statep state;
+ z_streamp strm;
+
+ /* get internal structure */
+ if (file == NULL)
+ return Z_STREAM_ERROR;
+ state = (gz_statep)file;
+ strm = &(state->strm);
+
+ /* check that we're writing and that there's no error */
+ if (state->mode != GZ_WRITE || state->err != Z_OK)
+ return Z_STREAM_ERROR;
+
+ /* if no change is requested, then do nothing */
+ if (level == state->level && strategy == state->strategy)
+ return Z_OK;
+
+ /* check for seek request */
+ if (state->seek) {
+ state->seek = 0;
+ if (gz_zero(state, state->skip) == -1)
+ return -1;
+ }
+
+ /* change compression parameters for subsequent input */
+ if (state->size) {
+ /* flush previous input with previous parameters before changing */
+ if (strm->avail_in && gz_comp(state, Z_PARTIAL_FLUSH) == -1)
+ return state->err;
+ deflateParams(strm, level, strategy);
+ }
+ state->level = level;
+ state->strategy = strategy;
+ return Z_OK;
+}
+
+/* -- see zlib.h -- */
+int gzclose_w(gzFile file)
+{
+ int ret = Z_OK;
+ gz_statep state;
+
+ /* get internal structure */
+ if (file == NULL)
+ return Z_STREAM_ERROR;
+ state = (gz_statep)file;
+
+ /* check that we're writing */
+ if (state->mode != GZ_WRITE)
+ return Z_STREAM_ERROR;
+
+ /* check for seek request */
+ if (state->seek) {
+ state->seek = 0;
+ if (gz_zero(state, state->skip) == -1)
+ ret = state->err;
+ }
+
+ /* flush, free memory, and close file */
+ if (gz_comp(state, Z_FINISH) == -1)
+ ret = state->err;
+ if (state->size) {
+ if (!state->direct) {
+ (void)deflateEnd(&(state->strm));
+ free(state->out);
+ }
+ free(state->in);
+ }
+ gz_error(state, Z_OK, NULL);
+ free(state->path);
+ if (close(state->fd) == -1)
+ ret = Z_ERRNO;
+ free(state);
+ return ret;
+}
--- /dev/null
+/* infback.c -- inflate using a call-back interface
+ * Copyright (C) 1995-2011 Mark Adler
+ * For conditions of distribution and use, see copyright notice in zlib.h
+ */
+
+/*
+ This code is largely copied from inflate.c. Normally either infback.o or
+ inflate.o would be linked into an application--not both. The interface
+ with inffast.c is retained so that optimized assembler-coded versions of
+ inflate_fast() can be used with either inflate.c or infback.c.
+ */
+
+#include "zutil.h"
+#include "inftrees.h"
+#include "inflate.h"
+#include "inffast.h"
+
+/* function prototypes */
+local void fixedtables OF((struct inflate_state FAR *state));
+
+/*
+ strm provides memory allocation functions in zalloc and zfree, or
+ Z_NULL to use the library memory allocation functions.
+
+ windowBits is in the range 8..15, and window is a user-supplied
+ window and output buffer that is 2**windowBits bytes.
+ */
+int ZEXPORT inflateBackInit_(z_streamp strm, int windowBits, unsigned char FAR *window, const char *version, int stream_size)
+{
+ struct inflate_state FAR *state;
+
+ if (version == Z_NULL || version[0] != ZLIB_VERSION[0] ||
+ stream_size != (int)(sizeof(z_stream)))
+ return Z_VERSION_ERROR;
+ if (strm == Z_NULL || window == Z_NULL ||
+ windowBits < 8 || windowBits > 15)
+ return Z_STREAM_ERROR;
+ strm->msg = Z_NULL; /* in case we return an error */
+ if (strm->zalloc == (alloc_func)0) {
+#ifdef Z_SOLO
+ return Z_STREAM_ERROR;
+#else
+ strm->zalloc = zcalloc;
+ strm->opaque = (voidpf)0;
+#endif
+ }
+ if (strm->zfree == Z_NULL)
+#ifdef Z_SOLO
+ return Z_STREAM_ERROR;
+#else
+ strm->zfree = zcfree;
+#endif
+ state = (struct inflate_state FAR *)ZALLOC(strm, 1,
+ sizeof(struct inflate_state));
+ if (state == Z_NULL) return Z_MEM_ERROR;
+ Tracev((stderr, "inflate: allocated\n"));
+ strm->state = (struct internal_state FAR *)state;
+ state->dmax = 32768U;
+ state->wbits = windowBits;
+ state->wsize = 1U << windowBits;
+ state->window = window;
+ state->wnext = 0;
+ state->whave = 0;
+ return Z_OK;
+}
+
+/*
+ Return state with length and distance decoding tables and index sizes set to
+ fixed code decoding. Normally this returns fixed tables from inffixed.h.
+ If BUILDFIXED is defined, then instead this routine builds the tables the
+ first time it's called, and returns those tables the first time and
+ thereafter. This reduces the size of the code by about 2K bytes, in
+ exchange for a little execution time. However, BUILDFIXED should not be
+ used for threaded applications, since the rewriting of the tables and virgin
+ may not be thread-safe.
+ */
+local void fixedtables(struct inflate_state FAR *state)
+{
+#ifdef BUILDFIXED
+ static int virgin = 1;
+ static code *lenfix, *distfix;
+ static code fixed[544];
+
+ /* build fixed huffman tables if first call (may not be thread safe) */
+ if (virgin) {
+ unsigned sym, bits;
+ static code *next;
+
+ /* literal/length table */
+ sym = 0;
+ while (sym < 144) state->lens[sym++] = 8;
+ while (sym < 256) state->lens[sym++] = 9;
+ while (sym < 280) state->lens[sym++] = 7;
+ while (sym < 288) state->lens[sym++] = 8;
+ next = fixed;
+ lenfix = next;
+ bits = 9;
+ inflate_table(LENS, state->lens, 288, &(next), &(bits), state->work);
+
+ /* distance table */
+ sym = 0;
+ while (sym < 32) state->lens[sym++] = 5;
+ distfix = next;
+ bits = 5;
+ inflate_table(DISTS, state->lens, 32, &(next), &(bits), state->work);
+
+ /* do this just once */
+ virgin = 0;
+ }
+#else /* !BUILDFIXED */
+# include "inffixed.h"
+#endif /* BUILDFIXED */
+ state->lencode = lenfix;
+ state->lenbits = 9;
+ state->distcode = distfix;
+ state->distbits = 5;
+}
+
+/* Macros for inflateBack(): */
+
+/* Load returned state from inflate_fast() */
+#define LOAD() \
+ do { \
+ put = strm->next_out; \
+ left = strm->avail_out; \
+ next = strm->next_in; \
+ have = strm->avail_in; \
+ hold = state->hold; \
+ bits = state->bits; \
+ } while (0)
+
+/* Set state from registers for inflate_fast() */
+#define RESTORE() \
+ do { \
+ strm->next_out = put; \
+ strm->avail_out = left; \
+ strm->next_in = next; \
+ strm->avail_in = have; \
+ state->hold = hold; \
+ state->bits = bits; \
+ } while (0)
+
+/* Clear the input bit accumulator */
+#define INITBITS() \
+ do { \
+ hold = 0; \
+ bits = 0; \
+ } while (0)
+
+/* Assure that some input is available. If input is requested, but denied,
+ then return a Z_BUF_ERROR from inflateBack(). */
+#define PULL() \
+ do { \
+ if (have == 0) { \
+ have = in(in_desc, &next); \
+ if (have == 0) { \
+ next = Z_NULL; \
+ ret = Z_BUF_ERROR; \
+ goto inf_leave; \
+ } \
+ } \
+ } while (0)
+
+/* Get a byte of input into the bit accumulator, or return from inflateBack()
+ with an error if there is no input available. */
+#define PULLBYTE() \
+ do { \
+ PULL(); \
+ have--; \
+ hold += (unsigned long)(*next++) << bits; \
+ bits += 8; \
+ } while (0)
+
+/* Assure that there are at least n bits in the bit accumulator. If there is
+ not enough available input to do that, then return from inflateBack() with
+ an error. */
+#define NEEDBITS(n) \
+ do { \
+ while (bits < (unsigned)(n)) \
+ PULLBYTE(); \
+ } while (0)
+
+/* Return the low n bits of the bit accumulator (n < 16) */
+#define BITS(n) \
+ ((unsigned)hold & ((1U << (n)) - 1))
+
+/* Remove n bits from the bit accumulator */
+#define DROPBITS(n) \
+ do { \
+ hold >>= (n); \
+ bits -= (unsigned)(n); \
+ } while (0)
+
+/* Remove zero to seven bits as needed to go to a byte boundary */
+#define BYTEBITS() \
+ do { \
+ hold >>= bits & 7; \
+ bits -= bits & 7; \
+ } while (0)
+
+/* Assure that some output space is available, by writing out the window
+ if it's full. If the write fails, return from inflateBack() with a
+ Z_BUF_ERROR. */
+#define ROOM() \
+ do { \
+ if (left == 0) { \
+ put = state->window; \
+ left = state->wsize; \
+ state->whave = left; \
+ if (out(out_desc, put, left)) { \
+ ret = Z_BUF_ERROR; \
+ goto inf_leave; \
+ } \
+ } \
+ } while (0)
+
+/*
+ strm provides the memory allocation functions and window buffer on input,
+ and provides information on the unused input on return. For Z_DATA_ERROR
+ returns, strm will also provide an error message.
+
+ in() and out() are the call-back input and output functions. When
+ inflateBack() needs more input, it calls in(). When inflateBack() has
+ filled the window with output, or when it completes with data in the
+ window, it calls out() to write out the data. The application must not
+ change the provided input until in() is called again or inflateBack()
+ returns. The application must not change the window/output buffer until
+ inflateBack() returns.
+
+ in() and out() are called with a descriptor parameter provided in the
+ inflateBack() call. This parameter can be a structure that provides the
+ information required to do the read or write, as well as accumulated
+ information on the input and output such as totals and check values.
+
+ in() should return zero on failure. out() should return non-zero on
+ failure. If either in() or out() fails, than inflateBack() returns a
+ Z_BUF_ERROR. strm->next_in can be checked for Z_NULL to see whether it
+ was in() or out() that caused in the error. Otherwise, inflateBack()
+ returns Z_STREAM_END on success, Z_DATA_ERROR for an deflate format
+ error, or Z_MEM_ERROR if it could not allocate memory for the state.
+ inflateBack() can also return Z_STREAM_ERROR if the input parameters
+ are not correct, i.e. strm is Z_NULL or the state was not initialized.
+ */
+int ZEXPORT inflateBack(z_streamp strm, in_func in, void FAR *in_desc, out_func out, void FAR *out_desc)
+{
+ struct inflate_state FAR *state;
+ z_const unsigned char FAR *next; /* next input */
+ unsigned char FAR *put; /* next output */
+ unsigned have, left; /* available input and output */
+ unsigned long hold; /* bit buffer */
+ unsigned bits; /* bits in bit buffer */
+ unsigned copy; /* number of stored or match bytes to copy */
+ unsigned char FAR *from; /* where to copy match bytes from */
+ code here; /* current decoding table entry */
+ code last; /* parent table entry */
+ unsigned len; /* length to copy for repeats, bits to drop */
+ int ret; /* return code */
+ static const unsigned short order[19] = /* permutation of code lengths */
+ {16, 17, 18, 0, 8, 7, 9, 6, 10, 5, 11, 4, 12, 3, 13, 2, 14, 1, 15};
+
+ /* Check that the strm exists and that the state was initialized */
+ if (strm == Z_NULL || strm->state == Z_NULL)
+ return Z_STREAM_ERROR;
+ state = (struct inflate_state FAR *)strm->state;
+
+ /* Reset the state */
+ strm->msg = Z_NULL;
+ state->mode = TYPE;
+ state->last = 0;
+ state->whave = 0;
+ next = strm->next_in;
+ have = next != Z_NULL ? strm->avail_in : 0;
+ hold = 0;
+ bits = 0;
+ put = state->window;
+ left = state->wsize;
+
+ /* Inflate until end of block marked as last */
+ for (;;)
+ switch (state->mode) {
+ case TYPE:
+ /* determine and dispatch block type */
+ if (state->last) {
+ BYTEBITS();
+ state->mode = DONE;
+ break;
+ }
+ NEEDBITS(3);
+ state->last = BITS(1);
+ DROPBITS(1);
+ switch (BITS(2)) {
+ case 0: /* stored block */
+ Tracev((stderr, "inflate: stored block%s\n",
+ state->last ? " (last)" : ""));
+ state->mode = STORED;
+ break;
+ case 1: /* fixed block */
+ fixedtables(state);
+ Tracev((stderr, "inflate: fixed codes block%s\n",
+ state->last ? " (last)" : ""));
+ state->mode = LEN; /* decode codes */
+ break;
+ case 2: /* dynamic block */
+ Tracev((stderr, "inflate: dynamic codes block%s\n",
+ state->last ? " (last)" : ""));
+ state->mode = TABLE;
+ break;
+ case 3:
+ strm->msg = (char *)"invalid block type";
+ state->mode = BAD;
+ }
+ DROPBITS(2);
+ break;
+
+ case STORED:
+ /* get and verify stored block length */
+ BYTEBITS(); /* go to byte boundary */
+ NEEDBITS(32);
+ if ((hold & 0xffff) != ((hold >> 16) ^ 0xffff)) {
+ strm->msg = (char *)"invalid stored block lengths";
+ state->mode = BAD;
+ break;
+ }
+ state->length = (unsigned)hold & 0xffff;
+ Tracev((stderr, "inflate: stored length %u\n",
+ state->length));
+ INITBITS();
+
+ /* copy stored block from input to output */
+ while (state->length != 0) {
+ copy = state->length;
+ PULL();
+ ROOM();
+ if (copy > have) copy = have;
+ if (copy > left) copy = left;
+ zmemcpy(put, next, copy);
+ have -= copy;
+ next += copy;
+ left -= copy;
+ put += copy;
+ state->length -= copy;
+ }
+ Tracev((stderr, "inflate: stored end\n"));
+ state->mode = TYPE;
+ break;
+
+ case TABLE:
+ /* get dynamic table entries descriptor */
+ NEEDBITS(14);
+ state->nlen = BITS(5) + 257;
+ DROPBITS(5);
+ state->ndist = BITS(5) + 1;
+ DROPBITS(5);
+ state->ncode = BITS(4) + 4;
+ DROPBITS(4);
+#ifndef PKZIP_BUG_WORKAROUND
+ if (state->nlen > 286 || state->ndist > 30) {
+ strm->msg = (char *)"too many length or distance symbols";
+ state->mode = BAD;
+ break;
+ }
+#endif
+ Tracev((stderr, "inflate: table sizes ok\n"));
+
+ /* get code length code lengths (not a typo) */
+ state->have = 0;
+ while (state->have < state->ncode) {
+ NEEDBITS(3);
+ state->lens[order[state->have++]] = (unsigned short)BITS(3);
+ DROPBITS(3);
+ }
+ while (state->have < 19)
+ state->lens[order[state->have++]] = 0;
+ state->next = state->codes;
+ state->lencode = (code const FAR *)(state->next);
+ state->lenbits = 7;
+ ret = inflate_table(CODES, state->lens, 19, &(state->next),
+ &(state->lenbits), state->work);
+ if (ret) {
+ strm->msg = (char *)"invalid code lengths set";
+ state->mode = BAD;
+ break;
+ }
+ Tracev((stderr, "inflate: code lengths ok\n"));
+
+ /* get length and distance code code lengths */
+ state->have = 0;
+ while (state->have < state->nlen + state->ndist) {
+ for (;;) {
+ here = state->lencode[BITS(state->lenbits)];
+ if ((unsigned)(here.bits) <= bits) break;
+ PULLBYTE();
+ }
+ if (here.val < 16) {
+ DROPBITS(here.bits);
+ state->lens[state->have++] = here.val;
+ }
+ else {
+ if (here.val == 16) {
+ NEEDBITS(here.bits + 2);
+ DROPBITS(here.bits);
+ if (state->have == 0) {
+ strm->msg = (char *)"invalid bit length repeat";
+ state->mode = BAD;
+ break;
+ }
+ len = (unsigned)(state->lens[state->have - 1]);
+ copy = 3 + BITS(2);
+ DROPBITS(2);
+ }
+ else if (here.val == 17) {
+ NEEDBITS(here.bits + 3);
+ DROPBITS(here.bits);
+ len = 0;
+ copy = 3 + BITS(3);
+ DROPBITS(3);
+ }
+ else {
+ NEEDBITS(here.bits + 7);
+ DROPBITS(here.bits);
+ len = 0;
+ copy = 11 + BITS(7);
+ DROPBITS(7);
+ }
+ if (state->have + copy > state->nlen + state->ndist) {
+ strm->msg = (char *)"invalid bit length repeat";
+ state->mode = BAD;
+ break;
+ }
+ while (copy--)
+ state->lens[state->have++] = (unsigned short)len;
+ }
+ }
+
+ /* handle error breaks in while */
+ if (state->mode == BAD) break;
+
+ /* check for end-of-block code (better have one) */
+ if (state->lens[256] == 0) {
+ strm->msg = (char *)"invalid code -- missing end-of-block";
+ state->mode = BAD;
+ break;
+ }
+
+ /* build code tables -- note: do not change the lenbits or distbits
+ values here (9 and 6) without reading the comments in inftrees.h
+ concerning the ENOUGH constants, which depend on those values */
+ state->next = state->codes;
+ state->lencode = (code const FAR *)(state->next);
+ state->lenbits = 9;
+ ret = inflate_table(LENS, state->lens, state->nlen, &(state->next),
+ &(state->lenbits), state->work);
+ if (ret) {
+ strm->msg = (char *)"invalid literal/lengths set";
+ state->mode = BAD;
+ break;
+ }
+ state->distcode = (code const FAR *)(state->next);
+ state->distbits = 6;
+ ret = inflate_table(DISTS, state->lens + state->nlen, state->ndist,
+ &(state->next), &(state->distbits), state->work);
+ if (ret) {
+ strm->msg = (char *)"invalid distances set";
+ state->mode = BAD;
+ break;
+ }
+ Tracev((stderr, "inflate: codes ok\n"));
+ state->mode = LEN;
+
+ case LEN:
+ /* use inflate_fast() if we have enough input and output */
+ if (have >= 6 && left >= 258) {
+ RESTORE();
+ if (state->whave < state->wsize)
+ state->whave = state->wsize - left;
+ inflate_fast(strm, state->wsize);
+ LOAD();
+ break;
+ }
+
+ /* get a literal, length, or end-of-block code */
+ for (;;) {
+ here = state->lencode[BITS(state->lenbits)];
+ if ((unsigned)(here.bits) <= bits) break;
+ PULLBYTE();
+ }
+ if (here.op && (here.op & 0xf0) == 0) {
+ last = here;
+ for (;;) {
+ here = state->lencode[last.val +
+ (BITS(last.bits + last.op) >> last.bits)];
+ if ((unsigned)(last.bits + here.bits) <= bits) break;
+ PULLBYTE();
+ }
+ DROPBITS(last.bits);
+ }
+ DROPBITS(here.bits);
+ state->length = (unsigned)here.val;
+
+ /* process literal */
+ if (here.op == 0) {
+ Tracevv((stderr, here.val >= 0x20 && here.val < 0x7f ?
+ "inflate: literal '%c'\n" :
+ "inflate: literal 0x%02x\n", here.val));
+ ROOM();
+ *put++ = (unsigned char)(state->length);
+ left--;
+ state->mode = LEN;
+ break;
+ }
+
+ /* process end of block */
+ if (here.op & 32) {
+ Tracevv((stderr, "inflate: end of block\n"));
+ state->mode = TYPE;
+ break;
+ }
+
+ /* invalid code */
+ if (here.op & 64) {
+ strm->msg = (char *)"invalid literal/length code";
+ state->mode = BAD;
+ break;
+ }
+
+ /* length code -- get extra bits, if any */
+ state->extra = (unsigned)(here.op) & 15;
+ if (state->extra != 0) {
+ NEEDBITS(state->extra);
+ state->length += BITS(state->extra);
+ DROPBITS(state->extra);
+ }
+ Tracevv((stderr, "inflate: length %u\n", state->length));
+
+ /* get distance code */
+ for (;;) {
+ here = state->distcode[BITS(state->distbits)];
+ if ((unsigned)(here.bits) <= bits) break;
+ PULLBYTE();
+ }
+ if ((here.op & 0xf0) == 0) {
+ last = here;
+ for (;;) {
+ here = state->distcode[last.val +
+ (BITS(last.bits + last.op) >> last.bits)];
+ if ((unsigned)(last.bits + here.bits) <= bits) break;
+ PULLBYTE();
+ }
+ DROPBITS(last.bits);
+ }
+ DROPBITS(here.bits);
+ if (here.op & 64) {
+ strm->msg = (char *)"invalid distance code";
+ state->mode = BAD;
+ break;
+ }
+ state->offset = (unsigned)here.val;
+
+ /* get distance extra bits, if any */
+ state->extra = (unsigned)(here.op) & 15;
+ if (state->extra != 0) {
+ NEEDBITS(state->extra);
+ state->offset += BITS(state->extra);
+ DROPBITS(state->extra);
+ }
+ if (state->offset > state->wsize - (state->whave < state->wsize ?
+ left : 0)) {
+ strm->msg = (char *)"invalid distance too far back";
+ state->mode = BAD;
+ break;
+ }
+ Tracevv((stderr, "inflate: distance %u\n", state->offset));
+
+ /* copy match from window to output */
+ do {
+ ROOM();
+ copy = state->wsize - state->offset;
+ if (copy < left) {
+ from = put + copy;
+ copy = left - copy;
+ }
+ else {
+ from = put - state->offset;
+ copy = left;
+ }
+ if (copy > state->length) copy = state->length;
+ state->length -= copy;
+ left -= copy;
+ do {
+ *put++ = *from++;
+ } while (--copy);
+ } while (state->length != 0);
+ break;
+
+ case DONE:
+ /* inflate stream terminated properly -- write leftover output */
+ ret = Z_STREAM_END;
+ if (left < state->wsize) {
+ if (out(out_desc, state->window, state->wsize - left))
+ ret = Z_BUF_ERROR;
+ }
+ goto inf_leave;
+
+ case BAD:
+ ret = Z_DATA_ERROR;
+ goto inf_leave;
+
+ default: /* can't happen, but makes compilers happy */
+ ret = Z_STREAM_ERROR;
+ goto inf_leave;
+ }
+
+ /* Return unused input */
+inf_leave:
+ strm->next_in = next;
+ strm->avail_in = have;
+ return ret;
+}
+
+int ZEXPORT inflateBackEnd(z_streamp strm)
+{
+ if (strm == Z_NULL || strm->state == Z_NULL || strm->zfree == Z_NULL)
+ return Z_STREAM_ERROR;
+ ZFREE(strm, strm->state);
+ strm->state = Z_NULL;
+ Tracev((stderr, "inflate: end\n"));
+ return Z_OK;
+}
--- /dev/null
+/* inffast.c -- fast decoding
+ * Copyright (C) 1995-2008, 2010, 2013 Mark Adler
+ * For conditions of distribution and use, see copyright notice in zlib.h
+ */
+
+#include "zutil.h"
+#include "inftrees.h"
+#include "inflate.h"
+#include "inffast.h"
+
+#ifndef ASMINF
+
+/* Allow machine dependent optimization for post-increment or pre-increment.
+ Based on testing to date,
+ Pre-increment preferred for:
+ - PowerPC G3 (Adler)
+ - MIPS R5000 (Randers-Pehrson)
+ Post-increment preferred for:
+ - none
+ No measurable difference:
+ - Pentium III (Anderson)
+ - M68060 (Nikl)
+ */
+#ifdef POSTINC
+# define OFF 0
+# define PUP(a) *(a)++
+#else
+# define OFF 1
+# define PUP(a) *++(a)
+#endif
+
+/*
+ Decode literal, length, and distance codes and write out the resulting
+ literal and match bytes until either not enough input or output is
+ available, an end-of-block is encountered, or a data error is encountered.
+ When large enough input and output buffers are supplied to inflate(), for
+ example, a 16K input buffer and a 64K output buffer, more than 95% of the
+ inflate execution time is spent in this routine.
+
+ Entry assumptions:
+
+ state->mode == LEN
+ strm->avail_in >= 6
+ strm->avail_out >= 258
+ start >= strm->avail_out
+ state->bits < 8
+
+ On return, state->mode is one of:
+
+ LEN -- ran out of enough output space or enough available input
+ TYPE -- reached end of block code, inflate() to interpret next block
+ BAD -- error in block data
+
+Notes:
+
+- The maximum input bits used by a length/distance pair is 15 bits for the
+length code, 5 bits for the length extra, 15 bits for the distance code,
+and 13 bits for the distance extra. This totals 48 bits, or six bytes.
+Therefore if strm->avail_in >= 6, then there is enough input to avoid
+checking for available input while decoding.
+
+- The maximum bytes that a single length/distance pair can output is 258
+bytes, which is the maximum length that can be coded. inflate_fast()
+requires strm->avail_out >= 258 for each loop to avoid checking for
+output space.
+*/
+void ZLIB_INTERNAL inflate_fast(z_streamp strm, unsigned start)
+{
+ struct inflate_state FAR *state;
+ unsigned char FAR *in; /* local strm->next_in */
+ unsigned char FAR *last; /* have enough input while in < last */
+ unsigned char FAR *out; /* local strm->next_out */
+ unsigned char FAR *beg; /* inflate()'s initial strm->next_out */
+ unsigned char FAR *end; /* while out < end, enough space available */
+#ifdef INFLATE_STRICT
+ unsigned dmax; /* maximum distance from zlib header */
+#endif
+ unsigned wsize; /* window size or zero if not using window */
+ unsigned whave; /* valid bytes in the window */
+ unsigned wnext; /* window write index */
+ unsigned char FAR *window; /* allocated sliding window, if wsize != 0 */
+ unsigned long hold; /* local strm->hold */
+ unsigned bits; /* local strm->bits */
+ code const FAR *lcode; /* local strm->lencode */
+ code const FAR *dcode; /* local strm->distcode */
+ unsigned lmask; /* mask for first level of length codes */
+ unsigned dmask; /* mask for first level of distance codes */
+ code here; /* retrieved table entry */
+ unsigned op; /* code bits, operation, extra bits, or */
+ /* window position, window bytes to copy */
+ unsigned len; /* match length, unused bytes */
+ unsigned dist; /* match distance */
+ unsigned char FAR *from; /* where to copy match from */
+
+ /* copy state to local variables */
+ state = (struct inflate_state FAR *)strm->state;
+ in = strm->next_in - OFF;
+ last = in + (strm->avail_in - 5);
+ out = strm->next_out - OFF;
+ beg = out - (start - strm->avail_out);
+ end = out + (strm->avail_out - 257);
+#ifdef INFLATE_STRICT
+ dmax = state->dmax;
+#endif
+ wsize = state->wsize;
+ whave = state->whave;
+ wnext = state->wnext;
+ window = state->window;
+ hold = state->hold;
+ bits = state->bits;
+ lcode = state->lencode;
+ dcode = state->distcode;
+ lmask = (1U << state->lenbits) - 1;
+ dmask = (1U << state->distbits) - 1;
+
+ /* decode literals and length/distances until end-of-block or not enough
+ input data or output space */
+ do {
+ if (bits < 15) {
+ hold += (unsigned long)(PUP(in)) << bits;
+ bits += 8;
+ hold += (unsigned long)(PUP(in)) << bits;
+ bits += 8;
+ }
+ here = lcode[hold & lmask];
+dolen:
+ op = (unsigned)(here.bits);
+ hold >>= op;
+ bits -= op;
+ op = (unsigned)(here.op);
+ if (op == 0) { /* literal */
+ Tracevv((stderr, here.val >= 0x20 && here.val < 0x7f ?
+ "inflate: literal '%c'\n" :
+ "inflate: literal 0x%02x\n", here.val));
+ PUP(out) = (unsigned char)(here.val);
+ }
+ else if (op & 16) { /* length base */
+ len = (unsigned)(here.val);
+ op &= 15; /* number of extra bits */
+ if (op) {
+ if (bits < op) {
+ hold += (unsigned long)(PUP(in)) << bits;
+ bits += 8;
+ }
+ len += (unsigned)hold & ((1U << op) - 1);
+ hold >>= op;
+ bits -= op;
+ }
+ Tracevv((stderr, "inflate: length %u\n", len));
+ if (bits < 15) {
+ hold += (unsigned long)(PUP(in)) << bits;
+ bits += 8;
+ hold += (unsigned long)(PUP(in)) << bits;
+ bits += 8;
+ }
+ here = dcode[hold & dmask];
+dodist:
+ op = (unsigned)(here.bits);
+ hold >>= op;
+ bits -= op;
+ op = (unsigned)(here.op);
+ if (op & 16) { /* distance base */
+ dist = (unsigned)(here.val);
+ op &= 15; /* number of extra bits */
+ if (bits < op) {
+ hold += (unsigned long)(PUP(in)) << bits;
+ bits += 8;
+ if (bits < op) {
+ hold += (unsigned long)(PUP(in)) << bits;
+ bits += 8;
+ }
+ }
+ dist += (unsigned)hold & ((1U << op) - 1);
+#ifdef INFLATE_STRICT
+ if (dist > dmax) {
+ strm->msg = (char *)"invalid distance too far back";
+ state->mode = BAD;
+ break;
+ }
+#endif
+ hold >>= op;
+ bits -= op;
+ Tracevv((stderr, "inflate: distance %u\n", dist));
+ op = (unsigned)(out - beg); /* max distance in output */
+ if (dist > op) { /* see if copy from window */
+ op = dist - op; /* distance back in window */
+ if (op > whave) {
+ if (state->sane) {
+ strm->msg =
+ (char *)"invalid distance too far back";
+ state->mode = BAD;
+ break;
+ }
+#ifdef INFLATE_ALLOW_INVALID_DISTANCE_TOOFAR_ARRR
+ if (len <= op - whave) {
+ do {
+ PUP(out) = 0;
+ } while (--len);
+ continue;
+ }
+ len -= op - whave;
+ do {
+ PUP(out) = 0;
+ } while (--op > whave);
+ if (op == 0) {
+ from = out - dist;
+ do {
+ PUP(out) = PUP(from);
+ } while (--len);
+ continue;
+ }
+#endif
+ }
+ from = window - OFF;
+ if (wnext == 0) { /* very common case */
+ from += wsize - op;
+ if (op < len) { /* some from window */
+ len -= op;
+ do {
+ PUP(out) = PUP(from);
+ } while (--op);
+ from = out - dist; /* rest from output */
+ }
+ }
+ else if (wnext < op) { /* wrap around window */
+ from += wsize + wnext - op;
+ op -= wnext;
+ if (op < len) { /* some from end of window */
+ len -= op;
+ do {
+ PUP(out) = PUP(from);
+ } while (--op);
+ from = window - OFF;
+ if (wnext < len) { /* some from start of window */
+ op = wnext;
+ len -= op;
+ do {
+ PUP(out) = PUP(from);
+ } while (--op);
+ from = out - dist; /* rest from output */
+ }
+ }
+ }
+ else { /* contiguous in window */
+ from += wnext - op;
+ if (op < len) { /* some from window */
+ len -= op;
+ do {
+ PUP(out) = PUP(from);
+ } while (--op);
+ from = out - dist; /* rest from output */
+ }
+ }
+ while (len > 2) {
+ PUP(out) = PUP(from);
+ PUP(out) = PUP(from);
+ PUP(out) = PUP(from);
+ len -= 3;
+ }
+ if (len) {
+ PUP(out) = PUP(from);
+ if (len > 1)
+ PUP(out) = PUP(from);
+ }
+ }
+ else {
+ from = out - dist; /* copy direct from output */
+ do { /* minimum length is three */
+ PUP(out) = PUP(from);
+ PUP(out) = PUP(from);
+ PUP(out) = PUP(from);
+ len -= 3;
+ } while (len > 2);
+ if (len) {
+ PUP(out) = PUP(from);
+ if (len > 1)
+ PUP(out) = PUP(from);
+ }
+ }
+ }
+ else if ((op & 64) == 0) { /* 2nd level distance code */
+ here = dcode[here.val + (hold & ((1U << op) - 1))];
+ goto dodist;
+ }
+ else {
+ strm->msg = (char *)"invalid distance code";
+ state->mode = BAD;
+ break;
+ }
+ }
+ else if ((op & 64) == 0) { /* 2nd level length code */
+ here = lcode[here.val + (hold & ((1U << op) - 1))];
+ goto dolen;
+ }
+ else if (op & 32) { /* end-of-block */
+ Tracevv((stderr, "inflate: end of block\n"));
+ state->mode = TYPE;
+ break;
+ }
+ else {
+ strm->msg = (char *)"invalid literal/length code";
+ state->mode = BAD;
+ break;
+ }
+ } while (in < last && out < end);
+
+ /* return unused bytes (on entry, bits < 8, so in won't go too far back) */
+ len = bits >> 3;
+ in -= len;
+ bits -= len << 3;
+ hold &= (1U << bits) - 1;
+
+ /* update state and return */
+ strm->next_in = in + OFF;
+ strm->next_out = out + OFF;
+ strm->avail_in = (unsigned)(in < last ? 5 + (last - in) : 5 - (in - last));
+ strm->avail_out = (unsigned)(out < end ?
+ 257 + (end - out) : 257 - (out - end));
+ state->hold = hold;
+ state->bits = bits;
+ return;
+}
+
+/*
+ inflate_fast() speedups that turned out slower (on a PowerPC G3 750CXe):
+ - Using bit fields for code structure
+ - Different op definition to avoid & for extra bits (do & for table bits)
+ - Three separate decoding do-loops for direct, window, and wnext == 0
+ - Special case for distance > 1 copies to do overlapped load and store copy
+ - Explicit branch predictions (based on measured branch probabilities)
+ - Deferring match copy and interspersed it with decoding subsequent codes
+ - Swapping literal/length else
+ - Swapping window/direct else
+ - Larger unrolled copy loops (three is about right)
+ - Moving len -= 3 statement into middle of loop
+ */
+
+#endif /* !ASMINF */
--- /dev/null
+/* inffast.h -- header to use inffast.c
+ * Copyright (C) 1995-2003, 2010 Mark Adler
+ * For conditions of distribution and use, see copyright notice in zlib.h
+ */
+
+/* WARNING: this file should *not* be used by applications. It is
+ part of the implementation of the compression library and is
+ subject to change. Applications should only use zlib.h.
+ */
+#ifndef _INFFAST_H
+#define _INFFAST_H
+
+void ZLIB_INTERNAL inflate_fast OF((z_streamp strm, unsigned start));
+
+#endif
--- /dev/null
+#ifndef _INFFIXED_H
+#define _INFFIXED_H
+
+/* inffixed.h -- table for decoding fixed codes
+ * Generated automatically by makefixed().
+ */
+
+ /* WARNING: this file should *not* be used by applications.
+ It is part of the implementation of this library and is
+ subject to change. Applications should only use zlib.h.
+ */
+
+ static const code lenfix[512] = {
+ {96,7,0},{0,8,80},{0,8,16},{20,8,115},{18,7,31},{0,8,112},{0,8,48},
+ {0,9,192},{16,7,10},{0,8,96},{0,8,32},{0,9,160},{0,8,0},{0,8,128},
+ {0,8,64},{0,9,224},{16,7,6},{0,8,88},{0,8,24},{0,9,144},{19,7,59},
+ {0,8,120},{0,8,56},{0,9,208},{17,7,17},{0,8,104},{0,8,40},{0,9,176},
+ {0,8,8},{0,8,136},{0,8,72},{0,9,240},{16,7,4},{0,8,84},{0,8,20},
+ {21,8,227},{19,7,43},{0,8,116},{0,8,52},{0,9,200},{17,7,13},{0,8,100},
+ {0,8,36},{0,9,168},{0,8,4},{0,8,132},{0,8,68},{0,9,232},{16,7,8},
+ {0,8,92},{0,8,28},{0,9,152},{20,7,83},{0,8,124},{0,8,60},{0,9,216},
+ {18,7,23},{0,8,108},{0,8,44},{0,9,184},{0,8,12},{0,8,140},{0,8,76},
+ {0,9,248},{16,7,3},{0,8,82},{0,8,18},{21,8,163},{19,7,35},{0,8,114},
+ {0,8,50},{0,9,196},{17,7,11},{0,8,98},{0,8,34},{0,9,164},{0,8,2},
+ {0,8,130},{0,8,66},{0,9,228},{16,7,7},{0,8,90},{0,8,26},{0,9,148},
+ {20,7,67},{0,8,122},{0,8,58},{0,9,212},{18,7,19},{0,8,106},{0,8,42},
+ {0,9,180},{0,8,10},{0,8,138},{0,8,74},{0,9,244},{16,7,5},{0,8,86},
+ {0,8,22},{64,8,0},{19,7,51},{0,8,118},{0,8,54},{0,9,204},{17,7,15},
+ {0,8,102},{0,8,38},{0,9,172},{0,8,6},{0,8,134},{0,8,70},{0,9,236},
+ {16,7,9},{0,8,94},{0,8,30},{0,9,156},{20,7,99},{0,8,126},{0,8,62},
+ {0,9,220},{18,7,27},{0,8,110},{0,8,46},{0,9,188},{0,8,14},{0,8,142},
+ {0,8,78},{0,9,252},{96,7,0},{0,8,81},{0,8,17},{21,8,131},{18,7,31},
+ {0,8,113},{0,8,49},{0,9,194},{16,7,10},{0,8,97},{0,8,33},{0,9,162},
+ {0,8,1},{0,8,129},{0,8,65},{0,9,226},{16,7,6},{0,8,89},{0,8,25},
+ {0,9,146},{19,7,59},{0,8,121},{0,8,57},{0,9,210},{17,7,17},{0,8,105},
+ {0,8,41},{0,9,178},{0,8,9},{0,8,137},{0,8,73},{0,9,242},{16,7,4},
+ {0,8,85},{0,8,21},{16,8,258},{19,7,43},{0,8,117},{0,8,53},{0,9,202},
+ {17,7,13},{0,8,101},{0,8,37},{0,9,170},{0,8,5},{0,8,133},{0,8,69},
+ {0,9,234},{16,7,8},{0,8,93},{0,8,29},{0,9,154},{20,7,83},{0,8,125},
+ {0,8,61},{0,9,218},{18,7,23},{0,8,109},{0,8,45},{0,9,186},{0,8,13},
+ {0,8,141},{0,8,77},{0,9,250},{16,7,3},{0,8,83},{0,8,19},{21,8,195},
+ {19,7,35},{0,8,115},{0,8,51},{0,9,198},{17,7,11},{0,8,99},{0,8,35},
+ {0,9,166},{0,8,3},{0,8,131},{0,8,67},{0,9,230},{16,7,7},{0,8,91},
+ {0,8,27},{0,9,150},{20,7,67},{0,8,123},{0,8,59},{0,9,214},{18,7,19},
+ {0,8,107},{0,8,43},{0,9,182},{0,8,11},{0,8,139},{0,8,75},{0,9,246},
+ {16,7,5},{0,8,87},{0,8,23},{64,8,0},{19,7,51},{0,8,119},{0,8,55},
+ {0,9,206},{17,7,15},{0,8,103},{0,8,39},{0,9,174},{0,8,7},{0,8,135},
+ {0,8,71},{0,9,238},{16,7,9},{0,8,95},{0,8,31},{0,9,158},{20,7,99},
+ {0,8,127},{0,8,63},{0,9,222},{18,7,27},{0,8,111},{0,8,47},{0,9,190},
+ {0,8,15},{0,8,143},{0,8,79},{0,9,254},{96,7,0},{0,8,80},{0,8,16},
+ {20,8,115},{18,7,31},{0,8,112},{0,8,48},{0,9,193},{16,7,10},{0,8,96},
+ {0,8,32},{0,9,161},{0,8,0},{0,8,128},{0,8,64},{0,9,225},{16,7,6},
+ {0,8,88},{0,8,24},{0,9,145},{19,7,59},{0,8,120},{0,8,56},{0,9,209},
+ {17,7,17},{0,8,104},{0,8,40},{0,9,177},{0,8,8},{0,8,136},{0,8,72},
+ {0,9,241},{16,7,4},{0,8,84},{0,8,20},{21,8,227},{19,7,43},{0,8,116},
+ {0,8,52},{0,9,201},{17,7,13},{0,8,100},{0,8,36},{0,9,169},{0,8,4},
+ {0,8,132},{0,8,68},{0,9,233},{16,7,8},{0,8,92},{0,8,28},{0,9,153},
+ {20,7,83},{0,8,124},{0,8,60},{0,9,217},{18,7,23},{0,8,108},{0,8,44},
+ {0,9,185},{0,8,12},{0,8,140},{0,8,76},{0,9,249},{16,7,3},{0,8,82},
+ {0,8,18},{21,8,163},{19,7,35},{0,8,114},{0,8,50},{0,9,197},{17,7,11},
+ {0,8,98},{0,8,34},{0,9,165},{0,8,2},{0,8,130},{0,8,66},{0,9,229},
+ {16,7,7},{0,8,90},{0,8,26},{0,9,149},{20,7,67},{0,8,122},{0,8,58},
+ {0,9,213},{18,7,19},{0,8,106},{0,8,42},{0,9,181},{0,8,10},{0,8,138},
+ {0,8,74},{0,9,245},{16,7,5},{0,8,86},{0,8,22},{64,8,0},{19,7,51},
+ {0,8,118},{0,8,54},{0,9,205},{17,7,15},{0,8,102},{0,8,38},{0,9,173},
+ {0,8,6},{0,8,134},{0,8,70},{0,9,237},{16,7,9},{0,8,94},{0,8,30},
+ {0,9,157},{20,7,99},{0,8,126},{0,8,62},{0,9,221},{18,7,27},{0,8,110},
+ {0,8,46},{0,9,189},{0,8,14},{0,8,142},{0,8,78},{0,9,253},{96,7,0},
+ {0,8,81},{0,8,17},{21,8,131},{18,7,31},{0,8,113},{0,8,49},{0,9,195},
+ {16,7,10},{0,8,97},{0,8,33},{0,9,163},{0,8,1},{0,8,129},{0,8,65},
+ {0,9,227},{16,7,6},{0,8,89},{0,8,25},{0,9,147},{19,7,59},{0,8,121},
+ {0,8,57},{0,9,211},{17,7,17},{0,8,105},{0,8,41},{0,9,179},{0,8,9},
+ {0,8,137},{0,8,73},{0,9,243},{16,7,4},{0,8,85},{0,8,21},{16,8,258},
+ {19,7,43},{0,8,117},{0,8,53},{0,9,203},{17,7,13},{0,8,101},{0,8,37},
+ {0,9,171},{0,8,5},{0,8,133},{0,8,69},{0,9,235},{16,7,8},{0,8,93},
+ {0,8,29},{0,9,155},{20,7,83},{0,8,125},{0,8,61},{0,9,219},{18,7,23},
+ {0,8,109},{0,8,45},{0,9,187},{0,8,13},{0,8,141},{0,8,77},{0,9,251},
+ {16,7,3},{0,8,83},{0,8,19},{21,8,195},{19,7,35},{0,8,115},{0,8,51},
+ {0,9,199},{17,7,11},{0,8,99},{0,8,35},{0,9,167},{0,8,3},{0,8,131},
+ {0,8,67},{0,9,231},{16,7,7},{0,8,91},{0,8,27},{0,9,151},{20,7,67},
+ {0,8,123},{0,8,59},{0,9,215},{18,7,19},{0,8,107},{0,8,43},{0,9,183},
+ {0,8,11},{0,8,139},{0,8,75},{0,9,247},{16,7,5},{0,8,87},{0,8,23},
+ {64,8,0},{19,7,51},{0,8,119},{0,8,55},{0,9,207},{17,7,15},{0,8,103},
+ {0,8,39},{0,9,175},{0,8,7},{0,8,135},{0,8,71},{0,9,239},{16,7,9},
+ {0,8,95},{0,8,31},{0,9,159},{20,7,99},{0,8,127},{0,8,63},{0,9,223},
+ {18,7,27},{0,8,111},{0,8,47},{0,9,191},{0,8,15},{0,8,143},{0,8,79},
+ {0,9,255}
+ };
+
+ static const code distfix[32] = {
+ {16,5,1},{23,5,257},{19,5,17},{27,5,4097},{17,5,5},{25,5,1025},
+ {21,5,65},{29,5,16385},{16,5,3},{24,5,513},{20,5,33},{28,5,8193},
+ {18,5,9},{26,5,2049},{22,5,129},{64,5,0},{16,5,2},{23,5,385},
+ {19,5,25},{27,5,6145},{17,5,7},{25,5,1537},{21,5,97},{29,5,24577},
+ {16,5,4},{24,5,769},{20,5,49},{28,5,12289},{18,5,13},{26,5,3073},
+ {22,5,193},{64,5,0}
+ };
+
+#endif
--- /dev/null
+/* inflate.c -- zlib decompression
+ * Copyright (C) 1995-2012 Mark Adler
+ * For conditions of distribution and use, see copyright notice in zlib.h
+ */
+
+/*
+ * Change history:
+ *
+ * 1.2.beta0 24 Nov 2002
+ * - First version -- complete rewrite of inflate to simplify code, avoid
+ * creation of window when not needed, minimize use of window when it is
+ * needed, make inffast.c even faster, implement gzip decoding, and to
+ * improve code readability and style over the previous zlib inflate code
+ *
+ * 1.2.beta1 25 Nov 2002
+ * - Use pointers for available input and output checking in inffast.c
+ * - Remove input and output counters in inffast.c
+ * - Change inffast.c entry and loop from avail_in >= 7 to >= 6
+ * - Remove unnecessary second byte pull from length extra in inffast.c
+ * - Unroll direct copy to three copies per loop in inffast.c
+ *
+ * 1.2.beta2 4 Dec 2002
+ * - Change external routine names to reduce potential conflicts
+ * - Correct filename to inffixed.h for fixed tables in inflate.c
+ * - Make hbuf[] unsigned char to match parameter type in inflate.c
+ * - Change strm->next_out[-state->offset] to *(strm->next_out - state->offset)
+ * to avoid negation problem on Alphas (64 bit) in inflate.c
+ *
+ * 1.2.beta3 22 Dec 2002
+ * - Add comments on state->bits assertion in inffast.c
+ * - Add comments on op field in inftrees.h
+ * - Fix bug in reuse of allocated window after inflateReset()
+ * - Remove bit fields--back to byte structure for speed
+ * - Remove distance extra == 0 check in inflate_fast()--only helps for lengths
+ * - Change post-increments to pre-increments in inflate_fast(), PPC biased?
+ * - Add compile time option, POSTINC, to use post-increments instead (Intel?)
+ * - Make MATCH copy in inflate() much faster for when inflate_fast() not used
+ * - Use local copies of stream next and avail values, as well as local bit
+ * buffer and bit count in inflate()--for speed when inflate_fast() not used
+ *
+ * 1.2.beta4 1 Jan 2003
+ * - Split ptr - 257 statements in inflate_table() to avoid compiler warnings
+ * - Move a comment on output buffer sizes from inffast.c to inflate.c
+ * - Add comments in inffast.c to introduce the inflate_fast() routine
+ * - Rearrange window copies in inflate_fast() for speed and simplification
+ * - Unroll last copy for window match in inflate_fast()
+ * - Use local copies of window variables in inflate_fast() for speed
+ * - Pull out common wnext == 0 case for speed in inflate_fast()
+ * - Make op and len in inflate_fast() unsigned for consistency
+ * - Add FAR to lcode and dcode declarations in inflate_fast()
+ * - Simplified bad distance check in inflate_fast()
+ * - Added inflateBackInit(), inflateBack(), and inflateBackEnd() in new
+ * source file infback.c to provide a call-back interface to inflate for
+ * programs like gzip and unzip -- uses window as output buffer to avoid
+ * window copying
+ *
+ * 1.2.beta5 1 Jan 2003
+ * - Improved inflateBack() interface to allow the caller to provide initial
+ * input in strm.
+ * - Fixed stored blocks bug in inflateBack()
+ *
+ * 1.2.beta6 4 Jan 2003
+ * - Added comments in inffast.c on effectiveness of POSTINC
+ * - Typecasting all around to reduce compiler warnings
+ * - Changed loops from while (1) or do {} while (1) to for (;;), again to
+ * make compilers happy
+ * - Changed type of window in inflateBackInit() to unsigned char *
+ *
+ * 1.2.beta7 27 Jan 2003
+ * - Changed many types to unsigned or unsigned short to avoid warnings
+ * - Added inflateCopy() function
+ *
+ * 1.2.0 9 Mar 2003
+ * - Changed inflateBack() interface to provide separate opaque descriptors
+ * for the in() and out() functions
+ * - Changed inflateBack() argument and in_func typedef to swap the length
+ * and buffer address return values for the input function
+* - Check next_in and next_out for Z_NULL on entry to inflate()
+ *
+ * The history for versions after 1.2.0 are in ChangeLog in zlib distribution.
+ */
+
+#include "zutil.h"
+#include "inftrees.h"
+#include "inflate.h"
+#include "inffast.h"
+
+#ifdef MAKEFIXED
+# ifndef BUILDFIXED
+# define BUILDFIXED
+# endif
+#endif
+
+#ifndef Z_TREES
+#define Z_TREES 6
+#endif
+
+ /* function prototypes */
+int ZEXPORT inflateReset2(z_streamp strm, int windowBits);
+ local void fixedtables OF((struct inflate_state FAR *state));
+ local int updatewindow OF((z_streamp strm, const unsigned char FAR *end,
+ unsigned copy));
+#ifdef BUILDFIXED
+void makefixed OF((void));
+#endif
+local unsigned syncsearch OF((unsigned FAR *have, const unsigned char FAR *buf,
+ unsigned len));
+
+long ZEXPORT inflateMark(z_streamp strm);
+
+int ZEXPORT inflateResetKeep(z_streamp strm);
+
+int ZEXPORT inflateUndermine(z_streamp strm, int subvert);
+
+int ZEXPORT inflateGetDictionary(z_streamp strm, Bytef *dictionary, uInt *dictLength);
+
+int ZEXPORT inflateResetKeep(z_streamp strm)
+{
+ struct inflate_state FAR *state;
+
+ if (strm == Z_NULL || strm->state == Z_NULL) return Z_STREAM_ERROR;
+ state = (struct inflate_state FAR *)strm->state;
+ strm->total_in = strm->total_out = state->total = 0;
+ strm->msg = Z_NULL;
+ if (state->wrap) /* to support ill-conceived Java test suite */
+ strm->adler = state->wrap & 1;
+ state->mode = HEAD;
+ state->last = 0;
+ state->havedict = 0;
+ state->dmax = 32768U;
+ state->head = Z_NULL;
+ state->hold = 0;
+ state->bits = 0;
+ state->lencode = state->distcode = state->next = state->codes;
+ state->sane = 1;
+ state->back = -1;
+ Tracev((stderr, "inflate: reset\n"));
+ return Z_OK;
+}
+
+int ZEXPORT inflateReset(z_streamp strm)
+{
+ struct inflate_state FAR *state;
+
+ if (strm == Z_NULL || strm->state == Z_NULL) return Z_STREAM_ERROR;
+ state = (struct inflate_state FAR *)strm->state;
+ state->wsize = 0;
+ state->whave = 0;
+ state->wnext = 0;
+ return inflateResetKeep(strm);
+}
+
+int ZEXPORT inflateReset2(z_streamp strm, int windowBits)
+{
+ int wrap;
+ struct inflate_state FAR *state = NULL;
+
+ /* get the state */
+ if (strm == Z_NULL || strm->state == Z_NULL)
+ return Z_STREAM_ERROR;
+ state = (struct inflate_state FAR *)strm->state;
+
+ /* extract wrap request from windowBits parameter */
+ if (windowBits < 0) {
+ wrap = 0;
+ windowBits = -windowBits;
+ }
+ else {
+ wrap = (windowBits >> 4) + 1;
+#ifdef GUNZIP
+ if (windowBits < 48)
+ windowBits &= 15;
+#endif
+ }
+
+ /* set number of window bits, free window if different */
+ if (windowBits && (windowBits < 8 || windowBits > 15))
+ return Z_STREAM_ERROR;
+ if (state->window != Z_NULL && state->wbits != (unsigned)windowBits) {
+ ZFREE(strm, state->window);
+ state->window = Z_NULL;
+ }
+
+ /* update state and reset the rest of it */
+ state->wrap = wrap;
+ state->wbits = (unsigned)windowBits;
+ return inflateReset(strm);
+}
+
+int ZEXPORT inflateInit2_(z_streamp strm, int windowBits, const char *version, int stream_size)
+{
+ int ret;
+ struct inflate_state FAR *state;
+
+ if (version == Z_NULL || version[0] != ZLIB_VERSION[0] ||
+ stream_size != (int)(sizeof(z_stream)))
+ return Z_VERSION_ERROR;
+ if (strm == Z_NULL) return Z_STREAM_ERROR;
+ strm->msg = Z_NULL; /* in case we return an error */
+ if (strm->zalloc == (alloc_func)0) {
+#ifdef Z_SOLO
+ return Z_STREAM_ERROR;
+#else
+ strm->zalloc = zcalloc;
+ strm->opaque = (voidpf)0;
+#endif
+ }
+ if (strm->zfree == Z_NULL)
+#ifdef Z_SOLO
+ return Z_STREAM_ERROR;
+#else
+ strm->zfree = zcfree;
+#endif
+ state = (struct inflate_state FAR *)
+ ZALLOC(strm, 1, sizeof(struct inflate_state));
+ if (state == Z_NULL) return Z_MEM_ERROR;
+ Tracev((stderr, "inflate: allocated\n"));
+ strm->state = (struct internal_state FAR *)state;
+ state->window = Z_NULL;
+ ret = inflateReset2(strm, windowBits);
+ if (ret != Z_OK) {
+ ZFREE(strm, state);
+ strm->state = Z_NULL;
+ }
+ return ret;
+}
+
+int ZEXPORT inflateInit_(z_streamp strm, const char *version, int stream_size)
+{
+ return inflateInit2_(strm, DEF_WBITS, version, stream_size);
+}
+
+int ZEXPORT inflatePrime(z_streamp strm, int bits, int value)
+{
+ struct inflate_state FAR *state;
+
+ if (strm == Z_NULL || strm->state == Z_NULL) return Z_STREAM_ERROR;
+ state = (struct inflate_state FAR *)strm->state;
+ if (bits < 0) {
+ state->hold = 0;
+ state->bits = 0;
+ return Z_OK;
+ }
+ if (bits > 16 || state->bits + bits > 32) return Z_STREAM_ERROR;
+ value &= (1L << bits) - 1;
+ state->hold += value << state->bits;
+ state->bits += bits;
+ return Z_OK;
+}
+
+/*
+ Return state with length and distance decoding tables and index sizes set to
+ fixed code decoding. Normally this returns fixed tables from inffixed.h.
+ If BUILDFIXED is defined, then instead this routine builds the tables the
+ first time it's called, and returns those tables the first time and
+ thereafter. This reduces the size of the code by about 2K bytes, in
+ exchange for a little execution time. However, BUILDFIXED should not be
+ used for threaded applications, since the rewriting of the tables and virgin
+ may not be thread-safe.
+ */
+local void fixedtables(struct inflate_state FAR *state)
+{
+#ifdef BUILDFIXED
+ static int virgin = 1;
+ static code *lenfix, *distfix;
+ static code fixed[544];
+
+ /* build fixed huffman tables if first call (may not be thread safe) */
+ if (virgin) {
+ unsigned sym, bits;
+ static code *next;
+
+ /* literal/length table */
+ sym = 0;
+ while (sym < 144) state->lens[sym++] = 8;
+ while (sym < 256) state->lens[sym++] = 9;
+ while (sym < 280) state->lens[sym++] = 7;
+ while (sym < 288) state->lens[sym++] = 8;
+ next = fixed;
+ lenfix = next;
+ bits = 9;
+ inflate_table(LENS, state->lens, 288, &(next), &(bits), state->work);
+
+ /* distance table */
+ sym = 0;
+ while (sym < 32) state->lens[sym++] = 5;
+ distfix = next;
+ bits = 5;
+ inflate_table(DISTS, state->lens, 32, &(next), &(bits), state->work);
+
+ /* do this just once */
+ virgin = 0;
+ }
+#else /* !BUILDFIXED */
+# include "inffixed.h"
+#endif /* BUILDFIXED */
+ state->lencode = lenfix;
+ state->lenbits = 9;
+ state->distcode = distfix;
+ state->distbits = 5;
+}
+
+#ifdef MAKEFIXED
+#include <stdio.h>
+
+/*
+ Write out the inffixed.h that is #include'd above. Defining MAKEFIXED also
+ defines BUILDFIXED, so the tables are built on the fly. makefixed() writes
+ those tables to stdout, which would be piped to inffixed.h. A small program
+ can simply call makefixed to do this:
+
+ void makefixed(void);
+
+ int main(void)
+ {
+ makefixed();
+ return 0;
+ }
+
+ Then that can be linked with zlib built with MAKEFIXED defined and run:
+
+ a.out > inffixed.h
+ */
+void makefixed(void)
+{
+ unsigned low, size;
+ struct inflate_state state;
+
+ fixedtables(&state);
+ puts(" /* inffixed.h -- table for decoding fixed codes");
+ puts(" * Generated automatically by makefixed().");
+ puts(" */");
+ puts("");
+ puts(" /* WARNING: this file should *not* be used by applications.");
+ puts(" It is part of the implementation of this library and is");
+ puts(" subject to change. Applications should only use zlib.h.");
+ puts(" */");
+ puts("");
+ size = 1U << 9;
+ printf(" static const code lenfix[%u] = {", size);
+ low = 0;
+ for (;;) {
+ if ((low % 7) == 0) printf("\n ");
+ printf("{%u,%u,%d}", (low & 127) == 99 ? 64 : state.lencode[low].op,
+ state.lencode[low].bits, state.lencode[low].val);
+ if (++low == size) break;
+ putchar(',');
+ }
+ puts("\n };");
+ size = 1U << 5;
+ printf("\n static const code distfix[%u] = {", size);
+ low = 0;
+ for (;;) {
+ if ((low % 6) == 0) printf("\n ");
+ printf("{%u,%u,%d}", state.distcode[low].op, state.distcode[low].bits,
+ state.distcode[low].val);
+ if (++low == size) break;
+ putchar(',');
+ }
+ puts("\n };");
+}
+#endif /* MAKEFIXED */
+
+/*
+ Update the window with the last wsize (normally 32K) bytes written before
+ returning. If window does not exist yet, create it. This is only called
+ when a window is already in use, or when output has been written during this
+ inflate call, but the end of the deflate stream has not been reached yet.
+ It is also called to create a window for dictionary data when a dictionary
+ is loaded.
+
+ Providing output buffers larger than 32K to inflate() should provide a speed
+ advantage, since only the last 32K of output is copied to the sliding window
+ upon return from inflate(), and since all distances after the first 32K of
+ output will fall in the output data, making match copies simpler and faster.
+ The advantage may be dependent on the size of the processor's data caches.
+ */
+local int updatewindow(z_streamp strm, const Bytef *end, unsigned copy)
+{
+ struct inflate_state FAR *state;
+ unsigned dist;
+
+ state = (struct inflate_state FAR *)strm->state;
+
+ /* if it hasn't been done already, allocate space for the window */
+ if (state->window == Z_NULL) {
+ state->window = (unsigned char FAR *)
+ ZALLOC(strm, 1U << state->wbits,
+ sizeof(unsigned char));
+ if (state->window == Z_NULL) return 1;
+ }
+
+ /* if window not in use yet, initialize */
+ if (state->wsize == 0) {
+ state->wsize = 1U << state->wbits;
+ state->wnext = 0;
+ state->whave = 0;
+ }
+
+ /* copy state->wsize or less output bytes into the circular window */
+ if (copy >= state->wsize) {
+ zmemcpy(state->window, end - state->wsize, state->wsize);
+ state->wnext = 0;
+ state->whave = state->wsize;
+ }
+ else {
+ dist = state->wsize - state->wnext;
+ if (dist > copy) dist = copy;
+ zmemcpy(state->window + state->wnext, end - copy, dist);
+ copy -= dist;
+ if (copy) {
+ zmemcpy(state->window, end - copy, copy);
+ state->wnext = copy;
+ state->whave = state->wsize;
+ }
+ else {
+ state->wnext += dist;
+ if (state->wnext == state->wsize) state->wnext = 0;
+ if (state->whave < state->wsize) state->whave += dist;
+ }
+ }
+ return 0;
+}
+
+/* Macros for inflate(): */
+
+/* check function to use adler32() for zlib or crc32() for gzip */
+#ifdef GUNZIP
+# define UPDATE(check, buf, len) \
+ (state->flags ? crc32(check, buf, len) : adler32(check, buf, len))
+#else
+# define UPDATE(check, buf, len) adler32(check, buf, len)
+#endif
+
+/* check macros for header crc */
+#ifdef GUNZIP
+# define CRC2(check, word) \
+ do { \
+ hbuf[0] = (unsigned char)(word); \
+ hbuf[1] = (unsigned char)((word) >> 8); \
+ check = crc32(check, hbuf, 2); \
+ } while (0)
+
+# define CRC4(check, word) \
+ do { \
+ hbuf[0] = (unsigned char)(word); \
+ hbuf[1] = (unsigned char)((word) >> 8); \
+ hbuf[2] = (unsigned char)((word) >> 16); \
+ hbuf[3] = (unsigned char)((word) >> 24); \
+ check = crc32(check, hbuf, 4); \
+ } while (0)
+#endif
+
+/* Load registers with state in inflate() for speed */
+#define LOAD() \
+ do { \
+ put = strm->next_out; \
+ left = strm->avail_out; \
+ next = strm->next_in; \
+ have = strm->avail_in; \
+ hold = state->hold; \
+ bits = state->bits; \
+ } while (0)
+
+/* Restore state from registers in inflate() */
+#define RESTORE() \
+ do { \
+ strm->next_out = put; \
+ strm->avail_out = left; \
+ strm->next_in = next; \
+ strm->avail_in = have; \
+ state->hold = hold; \
+ state->bits = bits; \
+ } while (0)
+
+/* Clear the input bit accumulator */
+#define INITBITS() \
+ do { \
+ hold = 0; \
+ bits = 0; \
+ } while (0)
+
+/* Get a byte of input into the bit accumulator, or return from inflate()
+ if there is no input available. */
+#define PULLBYTE() \
+ do { \
+ if (have == 0) goto inf_leave; \
+ have--; \
+ hold += (unsigned long)(*next++) << bits; \
+ bits += 8; \
+ } while (0)
+
+/* Assure that there are at least n bits in the bit accumulator. If there is
+ not enough available input to do that, then return from inflate(). */
+#define NEEDBITS(n) \
+ do { \
+ while (bits < (unsigned)(n)) \
+ PULLBYTE(); \
+ } while (0)
+
+/* Return the low n bits of the bit accumulator (n < 16) */
+#define BITS(n) \
+ ((unsigned)hold & ((1U << (n)) - 1))
+
+/* Remove n bits from the bit accumulator */
+#define DROPBITS(n) \
+ do { \
+ hold >>= (n); \
+ bits -= (unsigned)(n); \
+ } while (0)
+
+/* Remove zero to seven bits as needed to go to a byte boundary */
+#define BYTEBITS() \
+ do { \
+ hold >>= bits & 7; \
+ bits -= bits & 7; \
+ } while (0)
+
+/*
+ inflate() uses a state machine to process as much input data and generate as
+ much output data as possible before returning. The state machine is
+ structured roughly as follows:
+
+ for (;;) switch (state) {
+ ...
+ case STATEn:
+ if (not enough input data or output space to make progress)
+ return;
+ ... make progress ...
+ state = STATEm;
+ break;
+ ...
+ }
+
+ so when inflate() is called again, the same case is attempted again, and
+ if the appropriate resources are provided, the machine proceeds to the
+ next state. The NEEDBITS() macro is usually the way the state evaluates
+ whether it can proceed or should return. NEEDBITS() does the return if
+ the requested bits are not available. The typical use of the BITS macros
+is:
+
+NEEDBITS(n);
+... do something with BITS(n) ...
+DROPBITS(n);
+
+where NEEDBITS(n) either returns from inflate() if there isn't enough
+input left to load n bits into the accumulator, or it continues. BITS(n)
+gives the low n bits in the accumulator. When done, DROPBITS(n) drops
+the low n bits off the accumulator. INITBITS() clears the accumulator
+and sets the number of available bits to zero. BYTEBITS() discards just
+enough bits to put the accumulator on a byte boundary. After BYTEBITS()
+and a NEEDBITS(8), then BITS(8) would return the next byte in the stream.
+
+NEEDBITS(n) uses PULLBYTE() to get an available byte of input, or to return
+if there is no input available. The decoding of variable length codes uses
+PULLBYTE() directly in order to pull just enough bytes to decode the next
+code, and no more.
+
+Some states loop until they get enough input, making sure that enough
+state information is maintained to continue the loop where it left off
+if NEEDBITS() returns in the loop. For example, want, need, and keep
+would all have to actually be part of the saved state in case NEEDBITS()
+returns:
+
+case STATEw:
+while (want < need) {
+NEEDBITS(n);
+keep[want++] = BITS(n);
+DROPBITS(n);
+}
+state = STATEx;
+case STATEx:
+
+As shown above, if the next state is also the next case, then the break
+is omitted.
+
+A state may also return if there is not enough output space available to
+complete that state. Those states are copying stored data, writing a
+literal byte, and copying a matching string.
+
+When returning, a "goto inf_leave" is used to update the total counters,
+update the check value, and determine whether any progress has been made
+during that inflate() call in order to return the proper return code.
+Progress is defined as a change in either strm->avail_in or strm->avail_out.
+When there is a window, goto inf_leave will update the window with the last
+output written. If a goto inf_leave occurs in the middle of decompression
+and there is no window currently, goto inf_leave will create one and copy
+output to the window for the next call of inflate().
+
+In this implementation, the flush parameter of inflate() only affects the
+return code (per zlib.h). inflate() always writes as much as possible to
+strm->next_out, given the space available and the provided input--the effect
+documented in zlib.h of Z_SYNC_FLUSH. Furthermore, inflate() always defers
+the allocation of and copying into a sliding window until necessary, which
+provides the effect documented in zlib.h for Z_FINISH when the entire input
+stream available. So the only thing the flush parameter actually does is:
+when flush is set to Z_FINISH, inflate() cannot return Z_OK. Instead it
+will return Z_BUF_ERROR if it has not reached the end of the stream.
+*/
+
+int ZEXPORT inflate(z_streamp strm, int flush)
+{
+ struct inflate_state FAR *state;
+ unsigned char FAR *next; /* next input */
+ unsigned char FAR *put; /* next output */
+ unsigned have, left; /* available input and output */
+ unsigned long hold; /* bit buffer */
+ unsigned bits; /* bits in bit buffer */
+ unsigned in, out; /* save starting available input and output */
+ unsigned copy; /* number of stored or match bytes to copy */
+ unsigned char FAR *from; /* where to copy match bytes from */
+ code here; /* current decoding table entry */
+ code last; /* parent table entry */
+ unsigned len; /* length to copy for repeats, bits to drop */
+ int ret; /* return code */
+#ifdef GUNZIP
+ unsigned char hbuf[4]; /* buffer for gzip header crc calculation */
+#endif
+ static const unsigned short order[19] = /* permutation of code lengths */
+ {16, 17, 18, 0, 8, 7, 9, 6, 10, 5, 11, 4, 12, 3, 13, 2, 14, 1, 15};
+
+ if (strm == Z_NULL || strm->state == Z_NULL || strm->next_out == Z_NULL ||
+ (strm->next_in == Z_NULL && strm->avail_in != 0))
+ return Z_STREAM_ERROR;
+
+ state = (struct inflate_state FAR *)strm->state;
+ if (state->mode == TYPE) state->mode = TYPEDO; /* skip check */
+ LOAD();
+ in = have;
+ out = left;
+ ret = Z_OK;
+ for (;;)
+ switch (state->mode) {
+ case HEAD:
+ if (state->wrap == 0) {
+ state->mode = TYPEDO;
+ break;
+ }
+ NEEDBITS(16);
+#ifdef GUNZIP
+ if ((state->wrap & 2) && hold == 0x8b1f) { /* gzip header */
+ state->check = crc32(0L, Z_NULL, 0);
+ CRC2(state->check, hold);
+ INITBITS();
+ state->mode = FLAGS;
+ break;
+ }
+ state->flags = 0; /* expect zlib header */
+ if (state->head != Z_NULL)
+ state->head->done = -1;
+ if (!(state->wrap & 1) || /* check if zlib header allowed */
+#else
+ if (
+#endif
+ ((BITS(8) << 8) + (hold >> 8)) % 31) {
+ strm->msg = (char *)"incorrect header check";
+ state->mode = BAD;
+ break;
+ }
+ if (BITS(4) != Z_DEFLATED) {
+ strm->msg = (char *)"unknown compression method";
+ state->mode = BAD;
+ break;
+ }
+ DROPBITS(4);
+ len = BITS(4) + 8;
+ if (state->wbits == 0)
+ state->wbits = len;
+ else if (len > state->wbits) {
+ strm->msg = (char *)"invalid window size";
+ state->mode = BAD;
+ break;
+ }
+ state->dmax = 1U << len;
+ Tracev((stderr, "inflate: zlib header ok\n"));
+ strm->adler = state->check = adler32(0L, Z_NULL, 0);
+ state->mode = hold & 0x200 ? DICTID : TYPE;
+ INITBITS();
+ break;
+#ifdef GUNZIP
+ case FLAGS:
+ NEEDBITS(16);
+ state->flags = (int)(hold);
+ if ((state->flags & 0xff) != Z_DEFLATED) {
+ strm->msg = (char *)"unknown compression method";
+ state->mode = BAD;
+ break;
+ }
+ if (state->flags & 0xe000) {
+ strm->msg = (char *)"unknown header flags set";
+ state->mode = BAD;
+ break;
+ }
+ if (state->head != Z_NULL)
+ state->head->text = (int)((hold >> 8) & 1);
+ if (state->flags & 0x0200) CRC2(state->check, hold);
+ INITBITS();
+ state->mode = TIME;
+ case TIME:
+ NEEDBITS(32);
+ if (state->head != Z_NULL)
+ state->head->time = hold;
+ if (state->flags & 0x0200) CRC4(state->check, hold);
+ INITBITS();
+ state->mode = OS;
+ case OS:
+ NEEDBITS(16);
+ if (state->head != Z_NULL) {
+ state->head->xflags = (int)(hold & 0xff);
+ state->head->os = (int)(hold >> 8);
+ }
+ if (state->flags & 0x0200) CRC2(state->check, hold);
+ INITBITS();
+ state->mode = EXLEN;
+ case EXLEN:
+ if (state->flags & 0x0400) {
+ NEEDBITS(16);
+ state->length = (unsigned)(hold);
+ if (state->head != Z_NULL)
+ state->head->extra_len = (unsigned)hold;
+ if (state->flags & 0x0200) CRC2(state->check, hold);
+ INITBITS();
+ }
+ else if (state->head != Z_NULL)
+ state->head->extra = Z_NULL;
+ state->mode = EXTRA;
+ case EXTRA:
+ if (state->flags & 0x0400) {
+ copy = state->length;
+ if (copy > have) copy = have;
+ if (copy) {
+ if (state->head != Z_NULL &&
+ state->head->extra != Z_NULL) {
+ len = state->head->extra_len - state->length;
+ zmemcpy(state->head->extra + len, next,
+ len + copy > state->head->extra_max ?
+ state->head->extra_max - len : copy);
+ }
+ if (state->flags & 0x0200)
+ state->check = crc32(state->check, next, copy);
+ have -= copy;
+ next += copy;
+ state->length -= copy;
+ }
+ if (state->length) goto inf_leave;
+ }
+ state->length = 0;
+ state->mode = NAME;
+ case NAME:
+ if (state->flags & 0x0800) {
+ if (have == 0) goto inf_leave;
+ copy = 0;
+ do {
+ len = (unsigned)(next[copy++]);
+ if (state->head != Z_NULL &&
+ state->head->name != Z_NULL &&
+ state->length < state->head->name_max)
+ state->head->name[state->length++] = len;
+ } while (len && copy < have);
+ if (state->flags & 0x0200)
+ state->check = crc32(state->check, next, copy);
+ have -= copy;
+ next += copy;
+ if (len) goto inf_leave;
+ }
+ else if (state->head != Z_NULL)
+ state->head->name = Z_NULL;
+ state->length = 0;
+ state->mode = COMMENT;
+ case COMMENT:
+ if (state->flags & 0x1000) {
+ if (have == 0) goto inf_leave;
+ copy = 0;
+ do {
+ len = (unsigned)(next[copy++]);
+ if (state->head != Z_NULL &&
+ state->head->comment != Z_NULL &&
+ state->length < state->head->comm_max)
+ state->head->comment[state->length++] = len;
+ } while (len && copy < have);
+ if (state->flags & 0x0200)
+ state->check = crc32(state->check, next, copy);
+ have -= copy;
+ next += copy;
+ if (len) goto inf_leave;
+ }
+ else if (state->head != Z_NULL)
+ state->head->comment = Z_NULL;
+ state->mode = HCRC;
+ case HCRC:
+ if (state->flags & 0x0200) {
+ NEEDBITS(16);
+ if (hold != (state->check & 0xffff)) {
+ strm->msg = (char *)"header crc mismatch";
+ state->mode = BAD;
+ break;
+ }
+ INITBITS();
+ }
+ if (state->head != Z_NULL) {
+ state->head->hcrc = (int)((state->flags >> 9) & 1);
+ state->head->done = 1;
+ }
+ strm->adler = state->check = crc32(0L, Z_NULL, 0);
+ state->mode = TYPE;
+ break;
+#endif
+ case DICTID:
+ NEEDBITS(32);
+ strm->adler = state->check = ZSWAP32(hold);
+ INITBITS();
+ state->mode = DICT;
+ case DICT:
+ if (state->havedict == 0) {
+ RESTORE();
+ return Z_NEED_DICT;
+ }
+ strm->adler = state->check = adler32(0L, Z_NULL, 0);
+ state->mode = TYPE;
+ case TYPE:
+ if (flush == Z_BLOCK || flush == Z_TREES) goto inf_leave;
+ case TYPEDO:
+ if (state->last) {
+ BYTEBITS();
+ state->mode = CHECK;
+ break;
+ }
+ NEEDBITS(3);
+ state->last = BITS(1);
+ DROPBITS(1);
+ switch (BITS(2)) {
+ case 0: /* stored block */
+ Tracev((stderr, "inflate: stored block%s\n",
+ state->last ? " (last)" : ""));
+ state->mode = STORED;
+ break;
+ case 1: /* fixed block */
+ fixedtables(state);
+ Tracev((stderr, "inflate: fixed codes block%s\n",
+ state->last ? " (last)" : ""));
+ state->mode = LEN_; /* decode codes */
+ if (flush == Z_TREES) {
+ DROPBITS(2);
+ goto inf_leave;
+ }
+ break;
+ case 2: /* dynamic block */
+ Tracev((stderr, "inflate: dynamic codes block%s\n",
+ state->last ? " (last)" : ""));
+ state->mode = TABLE;
+ break;
+ case 3:
+ strm->msg = (char *)"invalid block type";
+ state->mode = BAD;
+ }
+ DROPBITS(2);
+ break;
+ case STORED:
+ BYTEBITS(); /* go to byte boundary */
+ NEEDBITS(32);
+ if ((hold & 0xffff) != ((hold >> 16) ^ 0xffff)) {
+ strm->msg = (char *)"invalid stored block lengths";
+ state->mode = BAD;
+ break;
+ }
+ state->length = (unsigned)hold & 0xffff;
+ Tracev((stderr, "inflate: stored length %u\n",
+ state->length));
+ INITBITS();
+ state->mode = COPY_;
+ if (flush == Z_TREES) goto inf_leave;
+ case COPY_:
+ state->mode = COPY;
+ case COPY:
+ copy = state->length;
+ if (copy) {
+ if (copy > have) copy = have;
+ if (copy > left) copy = left;
+ if (copy == 0) goto inf_leave;
+ zmemcpy(put, next, copy);
+ have -= copy;
+ next += copy;
+ left -= copy;
+ put += copy;
+ state->length -= copy;
+ break;
+ }
+ Tracev((stderr, "inflate: stored end\n"));
+ state->mode = TYPE;
+ break;
+ case TABLE:
+ NEEDBITS(14);
+ state->nlen = BITS(5) + 257;
+ DROPBITS(5);
+ state->ndist = BITS(5) + 1;
+ DROPBITS(5);
+ state->ncode = BITS(4) + 4;
+ DROPBITS(4);
+#ifndef PKZIP_BUG_WORKAROUND
+ if (state->nlen > 286 || state->ndist > 30) {
+ strm->msg = (char *)"too many length or distance symbols";
+ state->mode = BAD;
+ break;
+ }
+#endif
+ Tracev((stderr, "inflate: table sizes ok\n"));
+ state->have = 0;
+ state->mode = LENLENS;
+ case LENLENS:
+ while (state->have < state->ncode) {
+ NEEDBITS(3);
+ state->lens[order[state->have++]] = (unsigned short)BITS(3);
+ DROPBITS(3);
+ }
+ while (state->have < 19)
+ state->lens[order[state->have++]] = 0;
+ state->next = state->codes;
+ state->lencode = (const code FAR *)(state->next);
+ state->lenbits = 7;
+ ret = inflate_table(CODES, state->lens, 19, &(state->next),
+ &(state->lenbits), state->work);
+ if (ret) {
+ strm->msg = (char *)"invalid code lengths set";
+ state->mode = BAD;
+ break;
+ }
+ Tracev((stderr, "inflate: code lengths ok\n"));
+ state->have = 0;
+ state->mode = CODELENS;
+ case CODELENS:
+ while (state->have < state->nlen + state->ndist) {
+ for (;;) {
+ here = state->lencode[BITS(state->lenbits)];
+ if ((unsigned)(here.bits) <= bits) break;
+ PULLBYTE();
+ }
+ if (here.val < 16) {
+ DROPBITS(here.bits);
+ state->lens[state->have++] = here.val;
+ }
+ else {
+ if (here.val == 16) {
+ NEEDBITS(here.bits + 2);
+ DROPBITS(here.bits);
+ if (state->have == 0) {
+ strm->msg = (char *)"invalid bit length repeat";
+ state->mode = BAD;
+ break;
+ }
+ len = state->lens[state->have - 1];
+ copy = 3 + BITS(2);
+ DROPBITS(2);
+ }
+ else if (here.val == 17) {
+ NEEDBITS(here.bits + 3);
+ DROPBITS(here.bits);
+ len = 0;
+ copy = 3 + BITS(3);
+ DROPBITS(3);
+ }
+ else {
+ NEEDBITS(here.bits + 7);
+ DROPBITS(here.bits);
+ len = 0;
+ copy = 11 + BITS(7);
+ DROPBITS(7);
+ }
+ if (state->have + copy > state->nlen + state->ndist) {
+ strm->msg = (char *)"invalid bit length repeat";
+ state->mode = BAD;
+ break;
+ }
+ while (copy--)
+ state->lens[state->have++] = (unsigned short)len;
+ }
+ }
+
+ /* handle error breaks in while */
+ if (state->mode == BAD) break;
+
+ /* check for end-of-block code (better have one) */
+ if (state->lens[256] == 0) {
+ strm->msg = (char *)"invalid code -- missing end-of-block";
+ state->mode = BAD;
+ break;
+ }
+
+ /* build code tables -- note: do not change the lenbits or distbits
+ values here (9 and 6) without reading the comments in inftrees.h
+ concerning the ENOUGH constants, which depend on those values */
+ state->next = state->codes;
+ state->lencode = (const code FAR *)(state->next);
+ state->lenbits = 9;
+ ret = inflate_table(LENS, state->lens, state->nlen, &(state->next),
+ &(state->lenbits), state->work);
+ if (ret) {
+ strm->msg = (char *)"invalid literal/lengths set";
+ state->mode = BAD;
+ break;
+ }
+ state->distcode = (const code FAR *)(state->next);
+ state->distbits = 6;
+ ret = inflate_table(DISTS, state->lens + state->nlen, state->ndist,
+ &(state->next), &(state->distbits), state->work);
+ if (ret) {
+ strm->msg = (char *)"invalid distances set";
+ state->mode = BAD;
+ break;
+ }
+ Tracev((stderr, "inflate: codes ok\n"));
+ state->mode = LEN_;
+ if (flush == Z_TREES) goto inf_leave;
+ case LEN_:
+ state->mode = LEN;
+ case LEN:
+ if (have >= 6 && left >= 258) {
+ RESTORE();
+ inflate_fast(strm, out);
+ LOAD();
+ if (state->mode == TYPE)
+ state->back = -1;
+ break;
+ }
+ state->back = 0;
+ for (;;) {
+ here = state->lencode[BITS(state->lenbits)];
+ if ((unsigned)(here.bits) <= bits) break;
+ PULLBYTE();
+ }
+ if (here.op && (here.op & 0xf0) == 0) {
+ last = here;
+ for (;;) {
+ here = state->lencode[last.val +
+ (BITS(last.bits + last.op) >> last.bits)];
+ if ((unsigned)(last.bits + here.bits) <= bits) break;
+ PULLBYTE();
+ }
+ DROPBITS(last.bits);
+ state->back += last.bits;
+ }
+ DROPBITS(here.bits);
+ state->back += here.bits;
+ state->length = (unsigned)here.val;
+ if ((int)(here.op) == 0) {
+ Tracevv((stderr, here.val >= 0x20 && here.val < 0x7f ?
+ "inflate: literal '%c'\n" :
+ "inflate: literal 0x%02x\n", here.val));
+ state->mode = LIT;
+ break;
+ }
+ if (here.op & 32) {
+ Tracevv((stderr, "inflate: end of block\n"));
+ state->back = -1;
+ state->mode = TYPE;
+ break;
+ }
+ if (here.op & 64) {
+ strm->msg = (char *)"invalid literal/length code";
+ state->mode = BAD;
+ break;
+ }
+ state->extra = (unsigned)(here.op) & 15;
+ state->mode = LENEXT;
+ case LENEXT:
+ if (state->extra) {
+ NEEDBITS(state->extra);
+ state->length += BITS(state->extra);
+ DROPBITS(state->extra);
+ state->back += state->extra;
+ }
+ Tracevv((stderr, "inflate: length %u\n", state->length));
+ state->was = state->length;
+ state->mode = DIST;
+ case DIST:
+ for (;;) {
+ here = state->distcode[BITS(state->distbits)];
+ if ((unsigned)(here.bits) <= bits) break;
+ PULLBYTE();
+ }
+ if ((here.op & 0xf0) == 0) {
+ last = here;
+ for (;;) {
+ here = state->distcode[last.val +
+ (BITS(last.bits + last.op) >> last.bits)];
+ if ((unsigned)(last.bits + here.bits) <= bits) break;
+ PULLBYTE();
+ }
+ DROPBITS(last.bits);
+ state->back += last.bits;
+ }
+ DROPBITS(here.bits);
+ state->back += here.bits;
+ if (here.op & 64) {
+ strm->msg = (char *)"invalid distance code";
+ state->mode = BAD;
+ break;
+ }
+ state->offset = (unsigned)here.val;
+ state->extra = (unsigned)(here.op) & 15;
+ state->mode = DISTEXT;
+ case DISTEXT:
+ if (state->extra) {
+ NEEDBITS(state->extra);
+ state->offset += BITS(state->extra);
+ DROPBITS(state->extra);
+ state->back += state->extra;
+ }
+#ifdef INFLATE_STRICT
+ if (state->offset > state->dmax) {
+ strm->msg = (char *)"invalid distance too far back";
+ state->mode = BAD;
+ break;
+ }
+#endif
+ Tracevv((stderr, "inflate: distance %u\n", state->offset));
+ state->mode = MATCH;
+ case MATCH:
+ if (left == 0) goto inf_leave;
+ copy = out - left;
+ if (state->offset > copy) { /* copy from window */
+ copy = state->offset - copy;
+ if (copy > state->whave) {
+ if (state->sane) {
+ strm->msg = (char *)"invalid distance too far back";
+ state->mode = BAD;
+ break;
+ }
+#ifdef INFLATE_ALLOW_INVALID_DISTANCE_TOOFAR_ARRR
+ Trace((stderr, "inflate.c too far\n"));
+ copy -= state->whave;
+ if (copy > state->length) copy = state->length;
+ if (copy > left) copy = left;
+ left -= copy;
+ state->length -= copy;
+ do {
+ *put++ = 0;
+ } while (--copy);
+ if (state->length == 0) state->mode = LEN;
+ break;
+#endif
+ }
+ if (copy > state->wnext) {
+ copy -= state->wnext;
+ from = state->window + (state->wsize - copy);
+ }
+ else
+ from = state->window + (state->wnext - copy);
+ if (copy > state->length) copy = state->length;
+ }
+ else { /* copy from output */
+ from = put - state->offset;
+ copy = state->length;
+ }
+ if (copy > left) copy = left;
+ left -= copy;
+ state->length -= copy;
+ do {
+ *put++ = *from++;
+ } while (--copy);
+ if (state->length == 0) state->mode = LEN;
+ break;
+ case LIT:
+ if (left == 0) goto inf_leave;
+ *put++ = (unsigned char)(state->length);
+ left--;
+ state->mode = LEN;
+ break;
+ case CHECK:
+ if (state->wrap) {
+ NEEDBITS(32);
+ out -= left;
+ strm->total_out += out;
+ state->total += out;
+ if (out)
+ strm->adler = state->check =
+ UPDATE(state->check, put - out, out);
+ out = left;
+ if ((
+#ifdef GUNZIP
+ state->flags ? hold :
+#endif
+ ZSWAP32(hold)) != state->check) {
+ strm->msg = (char *)"incorrect data check";
+ state->mode = BAD;
+ break;
+ }
+ INITBITS();
+ Tracev((stderr, "inflate: check matches trailer\n"));
+ }
+#ifdef GUNZIP
+ state->mode = LENGTH;
+ case LENGTH:
+ if (state->wrap && state->flags) {
+ NEEDBITS(32);
+ if (hold != (state->total & 0xffffffffUL)) {
+ strm->msg = (char *)"incorrect length check";
+ state->mode = BAD;
+ break;
+ }
+ INITBITS();
+ Tracev((stderr, "inflate: length matches trailer\n"));
+ }
+#endif
+ state->mode = DONE;
+ case DONE:
+ ret = Z_STREAM_END;
+ goto inf_leave;
+ case BAD:
+ ret = Z_DATA_ERROR;
+ goto inf_leave;
+ case MEM:
+ return Z_MEM_ERROR;
+ case SYNC:
+ default:
+ return Z_STREAM_ERROR;
+ }
+
+ /*
+ Return from inflate(), updating the total counts and the check value.
+ If there was no progress during the inflate() call, return a buffer
+ error. Call updatewindow() to create and/or update the window state.
+Note: a memory error from inflate() is non-recoverable.
+*/
+inf_leave:
+ RESTORE();
+ if (state->wsize || (out != strm->avail_out && state->mode < BAD &&
+ (state->mode < CHECK || flush != Z_FINISH)))
+ if (updatewindow(strm, strm->next_out, out - strm->avail_out)) {
+ state->mode = MEM;
+ return Z_MEM_ERROR;
+ }
+ in -= strm->avail_in;
+ out -= strm->avail_out;
+ strm->total_in += in;
+ strm->total_out += out;
+ state->total += out;
+ if (state->wrap && out)
+ strm->adler = state->check =
+ UPDATE(state->check, strm->next_out - out, out);
+ strm->data_type = state->bits + (state->last ? 64 : 0) +
+ (state->mode == TYPE ? 128 : 0) +
+ (state->mode == LEN_ || state->mode == COPY_ ? 256 : 0);
+ if (((in == 0 && out == 0) || flush == Z_FINISH) && ret == Z_OK)
+ ret = Z_BUF_ERROR;
+ return ret;
+}
+
+int ZEXPORT inflateEnd(z_streamp strm)
+{
+ struct inflate_state FAR *state;
+ if (strm == Z_NULL || strm->state == Z_NULL || strm->zfree == Z_NULL)
+ return Z_STREAM_ERROR;
+ state = (struct inflate_state FAR *)strm->state;
+ if (state->window != Z_NULL) ZFREE(strm, state->window);
+ ZFREE(strm, strm->state);
+ strm->state = Z_NULL;
+ Tracev((stderr, "inflate: end\n"));
+ return Z_OK;
+}
+
+int ZEXPORT inflateGetDictionary(z_streamp strm, Bytef *dictionary, uInt *dictLength)
+{
+ struct inflate_state FAR *state;
+
+ /* check state */
+ if (strm == Z_NULL || strm->state == Z_NULL) return Z_STREAM_ERROR;
+ state = (struct inflate_state FAR *)strm->state;
+
+ /* copy dictionary */
+ if (state->whave && dictionary != Z_NULL) {
+ zmemcpy(dictionary, state->window + state->wnext,
+ state->whave - state->wnext);
+ zmemcpy(dictionary + state->whave - state->wnext,
+ state->window, state->wnext);
+ }
+ if (dictLength != Z_NULL)
+ *dictLength = state->whave;
+ return Z_OK;
+}
+
+int ZEXPORT inflateSetDictionary(z_streamp strm, const Bytef *dictionary, uInt dictLength)
+{
+ struct inflate_state FAR *state;
+ unsigned long dictid;
+ int ret;
+
+ /* check state */
+ if (strm == Z_NULL || strm->state == Z_NULL) return Z_STREAM_ERROR;
+ state = (struct inflate_state FAR *)strm->state;
+ if (state->wrap != 0 && state->mode != DICT)
+ return Z_STREAM_ERROR;
+
+ /* check for correct dictionary identifier */
+ if (state->mode == DICT) {
+ dictid = adler32(0L, Z_NULL, 0);
+ dictid = adler32(dictid, dictionary, dictLength);
+ if (dictid != state->check)
+ return Z_DATA_ERROR;
+ }
+
+ /* copy dictionary to window using updatewindow(), which will amend the
+ existing dictionary if appropriate */
+ ret = updatewindow(strm, dictionary + dictLength, dictLength);
+ if (ret) {
+ state->mode = MEM;
+ return Z_MEM_ERROR;
+ }
+ state->havedict = 1;
+ Tracev((stderr, "inflate: dictionary set\n"));
+ return Z_OK;
+}
+
+int ZEXPORT inflateGetHeader(z_streamp strm, gz_headerp head)
+{
+ struct inflate_state FAR *state;
+
+ /* check state */
+ if (strm == Z_NULL || strm->state == Z_NULL) return Z_STREAM_ERROR;
+ state = (struct inflate_state FAR *)strm->state;
+ if ((state->wrap & 2) == 0) return Z_STREAM_ERROR;
+
+ /* save header structure */
+ state->head = head;
+ head->done = 0;
+ return Z_OK;
+}
+
+/*
+ Search buf[0..len-1] for the pattern: 0, 0, 0xff, 0xff. Return when found
+ or when out of input. When called, *have is the number of pattern bytes
+ found in order so far, in 0..3. On return *have is updated to the new
+ state. If on return *have equals four, then the pattern was found and the
+ return value is how many bytes were read including the last byte of the
+ pattern. If *have is less than four, then the pattern has not been found
+ yet and the return value is len. In the latter case, syncsearch() can be
+ called again with more data and the *have state. *have is initialized to
+ zero for the first call.
+ */
+local unsigned syncsearch(unsigned FAR *have, const unsigned char FAR *buf, unsigned len)
+{
+ unsigned got;
+ unsigned next;
+
+ got = *have;
+ next = 0;
+ while (next < len && got < 4) {
+ if ((int)(buf[next]) == (got < 2 ? 0 : 0xff))
+ got++;
+ else if (buf[next])
+ got = 0;
+ else
+ got = 4 - got;
+ next++;
+ }
+ *have = got;
+ return next;
+}
+
+int ZEXPORT inflateSync(z_streamp strm)
+{
+ unsigned len; /* number of bytes to look at or looked at */
+ unsigned long in, out; /* temporary to save total_in and total_out */
+ unsigned char buf[4]; /* to restore bit buffer to byte string */
+ struct inflate_state FAR *state;
+
+ /* check parameters */
+ if (strm == Z_NULL || strm->state == Z_NULL) return Z_STREAM_ERROR;
+ state = (struct inflate_state FAR *)strm->state;
+ if (strm->avail_in == 0 && state->bits < 8) return Z_BUF_ERROR;
+
+ /* if first time, start search in bit buffer */
+ if (state->mode != SYNC) {
+ state->mode = SYNC;
+ state->hold <<= state->bits & 7;
+ state->bits -= state->bits & 7;
+ len = 0;
+ while (state->bits >= 8) {
+ buf[len++] = (unsigned char)(state->hold);
+ state->hold >>= 8;
+ state->bits -= 8;
+ }
+ state->have = 0;
+ syncsearch(&(state->have), buf, len);
+ }
+
+ /* search available input */
+ len = syncsearch(&(state->have), strm->next_in, strm->avail_in);
+ strm->avail_in -= len;
+ strm->next_in += len;
+ strm->total_in += len;
+
+ /* return no joy or set up to restart inflate() on a new block */
+ if (state->have != 4) return Z_DATA_ERROR;
+ in = strm->total_in; out = strm->total_out;
+ inflateReset(strm);
+ strm->total_in = in; strm->total_out = out;
+ state->mode = TYPE;
+ return Z_OK;
+}
+
+/*
+ Returns true if inflate is currently at the end of a block generated by
+ Z_SYNC_FLUSH or Z_FULL_FLUSH. This function is used by one PPP
+ implementation to provide an additional safety check. PPP uses
+ Z_SYNC_FLUSH but removes the length bytes of the resulting empty stored
+ block. When decompressing, PPP checks that at the end of input packet,
+ inflate is waiting for these length bytes.
+ */
+int ZEXPORT inflateSyncPoint(z_streamp strm)
+{
+ struct inflate_state FAR *state;
+
+ if (strm == Z_NULL || strm->state == Z_NULL) return Z_STREAM_ERROR;
+ state = (struct inflate_state FAR *)strm->state;
+ return state->mode == STORED && state->bits == 0;
+}
+
+int ZEXPORT inflateCopy(z_streamp dest, z_streamp source)
+{
+ struct inflate_state FAR *state;
+ struct inflate_state FAR *copy;
+ unsigned char FAR *window;
+ unsigned wsize;
+
+ /* check input */
+ if (dest == Z_NULL || source == Z_NULL || source->state == Z_NULL ||
+ source->zalloc == Z_NULL || source->zfree == Z_NULL)
+ return Z_STREAM_ERROR;
+ state = (struct inflate_state FAR *)source->state;
+
+ /* allocate space */
+ copy = (struct inflate_state FAR *)
+ ZALLOC(source, 1, sizeof(struct inflate_state));
+ if (copy == Z_NULL) return Z_MEM_ERROR;
+ window = Z_NULL;
+ if (state->window != Z_NULL) {
+ window = (unsigned char FAR *)
+ ZALLOC(source, 1U << state->wbits, sizeof(unsigned char));
+ if (window == Z_NULL) {
+ ZFREE(source, copy);
+ return Z_MEM_ERROR;
+ }
+ }
+
+ /* copy state */
+ zmemcpy((voidpf)dest, (voidpf)source, sizeof(z_stream));
+ zmemcpy((voidpf)copy, (voidpf)state, sizeof(struct inflate_state));
+ if (state->lencode >= state->codes &&
+ state->lencode <= state->codes + ENOUGH - 1) {
+ copy->lencode = copy->codes + (state->lencode - state->codes);
+ copy->distcode = copy->codes + (state->distcode - state->codes);
+ }
+ copy->next = copy->codes + (state->next - state->codes);
+ if (window != Z_NULL) {
+ wsize = 1U << state->wbits;
+ zmemcpy(window, state->window, wsize);
+ }
+ copy->window = window;
+ dest->state = (struct internal_state FAR *)copy;
+ return Z_OK;
+}
+
+int ZEXPORT inflateUndermine(z_streamp strm, int subvert)
+{
+ struct inflate_state FAR *state = NULL;
+
+ if (strm == Z_NULL || strm->state == Z_NULL)
+ return Z_STREAM_ERROR;
+ state = (struct inflate_state FAR *)strm->state;
+ state->sane = !subvert;
+#ifdef INFLATE_ALLOW_INVALID_DISTANCE_TOOFAR_ARRR
+ return Z_OK;
+#else
+ state->sane = 1;
+ return Z_DATA_ERROR;
+#endif
+}
+
+long ZEXPORT inflateMark(z_streamp strm)
+{
+ struct inflate_state FAR *state = NULL;
+
+ if (strm == Z_NULL || strm->state == Z_NULL)
+ return -1L << 16;
+ state = (struct inflate_state FAR *)strm->state;
+ return ((long)(state->back) << 16) +
+ (state->mode == COPY ? state->length :
+ (state->mode == MATCH ? state->was - state->length : 0));
+}
--- /dev/null
+/* inflate.h -- internal inflate state definition
+ * Copyright (C) 1995-2009 Mark Adler
+ * For conditions of distribution and use, see copyright notice in zlib.h
+ */
+
+/* WARNING: this file should *not* be used by applications. It is
+ part of the implementation of the compression library and is
+ subject to change. Applications should only use zlib.h.
+ */
+
+/* define NO_GZIP when compiling if you want to disable gzip header and
+ trailer decoding by inflate(). NO_GZIP would be used to avoid linking in
+ the crc code when it is not needed. For shared libraries, gzip decoding
+ should be left enabled. */
+#ifndef _INFLATE_H
+#define _INFLATE_H
+
+#ifndef NO_GZIP
+# define GUNZIP
+#endif
+
+/* Possible inflate modes between inflate() calls */
+typedef enum {
+ HEAD, /* i: waiting for magic header */
+ FLAGS, /* i: waiting for method and flags (gzip) */
+ TIME, /* i: waiting for modification time (gzip) */
+ OS, /* i: waiting for extra flags and operating system (gzip) */
+ EXLEN, /* i: waiting for extra length (gzip) */
+ EXTRA, /* i: waiting for extra bytes (gzip) */
+ NAME, /* i: waiting for end of file name (gzip) */
+ COMMENT, /* i: waiting for end of comment (gzip) */
+ HCRC, /* i: waiting for header crc (gzip) */
+ DICTID, /* i: waiting for dictionary check value */
+ DICT, /* waiting for inflateSetDictionary() call */
+ TYPE, /* i: waiting for type bits, including last-flag bit */
+ TYPEDO, /* i: same, but skip check to exit inflate on new block */
+ STORED, /* i: waiting for stored size (length and complement) */
+ COPY_, /* i/o: same as COPY below, but only first time in */
+ COPY, /* i/o: waiting for input or output to copy stored block */
+ TABLE, /* i: waiting for dynamic block table lengths */
+ LENLENS, /* i: waiting for code length code lengths */
+ CODELENS, /* i: waiting for length/lit and distance code lengths */
+ LEN_, /* i: same as LEN below, but only first time in */
+ LEN, /* i: waiting for length/lit/eob code */
+ LENEXT, /* i: waiting for length extra bits */
+ DIST, /* i: waiting for distance code */
+ DISTEXT, /* i: waiting for distance extra bits */
+ MATCH, /* o: waiting for output space to copy string */
+ LIT, /* o: waiting for output space to write literal */
+ CHECK, /* i: waiting for 32-bit check value */
+ LENGTH, /* i: waiting for 32-bit length (gzip) */
+ DONE, /* finished check, done -- remain here until reset */
+ BAD, /* got a data error -- remain here until reset */
+ MEM, /* got an inflate() memory error -- remain here until reset */
+ SYNC /* looking for synchronization bytes to restart inflate() */
+} inflate_mode;
+
+/*
+ State transitions between above modes -
+
+ (most modes can go to BAD or MEM on error -- not shown for clarity)
+
+ Process header:
+ HEAD -> (gzip) or (zlib) or (raw)
+ (gzip) -> FLAGS -> TIME -> OS -> EXLEN -> EXTRA -> NAME -> COMMENT ->
+ HCRC -> TYPE
+ (zlib) -> DICTID or TYPE
+ DICTID -> DICT -> TYPE
+ (raw) -> TYPEDO
+ Read deflate blocks:
+ TYPE -> TYPEDO -> STORED or TABLE or LEN_ or CHECK
+ STORED -> COPY_ -> COPY -> TYPE
+ TABLE -> LENLENS -> CODELENS -> LEN_
+ LEN_ -> LEN
+ Read deflate codes in fixed or dynamic block:
+ LEN -> LENEXT or LIT or TYPE
+ LENEXT -> DIST -> DISTEXT -> MATCH -> LEN
+ LIT -> LEN
+ Process trailer:
+ CHECK -> LENGTH -> DONE
+ */
+
+/* state maintained between inflate() calls. Approximately 10K bytes. */
+struct inflate_state {
+ inflate_mode mode; /* current inflate mode */
+ int last; /* true if processing last block */
+ int wrap; /* bit 0 true for zlib, bit 1 true for gzip */
+ int havedict; /* true if dictionary provided */
+ int flags; /* gzip header method and flags (0 if zlib) */
+ unsigned dmax; /* zlib header max distance (INFLATE_STRICT) */
+ unsigned long check; /* protected copy of check value */
+ unsigned long total; /* protected copy of output count */
+ gz_headerp head; /* where to save gzip header information */
+ /* sliding window */
+ unsigned wbits; /* log base 2 of requested window size */
+ unsigned wsize; /* window size or zero if not using window */
+ unsigned whave; /* valid bytes in the window */
+ unsigned wnext; /* window write index */
+ unsigned char FAR *window; /* allocated sliding window, if needed */
+ /* bit accumulator */
+ unsigned long hold; /* input bit accumulator */
+ unsigned bits; /* number of bits in "in" */
+ /* for string and stored block copying */
+ unsigned length; /* literal or length of data to copy */
+ unsigned offset; /* distance back to copy string from */
+ /* for table and code decoding */
+ unsigned extra; /* extra bits needed */
+ /* fixed and dynamic code tables */
+ code const FAR *lencode; /* starting table for length/literal codes */
+ code const FAR *distcode; /* starting table for distance codes */
+ unsigned lenbits; /* index bits for lencode */
+ unsigned distbits; /* index bits for distcode */
+ /* dynamic table building */
+ unsigned ncode; /* number of code length code lengths */
+ unsigned nlen; /* number of length code lengths */
+ unsigned ndist; /* number of distance code lengths */
+ unsigned have; /* number of code lengths in lens[] */
+ code FAR *next; /* next available space in codes[] */
+ unsigned short lens[320]; /* temporary storage for code lengths */
+ unsigned short work[288]; /* work area for code table building */
+ code codes[ENOUGH]; /* space for code tables */
+ int sane; /* if false, allow invalid distance too far */
+ int back; /* bits back of last unprocessed length/lit */
+ unsigned was; /* initial length of match */
+};
+
+#endif
--- /dev/null
+/* inftrees.c -- generate Huffman trees for efficient decoding
+ * Copyright (C) 1995-2013 Mark Adler
+ * For conditions of distribution and use, see copyright notice in zlib.h
+ */
+
+#include "zutil.h"
+#include "inftrees.h"
+
+#define MAXBITS 15
+
+const char inflate_copyright[] =
+" inflate 1.2.8 Copyright 1995-2013 Mark Adler ";
+/*
+ If you use the zlib library in a product, an acknowledgment is welcome
+ in the documentation of your product. If for some reason you cannot
+ include such an acknowledgment, I would appreciate that you keep this
+ copyright string in the executable of your product.
+ */
+
+/*
+ Build a set of tables to decode the provided canonical Huffman code.
+ The code lengths are lens[0..codes-1]. The result starts at *table,
+ whose indices are 0..2^bits-1. work is a writable array of at least
+ lens shorts, which is used as a work area. type is the type of code
+ to be generated, CODES, LENS, or DISTS. On return, zero is success,
+ -1 is an invalid code, and +1 means that ENOUGH isn't enough. table
+ on return points to the next available entry's address. bits is the
+ requested root table index bits, and on return it is the actual root
+ table index bits. It will differ if the request is greater than the
+ longest code or if it is less than the shortest code.
+ */
+int ZLIB_INTERNAL inflate_table(codetype type, unsigned short FAR *lens, unsigned codes, code FAR * FAR *table, unsigned FAR *bits, unsigned short FAR *work)
+{
+ unsigned len; /* a code's length in bits */
+ unsigned sym; /* index of code symbols */
+ unsigned min, max; /* minimum and maximum code lengths */
+ unsigned root; /* number of index bits for root table */
+ unsigned curr; /* number of index bits for current table */
+ unsigned drop; /* code bits to drop for sub-table */
+ int left; /* number of prefix codes available */
+ unsigned used; /* code entries in table used */
+ unsigned huff; /* Huffman code */
+ unsigned incr; /* for incrementing code, index */
+ unsigned fill; /* index for replicating entries */
+ unsigned low; /* low bits for current root entry */
+ unsigned mask; /* mask for low root bits */
+ code here; /* table entry for duplication */
+ code FAR *next; /* next available space in table */
+ const unsigned short FAR *base; /* base value table to use */
+ const unsigned short FAR *extra; /* extra bits table to use */
+ int end; /* use base and extra for symbol > end */
+ unsigned short count[MAXBITS+1]; /* number of codes of each length */
+ unsigned short offs[MAXBITS+1]; /* offsets in table for each length */
+ static const unsigned short lbase[31] = { /* Length codes 257..285 base */
+ 3, 4, 5, 6, 7, 8, 9, 10, 11, 13, 15, 17, 19, 23, 27, 31,
+ 35, 43, 51, 59, 67, 83, 99, 115, 131, 163, 195, 227, 258, 0, 0};
+ static const unsigned short lext[31] = { /* Length codes 257..285 extra */
+ 16, 16, 16, 16, 16, 16, 16, 16, 17, 17, 17, 17, 18, 18, 18, 18,
+ 19, 19, 19, 19, 20, 20, 20, 20, 21, 21, 21, 21, 16, 72, 78};
+ static const unsigned short dbase[32] = { /* Distance codes 0..29 base */
+ 1, 2, 3, 4, 5, 7, 9, 13, 17, 25, 33, 49, 65, 97, 129, 193,
+ 257, 385, 513, 769, 1025, 1537, 2049, 3073, 4097, 6145,
+ 8193, 12289, 16385, 24577, 0, 0};
+ static const unsigned short dext[32] = { /* Distance codes 0..29 extra */
+ 16, 16, 16, 16, 17, 17, 18, 18, 19, 19, 20, 20, 21, 21, 22, 22,
+ 23, 23, 24, 24, 25, 25, 26, 26, 27, 27,
+ 28, 28, 29, 29, 64, 64};
+
+ /*
+ Process a set of code lengths to create a canonical Huffman code. The
+ code lengths are lens[0..codes-1]. Each length corresponds to the
+ symbols 0..codes-1. The Huffman code is generated by first sorting the
+ symbols by length from short to long, and retaining the symbol order
+ for codes with equal lengths. Then the code starts with all zero bits
+ for the first code of the shortest length, and the codes are integer
+ increments for the same length, and zeros are appended as the length
+ increases. For the deflate format, these bits are stored backwards
+ from their more natural integer increment ordering, and so when the
+ decoding tables are built in the large loop below, the integer codes
+ are incremented backwards.
+
+ This routine assumes, but does not check, that all of the entries in
+ lens[] are in the range 0..MAXBITS. The caller must assure this.
+ 1..MAXBITS is interpreted as that code length. zero means that that
+ symbol does not occur in this code.
+
+ The codes are sorted by computing a count of codes for each length,
+ creating from that a table of starting indices for each length in the
+ sorted table, and then entering the symbols in order in the sorted
+ table. The sorted table is work[], with that space being provided by
+ the caller.
+
+ The length counts are used for other purposes as well, i.e. finding
+ the minimum and maximum length codes, determining if there are any
+ codes at all, checking for a valid set of lengths, and looking ahead
+ at length counts to determine sub-table sizes when building the
+ decoding tables.
+ */
+
+ /* accumulate lengths for codes (assumes lens[] all in 0..MAXBITS) */
+ for (len = 0; len <= MAXBITS; len++)
+ count[len] = 0;
+ for (sym = 0; sym < codes; sym++)
+ count[lens[sym]]++;
+
+ /* bound code lengths, force root to be within code lengths */
+ root = *bits;
+ for (max = MAXBITS; max >= 1; max--)
+ if (count[max] != 0) break;
+ if (root > max) root = max;
+ if (max == 0) { /* no symbols to code at all */
+ here.op = (unsigned char)64; /* invalid code marker */
+ here.bits = (unsigned char)1;
+ here.val = (unsigned short)0;
+ *(*table)++ = here; /* make a table to force an error */
+ *(*table)++ = here;
+ *bits = 1;
+ return 0; /* no symbols, but wait for decoding to report error */
+ }
+ for (min = 1; min < max; min++)
+ if (count[min] != 0) break;
+ if (root < min) root = min;
+
+ /* check for an over-subscribed or incomplete set of lengths */
+ left = 1;
+ for (len = 1; len <= MAXBITS; len++) {
+ left <<= 1;
+ left -= count[len];
+ if (left < 0) return -1; /* over-subscribed */
+ }
+ if (left > 0 && (type == CODES || max != 1))
+ return -1; /* incomplete set */
+
+ /* generate offsets into symbol table for each length for sorting */
+ offs[1] = 0;
+ for (len = 1; len < MAXBITS; len++)
+ offs[len + 1] = offs[len] + count[len];
+
+ /* sort symbols by length, by symbol order within each length */
+ for (sym = 0; sym < codes; sym++)
+ if (lens[sym] != 0) work[offs[lens[sym]]++] = (unsigned short)sym;
+
+ /*
+ Create and fill in decoding tables. In this loop, the table being
+ filled is at next and has curr index bits. The code being used is huff
+ with length len. That code is converted to an index by dropping drop
+ bits off of the bottom. For codes where len is less than drop + curr,
+ those top drop + curr - len bits are incremented through all values to
+ fill the table with replicated entries.
+
+ root is the number of index bits for the root table. When len exceeds
+ root, sub-tables are created pointed to by the root entry with an index
+ of the low root bits of huff. This is saved in low to check for when a
+ new sub-table should be started. drop is zero when the root table is
+ being filled, and drop is root when sub-tables are being filled.
+
+ When a new sub-table is needed, it is necessary to look ahead in the
+ code lengths to determine what size sub-table is needed. The length
+ counts are used for this, and so count[] is decremented as codes are
+ entered in the tables.
+
+ used keeps track of how many table entries have been allocated from the
+ provided *table space. It is checked for LENS and DIST tables against
+ the constants ENOUGH_LENS and ENOUGH_DISTS to guard against changes in
+ the initial root table size constants. See the comments in inftrees.h
+ for more information.
+
+ sym increments through all symbols, and the loop terminates when
+ all codes of length max, i.e. all codes, have been processed. This
+ routine permits incomplete codes, so another loop after this one fills
+ in the rest of the decoding tables with invalid code markers.
+ */
+
+ /* set up for code type */
+ switch (type) {
+ case CODES:
+ base = extra = work; /* dummy value--not used */
+ end = 19;
+ break;
+ case LENS:
+ base = lbase;
+ base -= 257;
+ extra = lext;
+ extra -= 257;
+ end = 256;
+ break;
+ default: /* DISTS */
+ base = dbase;
+ extra = dext;
+ end = -1;
+ }
+
+ /* initialize state for loop */
+ huff = 0; /* starting code */
+ sym = 0; /* starting code symbol */
+ len = min; /* starting code length */
+ next = *table; /* current table to fill in */
+ curr = root; /* current table index bits */
+ drop = 0; /* current bits to drop from code for index */
+ low = (unsigned)(-1); /* trigger new sub-table when len > root */
+ used = 1U << root; /* use root table entries */
+ mask = used - 1; /* mask for comparing low */
+
+ /* check available table space */
+ if ((type == LENS && used > ENOUGH_LENS) ||
+ (type == DISTS && used > ENOUGH_DISTS))
+ return 1;
+
+ /* process all codes and make table entries */
+ for (;;) {
+ /* create table entry */
+ here.bits = (unsigned char)(len - drop);
+ if ((int)(work[sym]) < end) {
+ here.op = (unsigned char)0;
+ here.val = work[sym];
+ }
+ else if ((int)(work[sym]) > end) {
+ here.op = (unsigned char)(extra[work[sym]]);
+ here.val = base[work[sym]];
+ }
+ else {
+ here.op = (unsigned char)(32 + 64); /* end of block */
+ here.val = 0;
+ }
+
+ /* replicate for those indices with low len bits equal to huff */
+ incr = 1U << (len - drop);
+ fill = 1U << curr;
+ min = fill; /* save offset to next table */
+ do {
+ fill -= incr;
+ next[(huff >> drop) + fill] = here;
+ } while (fill != 0);
+
+ /* backwards increment the len-bit code huff */
+ incr = 1U << (len - 1);
+ while (huff & incr)
+ incr >>= 1;
+ if (incr != 0) {
+ huff &= incr - 1;
+ huff += incr;
+ }
+ else
+ huff = 0;
+
+ /* go to next symbol, update count, len */
+ sym++;
+ if (--(count[len]) == 0) {
+ if (len == max) break;
+ len = lens[work[sym]];
+ }
+
+ /* create new sub-table if needed */
+ if (len > root && (huff & mask) != low) {
+ /* if first time, transition to sub-tables */
+ if (drop == 0)
+ drop = root;
+
+ /* increment past last table */
+ next += min; /* here min is 1 << curr */
+
+ /* determine length of next table */
+ curr = len - drop;
+ left = (int)(1 << curr);
+ while (curr + drop < max) {
+ left -= count[curr + drop];
+ if (left <= 0) break;
+ curr++;
+ left <<= 1;
+ }
+
+ /* check for enough space */
+ used += 1U << curr;
+ if ((type == LENS && used > ENOUGH_LENS) ||
+ (type == DISTS && used > ENOUGH_DISTS))
+ return 1;
+
+ /* point entry in root table to sub-table */
+ low = huff & mask;
+ (*table)[low].op = (unsigned char)curr;
+ (*table)[low].bits = (unsigned char)root;
+ (*table)[low].val = (unsigned short)(next - *table);
+ }
+ }
+
+ /* fill in remaining table entry if code is incomplete (guaranteed to have
+ at most one remaining entry, since if the code is incomplete, the
+ maximum code length that was allowed to get this far is one bit) */
+ if (huff != 0) {
+ here.op = (unsigned char)64; /* invalid code marker */
+ here.bits = (unsigned char)(len - drop);
+ here.val = (unsigned short)0;
+ next[huff] = here;
+ }
+
+ /* set return parameters */
+ *table += used;
+ *bits = root;
+ return 0;
+}
--- /dev/null
+/* inftrees.h -- header to use inftrees.c
+ * Copyright (C) 1995-2005, 2010 Mark Adler
+ * For conditions of distribution and use, see copyright notice in zlib.h
+ */
+
+/* WARNING: this file should *not* be used by applications. It is
+ part of the implementation of the compression library and is
+ subject to change. Applications should only use zlib.h.
+ */
+
+#ifndef _INFTREES_H
+#define _INFTREES_H
+
+/* Structure for decoding tables. Each entry provides either the
+ information needed to do the operation requested by the code that
+ indexed that table entry, or it provides a pointer to another
+ table that indexes more bits of the code. op indicates whether
+ the entry is a pointer to another table, a literal, a length or
+ distance, an end-of-block, or an invalid code. For a table
+ pointer, the low four bits of op is the number of index bits of
+ that table. For a length or distance, the low four bits of op
+ is the number of extra bits to get after the code. bits is
+ the number of bits in this code or part of the code to drop off
+ of the bit buffer. val is the actual byte to output in the case
+ of a literal, the base length or distance, or the offset from
+ the current table to the next table. Each entry is four bytes. */
+typedef struct {
+ unsigned char op; /* operation, extra bits, table bits */
+ unsigned char bits; /* bits in this part of the code */
+ unsigned short val; /* offset in table or code value */
+} code;
+
+/* op values as set by inflate_table():
+ 00000000 - literal
+ 0000tttt - table link, tttt != 0 is the number of table index bits
+ 0001eeee - length or distance, eeee is the number of extra bits
+ 01100000 - end of block
+ 01000000 - invalid code
+ */
+
+/* Maximum size of the dynamic table. The maximum number of code structures is
+ 1444, which is the sum of 852 for literal/length codes and 592 for distance
+ codes. These values were found by exhaustive searches using the program
+ examples/enough.c found in the zlib distribtution. The arguments to that
+ program are the number of symbols, the initial root table size, and the
+ maximum bit length of a code. "enough 286 9 15" for literal/length codes
+ returns returns 852, and "enough 30 6 15" for distance codes returns 592.
+ The initial root table size (9 or 6) is found in the fifth argument of the
+ inflate_table() calls in inflate.c and infback.c. If the root table size is
+ changed, then these maximum sizes would be need to be recalculated and
+ updated. */
+#define ENOUGH_LENS 852
+#define ENOUGH_DISTS 592
+#define ENOUGH (ENOUGH_LENS+ENOUGH_DISTS)
+
+/* Type of code to build for inflate_table() */
+typedef enum {
+ CODES,
+ LENS,
+ DISTS
+} codetype;
+
+int ZLIB_INTERNAL inflate_table OF((codetype type, unsigned short FAR *lens,
+ unsigned codes, code FAR * FAR *table,
+ unsigned FAR *bits, unsigned short FAR *work));
+
+#endif
--- /dev/null
+/* ioapi.h -- IO base function header for compress/uncompress .zip
+ part of the MiniZip project - ( http://www.winimage.com/zLibDll/minizip.html )
+
+ Copyright (C) 1998-2010 Gilles Vollant (minizip) ( http://www.winimage.com/zLibDll/minizip.html )
+
+ Modifications for Zip64 support
+ Copyright (C) 2009-2010 Mathias Svensson ( http://result42.com )
+
+ For more info read MiniZip_info.txt
+
+*/
+
+#ifdef _WIN32
+#ifndef _CRT_SECURE_NO_WARNINGS
+#define _CRT_SECURE_NO_WARNINGS
+#endif
+#endif
+
+#include "ioapi.h"
+
+voidpf call_zopen64 (const zlib_filefunc64_32_def* pfilefunc,const void*filename,int mode)
+{
+ if (pfilefunc->zfile_func64.zopen64_file != NULL)
+ return (*(pfilefunc->zfile_func64.zopen64_file)) (pfilefunc->zfile_func64.opaque,filename,mode);
+ else
+ {
+ return (*(pfilefunc->zopen32_file))(pfilefunc->zfile_func64.opaque,(const char*)filename,mode);
+ }
+}
+
+long call_zseek64 (const zlib_filefunc64_32_def* pfilefunc,voidpf filestream, ZPOS64_T offset, int origin)
+{
+ if (pfilefunc->zfile_func64.zseek64_file != NULL)
+ return (*(pfilefunc->zfile_func64.zseek64_file)) (pfilefunc->zfile_func64.opaque,filestream,offset,origin);
+ else
+ {
+ uLong offsetTruncated = (uLong)offset;
+ if (offsetTruncated != offset)
+ return -1;
+ else
+ return (*(pfilefunc->zseek32_file))(pfilefunc->zfile_func64.opaque,filestream,offsetTruncated,origin);
+ }
+}
+
+ZPOS64_T call_ztell64 (const zlib_filefunc64_32_def* pfilefunc,voidpf filestream)
+{
+ if (pfilefunc->zfile_func64.zseek64_file != NULL)
+ return (*(pfilefunc->zfile_func64.ztell64_file)) (pfilefunc->zfile_func64.opaque,filestream);
+ else
+ {
+ uLong tell_uLong = (*(pfilefunc->ztell32_file))(pfilefunc->zfile_func64.opaque,filestream);
+ if ((tell_uLong) == ((uLong)-1))
+ return (ZPOS64_T)-1;
+ else
+ return tell_uLong;
+ }
+}
+
+void fill_zlib_filefunc64_32_def_from_filefunc32(zlib_filefunc64_32_def* p_filefunc64_32,const zlib_filefunc_def* p_filefunc32)
+{
+ p_filefunc64_32->zfile_func64.zopen64_file = NULL;
+ p_filefunc64_32->zopen32_file = p_filefunc32->zopen_file;
+ p_filefunc64_32->zfile_func64.zerror_file = p_filefunc32->zerror_file;
+ p_filefunc64_32->zfile_func64.zread_file = p_filefunc32->zread_file;
+ p_filefunc64_32->zfile_func64.zwrite_file = p_filefunc32->zwrite_file;
+ p_filefunc64_32->zfile_func64.ztell64_file = NULL;
+ p_filefunc64_32->zfile_func64.zseek64_file = NULL;
+ p_filefunc64_32->zfile_func64.zclose_file = p_filefunc32->zclose_file;
+ p_filefunc64_32->zfile_func64.zerror_file = p_filefunc32->zerror_file;
+ p_filefunc64_32->zfile_func64.opaque = p_filefunc32->opaque;
+ p_filefunc64_32->zseek32_file = p_filefunc32->zseek_file;
+ p_filefunc64_32->ztell32_file = p_filefunc32->ztell_file;
+}
+
+
+
+static voidpf ZCALLBACK fopen_file_func OF((voidpf opaque, const char* filename, int mode));
+static uLong ZCALLBACK fread_file_func OF((voidpf opaque, voidpf stream, void* buf, uLong size));
+static uLong ZCALLBACK fwrite_file_func OF((voidpf opaque, voidpf stream, const void* buf,uLong size));
+static ZPOS64_T ZCALLBACK ftell64_file_func OF((voidpf opaque, voidpf stream));
+static long ZCALLBACK fseek64_file_func OF((voidpf opaque, voidpf stream, ZPOS64_T offset, int origin));
+static int ZCALLBACK fclose_file_func OF((voidpf opaque, voidpf stream));
+static int ZCALLBACK ferror_file_func OF((voidpf opaque, voidpf stream));
+
+static voidpf ZCALLBACK fopen_file_func (voidpf opaque, const char* filename, int mode)
+{
+ FILE* file = NULL;
+ const char* mode_fopen = NULL;
+ if ((mode & ZLIB_FILEFUNC_MODE_READWRITEFILTER)==ZLIB_FILEFUNC_MODE_READ)
+ mode_fopen = "rb";
+ else
+ if (mode & ZLIB_FILEFUNC_MODE_EXISTING)
+ mode_fopen = "r+b";
+ else
+ if (mode & ZLIB_FILEFUNC_MODE_CREATE)
+ mode_fopen = "wb";
+
+ if ((filename!=NULL) && (mode_fopen != NULL))
+ file = fopen(filename, mode_fopen);
+ return file;
+}
+
+static voidpf ZCALLBACK fopen64_file_func (voidpf opaque, const void* filename, int mode)
+{
+ FILE* file = NULL;
+ const char* mode_fopen = NULL;
+ if ((mode & ZLIB_FILEFUNC_MODE_READWRITEFILTER)==ZLIB_FILEFUNC_MODE_READ)
+ mode_fopen = "rb";
+ else
+ if (mode & ZLIB_FILEFUNC_MODE_EXISTING)
+ mode_fopen = "r+b";
+ else
+ if (mode & ZLIB_FILEFUNC_MODE_CREATE)
+ mode_fopen = "wb";
+
+ if ((filename!=NULL) && (mode_fopen != NULL))
+ file = fopen((const char*)filename, mode_fopen);
+ return file;
+}
+
+
+static uLong ZCALLBACK fread_file_func (voidpf opaque, voidpf stream, void* buf, uLong size)
+{
+ uLong ret;
+ ret = (uLong)fread(buf, 1, (size_t)size, (FILE *)stream);
+ return ret;
+}
+
+static uLong ZCALLBACK fwrite_file_func (voidpf opaque, voidpf stream, const void* buf, uLong size)
+{
+ uLong ret;
+ ret = (uLong)fwrite(buf, 1, (size_t)size, (FILE *)stream);
+ return ret;
+}
+
+static long ZCALLBACK ftell_file_func (voidpf opaque, voidpf stream)
+{
+ long ret;
+ ret = ftell((FILE *)stream);
+ return ret;
+}
+
+
+static ZPOS64_T ZCALLBACK ftell64_file_func (voidpf opaque, voidpf stream)
+{
+ ZPOS64_T ret;
+ ret = ftell((FILE *)stream);
+ return ret;
+}
+
+static long ZCALLBACK fseek_file_func (voidpf opaque, voidpf stream, uLong offset, int origin)
+{
+ int fseek_origin=0;
+ long ret;
+ switch (origin)
+ {
+ case ZLIB_FILEFUNC_SEEK_CUR :
+ fseek_origin = SEEK_CUR;
+ break;
+ case ZLIB_FILEFUNC_SEEK_END :
+ fseek_origin = SEEK_END;
+ break;
+ case ZLIB_FILEFUNC_SEEK_SET :
+ fseek_origin = SEEK_SET;
+ break;
+ default: return -1;
+ }
+ ret = 0;
+ if (fseek((FILE *)stream, offset, fseek_origin) != 0)
+ ret = -1;
+ return ret;
+}
+
+static long ZCALLBACK fseek64_file_func (voidpf opaque, voidpf stream, ZPOS64_T offset, int origin)
+{
+ int fseek_origin=0;
+ long ret;
+ switch (origin)
+ {
+ case ZLIB_FILEFUNC_SEEK_CUR :
+ fseek_origin = SEEK_CUR;
+ break;
+ case ZLIB_FILEFUNC_SEEK_END :
+ fseek_origin = SEEK_END;
+ break;
+ case ZLIB_FILEFUNC_SEEK_SET :
+ fseek_origin = SEEK_SET;
+ break;
+ default: return -1;
+ }
+ ret = 0;
+
+ if(fseek((FILE *)stream, (long)offset, fseek_origin) != 0)
+ ret = -1;
+
+ return ret;
+}
+
+
+static int ZCALLBACK fclose_file_func (voidpf opaque, voidpf stream)
+{
+ int ret;
+ ret = fclose((FILE *)stream);
+ return ret;
+}
+
+static int ZCALLBACK ferror_file_func (voidpf opaque, voidpf stream)
+{
+ int ret;
+ ret = ferror((FILE *)stream);
+ return ret;
+}
+
+void fill_fopen_filefunc (zlib_filefunc_def *pzlib_filefunc_def)
+{
+ pzlib_filefunc_def->zopen_file = fopen_file_func;
+ pzlib_filefunc_def->zread_file = fread_file_func;
+ pzlib_filefunc_def->zwrite_file = fwrite_file_func;
+ pzlib_filefunc_def->ztell_file = ftell_file_func;
+ pzlib_filefunc_def->zseek_file = fseek_file_func;
+ pzlib_filefunc_def->zclose_file = fclose_file_func;
+ pzlib_filefunc_def->zerror_file = ferror_file_func;
+ pzlib_filefunc_def->opaque = NULL;
+}
+
+void fill_fopen64_filefunc (zlib_filefunc64_def* pzlib_filefunc_def)
+{
+ pzlib_filefunc_def->zopen64_file = fopen64_file_func;
+ pzlib_filefunc_def->zread_file = fread_file_func;
+ pzlib_filefunc_def->zwrite_file = fwrite_file_func;
+ pzlib_filefunc_def->ztell64_file = ftell64_file_func;
+ pzlib_filefunc_def->zseek64_file = fseek64_file_func;
+ pzlib_filefunc_def->zclose_file = fclose_file_func;
+ pzlib_filefunc_def->zerror_file = ferror_file_func;
+ pzlib_filefunc_def->opaque = NULL;
+}
--- /dev/null
+/* ioapi.h -- IO base function header for compress/uncompress .zip
+ part of the MiniZip project - ( http://www.winimage.com/zLibDll/minizip.html )
+
+ Copyright (C) 1998-2010 Gilles Vollant (minizip) ( http://www.winimage.com/zLibDll/minizip.html )
+
+ Modifications for Zip64 support
+ Copyright (C) 2009-2010 Mathias Svensson ( http://result42.com )
+
+ For more info read MiniZip_info.txt
+
+ Changes
+
+ Oct-2009 - Defined ZPOS64_T to fpos_t on windows and u_int64_t on linux. (might need to find a better why for this)
+ Oct-2009 - Change to fseeko64, ftello64 and fopen64 so large files would work on linux.
+ More if/def section may be needed to support other platforms
+ Oct-2009 - Defined fxxxx64 calls to normal fopen/ftell/fseek so they would compile on windows.
+ (but you should use iowin32.c for windows instead)
+
+*/
+
+#ifndef _ZLIBIOAPI64_H
+#define _ZLIBIOAPI64_H
+
+#if (!defined(_WIN32)) && (!defined(WIN32))
+
+ // Linux needs this to support file operation on files larger then 4+GB
+ // But might need better if/def to select just the platforms that needs them.
+
+ #ifndef __USE_FILE_OFFSET64
+ #define __USE_FILE_OFFSET64
+ #endif
+ #ifndef __USE_LARGEFILE64
+ #define __USE_LARGEFILE64
+ #endif
+ #ifndef _LARGEFILE64_SOURCE
+ #define _LARGEFILE64_SOURCE
+ #endif
+ #ifndef _FILE_OFFSET_BIT
+ #define _FILE_OFFSET_BIT 64
+ #endif
+#endif
+
+#include <stdio.h>
+#include <stdlib.h>
+#include "zlib.h"
+
+#if defined(USE_FILE32API)
+#define fopen64 fopen
+#define ftello64 ftell
+#define fseeko64 fseek
+#else
+#ifdef _MSC_VER
+ #define fopen64 fopen
+ #if (_MSC_VER >= 1400) && (!(defined(NO_MSCVER_FILE64_FUNC)))
+ #define ftello64 _ftelli64
+ #define fseeko64 _fseeki64
+ #else // old MSC
+ #define ftello64 ftell
+ #define fseeko64 fseek
+ #endif
+#endif
+#endif
+
+/*
+#ifndef ZPOS64_T
+ #ifdef _WIN32
+ #define ZPOS64_T fpos_t
+ #else
+ #include <stdint.h>
+ #define ZPOS64_T uint64_t
+ #endif
+#endif
+*/
+
+#ifdef HAVE_MINIZIP64_CONF_H
+#include "mz64conf.h"
+#endif
+
+/* a type choosen by DEFINE */
+#ifdef HAVE_64BIT_INT_CUSTOM
+typedef 64BIT_INT_CUSTOM_TYPE ZPOS64_T;
+#else
+#ifdef HAS_STDINT_H
+#include "stdint.h"
+typedef uint64_t ZPOS64_T;
+#else
+
+
+#if defined(_MSC_VER) || defined(__BORLANDC__)
+typedef unsigned __int64 ZPOS64_T;
+#else
+typedef unsigned long long int ZPOS64_T;
+#endif
+#endif
+#endif
+
+
+
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+
+#define ZLIB_FILEFUNC_SEEK_CUR (1)
+#define ZLIB_FILEFUNC_SEEK_END (2)
+#define ZLIB_FILEFUNC_SEEK_SET (0)
+
+#define ZLIB_FILEFUNC_MODE_READ (1)
+#define ZLIB_FILEFUNC_MODE_WRITE (2)
+#define ZLIB_FILEFUNC_MODE_READWRITEFILTER (3)
+
+#define ZLIB_FILEFUNC_MODE_EXISTING (4)
+#define ZLIB_FILEFUNC_MODE_CREATE (8)
+
+
+#ifndef ZCALLBACK
+ #if (defined(WIN32) || defined(_WIN32) || defined (WINDOWS) || defined (_WINDOWS)) && defined(CALLBACK) && defined (USEWINDOWS_CALLBACK)
+ #define ZCALLBACK CALLBACK
+ #else
+ #define ZCALLBACK
+ #endif
+#endif
+
+
+
+
+typedef voidpf (ZCALLBACK *open_file_func) OF((voidpf opaque, const char* filename, int mode));
+typedef uLong (ZCALLBACK *read_file_func) OF((voidpf opaque, voidpf stream, void* buf, uLong size));
+typedef uLong (ZCALLBACK *write_file_func) OF((voidpf opaque, voidpf stream, const void* buf, uLong size));
+typedef int (ZCALLBACK *close_file_func) OF((voidpf opaque, voidpf stream));
+typedef int (ZCALLBACK *testerror_file_func) OF((voidpf opaque, voidpf stream));
+
+typedef long (ZCALLBACK *tell_file_func) OF((voidpf opaque, voidpf stream));
+typedef long (ZCALLBACK *seek_file_func) OF((voidpf opaque, voidpf stream, uLong offset, int origin));
+
+
+/* here is the "old" 32 bits structure structure */
+typedef struct zlib_filefunc_def_s
+{
+ open_file_func zopen_file;
+ read_file_func zread_file;
+ write_file_func zwrite_file;
+ tell_file_func ztell_file;
+ seek_file_func zseek_file;
+ close_file_func zclose_file;
+ testerror_file_func zerror_file;
+ voidpf opaque;
+} zlib_filefunc_def;
+
+typedef ZPOS64_T (ZCALLBACK *tell64_file_func) OF((voidpf opaque, voidpf stream));
+typedef long (ZCALLBACK *seek64_file_func) OF((voidpf opaque, voidpf stream, ZPOS64_T offset, int origin));
+typedef voidpf (ZCALLBACK *open64_file_func) OF((voidpf opaque, const void* filename, int mode));
+
+typedef struct zlib_filefunc64_def_s
+{
+ open64_file_func zopen64_file;
+ read_file_func zread_file;
+ write_file_func zwrite_file;
+ tell64_file_func ztell64_file;
+ seek64_file_func zseek64_file;
+ close_file_func zclose_file;
+ testerror_file_func zerror_file;
+ voidpf opaque;
+} zlib_filefunc64_def;
+
+void fill_fopen64_filefunc OF((zlib_filefunc64_def* pzlib_filefunc_def));
+void fill_fopen_filefunc OF((zlib_filefunc_def* pzlib_filefunc_def));
+
+/* now internal definition, only for zip.c and unzip.h */
+typedef struct zlib_filefunc64_32_def_s
+{
+ zlib_filefunc64_def zfile_func64;
+ open_file_func zopen32_file;
+ tell_file_func ztell32_file;
+ seek_file_func zseek32_file;
+} zlib_filefunc64_32_def;
+
+
+#define ZREAD64(filefunc,filestream,buf,size) ((*((filefunc).zfile_func64.zread_file)) ((filefunc).zfile_func64.opaque,filestream,buf,size))
+#define ZWRITE64(filefunc,filestream,buf,size) ((*((filefunc).zfile_func64.zwrite_file)) ((filefunc).zfile_func64.opaque,filestream,buf,size))
+//#define ZTELL64(filefunc,filestream) ((*((filefunc).ztell64_file)) ((filefunc).opaque,filestream))
+//#define ZSEEK64(filefunc,filestream,pos,mode) ((*((filefunc).zseek64_file)) ((filefunc).opaque,filestream,pos,mode))
+#define ZCLOSE64(filefunc,filestream) ((*((filefunc).zfile_func64.zclose_file)) ((filefunc).zfile_func64.opaque,filestream))
+#define ZERROR64(filefunc,filestream) ((*((filefunc).zfile_func64.zerror_file)) ((filefunc).zfile_func64.opaque,filestream))
+
+voidpf call_zopen64 OF((const zlib_filefunc64_32_def* pfilefunc,const void*filename,int mode));
+long call_zseek64 OF((const zlib_filefunc64_32_def* pfilefunc,voidpf filestream, ZPOS64_T offset, int origin));
+ZPOS64_T call_ztell64 OF((const zlib_filefunc64_32_def* pfilefunc,voidpf filestream));
+
+void fill_zlib_filefunc64_32_def_from_filefunc32(zlib_filefunc64_32_def* p_filefunc64_32,const zlib_filefunc_def* p_filefunc32);
+
+#define ZOPEN64(filefunc,filename,mode) (call_zopen64((&(filefunc)),(filename),(mode)))
+#define ZTELL64(filefunc,filestream) (call_ztell64((&(filefunc)),(filestream)))
+#define ZSEEK64(filefunc,filestream,pos,mode) (call_zseek64((&(filefunc)),(filestream),(pos),(mode)))
+
+#ifdef __cplusplus
+}
+#endif
+
+#endif
--- /dev/null
+/* trees.c -- output deflated data using Huffman coding
+ * Copyright (C) 1995-2012 Jean-loup Gailly
+ * detect_data_type() function provided freely by Cosmin Truta, 2006
+ * For conditions of distribution and use, see copyright notice in zlib.h
+ */
+
+/*
+ * ALGORITHM
+ *
+ * The "deflation" process uses several Huffman trees. The more
+ * common source values are represented by shorter bit sequences.
+ *
+ * Each code tree is stored in a compressed form which is itself
+ * a Huffman encoding of the lengths of all the code strings (in
+ * ascending order by source values). The actual code strings are
+ * reconstructed from the lengths in the inflate process, as described
+ * in the deflate specification.
+ *
+ * REFERENCES
+ *
+ * Deutsch, L.P.,"'Deflate' Compressed Data Format Specification".
+ * Available in ftp.uu.net:/pub/archiving/zip/doc/deflate-1.1.doc
+ *
+ * Storer, James A.
+ * Data Compression: Methods and Theory, pp. 49-50.
+ * Computer Science Press, 1988. ISBN 0-7167-8156-5.
+ *
+ * Sedgewick, R.
+ * Algorithms, p290.
+ * Addison-Wesley, 1983. ISBN 0-201-06672-6.
+ */
+
+/* @(#) $Id$ */
+
+/* #define GEN_TREES_H */
+
+#include "deflate.h"
+
+#ifdef DEBUG
+# include <ctype.h>
+#endif
+
+/* ===========================================================================
+ * Constants
+ */
+
+#define MAX_BL_BITS 7
+/* Bit length codes must not exceed MAX_BL_BITS bits */
+
+#define END_BLOCK 256
+/* end of block literal code */
+
+#define REP_3_6 16
+/* repeat previous bit length 3-6 times (2 bits of repeat count) */
+
+#define REPZ_3_10 17
+/* repeat a zero length 3-10 times (3 bits of repeat count) */
+
+#define REPZ_11_138 18
+/* repeat a zero length 11-138 times (7 bits of repeat count) */
+
+local const int extra_lbits[LENGTH_CODES] /* extra bits for each length code */
+= {0,0,0,0,0,0,0,0,1,1,1,1,2,2,2,2,3,3,3,3,4,4,4,4,5,5,5,5,0};
+
+local const int extra_dbits[D_CODES] /* extra bits for each distance code */
+= {0,0,0,0,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13};
+
+local const int extra_blbits[BL_CODES]/* extra bits for each bit length code */
+= {0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,2,3,7};
+
+local const uch bl_order[BL_CODES]
+= {16,17,18,0,8,7,9,6,10,5,11,4,12,3,13,2,14,1,15};
+/* The lengths of the bit length codes are sent in order of decreasing
+ * probability, to avoid transmitting the lengths for unused bit length codes.
+ */
+
+/* ===========================================================================
+ * Local data. These are initialized only once.
+ */
+
+#define DIST_CODE_LEN 512 /* see definition of array dist_code below */
+
+#if defined(GEN_TREES_H) || !defined(STDC)
+/* non ANSI compilers may not accept trees.h */
+
+local ct_data static_ltree[L_CODES+2];
+/* The static literal tree. Since the bit lengths are imposed, there is no
+ * need for the L_CODES extra codes used during heap construction. However
+ * The codes 286 and 287 are needed to build a canonical tree (see _tr_init
+ * below).
+ */
+
+local ct_data static_dtree[D_CODES];
+/* The static distance tree. (Actually a trivial tree since all codes use
+ * 5 bits.)
+ */
+
+uch _dist_code[DIST_CODE_LEN];
+/* Distance codes. The first 256 values correspond to the distances
+ * 3 .. 258, the last 256 values correspond to the top 8 bits of
+ * the 15 bit distances.
+ */
+
+uch _length_code[MAX_MATCH-MIN_MATCH+1];
+/* length code for each normalized match length (0 == MIN_MATCH) */
+
+local int base_length[LENGTH_CODES];
+/* First normalized length for each code (0 = MIN_MATCH) */
+
+local int base_dist[D_CODES];
+/* First normalized distance for each code (0 = distance of 1) */
+
+#else
+# include "trees.h"
+#endif /* GEN_TREES_H */
+
+struct static_tree_desc_s {
+ const ct_data *static_tree; /* static tree or NULL */
+ const intf *extra_bits; /* extra bits for each code or NULL */
+ int extra_base; /* base index for extra_bits */
+ int elems; /* max number of elements in the tree */
+ int max_length; /* max bit length for the codes */
+};
+
+local static_tree_desc static_l_desc =
+{static_ltree, extra_lbits, LITERALS+1, L_CODES, MAX_BITS};
+
+local static_tree_desc static_d_desc =
+{static_dtree, extra_dbits, 0, D_CODES, MAX_BITS};
+
+local static_tree_desc static_bl_desc =
+{(const ct_data *)0, extra_blbits, 0, BL_CODES, MAX_BL_BITS};
+
+/* ===========================================================================
+ * Local (static) routines in this file.
+ */
+
+local void tr_static_init OF((void));
+local void init_block OF((deflate_state *s));
+local void pqdownheap OF((deflate_state *s, ct_data *tree, int k));
+local void gen_bitlen OF((deflate_state *s, tree_desc *desc));
+local void gen_codes OF((ct_data *tree, int max_code, ushf *bl_count));
+local void build_tree OF((deflate_state *s, tree_desc *desc));
+local void scan_tree OF((deflate_state *s, ct_data *tree, int max_code));
+local void send_tree OF((deflate_state *s, ct_data *tree, int max_code));
+local int build_bl_tree OF((deflate_state *s));
+local void send_all_trees OF((deflate_state *s, int lcodes, int dcodes,
+ int blcodes));
+local void compress_block OF((deflate_state *s, const ct_data *ltree,
+ const ct_data *dtree));
+local int detect_data_type OF((deflate_state *s));
+local unsigned bi_reverse OF((unsigned value, int length));
+local void bi_windup OF((deflate_state *s));
+local void bi_flush OF((deflate_state *s));
+local void copy_block OF((deflate_state *s, charf *buf, unsigned len,
+ int header));
+
+#ifdef GEN_TREES_H
+local void gen_trees_header OF((void));
+#endif
+
+#ifndef DEBUG
+# define send_code(s, c, tree) send_bits(s, tree[c].Code, tree[c].Len)
+/* Send a code of the given tree. c and tree must not have side effects */
+
+#else /* DEBUG */
+# define send_code(s, c, tree) \
+{ if (z_verbose>2) fprintf(stderr,"\ncd %3d ",(c)); \
+ send_bits(s, tree[c].Code, tree[c].Len); }
+#endif
+
+/* ===========================================================================
+ * Output a short LSB first on the stream.
+ * IN assertion: there is enough room in pendingBuf.
+ */
+#define put_short(s, w) { \
+ put_byte(s, (uch)((w) & 0xff)); \
+ put_byte(s, (uch)((ush)(w) >> 8)); \
+}
+
+/* ===========================================================================
+ * Send a value on a given number of bits.
+ * IN assertion: length <= 16 and value fits in length bits.
+ */
+#ifdef DEBUG
+local void send_bits OF((deflate_state *s, int value, int length));
+
+local void send_bits(deflate_state *s, int value, int length)
+{
+ Tracevv((stderr," l %2d v %4x ", length, value));
+ Assert(length > 0 && length <= 15, "invalid length");
+ s->bits_sent += (ulg)length;
+
+ /* If not enough room in bi_buf, use (valid) bits from bi_buf and
+ * (16 - bi_valid) bits from value, leaving (width - (16-bi_valid))
+ * unused bits in value.
+ */
+ if (s->bi_valid > (int)Buf_size - length) {
+ s->bi_buf |= (ush)value << s->bi_valid;
+ put_short(s, s->bi_buf);
+ s->bi_buf = (ush)value >> (Buf_size - s->bi_valid);
+ s->bi_valid += length - Buf_size;
+ } else {
+ s->bi_buf |= (ush)value << s->bi_valid;
+ s->bi_valid += length;
+ }
+}
+#else /* !DEBUG */
+
+#define send_bits(s, value, length) \
+{ int len = length;\
+ if (s->bi_valid > (int)Buf_size - len) {\
+ int val = value;\
+ s->bi_buf |= (ush)val << s->bi_valid;\
+ put_short(s, s->bi_buf);\
+ s->bi_buf = (ush)val >> (Buf_size - s->bi_valid);\
+ s->bi_valid += len - Buf_size;\
+ } else {\
+ s->bi_buf |= (ush)(value) << s->bi_valid;\
+ s->bi_valid += len;\
+ }\
+}
+#endif /* DEBUG */
+
+
+/* the arguments must not have side effects */
+
+/* ===========================================================================
+ * Initialize the various 'constant' tables.
+ */
+local void tr_static_init(void)
+{
+#if defined(GEN_TREES_H) || !defined(STDC)
+ static int static_init_done = 0;
+ int n; /* iterates over tree elements */
+ int bits; /* bit counter */
+ int length; /* length value */
+ int codes; /* code value */
+ int dist; /* distance index */
+ ush bl_count[MAX_BITS+1];
+ /* number of codes at each bit length for an optimal tree */
+
+ if (static_init_done) return;
+
+ /* For some embedded targets, global variables are not initialized: */
+#ifdef NO_INIT_GLOBAL_POINTERS
+ static_l_desc.static_tree = static_ltree;
+ static_l_desc.extra_bits = extra_lbits;
+ static_d_desc.static_tree = static_dtree;
+ static_d_desc.extra_bits = extra_dbits;
+ static_bl_desc.extra_bits = extra_blbits;
+#endif
+
+ /* Initialize the mapping length (0..255) -> length code (0..28) */
+ length = 0;
+ for (codes = 0; codes < LENGTH_CODES-1; codes++) {
+ base_length[codes] = length;
+ for (n = 0; n < (1<<extra_lbits[codes]); n++) {
+ _length_code[length++] = (uch)codes;
+ }
+ }
+ Assert (length == 256, "tr_static_init: length != 256");
+ /* Note that the length 255 (match length 258) can be represented
+ * in two different ways: code 284 + 5 bits or code 285, so we
+ * overwrite length_code[255] to use the best encoding:
+ */
+ _length_code[length-1] = (uch)codes;
+
+ /* Initialize the mapping dist (0..32K) -> dist code (0..29) */
+ dist = 0;
+ for (codes = 0 ; codes < 16; codes++) {
+ base_dist[codes] = dist;
+ for (n = 0; n < (1<<extra_dbits[codes]); n++) {
+ _dist_code[dist++] = (uch)codes;
+ }
+ }
+ Assert (dist == 256, "tr_static_init: dist != 256");
+ dist >>= 7; /* from now on, all distances are divided by 128 */
+ for ( ; codes < D_CODES; codes++) {
+ base_dist[codes] = dist << 7;
+ for (n = 0; n < (1<<(extra_dbits[codes]-7)); n++) {
+ _dist_code[256 + dist++] = (uch)codes;
+ }
+ }
+ Assert (dist == 256, "tr_static_init: 256+dist != 512");
+
+ /* Construct the codes of the static literal tree */
+ for (bits = 0; bits <= MAX_BITS; bits++) bl_count[bits] = 0;
+ n = 0;
+ while (n <= 143) static_ltree[n++].Len = 8, bl_count[8]++;
+ while (n <= 255) static_ltree[n++].Len = 9, bl_count[9]++;
+ while (n <= 279) static_ltree[n++].Len = 7, bl_count[7]++;
+ while (n <= 287) static_ltree[n++].Len = 8, bl_count[8]++;
+ /* Codes 286 and 287 do not exist, but we must include them in the
+ * tree construction to get a canonical Huffman tree (longest code
+ * all ones)
+ */
+ gen_codes((ct_data *)static_ltree, L_CODES+1, bl_count);
+
+ /* The static distance tree is trivial: */
+ for (n = 0; n < D_CODES; n++) {
+ static_dtree[n].Len = 5;
+ static_dtree[n].Code = bi_reverse((unsigned)n, 5);
+ }
+ static_init_done = 1;
+
+# ifdef GEN_TREES_H
+ gen_trees_header();
+# endif
+#endif /* defined(GEN_TREES_H) || !defined(STDC) */
+}
+
+/* ===========================================================================
+ * Genererate the file trees.h describing the static trees.
+ */
+#ifdef GEN_TREES_H
+# ifndef DEBUG
+# include <stdio.h>
+# endif
+
+# define SEPARATOR(i, last, width) \
+ ((i) == (last)? "\n};\n\n" : \
+ ((i) % (width) == (width)-1 ? ",\n" : ", "))
+
+void gen_trees_header(void)
+{
+ FILE *header = fopen("trees.h", "w");
+ int i;
+
+ Assert (header != NULL, "Can't open trees.h");
+ fprintf(header,
+ "/* header created automatically with -DGEN_TREES_H */\n\n");
+
+ fprintf(header, "local const ct_data static_ltree[L_CODES+2] = {\n");
+ for (i = 0; i < L_CODES+2; i++) {
+ fprintf(header, "{{%3u},{%3u}}%s", static_ltree[i].Code,
+ static_ltree[i].Len, SEPARATOR(i, L_CODES+1, 5));
+ }
+
+ fprintf(header, "local const ct_data static_dtree[D_CODES] = {\n");
+ for (i = 0; i < D_CODES; i++) {
+ fprintf(header, "{{%2u},{%2u}}%s", static_dtree[i].Code,
+ static_dtree[i].Len, SEPARATOR(i, D_CODES-1, 5));
+ }
+
+ fprintf(header, "const uch ZLIB_INTERNAL _dist_code[DIST_CODE_LEN] = {\n");
+ for (i = 0; i < DIST_CODE_LEN; i++) {
+ fprintf(header, "%2u%s", _dist_code[i],
+ SEPARATOR(i, DIST_CODE_LEN-1, 20));
+ }
+
+ fprintf(header,
+ "const uch ZLIB_INTERNAL _length_code[MAX_MATCH-MIN_MATCH+1]= {\n");
+ for (i = 0; i < MAX_MATCH-MIN_MATCH+1; i++) {
+ fprintf(header, "%2u%s", _length_code[i],
+ SEPARATOR(i, MAX_MATCH-MIN_MATCH, 20));
+ }
+
+ fprintf(header, "local const int base_length[LENGTH_CODES] = {\n");
+ for (i = 0; i < LENGTH_CODES; i++) {
+ fprintf(header, "%1u%s", base_length[i],
+ SEPARATOR(i, LENGTH_CODES-1, 20));
+ }
+
+ fprintf(header, "local const int base_dist[D_CODES] = {\n");
+ for (i = 0; i < D_CODES; i++) {
+ fprintf(header, "%5u%s", base_dist[i],
+ SEPARATOR(i, D_CODES-1, 10));
+ }
+
+ fclose(header);
+}
+#endif /* GEN_TREES_H */
+
+/* ===========================================================================
+ * Initialize the tree data structures for a new zlib stream.
+ */
+void ZLIB_INTERNAL _tr_init(deflate_state *s)
+{
+ tr_static_init();
+
+ s->l_desc.dyn_tree = s->dyn_ltree;
+ s->l_desc.stat_desc = &static_l_desc;
+
+ s->d_desc.dyn_tree = s->dyn_dtree;
+ s->d_desc.stat_desc = &static_d_desc;
+
+ s->bl_desc.dyn_tree = s->bl_tree;
+ s->bl_desc.stat_desc = &static_bl_desc;
+
+ s->bi_buf = 0;
+ s->bi_valid = 0;
+#ifdef DEBUG
+ s->compressed_len = 0L;
+ s->bits_sent = 0L;
+#endif
+
+ /* Initialize the first block of the first file: */
+ init_block(s);
+}
+
+/* ===========================================================================
+ * Initialize a new block.
+ */
+local void init_block(deflate_state *s)
+{
+ int n; /* iterates over tree elements */
+
+ /* Initialize the trees. */
+ for (n = 0; n < L_CODES; n++) s->dyn_ltree[n].Freq = 0;
+ for (n = 0; n < D_CODES; n++) s->dyn_dtree[n].Freq = 0;
+ for (n = 0; n < BL_CODES; n++) s->bl_tree[n].Freq = 0;
+
+ s->dyn_ltree[END_BLOCK].Freq = 1;
+ s->opt_len = s->static_len = 0L;
+ s->last_lit = s->matches = 0;
+}
+
+#define SMALLEST 1
+/* Index within the heap array of least frequent node in the Huffman tree */
+
+
+/* ===========================================================================
+ * Remove the smallest element from the heap and recreate the heap with
+ * one less element. Updates heap and heap_len.
+ */
+#define pqremove(s, tree, top) \
+{\
+ top = s->heap[SMALLEST]; \
+ s->heap[SMALLEST] = s->heap[s->heap_len--]; \
+ pqdownheap(s, tree, SMALLEST); \
+}
+
+/* ===========================================================================
+ * Compares to subtrees, using the tree depth as tie breaker when
+ * the subtrees have equal frequency. This minimizes the worst case length.
+ */
+#define smaller(tree, n, m, depth) \
+ (tree[n].Freq < tree[m].Freq || \
+ (tree[n].Freq == tree[m].Freq && depth[n] <= depth[m]))
+
+/* ===========================================================================
+ * Restore the heap property by moving down the tree starting at node k,
+ * exchanging a node with the smallest of its two sons if necessary, stopping
+ * when the heap property is re-established (each father smaller than its
+ * two sons).
+ */
+local void pqdownheap(deflate_state *s, ct_data *tree, int k)
+{
+ int v = s->heap[k];
+ int j = k << 1; /* left son of k */
+ while (j <= s->heap_len) {
+ /* Set j to the smallest of the two sons: */
+ if (j < s->heap_len &&
+ smaller(tree, s->heap[j+1], s->heap[j], s->depth)) {
+ j++;
+ }
+ /* Exit if v is smaller than both sons */
+ if (smaller(tree, v, s->heap[j], s->depth)) break;
+
+ /* Exchange v with the smallest son */
+ s->heap[k] = s->heap[j]; k = j;
+
+ /* And continue down the tree, setting j to the left son of k */
+ j <<= 1;
+ }
+ s->heap[k] = v;
+}
+
+/* ===========================================================================
+ * Compute the optimal bit lengths for a tree and update the total bit length
+ * for the current block.
+ * IN assertion: the fields freq and dad are set, heap[heap_max] and
+ * above are the tree nodes sorted by increasing frequency.
+ * OUT assertions: the field len is set to the optimal bit length, the
+ * array bl_count contains the frequencies for each bit length.
+ * The length opt_len is updated; static_len is also updated if stree is
+ * not null.
+ */
+local void gen_bitlen(deflate_state *s, tree_desc *desc)
+{
+ ct_data *tree = desc->dyn_tree;
+ int max_code = desc->max_code;
+ const ct_data *stree = desc->stat_desc->static_tree;
+ const intf *extra = desc->stat_desc->extra_bits;
+ int base = desc->stat_desc->extra_base;
+ int max_length = desc->stat_desc->max_length;
+ int h; /* heap index */
+ int n, m; /* iterate over the tree elements */
+ int bits; /* bit length */
+ int xbits; /* extra bits */
+ ush f; /* frequency */
+ int overflow = 0; /* number of elements with bit length too large */
+
+ for (bits = 0; bits <= MAX_BITS; bits++) s->bl_count[bits] = 0;
+
+ /* In a first pass, compute the optimal bit lengths (which may
+ * overflow in the case of the bit length tree).
+ */
+ tree[s->heap[s->heap_max]].Len = 0; /* root of the heap */
+
+ for (h = s->heap_max+1; h < HEAP_SIZE; h++) {
+ n = s->heap[h];
+ bits = tree[tree[n].Dad].Len + 1;
+ if (bits > max_length) bits = max_length, overflow++;
+ tree[n].Len = (ush)bits;
+ /* We overwrite tree[n].Dad which is no longer needed */
+
+ if (n > max_code) continue; /* not a leaf node */
+
+ s->bl_count[bits]++;
+ xbits = 0;
+ if (n >= base) xbits = extra[n-base];
+ f = tree[n].Freq;
+ s->opt_len += (ulg)f * (bits + xbits);
+ if (stree) s->static_len += (ulg)f * (stree[n].Len + xbits);
+ }
+ if (overflow == 0) return;
+
+ Trace((stderr,"\nbit length overflow\n"));
+ /* This happens for example on obj2 and pic of the Calgary corpus */
+
+ /* Find the first bit length which could increase: */
+ do {
+ bits = max_length-1;
+ while (s->bl_count[bits] == 0) bits--;
+ s->bl_count[bits]--; /* move one leaf down the tree */
+ s->bl_count[bits+1] += 2; /* move one overflow item as its brother */
+ s->bl_count[max_length]--;
+ /* The brother of the overflow item also moves one step up,
+ * but this does not affect bl_count[max_length]
+ */
+ overflow -= 2;
+ } while (overflow > 0);
+
+ /* Now recompute all bit lengths, scanning in increasing frequency.
+ * h is still equal to HEAP_SIZE. (It is simpler to reconstruct all
+ * lengths instead of fixing only the wrong ones. This idea is taken
+ * from 'ar' written by Haruhiko Okumura.)
+ */
+ for (bits = max_length; bits != 0; bits--) {
+ n = s->bl_count[bits];
+ while (n != 0) {
+ m = s->heap[--h];
+ if (m > max_code) continue;
+ if ((unsigned) tree[m].Len != (unsigned) bits) {
+ Trace((stderr,"code %d bits %d->%d\n", m, tree[m].Len, bits));
+ s->opt_len += ((long)bits - (long)tree[m].Len)
+ *(long)tree[m].Freq;
+ tree[m].Len = (ush)bits;
+ }
+ n--;
+ }
+ }
+}
+
+/* ===========================================================================
+ * Generate the codes for a given tree and bit counts (which need not be
+ * optimal).
+ * IN assertion: the array bl_count contains the bit length statistics for
+ * the given tree and the field len is set for all tree elements.
+ * OUT assertion: the field code is set for all tree elements of non
+ * zero code length.
+ */
+local void gen_codes (ct_data *tree, int max_code, ushf *bl_count)
+{
+ ush next_code[MAX_BITS+1]; /* next code value for each bit length */
+ ush codes = 0; /* running code value */
+ int bits; /* bit index */
+ int n; /* code index */
+
+ /* The distribution counts are first used to generate the code values
+ * without bit reversal.
+ */
+ for (bits = 1; bits <= MAX_BITS; bits++) {
+ next_code[bits] = codes = (codes + bl_count[bits-1]) << 1;
+ }
+ /* Check that the bit counts in bl_count are consistent. The last code
+ * must be all ones.
+ */
+ Assert (codes + bl_count[MAX_BITS]-1 == (1<<MAX_BITS)-1,
+ "inconsistent bit counts");
+ Tracev((stderr,"\ngen_codes: max_code %d ", max_code));
+
+ for (n = 0; n <= max_code; n++) {
+ int len = tree[n].Len;
+ if (len == 0) continue;
+ /* Now reverse the bits */
+ tree[n].Code = bi_reverse(next_code[len]++, len);
+
+ Tracecv(tree != static_ltree, (stderr,"\nn %3d %c l %2d c %4x (%x) ",
+ n, (isgraph(n) ? n : ' '), len, tree[n].Code, next_code[len]-1));
+ }
+}
+
+/* ===========================================================================
+ * Construct one Huffman tree and assigns the code bit strings and lengths.
+ * Update the total bit length for the current block.
+ * IN assertion: the field freq is set for all tree elements.
+ * OUT assertions: the fields len and code are set to the optimal bit length
+ * and corresponding code. The length opt_len is updated; static_len is
+ * also updated if stree is not null. The field max_code is set.
+ */
+local void build_tree(deflate_state *s, tree_desc *desc)
+{
+ ct_data *tree = desc->dyn_tree;
+ const ct_data *stree = desc->stat_desc->static_tree;
+ int elems = desc->stat_desc->elems;
+ int n, m; /* iterate over heap elements */
+ int max_code = -1; /* largest code with non zero frequency */
+ int node; /* new node being created */
+
+ /* Construct the initial heap, with least frequent element in
+ * heap[SMALLEST]. The sons of heap[n] are heap[2*n] and heap[2*n+1].
+ * heap[0] is not used.
+ */
+ s->heap_len = 0, s->heap_max = HEAP_SIZE;
+
+ for (n = 0; n < elems; n++) {
+ if (tree[n].Freq != 0) {
+ s->heap[++(s->heap_len)] = max_code = n;
+ s->depth[n] = 0;
+ } else {
+ tree[n].Len = 0;
+ }
+ }
+
+ /* The pkzip format requires that at least one distance code exists,
+ * and that at least one bit should be sent even if there is only one
+ * possible code. So to avoid special checks later on we force at least
+ * two codes of non zero frequency.
+ */
+ while (s->heap_len < 2) {
+ node = s->heap[++(s->heap_len)] = (max_code < 2 ? ++max_code : 0);
+ tree[node].Freq = 1;
+ s->depth[node] = 0;
+ s->opt_len--; if (stree) s->static_len -= stree[node].Len;
+ /* node is 0 or 1 so it does not have extra bits */
+ }
+ desc->max_code = max_code;
+
+ /* The elements heap[heap_len/2+1 .. heap_len] are leaves of the tree,
+ * establish sub-heaps of increasing lengths:
+ */
+ for (n = s->heap_len/2; n >= 1; n--) pqdownheap(s, tree, n);
+
+ /* Construct the Huffman tree by repeatedly combining the least two
+ * frequent nodes.
+ */
+ node = elems; /* next internal node of the tree */
+ do {
+ pqremove(s, tree, n); /* n = node of least frequency */
+ m = s->heap[SMALLEST]; /* m = node of next least frequency */
+
+ s->heap[--(s->heap_max)] = n; /* keep the nodes sorted by frequency */
+ s->heap[--(s->heap_max)] = m;
+
+ /* Create a new node father of n and m */
+ tree[node].Freq = tree[n].Freq + tree[m].Freq;
+ s->depth[node] = (uch)((s->depth[n] >= s->depth[m] ?
+ s->depth[n] : s->depth[m]) + 1);
+ tree[n].Dad = tree[m].Dad = (ush)node;
+#ifdef DUMP_BL_TREE
+ if (tree == s->bl_tree) {
+ fprintf(stderr,"\nnode %d(%d), sons %d(%d) %d(%d)",
+ node, tree[node].Freq, n, tree[n].Freq, m, tree[m].Freq);
+ }
+#endif
+ /* and insert the new node in the heap */
+ s->heap[SMALLEST] = node++;
+ pqdownheap(s, tree, SMALLEST);
+
+ } while (s->heap_len >= 2);
+
+ s->heap[--(s->heap_max)] = s->heap[SMALLEST];
+
+ /* At this point, the fields freq and dad are set. We can now
+ * generate the bit lengths.
+ */
+ gen_bitlen(s, (tree_desc *)desc);
+
+ /* The field len is now set, we can generate the bit codes */
+ gen_codes ((ct_data *)tree, max_code, s->bl_count);
+}
+
+/* ===========================================================================
+ * Scan a literal or distance tree to determine the frequencies of the codes
+ * in the bit length tree.
+ */
+local void scan_tree (deflate_state *s, ct_data *tree, int max_code)
+{
+ int n; /* iterates over all tree elements */
+ int prevlen = -1; /* last emitted length */
+ int curlen; /* length of current code */
+ int nextlen = tree[0].Len; /* length of next code */
+ int count = 0; /* repeat count of the current code */
+ int max_count = 7; /* max repeat count */
+ int min_count = 4; /* min repeat count */
+
+ if (nextlen == 0) max_count = 138, min_count = 3;
+ tree[max_code+1].Len = (ush)0xffff; /* guard */
+
+ for (n = 0; n <= max_code; n++) {
+ curlen = nextlen; nextlen = tree[n+1].Len;
+ if (++count < max_count && curlen == nextlen) {
+ continue;
+ } else if (count < min_count) {
+ s->bl_tree[curlen].Freq += count;
+ } else if (curlen != 0) {
+ if (curlen != prevlen) s->bl_tree[curlen].Freq++;
+ s->bl_tree[REP_3_6].Freq++;
+ } else if (count <= 10) {
+ s->bl_tree[REPZ_3_10].Freq++;
+ } else {
+ s->bl_tree[REPZ_11_138].Freq++;
+ }
+ count = 0; prevlen = curlen;
+ if (nextlen == 0) {
+ max_count = 138, min_count = 3;
+ } else if (curlen == nextlen) {
+ max_count = 6, min_count = 3;
+ } else {
+ max_count = 7, min_count = 4;
+ }
+ }
+}
+
+/* ===========================================================================
+ * Send a literal or distance tree in compressed form, using the codes in
+ * bl_tree.
+ */
+local void send_tree (deflate_state *s, ct_data *tree, int max_code)
+{
+ int n; /* iterates over all tree elements */
+ int prevlen = -1; /* last emitted length */
+ int curlen; /* length of current code */
+ int nextlen = tree[0].Len; /* length of next code */
+ int count = 0; /* repeat count of the current code */
+ int max_count = 7; /* max repeat count */
+ int min_count = 4; /* min repeat count */
+
+ /* tree[max_code+1].Len = -1; */ /* guard already set */
+ if (nextlen == 0) max_count = 138, min_count = 3;
+
+ for (n = 0; n <= max_code; n++) {
+ curlen = nextlen; nextlen = tree[n+1].Len;
+ if (++count < max_count && curlen == nextlen) {
+ continue;
+ } else if (count < min_count) {
+ do { send_code(s, curlen, s->bl_tree); } while (--count != 0);
+
+ } else if (curlen != 0) {
+ if (curlen != prevlen) {
+ send_code(s, curlen, s->bl_tree); count--;
+ }
+ Assert(count >= 3 && count <= 6, " 3_6?");
+ send_code(s, REP_3_6, s->bl_tree); send_bits(s, count-3, 2);
+
+ } else if (count <= 10) {
+ send_code(s, REPZ_3_10, s->bl_tree); send_bits(s, count-3, 3);
+
+ } else {
+ send_code(s, REPZ_11_138, s->bl_tree); send_bits(s, count-11, 7);
+ }
+ count = 0; prevlen = curlen;
+ if (nextlen == 0) {
+ max_count = 138, min_count = 3;
+ } else if (curlen == nextlen) {
+ max_count = 6, min_count = 3;
+ } else {
+ max_count = 7, min_count = 4;
+ }
+ }
+}
+
+/* ===========================================================================
+ * Construct the Huffman tree for the bit lengths and return the index in
+ * bl_order of the last bit length code to send.
+ */
+local int build_bl_tree(deflate_state *s)
+{
+ int max_blindex; /* index of last bit length code of non zero freq */
+
+ /* Determine the bit length frequencies for literal and distance trees */
+ scan_tree(s, (ct_data *)s->dyn_ltree, s->l_desc.max_code);
+ scan_tree(s, (ct_data *)s->dyn_dtree, s->d_desc.max_code);
+
+ /* Build the bit length tree: */
+ build_tree(s, (tree_desc *)(&(s->bl_desc)));
+ /* opt_len now includes the length of the tree representations, except
+ * the lengths of the bit lengths codes and the 5+5+4 bits for the counts.
+ */
+
+ /* Determine the number of bit length codes to send. The pkzip format
+ * requires that at least 4 bit length codes be sent. (appnote.txt says
+ * 3 but the actual value used is 4.)
+ */
+ for (max_blindex = BL_CODES-1; max_blindex >= 3; max_blindex--) {
+ if (s->bl_tree[bl_order[max_blindex]].Len != 0) break;
+ }
+ /* Update opt_len to include the bit length tree and counts */
+ s->opt_len += 3*(max_blindex+1) + 5+5+4;
+ Tracev((stderr, "\ndyn trees: dyn %ld, stat %ld",
+ s->opt_len, s->static_len));
+
+ return max_blindex;
+}
+
+/* ===========================================================================
+ * Send the header for a block using dynamic Huffman trees: the counts, the
+ * lengths of the bit length codes, the literal tree and the distance tree.
+ * IN assertion: lcodes >= 257, dcodes >= 1, blcodes >= 4.
+ */
+local void send_all_trees(deflate_state *s, int lcodes, int dcodes, int blcodes)
+{
+ int rank; /* index in bl_order */
+
+ Assert (lcodes >= 257 && dcodes >= 1 && blcodes >= 4, "not enough codes");
+ Assert (lcodes <= L_CODES && dcodes <= D_CODES && blcodes <= BL_CODES,
+ "too many codes");
+ Tracev((stderr, "\nbl counts: "));
+ send_bits(s, lcodes-257, 5); /* not +255 as stated in appnote.txt */
+ send_bits(s, dcodes-1, 5);
+ send_bits(s, blcodes-4, 4); /* not -3 as stated in appnote.txt */
+ for (rank = 0; rank < blcodes; rank++) {
+ Tracev((stderr, "\nbl code %2d ", bl_order[rank]));
+ send_bits(s, s->bl_tree[bl_order[rank]].Len, 3);
+ }
+ Tracev((stderr, "\nbl tree: sent %ld", s->bits_sent));
+
+ send_tree(s, (ct_data *)s->dyn_ltree, lcodes-1); /* literal tree */
+ Tracev((stderr, "\nlit tree: sent %ld", s->bits_sent));
+
+ send_tree(s, (ct_data *)s->dyn_dtree, dcodes-1); /* distance tree */
+ Tracev((stderr, "\ndist tree: sent %ld", s->bits_sent));
+}
+
+/* ===========================================================================
+ * Send a stored block
+ */
+void ZLIB_INTERNAL _tr_stored_block(deflate_state *s, charf *buf, ulg stored_len, int last)
+{
+ send_bits(s, (STORED_BLOCK<<1)+last, 3); /* send block type */
+#ifdef DEBUG
+ s->compressed_len = (s->compressed_len + 3 + 7) & (ulg)~7L;
+ s->compressed_len += (stored_len + 4) << 3;
+#endif
+ copy_block(s, buf, (unsigned)stored_len, 1); /* with header */
+}
+
+/* ===========================================================================
+ * Flush the bits in the bit buffer to pending output (leaves at most 7 bits)
+ */
+void ZLIB_INTERNAL _tr_flush_bits(deflate_state *s)
+{
+ bi_flush(s);
+}
+
+/* ===========================================================================
+ * Send one empty static block to give enough lookahead for inflate.
+ * This takes 10 bits, of which 7 may remain in the bit buffer.
+ */
+void ZLIB_INTERNAL _tr_align(deflate_state *s)
+{
+ send_bits(s, STATIC_TREES<<1, 3);
+ send_code(s, END_BLOCK, static_ltree);
+#ifdef DEBUG
+ s->compressed_len += 10L; /* 3 for block type, 7 for EOB */
+#endif
+ bi_flush(s);
+}
+
+/* ===========================================================================
+ * Determine the best encoding for the current block: dynamic trees, static
+ * trees or store, and output the encoded block to the zip file.
+ */
+void ZLIB_INTERNAL _tr_flush_block(deflate_state *s, charf *buf, ulg stored_len, int last)
+{
+ ulg opt_lenb, static_lenb; /* opt_len and static_len in bytes */
+ int max_blindex = 0; /* index of last bit length code of non zero freq */
+
+ /* Build the Huffman trees unless a stored block is forced */
+ if (s->level > 0) {
+
+ /* Check if the file is binary or text */
+ if (s->strm->data_type == Z_UNKNOWN)
+ s->strm->data_type = detect_data_type(s);
+
+ /* Construct the literal and distance trees */
+ build_tree(s, (tree_desc *)(&(s->l_desc)));
+ Tracev((stderr, "\nlit data: dyn %ld, stat %ld", s->opt_len,
+ s->static_len));
+
+ build_tree(s, (tree_desc *)(&(s->d_desc)));
+ Tracev((stderr, "\ndist data: dyn %ld, stat %ld", s->opt_len,
+ s->static_len));
+ /* At this point, opt_len and static_len are the total bit lengths of
+ * the compressed block data, excluding the tree representations.
+ */
+
+ /* Build the bit length tree for the above two trees, and get the index
+ * in bl_order of the last bit length code to send.
+ */
+ max_blindex = build_bl_tree(s);
+
+ /* Determine the best encoding. Compute the block lengths in bytes. */
+ opt_lenb = (s->opt_len+3+7)>>3;
+ static_lenb = (s->static_len+3+7)>>3;
+
+ Tracev((stderr, "\nopt %lu(%lu) stat %lu(%lu) stored %lu lit %u ",
+ opt_lenb, s->opt_len, static_lenb, s->static_len, stored_len,
+ s->last_lit));
+
+ if (static_lenb <= opt_lenb) opt_lenb = static_lenb;
+
+ } else {
+ Assert(buf != (char*)0, "lost buf");
+ opt_lenb = static_lenb = stored_len + 5; /* force a stored block */
+ }
+
+#ifdef FORCE_STORED
+ if (buf != (char*)0) { /* force stored block */
+#else
+ if (stored_len+4 <= opt_lenb && buf != (char*)0) {
+ /* 4: two words for the lengths */
+#endif
+ /* The test buf != NULL is only necessary if LIT_BUFSIZE > WSIZE.
+ * Otherwise we can't have processed more than WSIZE input bytes since
+ * the last block flush, because compression would have been
+ * successful. If LIT_BUFSIZE <= WSIZE, it is never too late to
+ * transform a block into a stored block.
+ */
+ _tr_stored_block(s, buf, stored_len, last);
+
+#ifdef FORCE_STATIC
+ } else if (static_lenb >= 0) { /* force static trees */
+#else
+ } else if (s->strategy == Z_FIXED || static_lenb == opt_lenb) {
+#endif
+ send_bits(s, (STATIC_TREES<<1)+last, 3);
+ compress_block(s, (const ct_data *)static_ltree,
+ (const ct_data *)static_dtree);
+#ifdef DEBUG
+ s->compressed_len += 3 + s->static_len;
+#endif
+ } else {
+ send_bits(s, (DYN_TREES<<1)+last, 3);
+ send_all_trees(s, s->l_desc.max_code+1, s->d_desc.max_code+1,
+ max_blindex+1);
+ compress_block(s, (const ct_data *)s->dyn_ltree,
+ (const ct_data *)s->dyn_dtree);
+#ifdef DEBUG
+ s->compressed_len += 3 + s->opt_len;
+#endif
+ }
+ Assert (s->compressed_len == s->bits_sent, "bad compressed size");
+ /* The above check is made mod 2^32, for files larger than 512 MB
+ * and uLong implemented on 32 bits.
+ */
+ init_block(s);
+
+ if (last) {
+ bi_windup(s);
+#ifdef DEBUG
+ s->compressed_len += 7; /* align on byte boundary */
+#endif
+ }
+ Tracev((stderr,"\ncomprlen %lu(%lu) ", s->compressed_len>>3,
+ s->compressed_len-7*last));
+ }
+
+ /* ===========================================================================
+ * Save the match info and tally the frequency counts. Return true if
+ * the current block must be flushed.
+ */
+ int ZLIB_INTERNAL _tr_tally (deflate_state *s, unsigned dist, unsigned lc)
+ {
+ s->d_buf[s->last_lit] = (ush)dist;
+ s->l_buf[s->last_lit++] = (uch)lc;
+ if (dist == 0) {
+ /* lc is the unmatched char */
+ s->dyn_ltree[lc].Freq++;
+ } else {
+ s->matches++;
+ /* Here, lc is the match length - MIN_MATCH */
+ dist--; /* dist = match distance - 1 */
+ Assert((ush)dist < (ush)MAX_DIST(s) &&
+ (ush)lc <= (ush)(MAX_MATCH-MIN_MATCH) &&
+ (ush)d_code(dist) < (ush)D_CODES, "_tr_tally: bad match");
+
+ s->dyn_ltree[_length_code[lc]+LITERALS+1].Freq++;
+ s->dyn_dtree[d_code(dist)].Freq++;
+ }
+
+#ifdef TRUNCATE_BLOCK
+ /* Try to guess if it is profitable to stop the current block here */
+ if ((s->last_lit & 0x1fff) == 0 && s->level > 2) {
+ /* Compute an upper bound for the compressed length */
+ ulg out_length = (ulg)s->last_lit*8L;
+ ulg in_length = (ulg)((long)s->strstart - s->block_start);
+ int dcode;
+ for (dcode = 0; dcode < D_CODES; dcode++) {
+ out_length += (ulg)s->dyn_dtree[dcode].Freq *
+ (5L+extra_dbits[dcode]);
+ }
+ out_length >>= 3;
+ Tracev((stderr,"\nlast_lit %u, in %ld, out ~%ld(%ld%%) ",
+ s->last_lit, in_length, out_length,
+ 100L - out_length*100L/in_length));
+ if (s->matches < s->last_lit/2 && out_length < in_length/2) return 1;
+ }
+#endif
+ return (s->last_lit == s->lit_bufsize-1);
+ /* We avoid equality with lit_bufsize because of wraparound at 64K
+ * on 16 bit machines and because stored blocks are restricted to
+ * 64K-1 bytes.
+ */
+ }
+
+ /* ===========================================================================
+ * Send the block data compressed using the given Huffman trees
+ */
+ local void compress_block(deflate_state *s, const ct_data *ltree, const ct_data *dtree)
+ {
+ unsigned dist; /* distance of matched string */
+ int lc; /* match length or unmatched char (if dist == 0) */
+ unsigned lx = 0; /* running index in l_buf */
+ unsigned codes; /* the code to send */
+ int extra; /* number of extra bits to send */
+
+ if (s->last_lit != 0) do {
+ dist = s->d_buf[lx];
+ lc = s->l_buf[lx++];
+ if (dist == 0) {
+ send_code(s, lc, ltree); /* send a literal byte */
+ Tracecv(isgraph(lc), (stderr," '%c' ", lc));
+ } else {
+ /* Here, lc is the match length - MIN_MATCH */
+ codes = _length_code[lc];
+ send_code(s, codes + LITERALS+1, ltree); /* send the length code */
+ extra = extra_lbits[codes];
+ if (extra != 0) {
+ lc -= base_length[codes];
+ send_bits(s, lc, extra); /* send the extra length bits */
+ }
+ dist--; /* dist is now the match distance - 1 */
+ codes = d_code(dist);
+ Assert (codes < D_CODES, "bad d_code");
+
+ send_code(s, codes, dtree); /* send the distance code */
+ extra = extra_dbits[codes];
+ if (extra != 0) {
+ dist -= base_dist[codes];
+ send_bits(s, dist, extra); /* send the extra distance bits */
+ }
+ } /* literal or match pair ? */
+
+ /* Check that the overlay between pending_buf and d_buf+l_buf is ok: */
+ Assert((uInt)(s->pending) < s->lit_bufsize + 2*lx,
+ "pendingBuf overflow");
+
+ } while (lx < s->last_lit);
+
+ send_code(s, END_BLOCK, ltree);
+ }
+
+ /* ===========================================================================
+ * Check if the data type is TEXT or BINARY, using the following algorithm:
+ * - TEXT if the two conditions below are satisfied:
+ * a) There are no non-portable control characters belonging to the
+ * "black list" (0..6, 14..25, 28..31).
+ * b) There is at least one printable character belonging to the
+ * "white list" (9 {TAB}, 10 {LF}, 13 {CR}, 32..255).
+ * - BINARY otherwise.
+ * - The following partially-portable control characters form a
+ * "gray list" that is ignored in this detection algorithm:
+ * (7 {BEL}, 8 {BS}, 11 {VT}, 12 {FF}, 26 {SUB}, 27 {ESC}).
+ * IN assertion: the fields Freq of dyn_ltree are set.
+ */
+ local int detect_data_type(deflate_state *s)
+ {
+ /* black_mask is the bit mask of black-listed bytes
+ * set bits 0..6, 14..25, and 28..31
+ * 0xf3ffc07f = binary 11110011111111111100000001111111
+ */
+ unsigned long black_mask = 0xf3ffc07fUL;
+ int n;
+
+ /* Check for non-textual ("black-listed") bytes. */
+ for (n = 0; n <= 31; n++, black_mask >>= 1)
+ if ((black_mask & 1) && (s->dyn_ltree[n].Freq != 0))
+ return Z_BINARY;
+
+ /* Check for textual ("white-listed") bytes. */
+ if (s->dyn_ltree[9].Freq != 0 || s->dyn_ltree[10].Freq != 0
+ || s->dyn_ltree[13].Freq != 0)
+ return Z_TEXT;
+ for (n = 32; n < LITERALS; n++)
+ if (s->dyn_ltree[n].Freq != 0)
+ return Z_TEXT;
+
+ /* There are no "black-listed" or "white-listed" bytes:
+ * this stream either is empty or has tolerated ("gray-listed") bytes only.
+ */
+ return Z_BINARY;
+ }
+
+ /* ===========================================================================
+ * Reverse the first len bits of a code, using straightforward code (a faster
+ * method would use a table)
+ * IN assertion: 1 <= len <= 15
+ */
+ local unsigned bi_reverse(unsigned codes, int len)
+ {
+ register unsigned res = 0;
+ do {
+ res |= codes & 1;
+ codes >>= 1, res <<= 1;
+ } while (--len > 0);
+ return res >> 1;
+ }
+
+ /* ===========================================================================
+ * Flush the bit buffer, keeping at most 7 bits in it.
+ */
+ local void bi_flush(deflate_state *s)
+ {
+ if (s->bi_valid == 16) {
+ put_short(s, s->bi_buf);
+ s->bi_buf = 0;
+ s->bi_valid = 0;
+ } else if (s->bi_valid >= 8) {
+ put_byte(s, (Byte)s->bi_buf);
+ s->bi_buf >>= 8;
+ s->bi_valid -= 8;
+ }
+ }
+
+ /* ===========================================================================
+ * Flush the bit buffer and align the output on a byte boundary
+ */
+ local void bi_windup(deflate_state *s)
+ {
+ if (s->bi_valid > 8) {
+ put_short(s, s->bi_buf);
+ } else if (s->bi_valid > 0) {
+ put_byte(s, (Byte)s->bi_buf);
+ }
+ s->bi_buf = 0;
+ s->bi_valid = 0;
+#ifdef DEBUG
+ s->bits_sent = (s->bits_sent+7) & ~7;
+#endif
+ }
+
+ /* ===========================================================================
+ * Copy a stored block, storing first the length and its
+ * one's complement if requested.
+ */
+ local void copy_block(deflate_state *s, charf *buf, unsigned len, int header)
+ {
+ bi_windup(s); /* align on byte boundary */
+
+ if (header) {
+ put_short(s, (ush)len);
+ put_short(s, (ush)~len);
+#ifdef DEBUG
+ s->bits_sent += 2*16;
+#endif
+ }
+#ifdef DEBUG
+ s->bits_sent += (ulg)len<<3;
+#endif
+ while (len--) {
+ put_byte(s, *buf++);
+ }
+ }
--- /dev/null
+/* header created automatically with -DGEN_TREES_H */
+#ifndef _TREES_H
+#define _TREES_H
+
+local const ct_data static_ltree[L_CODES+2] = {
+{{ 12},{ 8}}, {{140},{ 8}}, {{ 76},{ 8}}, {{204},{ 8}}, {{ 44},{ 8}},
+{{172},{ 8}}, {{108},{ 8}}, {{236},{ 8}}, {{ 28},{ 8}}, {{156},{ 8}},
+{{ 92},{ 8}}, {{220},{ 8}}, {{ 60},{ 8}}, {{188},{ 8}}, {{124},{ 8}},
+{{252},{ 8}}, {{ 2},{ 8}}, {{130},{ 8}}, {{ 66},{ 8}}, {{194},{ 8}},
+{{ 34},{ 8}}, {{162},{ 8}}, {{ 98},{ 8}}, {{226},{ 8}}, {{ 18},{ 8}},
+{{146},{ 8}}, {{ 82},{ 8}}, {{210},{ 8}}, {{ 50},{ 8}}, {{178},{ 8}},
+{{114},{ 8}}, {{242},{ 8}}, {{ 10},{ 8}}, {{138},{ 8}}, {{ 74},{ 8}},
+{{202},{ 8}}, {{ 42},{ 8}}, {{170},{ 8}}, {{106},{ 8}}, {{234},{ 8}},
+{{ 26},{ 8}}, {{154},{ 8}}, {{ 90},{ 8}}, {{218},{ 8}}, {{ 58},{ 8}},
+{{186},{ 8}}, {{122},{ 8}}, {{250},{ 8}}, {{ 6},{ 8}}, {{134},{ 8}},
+{{ 70},{ 8}}, {{198},{ 8}}, {{ 38},{ 8}}, {{166},{ 8}}, {{102},{ 8}},
+{{230},{ 8}}, {{ 22},{ 8}}, {{150},{ 8}}, {{ 86},{ 8}}, {{214},{ 8}},
+{{ 54},{ 8}}, {{182},{ 8}}, {{118},{ 8}}, {{246},{ 8}}, {{ 14},{ 8}},
+{{142},{ 8}}, {{ 78},{ 8}}, {{206},{ 8}}, {{ 46},{ 8}}, {{174},{ 8}},
+{{110},{ 8}}, {{238},{ 8}}, {{ 30},{ 8}}, {{158},{ 8}}, {{ 94},{ 8}},
+{{222},{ 8}}, {{ 62},{ 8}}, {{190},{ 8}}, {{126},{ 8}}, {{254},{ 8}},
+{{ 1},{ 8}}, {{129},{ 8}}, {{ 65},{ 8}}, {{193},{ 8}}, {{ 33},{ 8}},
+{{161},{ 8}}, {{ 97},{ 8}}, {{225},{ 8}}, {{ 17},{ 8}}, {{145},{ 8}},
+{{ 81},{ 8}}, {{209},{ 8}}, {{ 49},{ 8}}, {{177},{ 8}}, {{113},{ 8}},
+{{241},{ 8}}, {{ 9},{ 8}}, {{137},{ 8}}, {{ 73},{ 8}}, {{201},{ 8}},
+{{ 41},{ 8}}, {{169},{ 8}}, {{105},{ 8}}, {{233},{ 8}}, {{ 25},{ 8}},
+{{153},{ 8}}, {{ 89},{ 8}}, {{217},{ 8}}, {{ 57},{ 8}}, {{185},{ 8}},
+{{121},{ 8}}, {{249},{ 8}}, {{ 5},{ 8}}, {{133},{ 8}}, {{ 69},{ 8}},
+{{197},{ 8}}, {{ 37},{ 8}}, {{165},{ 8}}, {{101},{ 8}}, {{229},{ 8}},
+{{ 21},{ 8}}, {{149},{ 8}}, {{ 85},{ 8}}, {{213},{ 8}}, {{ 53},{ 8}},
+{{181},{ 8}}, {{117},{ 8}}, {{245},{ 8}}, {{ 13},{ 8}}, {{141},{ 8}},
+{{ 77},{ 8}}, {{205},{ 8}}, {{ 45},{ 8}}, {{173},{ 8}}, {{109},{ 8}},
+{{237},{ 8}}, {{ 29},{ 8}}, {{157},{ 8}}, {{ 93},{ 8}}, {{221},{ 8}},
+{{ 61},{ 8}}, {{189},{ 8}}, {{125},{ 8}}, {{253},{ 8}}, {{ 19},{ 9}},
+{{275},{ 9}}, {{147},{ 9}}, {{403},{ 9}}, {{ 83},{ 9}}, {{339},{ 9}},
+{{211},{ 9}}, {{467},{ 9}}, {{ 51},{ 9}}, {{307},{ 9}}, {{179},{ 9}},
+{{435},{ 9}}, {{115},{ 9}}, {{371},{ 9}}, {{243},{ 9}}, {{499},{ 9}},
+{{ 11},{ 9}}, {{267},{ 9}}, {{139},{ 9}}, {{395},{ 9}}, {{ 75},{ 9}},
+{{331},{ 9}}, {{203},{ 9}}, {{459},{ 9}}, {{ 43},{ 9}}, {{299},{ 9}},
+{{171},{ 9}}, {{427},{ 9}}, {{107},{ 9}}, {{363},{ 9}}, {{235},{ 9}},
+{{491},{ 9}}, {{ 27},{ 9}}, {{283},{ 9}}, {{155},{ 9}}, {{411},{ 9}},
+{{ 91},{ 9}}, {{347},{ 9}}, {{219},{ 9}}, {{475},{ 9}}, {{ 59},{ 9}},
+{{315},{ 9}}, {{187},{ 9}}, {{443},{ 9}}, {{123},{ 9}}, {{379},{ 9}},
+{{251},{ 9}}, {{507},{ 9}}, {{ 7},{ 9}}, {{263},{ 9}}, {{135},{ 9}},
+{{391},{ 9}}, {{ 71},{ 9}}, {{327},{ 9}}, {{199},{ 9}}, {{455},{ 9}},
+{{ 39},{ 9}}, {{295},{ 9}}, {{167},{ 9}}, {{423},{ 9}}, {{103},{ 9}},
+{{359},{ 9}}, {{231},{ 9}}, {{487},{ 9}}, {{ 23},{ 9}}, {{279},{ 9}},
+{{151},{ 9}}, {{407},{ 9}}, {{ 87},{ 9}}, {{343},{ 9}}, {{215},{ 9}},
+{{471},{ 9}}, {{ 55},{ 9}}, {{311},{ 9}}, {{183},{ 9}}, {{439},{ 9}},
+{{119},{ 9}}, {{375},{ 9}}, {{247},{ 9}}, {{503},{ 9}}, {{ 15},{ 9}},
+{{271},{ 9}}, {{143},{ 9}}, {{399},{ 9}}, {{ 79},{ 9}}, {{335},{ 9}},
+{{207},{ 9}}, {{463},{ 9}}, {{ 47},{ 9}}, {{303},{ 9}}, {{175},{ 9}},
+{{431},{ 9}}, {{111},{ 9}}, {{367},{ 9}}, {{239},{ 9}}, {{495},{ 9}},
+{{ 31},{ 9}}, {{287},{ 9}}, {{159},{ 9}}, {{415},{ 9}}, {{ 95},{ 9}},
+{{351},{ 9}}, {{223},{ 9}}, {{479},{ 9}}, {{ 63},{ 9}}, {{319},{ 9}},
+{{191},{ 9}}, {{447},{ 9}}, {{127},{ 9}}, {{383},{ 9}}, {{255},{ 9}},
+{{511},{ 9}}, {{ 0},{ 7}}, {{ 64},{ 7}}, {{ 32},{ 7}}, {{ 96},{ 7}},
+{{ 16},{ 7}}, {{ 80},{ 7}}, {{ 48},{ 7}}, {{112},{ 7}}, {{ 8},{ 7}},
+{{ 72},{ 7}}, {{ 40},{ 7}}, {{104},{ 7}}, {{ 24},{ 7}}, {{ 88},{ 7}},
+{{ 56},{ 7}}, {{120},{ 7}}, {{ 4},{ 7}}, {{ 68},{ 7}}, {{ 36},{ 7}},
+{{100},{ 7}}, {{ 20},{ 7}}, {{ 84},{ 7}}, {{ 52},{ 7}}, {{116},{ 7}},
+{{ 3},{ 8}}, {{131},{ 8}}, {{ 67},{ 8}}, {{195},{ 8}}, {{ 35},{ 8}},
+{{163},{ 8}}, {{ 99},{ 8}}, {{227},{ 8}}
+};
+
+local const ct_data static_dtree[D_CODES] = {
+{{ 0},{ 5}}, {{16},{ 5}}, {{ 8},{ 5}}, {{24},{ 5}}, {{ 4},{ 5}},
+{{20},{ 5}}, {{12},{ 5}}, {{28},{ 5}}, {{ 2},{ 5}}, {{18},{ 5}},
+{{10},{ 5}}, {{26},{ 5}}, {{ 6},{ 5}}, {{22},{ 5}}, {{14},{ 5}},
+{{30},{ 5}}, {{ 1},{ 5}}, {{17},{ 5}}, {{ 9},{ 5}}, {{25},{ 5}},
+{{ 5},{ 5}}, {{21},{ 5}}, {{13},{ 5}}, {{29},{ 5}}, {{ 3},{ 5}},
+{{19},{ 5}}, {{11},{ 5}}, {{27},{ 5}}, {{ 7},{ 5}}, {{23},{ 5}}
+};
+
+const uch ZLIB_INTERNAL _dist_code[DIST_CODE_LEN] = {
+ 0, 1, 2, 3, 4, 4, 5, 5, 6, 6, 6, 6, 7, 7, 7, 7, 8, 8, 8, 8,
+ 8, 8, 8, 8, 9, 9, 9, 9, 9, 9, 9, 9, 10, 10, 10, 10, 10, 10, 10, 10,
+10, 10, 10, 10, 10, 10, 10, 10, 11, 11, 11, 11, 11, 11, 11, 11, 11, 11, 11, 11,
+11, 11, 11, 11, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12,
+12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 13, 13, 13, 13,
+13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13,
+13, 13, 13, 13, 13, 13, 13, 13, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14,
+14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14,
+14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14,
+14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 15, 15, 15, 15, 15, 15, 15, 15,
+15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15,
+15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15,
+15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 0, 0, 16, 17,
+18, 18, 19, 19, 20, 20, 20, 20, 21, 21, 21, 21, 22, 22, 22, 22, 22, 22, 22, 22,
+23, 23, 23, 23, 23, 23, 23, 23, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24,
+24, 24, 24, 24, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25,
+26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26,
+26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 27, 27, 27, 27, 27, 27, 27, 27,
+27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27,
+27, 27, 27, 27, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28,
+28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28,
+28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28,
+28, 28, 28, 28, 28, 28, 28, 28, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29,
+29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29,
+29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29,
+29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29
+};
+
+const uch ZLIB_INTERNAL _length_code[MAX_MATCH-MIN_MATCH+1]= {
+ 0, 1, 2, 3, 4, 5, 6, 7, 8, 8, 9, 9, 10, 10, 11, 11, 12, 12, 12, 12,
+13, 13, 13, 13, 14, 14, 14, 14, 15, 15, 15, 15, 16, 16, 16, 16, 16, 16, 16, 16,
+17, 17, 17, 17, 17, 17, 17, 17, 18, 18, 18, 18, 18, 18, 18, 18, 19, 19, 19, 19,
+19, 19, 19, 19, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20,
+21, 21, 21, 21, 21, 21, 21, 21, 21, 21, 21, 21, 21, 21, 21, 21, 22, 22, 22, 22,
+22, 22, 22, 22, 22, 22, 22, 22, 22, 22, 22, 22, 23, 23, 23, 23, 23, 23, 23, 23,
+23, 23, 23, 23, 23, 23, 23, 23, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24,
+24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24,
+25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25,
+25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 26, 26, 26, 26, 26, 26, 26, 26,
+26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26,
+26, 26, 26, 26, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27,
+27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 28
+};
+
+local const int base_length[LENGTH_CODES] = {
+0, 1, 2, 3, 4, 5, 6, 7, 8, 10, 12, 14, 16, 20, 24, 28, 32, 40, 48, 56,
+64, 80, 96, 112, 128, 160, 192, 224, 0
+};
+
+local const int base_dist[D_CODES] = {
+ 0, 1, 2, 3, 4, 6, 8, 12, 16, 24,
+ 32, 48, 64, 96, 128, 192, 256, 384, 512, 768,
+ 1024, 1536, 2048, 3072, 4096, 6144, 8192, 12288, 16384, 24576
+};
+
+
+#endif
--- /dev/null
+/* uncompr.c -- decompress a memory buffer
+ * Copyright (C) 1995-2003, 2010 Jean-loup Gailly.
+ * For conditions of distribution and use, see copyright notice in zlib.h
+ */
+
+/* @(#) $Id$ */
+
+#define ZLIB_INTERNAL
+#include "zlib.h"
+
+/* ===========================================================================
+ Decompresses the source buffer into the destination buffer. sourceLen is
+ the byte length of the source buffer. Upon entry, destLen is the total
+ size of the destination buffer, which must be large enough to hold the
+ entire uncompressed data. (The size of the uncompressed data must have
+ been saved previously by the compressor and transmitted to the decompressor
+ by some mechanism outside the scope of this compression library.)
+ Upon exit, destLen is the actual size of the compressed buffer.
+
+ uncompress returns Z_OK if success, Z_MEM_ERROR if there was not
+ enough memory, Z_BUF_ERROR if there was not enough room in the output
+ buffer, or Z_DATA_ERROR if the input data was corrupted.
+ */
+int ZEXPORT uncompress (Bytef *dest, uLongf *destLen, const Bytef *source, uLong sourceLen)
+{
+ z_stream stream;
+ int err;
+
+ stream.next_in = (Bytef *)source;
+ stream.avail_in = (uInt)sourceLen;
+ /* Check for source > 64K on 16-bit machine: */
+ if ((uLong)stream.avail_in != sourceLen) return Z_BUF_ERROR;
+
+ stream.next_out = dest;
+ stream.avail_out = (uInt)*destLen;
+ if ((uLong)stream.avail_out != *destLen) return Z_BUF_ERROR;
+
+ stream.zalloc = Z_NULL;
+ stream.zfree = Z_NULL;
+
+ err = inflateInit(&stream);
+ if (err != Z_OK) return err;
+
+ err = inflate(&stream, Z_FINISH);
+ if (err != Z_STREAM_END) {
+ inflateEnd(&stream);
+ if (err == Z_NEED_DICT || (err == Z_BUF_ERROR && stream.avail_in == 0))
+ return Z_DATA_ERROR;
+ return err;
+ }
+ *destLen = stream.total_out;
+
+ err = inflateEnd(&stream);
+ return err;
+}
--- /dev/null
+/* unzip.c -- IO for uncompress .zip files using zlib
+ Version 1.1, February 14h, 2010
+ part of the MiniZip project - ( http://www.winimage.com/zLibDll/minizip.html )
+
+ Copyright (C) 1998-2010 Gilles Vollant (minizip) ( http://www.winimage.com/zLibDll/minizip.html )
+
+ Modifications of Unzip for Zip64
+ Copyright (C) 2007-2008 Even Rouault
+
+ Modifications for Zip64 support on both zip and unzip
+ Copyright (C) 2009-2010 Mathias Svensson ( http://result42.com )
+
+ For more info read MiniZip_info.txt
+
+
+ ------------------------------------------------------------------------------------
+ Decryption code comes from crypt.c by Info-ZIP but has been greatly reduced in terms of
+ compatibility with older software. The following is from the original crypt.c.
+ Code woven in by Terry Thorsen 1/2003.
+
+ Copyright (c) 1990-2000 Info-ZIP. All rights reserved.
+
+ See the accompanying file LICENSE, version 2000-Apr-09 or later
+ (the contents of which are also included in zip.h) for terms of use.
+ If, for some reason, all these files are missing, the Info-ZIP license
+ also may be found at: ftp://ftp.info-zip.org/pub/infozip/license.html
+
+ crypt.c (full version) by Info-ZIP. Last revised: [see crypt.h]
+
+ The encryption/decryption parts of this source code (as opposed to the
+ non-echoing password parts) were originally written in Europe. The
+ whole source package can be freely distributed, including from the USA.
+ (Prior to January 2000, re-export from the US was a violation of US law.)
+
+ This encryption code is a direct transcription of the algorithm from
+ Roger Schlafly, described by Phil Katz in the file appnote.txt. This
+ file (appnote.txt) is distributed with the PKZIP program (even in the
+ version without encryption capabilities).
+
+ ------------------------------------------------------------------------------------
+
+ Changes in unzip.c
+
+ 2007-2008 - Even Rouault - Addition of cpl_unzGetCurrentFileZStreamPos
+ 2007-2008 - Even Rouault - Decoration of symbol names unz* -> cpl_unz*
+ 2007-2008 - Even Rouault - Remove old C style function prototypes
+ 2007-2008 - Even Rouault - Add unzip support for ZIP64
+
+ Copyright (C) 2007-2008 Even Rouault
+
+
+ Oct-2009 - Mathias Svensson - Removed cpl_* from symbol names (Even Rouault added them but since this is now moved to a new project (minizip64) I renamed them again).
+ Oct-2009 - Mathias Svensson - Fixed problem if uncompressed size was > 4G and compressed size was <4G
+ should only read the compressed/uncompressed size from the Zip64 format if
+ the size from normal header was 0xFFFFFFFF
+ Oct-2009 - Mathias Svensson - Applied some bug fixes from paches recived from Gilles Vollant
+ Oct-2009 - Mathias Svensson - Applied support to unzip files with compression mathod BZIP2 (bzip2 lib is required)
+ Patch created by Daniel Borca
+
+ Jan-2010 - back to unzip and minizip 1.0 name scheme, with compatibility layer
+
+ Copyright (C) 1998 - 2010 Gilles Vollant, Even Rouault, Mathias Svensson
+
+*/
+
+
+#include <stdio.h>
+#include <stdlib.h>
+#include <string.h>
+
+#ifndef NOUNCRYPT
+#define NOUNCRYPT
+#endif
+
+#include "zlib.h"
+#include "unzip.h"
+
+#ifdef STDC
+# include <stddef.h>
+# include <string.h>
+# include <stdlib.h>
+#endif
+#ifdef NO_ERRNO_H
+extern int errno;
+#else
+# include <errno.h>
+#endif
+
+
+#ifndef local
+# define local static
+#endif
+/* compile with -Dlocal if your debugger can't find static symbols */
+
+
+#ifndef CASESENSITIVITYDEFAULT_NO
+# if !defined(unix) && !defined(CASESENSITIVITYDEFAULT_YES)
+# define CASESENSITIVITYDEFAULT_NO
+# endif
+#endif
+
+
+#ifndef UNZ_BUFSIZE
+#define UNZ_BUFSIZE (16384)
+#endif
+
+#ifndef UNZ_MAXFILENAMEINZIP
+#define UNZ_MAXFILENAMEINZIP (256)
+#endif
+
+#ifndef ALLOC
+# define ALLOC(size) (malloc(size))
+#endif
+#ifndef TRYFREE
+# define TRYFREE(p) {if (p) free(p);}
+#endif
+
+#define SIZECENTRALDIRITEM (0x2e)
+#define SIZEZIPLOCALHEADER (0x1e)
+
+
+const char unz_copyright[] =
+" unzip 1.01 Copyright 1998-2004 Gilles Vollant - http://www.winimage.com/zLibDll";
+
+/* unz_file_info_interntal contain internal info about a file in zipfile*/
+typedef struct unz_file_info64_internal_s
+{
+ ZPOS64_T offset_curfile;/* relative offset of local header 8 bytes */
+} unz_file_info64_internal;
+
+
+/* file_in_zip_read_info_s contain internal information about a file in zipfile,
+ when reading and decompress it */
+typedef struct
+{
+ char *read_buffer; /* internal buffer for compressed data */
+ z_stream stream; /* zLib stream structure for inflate */
+
+#ifdef HAVE_BZIP2
+ bz_stream bstream; /* bzLib stream structure for bziped */
+#endif
+
+ ZPOS64_T pos_in_zipfile; /* position in byte on the zipfile, for fseek*/
+ uLong stream_initialised; /* flag set if stream structure is initialised*/
+
+ ZPOS64_T offset_local_extrafield;/* offset of the local extra field */
+ uInt size_local_extrafield;/* size of the local extra field */
+ ZPOS64_T pos_local_extrafield; /* position in the local extra field in read*/
+ ZPOS64_T total_out_64;
+
+ uLong crc32; /* crc32 of all data uncompressed */
+ uLong crc32_wait; /* crc32 we must obtain after decompress all */
+ ZPOS64_T rest_read_compressed; /* number of byte to be decompressed */
+ ZPOS64_T rest_read_uncompressed;/*number of byte to be obtained after decomp*/
+ zlib_filefunc64_32_def z_filefunc;
+ voidpf filestream; /* io structore of the zipfile */
+ uLong compression_method; /* compression method (0==store) */
+ ZPOS64_T byte_before_the_zipfile;/* byte before the zipfile, (>0 for sfx)*/
+ int raw;
+} file_in_zip64_read_info_s;
+
+
+/* unz64_s contain internal information about the zipfile
+*/
+typedef struct
+{
+ zlib_filefunc64_32_def z_filefunc;
+ int is64bitOpenFunction;
+ voidpf filestream; /* io structore of the zipfile */
+ unz_global_info64 gi; /* public global information */
+ ZPOS64_T byte_before_the_zipfile;/* byte before the zipfile, (>0 for sfx)*/
+ ZPOS64_T num_file; /* number of the current file in the zipfile*/
+ ZPOS64_T pos_in_central_dir; /* pos of the current file in the central dir*/
+ ZPOS64_T current_file_ok; /* flag about the usability of the current file*/
+ ZPOS64_T central_pos; /* position of the beginning of the central dir*/
+
+ ZPOS64_T size_central_dir; /* size of the central directory */
+ ZPOS64_T offset_central_dir; /* offset of start of central directory with
+ respect to the starting disk number */
+
+ unz_file_info64 cur_file_info; /* public info about the current file in zip*/
+ unz_file_info64_internal cur_file_info_internal; /* private info about it*/
+ file_in_zip64_read_info_s* pfile_in_zip_read; /* structure about the current
+ file if we are decompressing it */
+ int encrypted;
+
+ int isZip64;
+
+# ifndef NOUNCRYPT
+ unsigned long keys[3]; /* keys defining the pseudo-random sequence */
+ const unsigned long* pcrc_32_tab;
+# endif
+} unz64_s;
+
+
+#ifndef NOUNCRYPT
+#include "crypt.h"
+#endif
+
+/* ===========================================================================
+ Read a byte from a gz_stream; update next_in and avail_in. Return EOF
+ for end of file.
+ IN assertion: the stream s has been sucessfully opened for reading.
+ */
+
+
+local int unz64local_getByte OF((
+ const zlib_filefunc64_32_def* pzlib_filefunc_def,
+ voidpf filestream,
+ int *pi));
+
+local int unz64local_getByte(const zlib_filefunc64_32_def* pzlib_filefunc_def,
+ voidpf filestream, int *_pi)
+{
+ unsigned char c;
+ int err = (int)ZREAD64(*pzlib_filefunc_def,filestream,&c,1);
+ if (err==1)
+ {
+ *_pi = (int)c;
+ return UNZ_OK;
+ }
+ else
+ {
+ if (ZERROR64(*pzlib_filefunc_def,filestream))
+ return UNZ_ERRNO;
+ else
+ return UNZ_EOF;
+ }
+}
+
+
+/* ===========================================================================
+ Reads a long in LSB order from the given gz_stream. Sets
+ */
+local int unz64local_getShort OF((
+ const zlib_filefunc64_32_def* pzlib_filefunc_def,
+ voidpf filestream,
+ uLong *pX));
+
+local int unz64local_getShort (const zlib_filefunc64_32_def* pzlib_filefunc_def,
+ voidpf filestream,
+ uLong *pX)
+{
+ uLong x ;
+ int i = 0;
+ int err;
+
+ err = unz64local_getByte(pzlib_filefunc_def,filestream,&i);
+ x = (uLong)i;
+
+ if (err==UNZ_OK)
+ err = unz64local_getByte(pzlib_filefunc_def,filestream,&i);
+ x |= ((uLong)i)<<8;
+
+ if (err==UNZ_OK)
+ *pX = x;
+ else
+ *pX = 0;
+ return err;
+}
+
+local int unz64local_getLong OF((
+ const zlib_filefunc64_32_def* pzlib_filefunc_def,
+ voidpf filestream,
+ uLong *pX));
+
+local int unz64local_getLong (const zlib_filefunc64_32_def* pzlib_filefunc_def,
+ voidpf filestream,
+ uLong *pX)
+{
+ uLong x ;
+ int i = 0;
+ int err;
+
+ err = unz64local_getByte(pzlib_filefunc_def,filestream,&i);
+ x = (uLong)i;
+
+ if (err==UNZ_OK)
+ err = unz64local_getByte(pzlib_filefunc_def,filestream,&i);
+ x |= ((uLong)i)<<8;
+
+ if (err==UNZ_OK)
+ err = unz64local_getByte(pzlib_filefunc_def,filestream,&i);
+ x |= ((uLong)i)<<16;
+
+ if (err==UNZ_OK)
+ err = unz64local_getByte(pzlib_filefunc_def,filestream,&i);
+ x += ((uLong)i)<<24;
+
+ if (err==UNZ_OK)
+ *pX = x;
+ else
+ *pX = 0;
+ return err;
+}
+
+local int unz64local_getLong64 OF((
+ const zlib_filefunc64_32_def* pzlib_filefunc_def,
+ voidpf filestream,
+ ZPOS64_T *pX));
+
+
+local int unz64local_getLong64 (const zlib_filefunc64_32_def* pzlib_filefunc_def,
+ voidpf filestream,
+ ZPOS64_T *pX)
+{
+ ZPOS64_T x ;
+ int i = 0;
+ int err;
+
+ err = unz64local_getByte(pzlib_filefunc_def,filestream,&i);
+ x = (ZPOS64_T)i;
+
+ if (err==UNZ_OK)
+ err = unz64local_getByte(pzlib_filefunc_def,filestream,&i);
+ x |= ((ZPOS64_T)i)<<8;
+
+ if (err==UNZ_OK)
+ err = unz64local_getByte(pzlib_filefunc_def,filestream,&i);
+ x |= ((ZPOS64_T)i)<<16;
+
+ if (err==UNZ_OK)
+ err = unz64local_getByte(pzlib_filefunc_def,filestream,&i);
+ x |= ((ZPOS64_T)i)<<24;
+
+ if (err==UNZ_OK)
+ err = unz64local_getByte(pzlib_filefunc_def,filestream,&i);
+ x |= ((ZPOS64_T)i)<<32;
+
+ if (err==UNZ_OK)
+ err = unz64local_getByte(pzlib_filefunc_def,filestream,&i);
+ x |= ((ZPOS64_T)i)<<40;
+
+ if (err==UNZ_OK)
+ err = unz64local_getByte(pzlib_filefunc_def,filestream,&i);
+ x |= ((ZPOS64_T)i)<<48;
+
+ if (err==UNZ_OK)
+ err = unz64local_getByte(pzlib_filefunc_def,filestream,&i);
+ x |= ((ZPOS64_T)i)<<56;
+
+ if (err==UNZ_OK)
+ *pX = x;
+ else
+ *pX = 0;
+ return err;
+}
+
+/* My own strcmpi / strcasecmp */
+local int strcmpcasenosensitive_internal (const char* fileName1, const char* fileName2)
+{
+ for (;;)
+ {
+ char c1=*(fileName1++);
+ char c2=*(fileName2++);
+ if ((c1>='a') && (c1<='z'))
+ c1 -= 0x20;
+ if ((c2>='a') && (c2<='z'))
+ c2 -= 0x20;
+ if (c1=='\0')
+ return ((c2=='\0') ? 0 : -1);
+ if (c2=='\0')
+ return 1;
+ if (c1<c2)
+ return -1;
+ if (c1>c2)
+ return 1;
+ }
+}
+
+
+#ifdef CASESENSITIVITYDEFAULT_NO
+#define CASESENSITIVITYDEFAULTVALUE 2
+#else
+#define CASESENSITIVITYDEFAULTVALUE 1
+#endif
+
+#ifndef STRCMPCASENOSENTIVEFUNCTION
+#define STRCMPCASENOSENTIVEFUNCTION strcmpcasenosensitive_internal
+#endif
+
+/*
+ Compare two filename (fileName1,fileName2).
+ If iCaseSenisivity = 1, comparision is case sensitivity (like strcmp)
+ If iCaseSenisivity = 2, comparision is not case sensitivity (like strcmpi
+ or strcasecmp)
+ If iCaseSenisivity = 0, case sensitivity is defaut of your operating system
+ (like 1 on Unix, 2 on Windows)
+
+*/
+extern int ZEXPORT unzStringFileNameCompare (const char* fileName1,
+ const char* fileName2,
+ int iCaseSensitivity)
+
+{
+ if (iCaseSensitivity==0)
+ iCaseSensitivity=CASESENSITIVITYDEFAULTVALUE;
+
+ if (iCaseSensitivity==1)
+ return strcmp(fileName1,fileName2);
+
+ return STRCMPCASENOSENTIVEFUNCTION(fileName1,fileName2);
+}
+
+#ifndef BUFREADCOMMENT
+#define BUFREADCOMMENT (0x400)
+#endif
+
+/*
+ Locate the Central directory of a zipfile (at the end, just before
+ the global comment)
+ */
+local ZPOS64_T unz64local_SearchCentralDir OF((const zlib_filefunc64_32_def* pzlib_filefunc_def, voidpf filestream));
+local ZPOS64_T unz64local_SearchCentralDir(const zlib_filefunc64_32_def* pzlib_filefunc_def, voidpf filestream)
+{
+ unsigned char* buf;
+ ZPOS64_T uSizeFile;
+ ZPOS64_T uBackRead;
+ ZPOS64_T uMaxBack=0xffff; /* maximum size of global comment */
+ ZPOS64_T uPosFound=0;
+
+ if (ZSEEK64(*pzlib_filefunc_def,filestream,0,ZLIB_FILEFUNC_SEEK_END) != 0)
+ return 0;
+
+
+ uSizeFile = ZTELL64(*pzlib_filefunc_def,filestream);
+
+ if (uMaxBack>uSizeFile)
+ uMaxBack = uSizeFile;
+
+ buf = (unsigned char*)ALLOC(BUFREADCOMMENT+4);
+ if (buf==NULL)
+ return 0;
+
+ uBackRead = 4;
+ while (uBackRead<uMaxBack)
+ {
+ uLong uReadSize;
+ ZPOS64_T uReadPos ;
+ int i;
+ if (uBackRead+BUFREADCOMMENT>uMaxBack)
+ uBackRead = uMaxBack;
+ else
+ uBackRead+=BUFREADCOMMENT;
+ uReadPos = uSizeFile-uBackRead ;
+
+ uReadSize = ((BUFREADCOMMENT+4) < (uSizeFile-uReadPos)) ?
+ (BUFREADCOMMENT+4) : (uLong)(uSizeFile-uReadPos);
+ if (ZSEEK64(*pzlib_filefunc_def,filestream,uReadPos,ZLIB_FILEFUNC_SEEK_SET)!=0)
+ break;
+
+ if (ZREAD64(*pzlib_filefunc_def,filestream,buf,uReadSize)!=uReadSize)
+ break;
+
+ for (i=(int)uReadSize-3; (i--)>0;)
+ if (((*(buf+i))==0x50) && ((*(buf+i+1))==0x4b) &&
+ ((*(buf+i+2))==0x05) && ((*(buf+i+3))==0x06))
+ {
+ uPosFound = uReadPos+i;
+ break;
+ }
+
+ if (uPosFound!=0)
+ break;
+ }
+ TRYFREE(buf);
+ return uPosFound;
+}
+
+
+/*
+ Locate the Central directory 64 of a zipfile (at the end, just before
+ the global comment)
+ */
+local ZPOS64_T unz64local_SearchCentralDir64 OF((
+ const zlib_filefunc64_32_def* pzlib_filefunc_def,
+ voidpf filestream));
+
+local ZPOS64_T unz64local_SearchCentralDir64(const zlib_filefunc64_32_def* pzlib_filefunc_def,
+ voidpf filestream)
+{
+ unsigned char* buf;
+ ZPOS64_T uSizeFile;
+ ZPOS64_T uBackRead;
+ ZPOS64_T uMaxBack=0xffff; /* maximum size of global comment */
+ ZPOS64_T uPosFound=0;
+ uLong uL;
+ ZPOS64_T relativeOffset;
+
+ if (ZSEEK64(*pzlib_filefunc_def,filestream,0,ZLIB_FILEFUNC_SEEK_END) != 0)
+ return 0;
+
+
+ uSizeFile = ZTELL64(*pzlib_filefunc_def,filestream);
+
+ if (uMaxBack>uSizeFile)
+ uMaxBack = uSizeFile;
+
+ buf = (unsigned char*)ALLOC(BUFREADCOMMENT+4);
+ if (buf==NULL)
+ return 0;
+
+ uBackRead = 4;
+ while (uBackRead<uMaxBack)
+ {
+ uLong uReadSize;
+ ZPOS64_T uReadPos;
+ int i;
+ if (uBackRead+BUFREADCOMMENT>uMaxBack)
+ uBackRead = uMaxBack;
+ else
+ uBackRead+=BUFREADCOMMENT;
+ uReadPos = uSizeFile-uBackRead ;
+
+ uReadSize = ((BUFREADCOMMENT+4) < (uSizeFile-uReadPos)) ?
+ (BUFREADCOMMENT+4) : (uLong)(uSizeFile-uReadPos);
+ if (ZSEEK64(*pzlib_filefunc_def,filestream,uReadPos,ZLIB_FILEFUNC_SEEK_SET)!=0)
+ break;
+
+ if (ZREAD64(*pzlib_filefunc_def,filestream,buf,uReadSize)!=uReadSize)
+ break;
+
+ for (i=(int)uReadSize-3; (i--)>0;)
+ if (((*(buf+i))==0x50) && ((*(buf+i+1))==0x4b) &&
+ ((*(buf+i+2))==0x06) && ((*(buf+i+3))==0x07))
+ {
+ uPosFound = uReadPos+i;
+ break;
+ }
+
+ if (uPosFound!=0)
+ break;
+ }
+ TRYFREE(buf);
+ if (uPosFound == 0)
+ return 0;
+
+ /* Zip64 end of central directory locator */
+ if (ZSEEK64(*pzlib_filefunc_def,filestream, uPosFound,ZLIB_FILEFUNC_SEEK_SET)!=0)
+ return 0;
+
+ /* the signature, already checked */
+ if (unz64local_getLong(pzlib_filefunc_def,filestream,&uL)!=UNZ_OK)
+ return 0;
+
+ /* number of the disk with the start of the zip64 end of central directory */
+ if (unz64local_getLong(pzlib_filefunc_def,filestream,&uL)!=UNZ_OK)
+ return 0;
+ if (uL != 0)
+ return 0;
+
+ /* relative offset of the zip64 end of central directory record */
+ if (unz64local_getLong64(pzlib_filefunc_def,filestream,&relativeOffset)!=UNZ_OK)
+ return 0;
+
+ /* total number of disks */
+ if (unz64local_getLong(pzlib_filefunc_def,filestream,&uL)!=UNZ_OK)
+ return 0;
+ if (uL != 1)
+ return 0;
+
+ /* Goto end of central directory record */
+ if (ZSEEK64(*pzlib_filefunc_def,filestream, relativeOffset,ZLIB_FILEFUNC_SEEK_SET)!=0)
+ return 0;
+
+ /* the signature */
+ if (unz64local_getLong(pzlib_filefunc_def,filestream,&uL)!=UNZ_OK)
+ return 0;
+
+ if (uL != 0x06064b50)
+ return 0;
+
+ return relativeOffset;
+}
+
+/*
+ Open a Zip file. path contain the full pathname (by example,
+ on a Windows NT computer "c:\\test\\zlib114.zip" or on an Unix computer
+ "zlib/zlib114.zip".
+ If the zipfile cannot be opened (file doesn't exist or in not valid), the
+ return value is NULL.
+ Else, the return value is a unzFile Handle, usable with other function
+ of this unzip package.
+ */
+local unzFile unzOpenInternal (const void *path,
+ zlib_filefunc64_32_def* pzlib_filefunc64_32_def,
+ int is64bitOpenFunction)
+{
+ unz64_s us;
+ unz64_s *s;
+ ZPOS64_T central_pos;
+ uLong uL;
+
+ uLong number_disk; /* number of the current dist, used for
+ spaning ZIP, unsupported, always 0*/
+ uLong number_disk_with_CD; /* number the the disk with central dir, used
+ for spaning ZIP, unsupported, always 0*/
+ ZPOS64_T number_entry_CD; /* total number of entries in
+ the central dir
+ (same than number_entry on nospan) */
+
+ int err=UNZ_OK;
+
+ if (unz_copyright[0]!=' ')
+ return NULL;
+
+ us.z_filefunc.zseek32_file = NULL;
+ us.z_filefunc.ztell32_file = NULL;
+ if (pzlib_filefunc64_32_def==NULL)
+ fill_fopen64_filefunc(&us.z_filefunc.zfile_func64);
+ else
+ us.z_filefunc = *pzlib_filefunc64_32_def;
+ us.is64bitOpenFunction = is64bitOpenFunction;
+
+
+
+ us.filestream = ZOPEN64(us.z_filefunc,
+ path,
+ ZLIB_FILEFUNC_MODE_READ |
+ ZLIB_FILEFUNC_MODE_EXISTING);
+ if (us.filestream==NULL)
+ return NULL;
+
+ central_pos = unz64local_SearchCentralDir64(&us.z_filefunc,us.filestream);
+ if (central_pos)
+ {
+ uLong uS;
+ ZPOS64_T uL64;
+
+ us.isZip64 = 1;
+
+ if (ZSEEK64(us.z_filefunc, us.filestream,
+ central_pos,ZLIB_FILEFUNC_SEEK_SET)!=0)
+ err=UNZ_ERRNO;
+
+ /* the signature, already checked */
+ if (unz64local_getLong(&us.z_filefunc, us.filestream,&uL)!=UNZ_OK)
+ err=UNZ_ERRNO;
+
+ /* size of zip64 end of central directory record */
+ if (unz64local_getLong64(&us.z_filefunc, us.filestream,&uL64)!=UNZ_OK)
+ err=UNZ_ERRNO;
+
+ /* version made by */
+ if (unz64local_getShort(&us.z_filefunc, us.filestream,&uS)!=UNZ_OK)
+ err=UNZ_ERRNO;
+
+ /* version needed to extract */
+ if (unz64local_getShort(&us.z_filefunc, us.filestream,&uS)!=UNZ_OK)
+ err=UNZ_ERRNO;
+
+ /* number of this disk */
+ if (unz64local_getLong(&us.z_filefunc, us.filestream,&number_disk)!=UNZ_OK)
+ err=UNZ_ERRNO;
+
+ /* number of the disk with the start of the central directory */
+ if (unz64local_getLong(&us.z_filefunc, us.filestream,&number_disk_with_CD)!=UNZ_OK)
+ err=UNZ_ERRNO;
+
+ /* total number of entries in the central directory on this disk */
+ if (unz64local_getLong64(&us.z_filefunc, us.filestream,&us.gi.number_entry)!=UNZ_OK)
+ err=UNZ_ERRNO;
+
+ /* total number of entries in the central directory */
+ if (unz64local_getLong64(&us.z_filefunc, us.filestream,&number_entry_CD)!=UNZ_OK)
+ err=UNZ_ERRNO;
+
+ if ((number_entry_CD!=us.gi.number_entry) ||
+ (number_disk_with_CD!=0) ||
+ (number_disk!=0))
+ err=UNZ_BADZIPFILE;
+
+ /* size of the central directory */
+ if (unz64local_getLong64(&us.z_filefunc, us.filestream,&us.size_central_dir)!=UNZ_OK)
+ err=UNZ_ERRNO;
+
+ /* offset of start of central directory with respect to the
+ starting disk number */
+ if (unz64local_getLong64(&us.z_filefunc, us.filestream,&us.offset_central_dir)!=UNZ_OK)
+ err=UNZ_ERRNO;
+
+ us.gi.size_comment = 0;
+ }
+ else
+ {
+ central_pos = unz64local_SearchCentralDir(&us.z_filefunc,us.filestream);
+ if (central_pos==0)
+ err=UNZ_ERRNO;
+
+ us.isZip64 = 0;
+
+ if (ZSEEK64(us.z_filefunc, us.filestream,
+ central_pos,ZLIB_FILEFUNC_SEEK_SET)!=0)
+ err=UNZ_ERRNO;
+
+ /* the signature, already checked */
+ if (unz64local_getLong(&us.z_filefunc, us.filestream,&uL)!=UNZ_OK)
+ err=UNZ_ERRNO;
+
+ /* number of this disk */
+ if (unz64local_getShort(&us.z_filefunc, us.filestream,&number_disk)!=UNZ_OK)
+ err=UNZ_ERRNO;
+
+ /* number of the disk with the start of the central directory */
+ if (unz64local_getShort(&us.z_filefunc, us.filestream,&number_disk_with_CD)!=UNZ_OK)
+ err=UNZ_ERRNO;
+
+ /* total number of entries in the central dir on this disk */
+ if (unz64local_getShort(&us.z_filefunc, us.filestream,&uL)!=UNZ_OK)
+ err=UNZ_ERRNO;
+ us.gi.number_entry = uL;
+
+ /* total number of entries in the central dir */
+ if (unz64local_getShort(&us.z_filefunc, us.filestream,&uL)!=UNZ_OK)
+ err=UNZ_ERRNO;
+ number_entry_CD = uL;
+
+ if ((number_entry_CD!=us.gi.number_entry) ||
+ (number_disk_with_CD!=0) ||
+ (number_disk!=0))
+ err=UNZ_BADZIPFILE;
+
+ /* size of the central directory */
+ if (unz64local_getLong(&us.z_filefunc, us.filestream,&uL)!=UNZ_OK)
+ err=UNZ_ERRNO;
+ us.size_central_dir = uL;
+
+ /* offset of start of central directory with respect to the
+ starting disk number */
+ if (unz64local_getLong(&us.z_filefunc, us.filestream,&uL)!=UNZ_OK)
+ err=UNZ_ERRNO;
+ us.offset_central_dir = uL;
+
+ /* zipfile comment length */
+ if (unz64local_getShort(&us.z_filefunc, us.filestream,&us.gi.size_comment)!=UNZ_OK)
+ err=UNZ_ERRNO;
+ }
+
+ if ((central_pos<us.offset_central_dir+us.size_central_dir) &&
+ (err==UNZ_OK))
+ err=UNZ_BADZIPFILE;
+
+ if (err!=UNZ_OK)
+ {
+ ZCLOSE64(us.z_filefunc, us.filestream);
+ return NULL;
+ }
+
+ us.byte_before_the_zipfile = central_pos -
+ (us.offset_central_dir+us.size_central_dir);
+ us.central_pos = central_pos;
+ us.pfile_in_zip_read = NULL;
+ us.encrypted = 0;
+
+
+ s=(unz64_s*)ALLOC(sizeof(unz64_s));
+ if( s != NULL)
+ {
+ *s=us;
+ unzGoToFirstFile((unzFile)s);
+ }
+ return (unzFile)s;
+}
+
+
+extern unzFile ZEXPORT unzOpen2 (const char *path,
+ zlib_filefunc_def* pzlib_filefunc32_def)
+{
+ if (pzlib_filefunc32_def != NULL)
+ {
+ zlib_filefunc64_32_def zlib_filefunc64_32_def_fill;
+ fill_zlib_filefunc64_32_def_from_filefunc32(&zlib_filefunc64_32_def_fill,pzlib_filefunc32_def);
+ return unzOpenInternal(path, &zlib_filefunc64_32_def_fill, 0);
+ }
+ else
+ return unzOpenInternal(path, NULL, 0);
+}
+
+extern unzFile ZEXPORT unzOpen2_64 (const void *path,
+ zlib_filefunc64_def* pzlib_filefunc_def)
+{
+ if (pzlib_filefunc_def != NULL)
+ {
+ zlib_filefunc64_32_def zlib_filefunc64_32_def_fill;
+ zlib_filefunc64_32_def_fill.zfile_func64 = *pzlib_filefunc_def;
+ zlib_filefunc64_32_def_fill.ztell32_file = NULL;
+ zlib_filefunc64_32_def_fill.zseek32_file = NULL;
+ return unzOpenInternal(path, &zlib_filefunc64_32_def_fill, 1);
+ }
+ else
+ return unzOpenInternal(path, NULL, 1);
+}
+
+extern unzFile ZEXPORT unzOpen (const char *path)
+{
+ return unzOpenInternal(path, NULL, 0);
+}
+
+extern unzFile ZEXPORT unzOpen64 (const void *path)
+{
+ return unzOpenInternal(path, NULL, 1);
+}
+
+/*
+ Close a ZipFile opened with unzipOpen.
+ If there is files inside the .Zip opened with unzipOpenCurrentFile (see later),
+ these files MUST be closed with unzipCloseCurrentFile before call unzipClose.
+ return UNZ_OK if there is no problem. */
+extern int ZEXPORT unzClose (unzFile file)
+{
+ unz64_s* s;
+ if (file==NULL)
+ return UNZ_PARAMERROR;
+ s=(unz64_s*)file;
+
+ if (s->pfile_in_zip_read!=NULL)
+ unzCloseCurrentFile(file);
+
+ ZCLOSE64(s->z_filefunc, s->filestream);
+ TRYFREE(s);
+ return UNZ_OK;
+}
+
+
+/*
+ Write info about the ZipFile in the *pglobal_info structure.
+ No preparation of the structure is needed
+ return UNZ_OK if there is no problem. */
+extern int ZEXPORT unzGetGlobalInfo64 (unzFile file, unz_global_info64* pglobal_info)
+{
+ unz64_s* s;
+ if (file==NULL)
+ return UNZ_PARAMERROR;
+ s=(unz64_s*)file;
+ *pglobal_info=s->gi;
+ return UNZ_OK;
+}
+
+extern int ZEXPORT unzGetGlobalInfo (unzFile file, unz_global_info* pglobal_info32)
+{
+ unz64_s* s;
+ if (file==NULL)
+ return UNZ_PARAMERROR;
+ s=(unz64_s*)file;
+ /* to do : check if number_entry is not truncated */
+ pglobal_info32->number_entry = (uLong)s->gi.number_entry;
+ pglobal_info32->size_comment = s->gi.size_comment;
+ return UNZ_OK;
+}
+/*
+ Translate date/time from Dos format to tm_unz (readable more easilty)
+ */
+local void unz64local_DosDateToTmuDate (ZPOS64_T ulDosDate, tm_unz* ptm)
+{
+ ZPOS64_T uDate;
+ uDate = (ZPOS64_T)(ulDosDate>>16);
+ ptm->tm_mday = (uInt)(uDate&0x1f) ;
+ ptm->tm_mon = (uInt)((((uDate)&0x1E0)/0x20)-1) ;
+ ptm->tm_year = (uInt)(((uDate&0x0FE00)/0x0200)+1980) ;
+
+ ptm->tm_hour = (uInt) ((ulDosDate &0xF800)/0x800);
+ ptm->tm_min = (uInt) ((ulDosDate&0x7E0)/0x20) ;
+ ptm->tm_sec = (uInt) (2*(ulDosDate&0x1f)) ;
+}
+
+/*
+ Get Info about the current file in the zipfile, with internal only info
+ */
+local int unz64local_GetCurrentFileInfoInternal OF((unzFile file,
+ unz_file_info64 *pfile_info,
+ unz_file_info64_internal
+ *pfile_info_internal,
+ char *szFileName,
+ uLong fileNameBufferSize,
+ void *extraField,
+ uLong extraFieldBufferSize,
+ char *szComment,
+ uLong commentBufferSize));
+
+local int unz64local_GetCurrentFileInfoInternal (unzFile file,
+ unz_file_info64 *pfile_info,
+ unz_file_info64_internal
+ *pfile_info_internal,
+ char *szFileName,
+ uLong fileNameBufferSize,
+ void *extraField,
+ uLong extraFieldBufferSize,
+ char *szComment,
+ uLong commentBufferSize)
+{
+ unz64_s* s;
+ unz_file_info64 file_info;
+ unz_file_info64_internal file_info_internal;
+ int err=UNZ_OK;
+ uLong uMagic;
+ long lSeek=0;
+ uLong uL;
+
+ if (file==NULL)
+ return UNZ_PARAMERROR;
+ s=(unz64_s*)file;
+ if (ZSEEK64(s->z_filefunc, s->filestream,
+ s->pos_in_central_dir+s->byte_before_the_zipfile,
+ ZLIB_FILEFUNC_SEEK_SET)!=0)
+ err=UNZ_ERRNO;
+
+
+ /* we check the magic */
+ if (err==UNZ_OK)
+ {
+ if (unz64local_getLong(&s->z_filefunc, s->filestream,&uMagic) != UNZ_OK)
+ err=UNZ_ERRNO;
+ else if (uMagic!=0x02014b50)
+ err=UNZ_BADZIPFILE;
+ }
+
+ if (unz64local_getShort(&s->z_filefunc, s->filestream,&file_info.version) != UNZ_OK)
+ err=UNZ_ERRNO;
+
+ if (unz64local_getShort(&s->z_filefunc, s->filestream,&file_info.version_needed) != UNZ_OK)
+ err=UNZ_ERRNO;
+
+ if (unz64local_getShort(&s->z_filefunc, s->filestream,&file_info.flag) != UNZ_OK)
+ err=UNZ_ERRNO;
+
+ if (unz64local_getShort(&s->z_filefunc, s->filestream,&file_info.compression_method) != UNZ_OK)
+ err=UNZ_ERRNO;
+
+ if (unz64local_getLong(&s->z_filefunc, s->filestream,&file_info.dosDate) != UNZ_OK)
+ err=UNZ_ERRNO;
+
+ unz64local_DosDateToTmuDate(file_info.dosDate,&file_info.tmu_date);
+
+ if (unz64local_getLong(&s->z_filefunc, s->filestream,&file_info.crc) != UNZ_OK)
+ err=UNZ_ERRNO;
+
+ if (unz64local_getLong(&s->z_filefunc, s->filestream,&uL) != UNZ_OK)
+ err=UNZ_ERRNO;
+ file_info.compressed_size = uL;
+
+ if (unz64local_getLong(&s->z_filefunc, s->filestream,&uL) != UNZ_OK)
+ err=UNZ_ERRNO;
+ file_info.uncompressed_size = uL;
+
+ if (unz64local_getShort(&s->z_filefunc, s->filestream,&file_info.size_filename) != UNZ_OK)
+ err=UNZ_ERRNO;
+
+ if (unz64local_getShort(&s->z_filefunc, s->filestream,&file_info.size_file_extra) != UNZ_OK)
+ err=UNZ_ERRNO;
+
+ if (unz64local_getShort(&s->z_filefunc, s->filestream,&file_info.size_file_comment) != UNZ_OK)
+ err=UNZ_ERRNO;
+
+ if (unz64local_getShort(&s->z_filefunc, s->filestream,&file_info.disk_num_start) != UNZ_OK)
+ err=UNZ_ERRNO;
+
+ if (unz64local_getShort(&s->z_filefunc, s->filestream,&file_info.internal_fa) != UNZ_OK)
+ err=UNZ_ERRNO;
+
+ if (unz64local_getLong(&s->z_filefunc, s->filestream,&file_info.external_fa) != UNZ_OK)
+ err=UNZ_ERRNO;
+
+ // relative offset of local header
+ if (unz64local_getLong(&s->z_filefunc, s->filestream,&uL) != UNZ_OK)
+ err=UNZ_ERRNO;
+ file_info_internal.offset_curfile = uL;
+
+ lSeek+=file_info.size_filename;
+ if ((err==UNZ_OK) && (szFileName!=NULL))
+ {
+ uLong uSizeRead ;
+ if (file_info.size_filename<fileNameBufferSize)
+ {
+ *(szFileName+file_info.size_filename)='\0';
+ uSizeRead = file_info.size_filename;
+ }
+ else
+ uSizeRead = fileNameBufferSize;
+
+ if ((file_info.size_filename>0) && (fileNameBufferSize>0))
+ if (ZREAD64(s->z_filefunc, s->filestream,szFileName,uSizeRead)!=uSizeRead)
+ err=UNZ_ERRNO;
+ lSeek -= uSizeRead;
+ }
+
+ // Read extrafield
+ if ((err==UNZ_OK) && (extraField!=NULL))
+ {
+ ZPOS64_T uSizeRead ;
+ if (file_info.size_file_extra<extraFieldBufferSize)
+ uSizeRead = file_info.size_file_extra;
+ else
+ uSizeRead = extraFieldBufferSize;
+
+ if (lSeek!=0)
+ {
+ if (ZSEEK64(s->z_filefunc, s->filestream,lSeek,ZLIB_FILEFUNC_SEEK_CUR)==0)
+ lSeek=0;
+ else
+ err=UNZ_ERRNO;
+ }
+
+ if ((file_info.size_file_extra>0) && (extraFieldBufferSize>0))
+ if (ZREAD64(s->z_filefunc, s->filestream,extraField,(uLong)uSizeRead)!=uSizeRead)
+ err=UNZ_ERRNO;
+
+ lSeek += file_info.size_file_extra - (uLong)uSizeRead;
+ }
+ else
+ lSeek += file_info.size_file_extra;
+
+
+ if ((err==UNZ_OK) && (file_info.size_file_extra != 0))
+ {
+ uLong acc = 0;
+
+ // since lSeek now points to after the extra field we need to move back
+ lSeek -= file_info.size_file_extra;
+
+ if (lSeek!=0)
+ {
+ if (ZSEEK64(s->z_filefunc, s->filestream,lSeek,ZLIB_FILEFUNC_SEEK_CUR)==0)
+ lSeek=0;
+ else
+ err=UNZ_ERRNO;
+ }
+
+ while(acc < file_info.size_file_extra)
+ {
+ uLong headerId;
+ uLong dataSize;
+
+ if (unz64local_getShort(&s->z_filefunc, s->filestream,&headerId) != UNZ_OK)
+ err=UNZ_ERRNO;
+
+ if (unz64local_getShort(&s->z_filefunc, s->filestream,&dataSize) != UNZ_OK)
+ err=UNZ_ERRNO;
+
+ /* ZIP64 extra fields */
+ if (headerId == 0x0001)
+ {
+ uLong tmp;
+
+ if(file_info.uncompressed_size == (ZPOS64_T)(unsigned long)-1)
+ {
+ if (unz64local_getLong64(&s->z_filefunc, s->filestream,&file_info.uncompressed_size) != UNZ_OK)
+ err=UNZ_ERRNO;
+ }
+
+ if(file_info.compressed_size == (ZPOS64_T)(unsigned long)-1)
+ {
+ if (unz64local_getLong64(&s->z_filefunc, s->filestream,&file_info.compressed_size) != UNZ_OK)
+ err=UNZ_ERRNO;
+ }
+
+ if(file_info_internal.offset_curfile == (ZPOS64_T)(unsigned long)-1)
+ {
+ /* Relative Header offset */
+ if (unz64local_getLong64(&s->z_filefunc, s->filestream,&file_info_internal.offset_curfile) != UNZ_OK)
+ err=UNZ_ERRNO;
+ }
+
+ if(file_info.disk_num_start == (unsigned long)-1)
+ {
+ /* Disk Start Number */
+ if (unz64local_getLong(&s->z_filefunc, s->filestream,&tmp) != UNZ_OK)
+ err=UNZ_ERRNO;
+ }
+
+ }
+ else
+ {
+ if (ZSEEK64(s->z_filefunc, s->filestream,dataSize,ZLIB_FILEFUNC_SEEK_CUR)!=0)
+ err=UNZ_ERRNO;
+ }
+
+ acc += 2 + 2 + dataSize;
+ }
+ }
+
+ if ((err==UNZ_OK) && (szComment!=NULL))
+ {
+ uLong uSizeRead ;
+ if (file_info.size_file_comment<commentBufferSize)
+ {
+ *(szComment+file_info.size_file_comment)='\0';
+ uSizeRead = file_info.size_file_comment;
+ }
+ else
+ uSizeRead = commentBufferSize;
+
+ if (lSeek!=0)
+ {
+ if (ZSEEK64(s->z_filefunc, s->filestream,lSeek,ZLIB_FILEFUNC_SEEK_CUR)==0)
+ lSeek=0;
+ else
+ err=UNZ_ERRNO;
+ }
+
+ if ((file_info.size_file_comment>0) && (commentBufferSize>0))
+ if (ZREAD64(s->z_filefunc, s->filestream,szComment,uSizeRead)!=uSizeRead)
+ err=UNZ_ERRNO;
+ lSeek+=file_info.size_file_comment - uSizeRead;
+ }
+ else
+ lSeek+=file_info.size_file_comment;
+
+
+ if ((err==UNZ_OK) && (pfile_info!=NULL))
+ *pfile_info=file_info;
+
+ if ((err==UNZ_OK) && (pfile_info_internal!=NULL))
+ *pfile_info_internal=file_info_internal;
+
+ return err;
+}
+
+
+
+/*
+ Write info about the ZipFile in the *pglobal_info structure.
+ No preparation of the structure is needed
+ return UNZ_OK if there is no problem.
+ */
+extern int ZEXPORT unzGetCurrentFileInfo64 (unzFile file,
+ unz_file_info64 * pfile_info,
+ char * szFileName, uLong fileNameBufferSize,
+ void *extraField, uLong extraFieldBufferSize,
+ char* szComment, uLong commentBufferSize)
+{
+ return unz64local_GetCurrentFileInfoInternal(file,pfile_info,NULL,
+ szFileName,fileNameBufferSize,
+ extraField,extraFieldBufferSize,
+ szComment,commentBufferSize);
+}
+
+extern int ZEXPORT unzGetCurrentFileInfo (unzFile file,
+ unz_file_info * pfile_info,
+ char * szFileName, uLong fileNameBufferSize,
+ void *extraField, uLong extraFieldBufferSize,
+ char* szComment, uLong commentBufferSize)
+{
+ int err;
+ unz_file_info64 file_info64;
+ err = unz64local_GetCurrentFileInfoInternal(file,&file_info64,NULL,
+ szFileName,fileNameBufferSize,
+ extraField,extraFieldBufferSize,
+ szComment,commentBufferSize);
+ if (err==UNZ_OK)
+ {
+ pfile_info->version = file_info64.version;
+ pfile_info->version_needed = file_info64.version_needed;
+ pfile_info->flag = file_info64.flag;
+ pfile_info->compression_method = file_info64.compression_method;
+ pfile_info->dosDate = file_info64.dosDate;
+ pfile_info->crc = file_info64.crc;
+
+ pfile_info->size_filename = file_info64.size_filename;
+ pfile_info->size_file_extra = file_info64.size_file_extra;
+ pfile_info->size_file_comment = file_info64.size_file_comment;
+
+ pfile_info->disk_num_start = file_info64.disk_num_start;
+ pfile_info->internal_fa = file_info64.internal_fa;
+ pfile_info->external_fa = file_info64.external_fa;
+
+ pfile_info->tmu_date = file_info64.tmu_date,
+
+
+ pfile_info->compressed_size = (uLong)file_info64.compressed_size;
+ pfile_info->uncompressed_size = (uLong)file_info64.uncompressed_size;
+
+ }
+ return err;
+}
+/*
+ Set the current file of the zipfile to the first file.
+ return UNZ_OK if there is no problem
+ */
+extern int ZEXPORT unzGoToFirstFile (unzFile file)
+{
+ int err=UNZ_OK;
+ unz64_s* s;
+ if (file==NULL)
+ return UNZ_PARAMERROR;
+ s=(unz64_s*)file;
+ s->pos_in_central_dir=s->offset_central_dir;
+ s->num_file=0;
+ err=unz64local_GetCurrentFileInfoInternal(file,&s->cur_file_info,
+ &s->cur_file_info_internal,
+ NULL,0,NULL,0,NULL,0);
+ s->current_file_ok = (err == UNZ_OK);
+ return err;
+}
+
+/*
+ Set the current file of the zipfile to the next file.
+ return UNZ_OK if there is no problem
+ return UNZ_END_OF_LIST_OF_FILE if the actual file was the latest.
+ */
+extern int ZEXPORT unzGoToNextFile (unzFile file)
+{
+ unz64_s* s;
+ int err;
+
+ if (file==NULL)
+ return UNZ_PARAMERROR;
+ s=(unz64_s*)file;
+ if (!s->current_file_ok)
+ return UNZ_END_OF_LIST_OF_FILE;
+ if (s->gi.number_entry != 0xffff) /* 2^16 files overflow hack */
+ if (s->num_file+1==s->gi.number_entry)
+ return UNZ_END_OF_LIST_OF_FILE;
+
+ s->pos_in_central_dir += SIZECENTRALDIRITEM + s->cur_file_info.size_filename +
+ s->cur_file_info.size_file_extra + s->cur_file_info.size_file_comment ;
+ s->num_file++;
+ err = unz64local_GetCurrentFileInfoInternal(file,&s->cur_file_info,
+ &s->cur_file_info_internal,
+ NULL,0,NULL,0,NULL,0);
+ s->current_file_ok = (err == UNZ_OK);
+ return err;
+}
+
+
+/*
+ Try locate the file szFileName in the zipfile.
+ For the iCaseSensitivity signification, see unzipStringFileNameCompare
+
+ return value :
+ UNZ_OK if the file is found. It becomes the current file.
+ UNZ_END_OF_LIST_OF_FILE if the file is not found
+ */
+extern int ZEXPORT unzLocateFile (unzFile file, const char *szFileName, int iCaseSensitivity)
+{
+ unz64_s* s;
+ int err;
+
+ /* We remember the 'current' position in the file so that we can jump
+ * back there if we fail.
+ */
+ unz_file_info64 cur_file_infoSaved;
+ unz_file_info64_internal cur_file_info_internalSaved;
+ ZPOS64_T num_fileSaved;
+ ZPOS64_T pos_in_central_dirSaved;
+
+
+ if (file==NULL)
+ return UNZ_PARAMERROR;
+
+ if (strlen(szFileName)>=UNZ_MAXFILENAMEINZIP)
+ return UNZ_PARAMERROR;
+
+ s=(unz64_s*)file;
+ if (!s->current_file_ok)
+ return UNZ_END_OF_LIST_OF_FILE;
+
+ /* Save the current state */
+ num_fileSaved = s->num_file;
+ pos_in_central_dirSaved = s->pos_in_central_dir;
+ cur_file_infoSaved = s->cur_file_info;
+ cur_file_info_internalSaved = s->cur_file_info_internal;
+
+ err = unzGoToFirstFile(file);
+
+ while (err == UNZ_OK)
+ {
+ char szCurrentFileName[UNZ_MAXFILENAMEINZIP+1];
+ err = unzGetCurrentFileInfo64(file,NULL,
+ szCurrentFileName,sizeof(szCurrentFileName)-1,
+ NULL,0,NULL,0);
+ if (err == UNZ_OK)
+ {
+ if (unzStringFileNameCompare(szCurrentFileName,
+ szFileName,iCaseSensitivity)==0)
+ return UNZ_OK;
+ err = unzGoToNextFile(file);
+ }
+ }
+
+ /* We failed, so restore the state of the 'current file' to where we
+ * were.
+ */
+ s->num_file = num_fileSaved ;
+ s->pos_in_central_dir = pos_in_central_dirSaved ;
+ s->cur_file_info = cur_file_infoSaved;
+ s->cur_file_info_internal = cur_file_info_internalSaved;
+ return err;
+}
+
+
+/*
+///////////////////////////////////////////
+// Contributed by Ryan Haksi (mailto://cryogen@infoserve.net)
+// I need random access
+//
+// Further optimization could be realized by adding an ability
+// to cache the directory in memory. The goal being a single
+// comprehensive file read to put the file I need in a memory.
+*/
+
+/*
+ typedef struct unz_file_pos_s
+ {
+ ZPOS64_T pos_in_zip_directory; // offset in file
+ ZPOS64_T num_of_file; // # of file
+ } unz_file_pos;
+ */
+
+extern int ZEXPORT unzGetFilePos64(unzFile file, unz64_file_pos* file_pos)
+{
+ unz64_s* s;
+
+ if (file==NULL || file_pos==NULL)
+ return UNZ_PARAMERROR;
+ s=(unz64_s*)file;
+ if (!s->current_file_ok)
+ return UNZ_END_OF_LIST_OF_FILE;
+
+ file_pos->pos_in_zip_directory = s->pos_in_central_dir;
+ file_pos->num_of_file = s->num_file;
+
+ return UNZ_OK;
+}
+
+extern int ZEXPORT unzGetFilePos(
+ unzFile file,
+ unz_file_pos* file_pos)
+{
+ unz64_file_pos file_pos64;
+ int err = unzGetFilePos64(file,&file_pos64);
+ if (err==UNZ_OK)
+ {
+ file_pos->pos_in_zip_directory = (uLong)file_pos64.pos_in_zip_directory;
+ file_pos->num_of_file = (uLong)file_pos64.num_of_file;
+ }
+ return err;
+}
+
+extern int ZEXPORT unzGoToFilePos64(unzFile file, const unz64_file_pos* file_pos)
+{
+ unz64_s* s;
+ int err;
+
+ if (file==NULL || file_pos==NULL)
+ return UNZ_PARAMERROR;
+ s=(unz64_s*)file;
+
+ /* jump to the right spot */
+ s->pos_in_central_dir = file_pos->pos_in_zip_directory;
+ s->num_file = file_pos->num_of_file;
+
+ /* set the current file */
+ err = unz64local_GetCurrentFileInfoInternal(file,&s->cur_file_info,
+ &s->cur_file_info_internal,
+ NULL,0,NULL,0,NULL,0);
+ /* return results */
+ s->current_file_ok = (err == UNZ_OK);
+ return err;
+}
+
+extern int ZEXPORT unzGoToFilePos(
+ unzFile file,
+ unz_file_pos* file_pos)
+{
+ unz64_file_pos file_pos64;
+ if (file_pos == NULL)
+ return UNZ_PARAMERROR;
+
+ file_pos64.pos_in_zip_directory = file_pos->pos_in_zip_directory;
+ file_pos64.num_of_file = file_pos->num_of_file;
+ return unzGoToFilePos64(file,&file_pos64);
+}
+
+/*
+// Unzip Helper Functions - should be here?
+///////////////////////////////////////////
+*/
+
+/*
+ Read the local header of the current zipfile
+ Check the coherency of the local header and info in the end of central
+ directory about this file
+ store in *piSizeVar the size of extra info in local header
+ (filename and size of extra field data)
+ */
+local int unz64local_CheckCurrentFileCoherencyHeader (unz64_s* s, uInt* piSizeVar,
+ ZPOS64_T * poffset_local_extrafield,
+ uInt * psize_local_extrafield)
+{
+ uLong uMagic,uData,uFlags;
+ uLong size_filename;
+ uLong size_extra_field;
+ int err=UNZ_OK;
+
+ *piSizeVar = 0;
+ *poffset_local_extrafield = 0;
+ *psize_local_extrafield = 0;
+
+ if (ZSEEK64(s->z_filefunc, s->filestream,s->cur_file_info_internal.offset_curfile +
+ s->byte_before_the_zipfile,ZLIB_FILEFUNC_SEEK_SET)!=0)
+ return UNZ_ERRNO;
+
+
+ if (err==UNZ_OK)
+ {
+ if (unz64local_getLong(&s->z_filefunc, s->filestream,&uMagic) != UNZ_OK)
+ err=UNZ_ERRNO;
+ else if (uMagic!=0x04034b50)
+ err=UNZ_BADZIPFILE;
+ }
+
+ if (unz64local_getShort(&s->z_filefunc, s->filestream,&uData) != UNZ_OK)
+ err=UNZ_ERRNO;
+ /*
+ else if ((err==UNZ_OK) && (uData!=s->cur_file_info.wVersion))
+ err=UNZ_BADZIPFILE;
+ */
+ if (unz64local_getShort(&s->z_filefunc, s->filestream,&uFlags) != UNZ_OK)
+ err=UNZ_ERRNO;
+
+ if (unz64local_getShort(&s->z_filefunc, s->filestream,&uData) != UNZ_OK)
+ err=UNZ_ERRNO;
+ else if ((err==UNZ_OK) && (uData!=s->cur_file_info.compression_method))
+ err=UNZ_BADZIPFILE;
+
+ if ((err==UNZ_OK) && (s->cur_file_info.compression_method!=0) &&
+ /* #ifdef HAVE_BZIP2 */
+ (s->cur_file_info.compression_method!=Z_BZIP2ED) &&
+ /* #endif */
+ (s->cur_file_info.compression_method!=Z_DEFLATED))
+ err=UNZ_BADZIPFILE;
+
+ if (unz64local_getLong(&s->z_filefunc, s->filestream,&uData) != UNZ_OK) /* date/time */
+ err=UNZ_ERRNO;
+
+ if (unz64local_getLong(&s->z_filefunc, s->filestream,&uData) != UNZ_OK) /* crc */
+ err=UNZ_ERRNO;
+ else if ((err==UNZ_OK) && (uData!=s->cur_file_info.crc) && ((uFlags & 8)==0))
+ err=UNZ_BADZIPFILE;
+
+ if (unz64local_getLong(&s->z_filefunc, s->filestream,&uData) != UNZ_OK) /* size compr */
+ err=UNZ_ERRNO;
+ else if (uData != 0xFFFFFFFF && (err==UNZ_OK) && (uData!=s->cur_file_info.compressed_size) && ((uFlags & 8)==0))
+ err=UNZ_BADZIPFILE;
+
+ if (unz64local_getLong(&s->z_filefunc, s->filestream,&uData) != UNZ_OK) /* size uncompr */
+ err=UNZ_ERRNO;
+ else if (uData != 0xFFFFFFFF && (err==UNZ_OK) && (uData!=s->cur_file_info.uncompressed_size) && ((uFlags & 8)==0))
+ err=UNZ_BADZIPFILE;
+
+ if (unz64local_getShort(&s->z_filefunc, s->filestream,&size_filename) != UNZ_OK)
+ err=UNZ_ERRNO;
+ else if ((err==UNZ_OK) && (size_filename!=s->cur_file_info.size_filename))
+ err=UNZ_BADZIPFILE;
+
+ *piSizeVar += (uInt)size_filename;
+
+ if (unz64local_getShort(&s->z_filefunc, s->filestream,&size_extra_field) != UNZ_OK)
+ err=UNZ_ERRNO;
+ *poffset_local_extrafield= s->cur_file_info_internal.offset_curfile +
+ SIZEZIPLOCALHEADER + size_filename;
+ *psize_local_extrafield = (uInt)size_extra_field;
+
+ *piSizeVar += (uInt)size_extra_field;
+
+ return err;
+}
+
+/*
+ Open for reading data the current file in the zipfile.
+ If there is no error and the file is opened, the return value is UNZ_OK.
+ */
+extern int ZEXPORT unzOpenCurrentFile3 (unzFile file, int* method,
+ int* level, int raw, const char* password)
+{
+ int err=UNZ_OK;
+ uInt iSizeVar;
+ unz64_s* s;
+ file_in_zip64_read_info_s* pfile_in_zip_read_info;
+ ZPOS64_T offset_local_extrafield; /* offset of the local extra field */
+ uInt size_local_extrafield; /* size of the local extra field */
+# ifndef NOUNCRYPT
+ char source[12];
+# else
+ if (password != NULL)
+ return UNZ_PARAMERROR;
+# endif
+
+ if (file==NULL)
+ return UNZ_PARAMERROR;
+ s=(unz64_s*)file;
+ if (!s->current_file_ok)
+ return UNZ_PARAMERROR;
+
+ if (s->pfile_in_zip_read != NULL)
+ unzCloseCurrentFile(file);
+
+ if (unz64local_CheckCurrentFileCoherencyHeader(s,&iSizeVar, &offset_local_extrafield,&size_local_extrafield)!=UNZ_OK)
+ return UNZ_BADZIPFILE;
+
+ pfile_in_zip_read_info = (file_in_zip64_read_info_s*)ALLOC(sizeof(file_in_zip64_read_info_s));
+ if (pfile_in_zip_read_info==NULL)
+ return UNZ_INTERNALERROR;
+
+ pfile_in_zip_read_info->read_buffer=(char*)ALLOC(UNZ_BUFSIZE);
+ pfile_in_zip_read_info->offset_local_extrafield = offset_local_extrafield;
+ pfile_in_zip_read_info->size_local_extrafield = size_local_extrafield;
+ pfile_in_zip_read_info->pos_local_extrafield=0;
+ pfile_in_zip_read_info->raw=raw;
+
+ if (pfile_in_zip_read_info->read_buffer==NULL)
+ {
+ TRYFREE(pfile_in_zip_read_info);
+ return UNZ_INTERNALERROR;
+ }
+
+ pfile_in_zip_read_info->stream_initialised=0;
+
+ if (method!=NULL)
+ *method = (int)s->cur_file_info.compression_method;
+
+ if (level!=NULL)
+ {
+ *level = 6;
+ switch (s->cur_file_info.flag & 0x06)
+ {
+ case 6 : *level = 1; break;
+ case 4 : *level = 2; break;
+ case 2 : *level = 9; break;
+ }
+ }
+
+ if ((s->cur_file_info.compression_method!=0) &&
+ /* #ifdef HAVE_BZIP2 */
+ (s->cur_file_info.compression_method!=Z_BZIP2ED) &&
+ /* #endif */
+ (s->cur_file_info.compression_method!=Z_DEFLATED))
+
+ err=UNZ_BADZIPFILE;
+
+ pfile_in_zip_read_info->crc32_wait=s->cur_file_info.crc;
+ pfile_in_zip_read_info->crc32=0;
+ pfile_in_zip_read_info->total_out_64=0;
+ pfile_in_zip_read_info->compression_method = s->cur_file_info.compression_method;
+ pfile_in_zip_read_info->filestream=s->filestream;
+ pfile_in_zip_read_info->z_filefunc=s->z_filefunc;
+ pfile_in_zip_read_info->byte_before_the_zipfile=s->byte_before_the_zipfile;
+
+ pfile_in_zip_read_info->stream.total_out = 0;
+
+ if ((s->cur_file_info.compression_method==Z_BZIP2ED) && (!raw))
+ {
+#ifdef HAVE_BZIP2
+ pfile_in_zip_read_info->bstream.bzalloc = (void *(*) (void *, int, int))0;
+ pfile_in_zip_read_info->bstream.bzfree = (free_func)0;
+ pfile_in_zip_read_info->bstream.opaque = (voidpf)0;
+ pfile_in_zip_read_info->bstream.state = (voidpf)0;
+
+ pfile_in_zip_read_info->stream.zalloc = (alloc_func)0;
+ pfile_in_zip_read_info->stream.zfree = (free_func)0;
+ pfile_in_zip_read_info->stream.opaque = (voidpf)0;
+ pfile_in_zip_read_info->stream.next_in = (voidpf)0;
+ pfile_in_zip_read_info->stream.avail_in = 0;
+
+ err=BZ2_bzDecompressInit(&pfile_in_zip_read_info->bstream, 0, 0);
+ if (err == Z_OK)
+ pfile_in_zip_read_info->stream_initialised=Z_BZIP2ED;
+ else
+ {
+ TRYFREE(pfile_in_zip_read_info);
+ return err;
+ }
+#else
+ pfile_in_zip_read_info->raw=1;
+#endif
+ }
+ else if ((s->cur_file_info.compression_method==Z_DEFLATED) && (!raw))
+ {
+ pfile_in_zip_read_info->stream.zalloc = Z_NULL;
+ pfile_in_zip_read_info->stream.zfree = Z_NULL;
+ pfile_in_zip_read_info->stream.opaque = (voidpf)0;
+ pfile_in_zip_read_info->stream.next_in = 0;
+ pfile_in_zip_read_info->stream.avail_in = 0;
+
+ err=inflateInit2(&pfile_in_zip_read_info->stream, -MAX_WBITS);
+ if (err == Z_OK)
+ pfile_in_zip_read_info->stream_initialised=Z_DEFLATED;
+ else
+ {
+ TRYFREE(pfile_in_zip_read_info);
+ return err;
+ }
+ /* windowBits is passed < 0 to tell that there is no zlib header.
+ * Note that in this case inflate *requires* an extra "dummy" byte
+ * after the compressed stream in order to complete decompression and
+ * return Z_STREAM_END.
+ * In unzip, i don't wait absolutely Z_STREAM_END because I known the
+ * size of both compressed and uncompressed data
+ */
+ }
+ pfile_in_zip_read_info->rest_read_compressed =
+ s->cur_file_info.compressed_size ;
+ pfile_in_zip_read_info->rest_read_uncompressed =
+ s->cur_file_info.uncompressed_size ;
+
+
+ pfile_in_zip_read_info->pos_in_zipfile =
+ s->cur_file_info_internal.offset_curfile + SIZEZIPLOCALHEADER +
+ iSizeVar;
+
+ pfile_in_zip_read_info->stream.avail_in = (uInt)0;
+
+ s->pfile_in_zip_read = pfile_in_zip_read_info;
+ s->encrypted = 0;
+
+# ifndef NOUNCRYPT
+ if (password != NULL)
+ {
+ int i;
+ s->pcrc_32_tab = get_crc_table();
+ init_keys(password,s->keys,s->pcrc_32_tab);
+ if (ZSEEK64(s->z_filefunc, s->filestream,
+ s->pfile_in_zip_read->pos_in_zipfile +
+ s->pfile_in_zip_read->byte_before_the_zipfile,
+ SEEK_SET)!=0)
+ return UNZ_INTERNALERROR;
+ if(ZREAD64(s->z_filefunc, s->filestream,source, 12)<12)
+ return UNZ_INTERNALERROR;
+
+ for (i = 0; i<12; i++)
+ zdecode(s->keys,s->pcrc_32_tab,source[i]);
+
+ s->pfile_in_zip_read->pos_in_zipfile+=12;
+ s->encrypted=1;
+ }
+# endif
+
+
+ return UNZ_OK;
+}
+
+extern int ZEXPORT unzOpenCurrentFile (unzFile file)
+{
+ return unzOpenCurrentFile3(file, NULL, NULL, 0, NULL);
+}
+
+extern int ZEXPORT unzOpenCurrentFilePassword (unzFile file, const char* password)
+{
+ return unzOpenCurrentFile3(file, NULL, NULL, 0, password);
+}
+
+extern int ZEXPORT unzOpenCurrentFile2 (unzFile file, int* method, int* level, int raw)
+{
+ return unzOpenCurrentFile3(file, method, level, raw, NULL);
+}
+
+/** Addition for GDAL : START */
+
+extern ZPOS64_T ZEXPORT unzGetCurrentFileZStreamPos64( unzFile file)
+{
+ unz64_s* s;
+ file_in_zip64_read_info_s* pfile_in_zip_read_info;
+ s=(unz64_s*)file;
+ if (file==NULL)
+ return 0; //UNZ_PARAMERROR;
+ pfile_in_zip_read_info=s->pfile_in_zip_read;
+ if (pfile_in_zip_read_info==NULL)
+ return 0; //UNZ_PARAMERROR;
+ return pfile_in_zip_read_info->pos_in_zipfile +
+ pfile_in_zip_read_info->byte_before_the_zipfile;
+}
+
+/** Addition for GDAL : END */
+
+/*
+ Read bytes from the current file.
+ buf contain buffer where data must be copied
+ len the size of buf.
+
+ return the number of byte copied if somes bytes are copied
+ return 0 if the end of file was reached
+ return <0 with error code if there is an error
+ (UNZ_ERRNO for IO error, or zLib error for uncompress error)
+ */
+extern int ZEXPORT unzReadCurrentFile (unzFile file, voidp buf, unsigned len)
+{
+ int err=UNZ_OK;
+ uInt iRead = 0;
+ unz64_s* s;
+ file_in_zip64_read_info_s* pfile_in_zip_read_info;
+ if (file==NULL)
+ return UNZ_PARAMERROR;
+ s=(unz64_s*)file;
+ pfile_in_zip_read_info=s->pfile_in_zip_read;
+
+ if (pfile_in_zip_read_info==NULL)
+ return UNZ_PARAMERROR;
+
+
+ if (pfile_in_zip_read_info->read_buffer == NULL)
+ return UNZ_END_OF_LIST_OF_FILE;
+ if (len==0)
+ return 0;
+
+ pfile_in_zip_read_info->stream.next_out = (Bytef*)buf;
+
+ pfile_in_zip_read_info->stream.avail_out = (uInt)len;
+
+ if ((len>pfile_in_zip_read_info->rest_read_uncompressed) &&
+ (!(pfile_in_zip_read_info->raw)))
+ pfile_in_zip_read_info->stream.avail_out =
+ (uInt)pfile_in_zip_read_info->rest_read_uncompressed;
+
+ if ((len>pfile_in_zip_read_info->rest_read_compressed+
+ pfile_in_zip_read_info->stream.avail_in) &&
+ (pfile_in_zip_read_info->raw))
+ pfile_in_zip_read_info->stream.avail_out =
+ (uInt)pfile_in_zip_read_info->rest_read_compressed+
+ pfile_in_zip_read_info->stream.avail_in;
+
+ while (pfile_in_zip_read_info->stream.avail_out>0)
+ {
+ if ((pfile_in_zip_read_info->stream.avail_in==0) &&
+ (pfile_in_zip_read_info->rest_read_compressed>0))
+ {
+ uInt uReadThis = UNZ_BUFSIZE;
+ if (pfile_in_zip_read_info->rest_read_compressed<uReadThis)
+ uReadThis = (uInt)pfile_in_zip_read_info->rest_read_compressed;
+ if (uReadThis == 0)
+ return UNZ_EOF;
+ if (ZSEEK64(pfile_in_zip_read_info->z_filefunc,
+ pfile_in_zip_read_info->filestream,
+ pfile_in_zip_read_info->pos_in_zipfile +
+ pfile_in_zip_read_info->byte_before_the_zipfile,
+ ZLIB_FILEFUNC_SEEK_SET)!=0)
+ return UNZ_ERRNO;
+ if (ZREAD64(pfile_in_zip_read_info->z_filefunc,
+ pfile_in_zip_read_info->filestream,
+ pfile_in_zip_read_info->read_buffer,
+ uReadThis)!=uReadThis)
+ return UNZ_ERRNO;
+
+
+# ifndef NOUNCRYPT
+ if(s->encrypted)
+ {
+ uInt i;
+ for(i=0;i<uReadThis;i++)
+ pfile_in_zip_read_info->read_buffer[i] =
+ zdecode(s->keys,s->pcrc_32_tab,
+ pfile_in_zip_read_info->read_buffer[i]);
+ }
+# endif
+
+
+ pfile_in_zip_read_info->pos_in_zipfile += uReadThis;
+
+ pfile_in_zip_read_info->rest_read_compressed-=uReadThis;
+
+ pfile_in_zip_read_info->stream.next_in =
+ (Bytef*)pfile_in_zip_read_info->read_buffer;
+ pfile_in_zip_read_info->stream.avail_in = (uInt)uReadThis;
+ }
+
+ if ((pfile_in_zip_read_info->compression_method==0) || (pfile_in_zip_read_info->raw))
+ {
+ uInt uDoCopy,i ;
+
+ if ((pfile_in_zip_read_info->stream.avail_in == 0) &&
+ (pfile_in_zip_read_info->rest_read_compressed == 0))
+ return (iRead==0) ? UNZ_EOF : iRead;
+
+ if (pfile_in_zip_read_info->stream.avail_out <
+ pfile_in_zip_read_info->stream.avail_in)
+ uDoCopy = pfile_in_zip_read_info->stream.avail_out ;
+ else
+ uDoCopy = pfile_in_zip_read_info->stream.avail_in ;
+
+ for (i=0;i<uDoCopy;i++)
+ *(pfile_in_zip_read_info->stream.next_out+i) =
+ *(pfile_in_zip_read_info->stream.next_in+i);
+
+ pfile_in_zip_read_info->total_out_64 = pfile_in_zip_read_info->total_out_64 + uDoCopy;
+
+ pfile_in_zip_read_info->crc32 = crc32(pfile_in_zip_read_info->crc32,
+ pfile_in_zip_read_info->stream.next_out,
+ uDoCopy);
+ pfile_in_zip_read_info->rest_read_uncompressed-=uDoCopy;
+ pfile_in_zip_read_info->stream.avail_in -= uDoCopy;
+ pfile_in_zip_read_info->stream.avail_out -= uDoCopy;
+ pfile_in_zip_read_info->stream.next_out += uDoCopy;
+ pfile_in_zip_read_info->stream.next_in += uDoCopy;
+ pfile_in_zip_read_info->stream.total_out += uDoCopy;
+ iRead += uDoCopy;
+ }
+ else if (pfile_in_zip_read_info->compression_method==Z_BZIP2ED)
+ {
+#ifdef HAVE_BZIP2
+ uLong uTotalOutBefore,uTotalOutAfter;
+ const Bytef *bufBefore;
+ uLong uOutThis;
+
+ pfile_in_zip_read_info->bstream.next_in = (char*)pfile_in_zip_read_info->stream.next_in;
+ pfile_in_zip_read_info->bstream.avail_in = pfile_in_zip_read_info->stream.avail_in;
+ pfile_in_zip_read_info->bstream.total_in_lo32 = pfile_in_zip_read_info->stream.total_in;
+ pfile_in_zip_read_info->bstream.total_in_hi32 = 0;
+ pfile_in_zip_read_info->bstream.next_out = (char*)pfile_in_zip_read_info->stream.next_out;
+ pfile_in_zip_read_info->bstream.avail_out = pfile_in_zip_read_info->stream.avail_out;
+ pfile_in_zip_read_info->bstream.total_out_lo32 = pfile_in_zip_read_info->stream.total_out;
+ pfile_in_zip_read_info->bstream.total_out_hi32 = 0;
+
+ uTotalOutBefore = pfile_in_zip_read_info->bstream.total_out_lo32;
+ bufBefore = (const Bytef *)pfile_in_zip_read_info->bstream.next_out;
+
+ err=BZ2_bzDecompress(&pfile_in_zip_read_info->bstream);
+
+ uTotalOutAfter = pfile_in_zip_read_info->bstream.total_out_lo32;
+ uOutThis = uTotalOutAfter-uTotalOutBefore;
+
+ pfile_in_zip_read_info->total_out_64 = pfile_in_zip_read_info->total_out_64 + uOutThis;
+
+ pfile_in_zip_read_info->crc32 = crc32(pfile_in_zip_read_info->crc32,bufBefore, (uInt)(uOutThis));
+ pfile_in_zip_read_info->rest_read_uncompressed -= uOutThis;
+ iRead += (uInt)(uTotalOutAfter - uTotalOutBefore);
+
+ pfile_in_zip_read_info->stream.next_in = (Bytef*)pfile_in_zip_read_info->bstream.next_in;
+ pfile_in_zip_read_info->stream.avail_in = pfile_in_zip_read_info->bstream.avail_in;
+ pfile_in_zip_read_info->stream.total_in = pfile_in_zip_read_info->bstream.total_in_lo32;
+ pfile_in_zip_read_info->stream.next_out = (Bytef*)pfile_in_zip_read_info->bstream.next_out;
+ pfile_in_zip_read_info->stream.avail_out = pfile_in_zip_read_info->bstream.avail_out;
+ pfile_in_zip_read_info->stream.total_out = pfile_in_zip_read_info->bstream.total_out_lo32;
+
+ if (err==BZ_STREAM_END)
+ return (iRead==0) ? UNZ_EOF : iRead;
+ if (err!=BZ_OK)
+ break;
+#endif
+ } // end Z_BZIP2ED
+ else
+ {
+ ZPOS64_T uTotalOutBefore,uTotalOutAfter;
+ const Bytef *bufBefore;
+ ZPOS64_T uOutThis;
+ int flush=Z_SYNC_FLUSH;
+
+ uTotalOutBefore = pfile_in_zip_read_info->stream.total_out;
+ bufBefore = pfile_in_zip_read_info->stream.next_out;
+
+ /*
+ if ((pfile_in_zip_read_info->rest_read_uncompressed ==
+ pfile_in_zip_read_info->stream.avail_out) &&
+ (pfile_in_zip_read_info->rest_read_compressed == 0))
+ flush = Z_FINISH;
+ */
+ err=inflate(&pfile_in_zip_read_info->stream,flush);
+
+ if ((err>=0) && (pfile_in_zip_read_info->stream.msg!=NULL))
+ err = Z_DATA_ERROR;
+
+ uTotalOutAfter = pfile_in_zip_read_info->stream.total_out;
+ uOutThis = uTotalOutAfter-uTotalOutBefore;
+
+ pfile_in_zip_read_info->total_out_64 = pfile_in_zip_read_info->total_out_64 + uOutThis;
+
+ pfile_in_zip_read_info->crc32 =
+ crc32(pfile_in_zip_read_info->crc32,bufBefore,
+ (uInt)(uOutThis));
+
+ pfile_in_zip_read_info->rest_read_uncompressed -=
+ uOutThis;
+
+ iRead += (uInt)(uTotalOutAfter - uTotalOutBefore);
+
+ if (err==Z_STREAM_END)
+ return (iRead==0) ? UNZ_EOF : iRead;
+ if (err!=Z_OK)
+ break;
+ }
+ }
+
+ if (err==Z_OK)
+ return iRead;
+ return err;
+}
+
+
+/*
+ Give the current position in uncompressed data
+ */
+extern z_off_t ZEXPORT unztell (unzFile file)
+{
+ unz64_s* s;
+ file_in_zip64_read_info_s* pfile_in_zip_read_info;
+ if (file==NULL)
+ return UNZ_PARAMERROR;
+ s=(unz64_s*)file;
+ pfile_in_zip_read_info=s->pfile_in_zip_read;
+
+ if (pfile_in_zip_read_info==NULL)
+ return UNZ_PARAMERROR;
+
+ return (z_off_t)pfile_in_zip_read_info->stream.total_out;
+}
+
+extern ZPOS64_T ZEXPORT unztell64 (unzFile file)
+{
+
+ unz64_s* s;
+ file_in_zip64_read_info_s* pfile_in_zip_read_info;
+ if (file==NULL)
+ return (ZPOS64_T)-1;
+ s=(unz64_s*)file;
+ pfile_in_zip_read_info=s->pfile_in_zip_read;
+
+ if (pfile_in_zip_read_info==NULL)
+ return (ZPOS64_T)-1;
+
+ return pfile_in_zip_read_info->total_out_64;
+}
+
+
+/*
+ return 1 if the end of file was reached, 0 elsewhere
+ */
+extern int ZEXPORT unzeof (unzFile file)
+{
+ unz64_s* s;
+ file_in_zip64_read_info_s* pfile_in_zip_read_info;
+ if (file==NULL)
+ return UNZ_PARAMERROR;
+ s=(unz64_s*)file;
+ pfile_in_zip_read_info=s->pfile_in_zip_read;
+
+ if (pfile_in_zip_read_info==NULL)
+ return UNZ_PARAMERROR;
+
+ if (pfile_in_zip_read_info->rest_read_uncompressed == 0)
+ return 1;
+ else
+ return 0;
+}
+
+
+
+/*
+ Read extra field from the current file (opened by unzOpenCurrentFile)
+ This is the local-header version of the extra field (sometimes, there is
+ more info in the local-header version than in the central-header)
+
+ if buf==NULL, it return the size of the local extra field that can be read
+
+ if buf!=NULL, len is the size of the buffer, the extra header is copied in
+ buf.
+ the return value is the number of bytes copied in buf, or (if <0)
+ the error code
+ */
+extern int ZEXPORT unzGetLocalExtrafield (unzFile file, voidp buf, unsigned len)
+{
+ unz64_s* s;
+ file_in_zip64_read_info_s* pfile_in_zip_read_info;
+ uInt read_now;
+ ZPOS64_T size_to_read;
+
+ if (file==NULL)
+ return UNZ_PARAMERROR;
+ s=(unz64_s*)file;
+ pfile_in_zip_read_info=s->pfile_in_zip_read;
+
+ if (pfile_in_zip_read_info==NULL)
+ return UNZ_PARAMERROR;
+
+ size_to_read = (pfile_in_zip_read_info->size_local_extrafield -
+ pfile_in_zip_read_info->pos_local_extrafield);
+
+ if (buf==NULL)
+ return (int)size_to_read;
+
+ if (len>size_to_read)
+ read_now = (uInt)size_to_read;
+ else
+ read_now = (uInt)len ;
+
+ if (read_now==0)
+ return 0;
+
+ if (ZSEEK64(pfile_in_zip_read_info->z_filefunc,
+ pfile_in_zip_read_info->filestream,
+ pfile_in_zip_read_info->offset_local_extrafield +
+ pfile_in_zip_read_info->pos_local_extrafield,
+ ZLIB_FILEFUNC_SEEK_SET)!=0)
+ return UNZ_ERRNO;
+
+ if (ZREAD64(pfile_in_zip_read_info->z_filefunc,
+ pfile_in_zip_read_info->filestream,
+ buf,read_now)!=read_now)
+ return UNZ_ERRNO;
+
+ return (int)read_now;
+}
+
+/*
+ Close the file in zip opened with unzipOpenCurrentFile
+ Return UNZ_CRCERROR if all the file was read but the CRC is not good
+ */
+extern int ZEXPORT unzCloseCurrentFile (unzFile file)
+{
+ int err=UNZ_OK;
+
+ unz64_s* s;
+ file_in_zip64_read_info_s* pfile_in_zip_read_info;
+ if (file==NULL)
+ return UNZ_PARAMERROR;
+ s=(unz64_s*)file;
+ pfile_in_zip_read_info=s->pfile_in_zip_read;
+
+ if (pfile_in_zip_read_info==NULL)
+ return UNZ_PARAMERROR;
+
+
+ if ((pfile_in_zip_read_info->rest_read_uncompressed == 0) &&
+ (!pfile_in_zip_read_info->raw))
+ {
+ if (pfile_in_zip_read_info->crc32 != pfile_in_zip_read_info->crc32_wait)
+ err=UNZ_CRCERROR;
+ }
+
+
+ TRYFREE(pfile_in_zip_read_info->read_buffer);
+ pfile_in_zip_read_info->read_buffer = NULL;
+ if (pfile_in_zip_read_info->stream_initialised == Z_DEFLATED)
+ inflateEnd(&pfile_in_zip_read_info->stream);
+#ifdef HAVE_BZIP2
+ else if (pfile_in_zip_read_info->stream_initialised == Z_BZIP2ED)
+ BZ2_bzDecompressEnd(&pfile_in_zip_read_info->bstream);
+#endif
+
+
+ pfile_in_zip_read_info->stream_initialised = 0;
+ TRYFREE(pfile_in_zip_read_info);
+
+ s->pfile_in_zip_read=NULL;
+
+ return err;
+}
+
+
+/*
+ Get the global comment string of the ZipFile, in the szComment buffer.
+ uSizeBuf is the size of the szComment buffer.
+ return the number of byte copied or an error code <0
+ */
+extern int ZEXPORT unzGetGlobalComment (unzFile file, char * szComment, uLong uSizeBuf)
+{
+ unz64_s* s;
+ uLong uReadThis ;
+ if (file==NULL)
+ return (int)UNZ_PARAMERROR;
+ s=(unz64_s*)file;
+
+ uReadThis = uSizeBuf;
+ if (uReadThis>s->gi.size_comment)
+ uReadThis = s->gi.size_comment;
+
+ if (ZSEEK64(s->z_filefunc,s->filestream,s->central_pos+22,ZLIB_FILEFUNC_SEEK_SET)!=0)
+ return UNZ_ERRNO;
+
+ if (uReadThis>0)
+ {
+ *szComment='\0';
+ if (ZREAD64(s->z_filefunc,s->filestream,szComment,uReadThis)!=uReadThis)
+ return UNZ_ERRNO;
+ }
+
+ if ((szComment != NULL) && (uSizeBuf > s->gi.size_comment))
+ *(szComment+s->gi.size_comment)='\0';
+ return (int)uReadThis;
+}
+
+/* Additions by RX '2004 */
+extern ZPOS64_T ZEXPORT unzGetOffset64(unzFile file)
+{
+ unz64_s* s;
+
+ if (file==NULL)
+ return 0; //UNZ_PARAMERROR;
+ s=(unz64_s*)file;
+ if (!s->current_file_ok)
+ return 0;
+ if (s->gi.number_entry != 0 && s->gi.number_entry != 0xffff)
+ if (s->num_file==s->gi.number_entry)
+ return 0;
+ return s->pos_in_central_dir;
+}
+
+extern uLong ZEXPORT unzGetOffset (unzFile file)
+{
+ ZPOS64_T offset64;
+
+ if (file==NULL)
+ return 0; //UNZ_PARAMERROR;
+ offset64 = unzGetOffset64(file);
+ return (uLong)offset64;
+}
+
+extern int ZEXPORT unzSetOffset64(unzFile file, ZPOS64_T pos)
+{
+ unz64_s* s;
+ int err;
+
+ if (file==NULL)
+ return UNZ_PARAMERROR;
+ s=(unz64_s*)file;
+
+ s->pos_in_central_dir = pos;
+ s->num_file = s->gi.number_entry; /* hack */
+ err = unz64local_GetCurrentFileInfoInternal(file,&s->cur_file_info,
+ &s->cur_file_info_internal,
+ NULL,0,NULL,0,NULL,0);
+ s->current_file_ok = (err == UNZ_OK);
+ return err;
+}
+
+extern int ZEXPORT unzSetOffset (unzFile file, uLong pos)
+{
+ return unzSetOffset64(file,pos);
+}
--- /dev/null
+/* unzip.h -- IO for uncompress .zip files using zlib
+ Version 1.1, February 14h, 2010
+ part of the MiniZip project - ( http://www.winimage.com/zLibDll/minizip.html )
+
+ Copyright (C) 1998-2010 Gilles Vollant (minizip) ( http://www.winimage.com/zLibDll/minizip.html )
+
+ Modifications of Unzip for Zip64
+ Copyright (C) 2007-2008 Even Rouault
+
+ Modifications for Zip64 support on both zip and unzip
+ Copyright (C) 2009-2010 Mathias Svensson ( http://result42.com )
+
+ For more info read MiniZip_info.txt
+
+ ---------------------------------------------------------------------------------
+
+ Condition of use and distribution are the same than zlib :
+
+ This software is provided 'as-is', without any express or implied
+ warranty. In no event will the authors be held liable for any damages
+ arising from the use of this software.
+
+ Permission is granted to anyone to use this software for any purpose,
+ including commercial applications, and to alter it and redistribute it
+ freely, subject to the following restrictions:
+
+ 1. The origin of this software must not be misrepresented; you must not
+ claim that you wrote the original software. If you use this software
+ in a product, an acknowledgment in the product documentation would be
+ appreciated but is not required.
+ 2. Altered source versions must be plainly marked as such, and must not be
+ misrepresented as being the original software.
+ 3. This notice may not be removed or altered from any source distribution.
+
+ ---------------------------------------------------------------------------------
+
+ Changes
+
+ See header of unzip64.c
+
+*/
+
+#ifndef _unz64_H
+#define _unz64_H
+
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+#ifndef _ZLIB_H
+#include "zlib.h"
+#endif
+
+#ifndef _ZLIBIOAPI_H
+#include "ioapi.h"
+#endif
+
+#ifdef HAVE_BZIP2
+#include "bzlib.h"
+#endif
+
+#define Z_BZIP2ED 12
+
+#if defined(STRICTUNZIP) || defined(STRICTZIPUNZIP)
+/* like the STRICT of WIN32, we define a pointer that cannot be converted
+ from (void*) without cast */
+typedef struct TagunzFile__ { int unused; } unzFile__;
+typedef unzFile__ *unzFile;
+#else
+typedef voidp unzFile;
+#endif
+
+
+#define UNZ_OK (0)
+#define UNZ_END_OF_LIST_OF_FILE (-100)
+#define UNZ_ERRNO (Z_ERRNO)
+#define UNZ_EOF (0)
+#define UNZ_PARAMERROR (-102)
+#define UNZ_BADZIPFILE (-103)
+#define UNZ_INTERNALERROR (-104)
+#define UNZ_CRCERROR (-105)
+
+/* tm_unz contain date/time info */
+typedef struct tm_unz_s
+{
+ uInt tm_sec; /* seconds after the minute - [0,59] */
+ uInt tm_min; /* minutes after the hour - [0,59] */
+ uInt tm_hour; /* hours since midnight - [0,23] */
+ uInt tm_mday; /* day of the month - [1,31] */
+ uInt tm_mon; /* months since January - [0,11] */
+ uInt tm_year; /* years - [1980..2044] */
+} tm_unz;
+
+/* unz_global_info structure contain global data about the ZIPfile
+ These data comes from the end of central dir */
+typedef struct unz_global_info64_s
+{
+ ZPOS64_T number_entry; /* total number of entries in
+ the central dir on this disk */
+ uLong size_comment; /* size of the global comment of the zipfile */
+} unz_global_info64;
+
+typedef struct unz_global_info_s
+{
+ uLong number_entry; /* total number of entries in
+ the central dir on this disk */
+ uLong size_comment; /* size of the global comment of the zipfile */
+} unz_global_info;
+
+/* unz_file_info contain information about a file in the zipfile */
+typedef struct unz_file_info64_s
+{
+ uLong version; /* version made by 2 bytes */
+ uLong version_needed; /* version needed to extract 2 bytes */
+ uLong flag; /* general purpose bit flag 2 bytes */
+ uLong compression_method; /* compression method 2 bytes */
+ uLong dosDate; /* last mod file date in Dos fmt 4 bytes */
+ uLong crc; /* crc-32 4 bytes */
+ ZPOS64_T compressed_size; /* compressed size 8 bytes */
+ ZPOS64_T uncompressed_size; /* uncompressed size 8 bytes */
+ uLong size_filename; /* filename length 2 bytes */
+ uLong size_file_extra; /* extra field length 2 bytes */
+ uLong size_file_comment; /* file comment length 2 bytes */
+
+ uLong disk_num_start; /* disk number start 2 bytes */
+ uLong internal_fa; /* internal file attributes 2 bytes */
+ uLong external_fa; /* external file attributes 4 bytes */
+
+ tm_unz tmu_date;
+} unz_file_info64;
+
+typedef struct unz_file_info_s
+{
+ uLong version; /* version made by 2 bytes */
+ uLong version_needed; /* version needed to extract 2 bytes */
+ uLong flag; /* general purpose bit flag 2 bytes */
+ uLong compression_method; /* compression method 2 bytes */
+ uLong dosDate; /* last mod file date in Dos fmt 4 bytes */
+ uLong crc; /* crc-32 4 bytes */
+ uLong compressed_size; /* compressed size 4 bytes */
+ uLong uncompressed_size; /* uncompressed size 4 bytes */
+ uLong size_filename; /* filename length 2 bytes */
+ uLong size_file_extra; /* extra field length 2 bytes */
+ uLong size_file_comment; /* file comment length 2 bytes */
+
+ uLong disk_num_start; /* disk number start 2 bytes */
+ uLong internal_fa; /* internal file attributes 2 bytes */
+ uLong external_fa; /* external file attributes 4 bytes */
+
+ tm_unz tmu_date;
+} unz_file_info;
+
+extern int ZEXPORT unzStringFileNameCompare OF ((const char* fileName1,
+ const char* fileName2,
+ int iCaseSensitivity));
+/*
+ Compare two filename (fileName1,fileName2).
+ If iCaseSenisivity = 1, comparision is case sensitivity (like strcmp)
+ If iCaseSenisivity = 2, comparision is not case sensitivity (like strcmpi
+ or strcasecmp)
+ If iCaseSenisivity = 0, case sensitivity is defaut of your operating system
+ (like 1 on Unix, 2 on Windows)
+*/
+
+
+extern unzFile ZEXPORT unzOpen OF((const char *path));
+extern unzFile ZEXPORT unzOpen64 OF((const void *path));
+/*
+ Open a Zip file. path contain the full pathname (by example,
+ on a Windows XP computer "c:\\zlib\\zlib113.zip" or on an Unix computer
+ "zlib/zlib113.zip".
+ If the zipfile cannot be opened (file don't exist or in not valid), the
+ return value is NULL.
+ Else, the return value is a unzFile Handle, usable with other function
+ of this unzip package.
+ the "64" function take a const void* pointer, because the path is just the
+ value passed to the open64_file_func callback.
+ Under Windows, if UNICODE is defined, using fill_fopen64_filefunc, the path
+ is a pointer to a wide unicode string (LPCTSTR is LPCWSTR), so const char*
+ does not describe the reality
+*/
+
+
+extern unzFile ZEXPORT unzOpen2 OF((const char *path,
+ zlib_filefunc_def* pzlib_filefunc_def));
+/*
+ Open a Zip file, like unzOpen, but provide a set of file low level API
+ for read/write the zip file (see ioapi.h)
+*/
+
+extern unzFile ZEXPORT unzOpen2_64 OF((const void *path,
+ zlib_filefunc64_def* pzlib_filefunc_def));
+/*
+ Open a Zip file, like unz64Open, but provide a set of file low level API
+ for read/write the zip file (see ioapi.h)
+*/
+
+extern int ZEXPORT unzClose OF((unzFile file));
+/*
+ Close a ZipFile opened with unzipOpen.
+ If there is files inside the .Zip opened with unzOpenCurrentFile (see later),
+ these files MUST be closed with unzipCloseCurrentFile before call unzipClose.
+ return UNZ_OK if there is no problem. */
+
+extern int ZEXPORT unzGetGlobalInfo OF((unzFile file,
+ unz_global_info *pglobal_info));
+
+extern int ZEXPORT unzGetGlobalInfo64 OF((unzFile file,
+ unz_global_info64 *pglobal_info));
+/*
+ Write info about the ZipFile in the *pglobal_info structure.
+ No preparation of the structure is needed
+ return UNZ_OK if there is no problem. */
+
+
+extern int ZEXPORT unzGetGlobalComment OF((unzFile file,
+ char *szComment,
+ uLong uSizeBuf));
+/*
+ Get the global comment string of the ZipFile, in the szComment buffer.
+ uSizeBuf is the size of the szComment buffer.
+ return the number of byte copied or an error code <0
+*/
+
+
+/***************************************************************************/
+/* Unzip package allow you browse the directory of the zipfile */
+
+extern int ZEXPORT unzGoToFirstFile OF((unzFile file));
+/*
+ Set the current file of the zipfile to the first file.
+ return UNZ_OK if there is no problem
+*/
+
+extern int ZEXPORT unzGoToNextFile OF((unzFile file));
+/*
+ Set the current file of the zipfile to the next file.
+ return UNZ_OK if there is no problem
+ return UNZ_END_OF_LIST_OF_FILE if the actual file was the latest.
+*/
+
+extern int ZEXPORT unzLocateFile OF((unzFile file,
+ const char *szFileName,
+ int iCaseSensitivity));
+/*
+ Try locate the file szFileName in the zipfile.
+ For the iCaseSensitivity signification, see unzStringFileNameCompare
+
+ return value :
+ UNZ_OK if the file is found. It becomes the current file.
+ UNZ_END_OF_LIST_OF_FILE if the file is not found
+*/
+
+
+/* ****************************************** */
+/* Ryan supplied functions */
+/* unz_file_info contain information about a file in the zipfile */
+typedef struct unz_file_pos_s
+{
+ uLong pos_in_zip_directory; /* offset in zip file directory */
+ uLong num_of_file; /* # of file */
+} unz_file_pos;
+
+extern int ZEXPORT unzGetFilePos(
+ unzFile file,
+ unz_file_pos* file_pos);
+
+extern int ZEXPORT unzGoToFilePos(
+ unzFile file,
+ unz_file_pos* file_pos);
+
+typedef struct unz64_file_pos_s
+{
+ ZPOS64_T pos_in_zip_directory; /* offset in zip file directory */
+ ZPOS64_T num_of_file; /* # of file */
+} unz64_file_pos;
+
+extern int ZEXPORT unzGetFilePos64(
+ unzFile file,
+ unz64_file_pos* file_pos);
+
+extern int ZEXPORT unzGoToFilePos64(
+ unzFile file,
+ const unz64_file_pos* file_pos);
+
+/* ****************************************** */
+
+extern int ZEXPORT unzGetCurrentFileInfo64 OF((unzFile file,
+ unz_file_info64 *pfile_info,
+ char *szFileName,
+ uLong fileNameBufferSize,
+ void *extraField,
+ uLong extraFieldBufferSize,
+ char *szComment,
+ uLong commentBufferSize));
+
+extern int ZEXPORT unzGetCurrentFileInfo OF((unzFile file,
+ unz_file_info *pfile_info,
+ char *szFileName,
+ uLong fileNameBufferSize,
+ void *extraField,
+ uLong extraFieldBufferSize,
+ char *szComment,
+ uLong commentBufferSize));
+/*
+ Get Info about the current file
+ if pfile_info!=NULL, the *pfile_info structure will contain somes info about
+ the current file
+ if szFileName!=NULL, the filemane string will be copied in szFileName
+ (fileNameBufferSize is the size of the buffer)
+ if extraField!=NULL, the extra field information will be copied in extraField
+ (extraFieldBufferSize is the size of the buffer).
+ This is the Central-header version of the extra field
+ if szComment!=NULL, the comment string of the file will be copied in szComment
+ (commentBufferSize is the size of the buffer)
+*/
+
+
+/** Addition for GDAL : START */
+
+extern ZPOS64_T ZEXPORT unzGetCurrentFileZStreamPos64 OF((unzFile file));
+
+/** Addition for GDAL : END */
+
+
+/***************************************************************************/
+/* for reading the content of the current zipfile, you can open it, read data
+ from it, and close it (you can close it before reading all the file)
+ */
+
+extern int ZEXPORT unzOpenCurrentFile OF((unzFile file));
+/*
+ Open for reading data the current file in the zipfile.
+ If there is no error, the return value is UNZ_OK.
+*/
+
+extern int ZEXPORT unzOpenCurrentFilePassword OF((unzFile file,
+ const char* password));
+/*
+ Open for reading data the current file in the zipfile.
+ password is a crypting password
+ If there is no error, the return value is UNZ_OK.
+*/
+
+extern int ZEXPORT unzOpenCurrentFile2 OF((unzFile file,
+ int* method,
+ int* level,
+ int raw));
+/*
+ Same than unzOpenCurrentFile, but open for read raw the file (not uncompress)
+ if raw==1
+ *method will receive method of compression, *level will receive level of
+ compression
+ note : you can set level parameter as NULL (if you did not want known level,
+ but you CANNOT set method parameter as NULL
+*/
+
+extern int ZEXPORT unzOpenCurrentFile3 OF((unzFile file,
+ int* method,
+ int* level,
+ int raw,
+ const char* password));
+/*
+ Same than unzOpenCurrentFile, but open for read raw the file (not uncompress)
+ if raw==1
+ *method will receive method of compression, *level will receive level of
+ compression
+ note : you can set level parameter as NULL (if you did not want known level,
+ but you CANNOT set method parameter as NULL
+*/
+
+
+extern int ZEXPORT unzCloseCurrentFile OF((unzFile file));
+/*
+ Close the file in zip opened with unzOpenCurrentFile
+ Return UNZ_CRCERROR if all the file was read but the CRC is not good
+*/
+
+extern int ZEXPORT unzReadCurrentFile OF((unzFile file,
+ voidp buf,
+ unsigned len));
+/*
+ Read bytes from the current file (opened by unzOpenCurrentFile)
+ buf contain buffer where data must be copied
+ len the size of buf.
+
+ return the number of byte copied if somes bytes are copied
+ return 0 if the end of file was reached
+ return <0 with error code if there is an error
+ (UNZ_ERRNO for IO error, or zLib error for uncompress error)
+*/
+
+extern z_off_t ZEXPORT unztell OF((unzFile file));
+
+extern ZPOS64_T ZEXPORT unztell64 OF((unzFile file));
+/*
+ Give the current position in uncompressed data
+*/
+
+extern int ZEXPORT unzeof OF((unzFile file));
+/*
+ return 1 if the end of file was reached, 0 elsewhere
+*/
+
+extern int ZEXPORT unzGetLocalExtrafield OF((unzFile file,
+ voidp buf,
+ unsigned len));
+/*
+ Read extra field from the current file (opened by unzOpenCurrentFile)
+ This is the local-header version of the extra field (sometimes, there is
+ more info in the local-header version than in the central-header)
+
+ if buf==NULL, it return the size of the local extra field
+
+ if buf!=NULL, len is the size of the buffer, the extra header is copied in
+ buf.
+ the return value is the number of bytes copied in buf, or (if <0)
+ the error code
+*/
+
+/***************************************************************************/
+
+/* Get the current file offset */
+extern ZPOS64_T ZEXPORT unzGetOffset64 (unzFile file);
+extern uLong ZEXPORT unzGetOffset (unzFile file);
+
+/* Set the current file offset */
+extern int ZEXPORT unzSetOffset64 (unzFile file, ZPOS64_T pos);
+extern int ZEXPORT unzSetOffset (unzFile file, uLong pos);
+
+
+
+#ifdef __cplusplus
+}
+#endif
+
+#endif /* _unz64_H */
--- /dev/null
+/* zconf.h -- configuration of the zlib compression library
+ * Copyright (C) 1995-2013 Jean-loup Gailly.
+ * For conditions of distribution and use, see copyright notice in zlib.h
+ */
+
+/* @(#) $Id$ */
+
+#ifndef ZCONF_H
+#define ZCONF_H
+
+/*
+ * If you *really* need a unique prefix for all types and library functions,
+ * compile with -DZ_PREFIX. The "standard" zlib should be compiled without it.
+ * Even better than compiling with -DZ_PREFIX would be to use configure to set
+ * this permanently in zconf.h using "./configure --zprefix".
+ */
+#ifdef Z_PREFIX /* may be set to #if 1 by ./configure */
+# define Z_PREFIX_SET
+
+/* all linked symbols */
+# define _dist_code z__dist_code
+# define _length_code z__length_code
+# define _tr_align z__tr_align
+# define _tr_flush_bits z__tr_flush_bits
+# define _tr_flush_block z__tr_flush_block
+# define _tr_init z__tr_init
+# define _tr_stored_block z__tr_stored_block
+# define _tr_tally z__tr_tally
+# define adler32 z_adler32
+# define adler32_combine z_adler32_combine
+# define adler32_combine64 z_adler32_combine64
+# ifndef Z_SOLO
+# define compress z_compress
+# define compress2 z_compress2
+# define compressBound z_compressBound
+# endif
+# define crc32 z_crc32
+# define crc32_combine z_crc32_combine
+# define crc32_combine64 z_crc32_combine64
+# define deflate z_deflate
+# define deflateBound z_deflateBound
+# define deflateCopy z_deflateCopy
+# define deflateEnd z_deflateEnd
+# define deflateInit2_ z_deflateInit2_
+# define deflateInit_ z_deflateInit_
+# define deflateParams z_deflateParams
+# define deflatePending z_deflatePending
+# define deflatePrime z_deflatePrime
+# define deflateReset z_deflateReset
+# define deflateResetKeep z_deflateResetKeep
+# define deflateSetDictionary z_deflateSetDictionary
+# define deflateSetHeader z_deflateSetHeader
+# define deflateTune z_deflateTune
+# define deflate_copyright z_deflate_copyright
+# define get_crc_table z_get_crc_table
+# ifndef Z_SOLO
+# define gz_error z_gz_error
+# define gz_intmax z_gz_intmax
+# define gz_strwinerror z_gz_strwinerror
+# define gzbuffer z_gzbuffer
+# define gzclearerr z_gzclearerr
+# define gzclose z_gzclose
+# define gzclose_r z_gzclose_r
+# define gzclose_w z_gzclose_w
+# define gzdirect z_gzdirect
+# define gzdopen z_gzdopen
+# define gzeof z_gzeof
+# define gzerror z_gzerror
+# define gzflush z_gzflush
+# define gzgetc z_gzgetc
+# define gzgetc_ z_gzgetc_
+# define gzgets z_gzgets
+# define gzoffset z_gzoffset
+# define gzoffset64 z_gzoffset64
+# define gzopen z_gzopen
+# define gzopen64 z_gzopen64
+# ifdef _WIN32
+# define gzopen_w z_gzopen_w
+# endif
+# define gzprintf z_gzprintf
+# define gzvprintf z_gzvprintf
+# define gzputc z_gzputc
+# define gzputs z_gzputs
+# define gzread z_gzread
+# define gzrewind z_gzrewind
+# define gzseek z_gzseek
+# define gzseek64 z_gzseek64
+# define gzsetparams z_gzsetparams
+# define gztell z_gztell
+# define gztell64 z_gztell64
+# define gzungetc z_gzungetc
+# define gzwrite z_gzwrite
+# endif
+# define inflate z_inflate
+# define inflateBack z_inflateBack
+# define inflateBackEnd z_inflateBackEnd
+# define inflateBackInit_ z_inflateBackInit_
+# define inflateCopy z_inflateCopy
+# define inflateEnd z_inflateEnd
+# define inflateGetHeader z_inflateGetHeader
+# define inflateInit2_ z_inflateInit2_
+# define inflateInit_ z_inflateInit_
+# define inflateMark z_inflateMark
+# define inflatePrime z_inflatePrime
+# define inflateReset z_inflateReset
+# define inflateReset2 z_inflateReset2
+# define inflateSetDictionary z_inflateSetDictionary
+# define inflateGetDictionary z_inflateGetDictionary
+# define inflateSync z_inflateSync
+# define inflateSyncPoint z_inflateSyncPoint
+# define inflateUndermine z_inflateUndermine
+# define inflateResetKeep z_inflateResetKeep
+# define inflate_copyright z_inflate_copyright
+# define inflate_fast z_inflate_fast
+# define inflate_table z_inflate_table
+# ifndef Z_SOLO
+# define uncompress z_uncompress
+# endif
+# define zError z_zError
+# ifndef Z_SOLO
+# define zcalloc z_zcalloc
+# define zcfree z_zcfree
+# endif
+# define zlibCompileFlags z_zlibCompileFlags
+# define zlibVersion z_zlibVersion
+
+/* all zlib typedefs in zlib.h and zconf.h */
+# define Byte z_Byte
+# define Bytef z_Bytef
+# define alloc_func z_alloc_func
+# define charf z_charf
+# define free_func z_free_func
+# ifndef Z_SOLO
+# define gzFile z_gzFile
+# endif
+# define gz_header z_gz_header
+# define gz_headerp z_gz_headerp
+# define in_func z_in_func
+# define intf z_intf
+# define out_func z_out_func
+# define uInt z_uInt
+# define uIntf z_uIntf
+# define uLong z_uLong
+# define uLongf z_uLongf
+# define voidp z_voidp
+# define voidpc z_voidpc
+# define voidpf z_voidpf
+
+/* all zlib structs in zlib.h and zconf.h */
+# define gz_header_s z_gz_header_s
+# define internal_state z_internal_state
+
+#endif
+
+#if defined(__MSDOS__) && !defined(MSDOS)
+# define MSDOS
+#endif
+#if (defined(OS_2) || defined(__OS2__)) && !defined(OS2)
+# define OS2
+#endif
+#if defined(_WINDOWS) && !defined(WINDOWS)
+# define WINDOWS
+#endif
+#if defined(_WIN32) || defined(_WIN32_WCE) || defined(__WIN32__)
+# ifndef WIN32
+# define WIN32
+# endif
+#endif
+#if (defined(MSDOS) || defined(OS2) || defined(WINDOWS)) && !defined(WIN32)
+# if !defined(__GNUC__) && !defined(__FLAT__) && !defined(__386__)
+# ifndef SYS16BIT
+# define SYS16BIT
+# endif
+# endif
+#endif
+
+/*
+ * Compile with -DMAXSEG_64K if the alloc function cannot allocate more
+ * than 64k bytes at a time (needed on systems with 16-bit int).
+ */
+#ifdef SYS16BIT
+# define MAXSEG_64K
+#endif
+#ifdef MSDOS
+# define UNALIGNED_OK
+#endif
+
+#ifdef __STDC_VERSION__
+# ifndef STDC
+# define STDC
+# endif
+# if __STDC_VERSION__ >= 199901L
+# ifndef STDC99
+# define STDC99
+# endif
+# endif
+#endif
+#if !defined(STDC) && (defined(__STDC__) || defined(__cplusplus))
+# define STDC
+#endif
+#if !defined(STDC) && (defined(__GNUC__) || defined(__BORLANDC__))
+# define STDC
+#endif
+#if !defined(STDC) && (defined(MSDOS) || defined(WINDOWS) || defined(WIN32))
+# define STDC
+#endif
+#if !defined(STDC) && (defined(OS2) || defined(__HOS_AIX__))
+# define STDC
+#endif
+
+#if defined(__OS400__) && !defined(STDC) /* iSeries (formerly AS/400). */
+# define STDC
+#endif
+
+#ifndef STDC
+# ifndef const /* cannot use !defined(STDC) && !defined(const) on Mac */
+# define const /* note: need a more gentle solution here */
+# endif
+#endif
+
+#if defined(ZLIB_CONST) && !defined(z_const)
+# define z_const const
+#else
+# define z_const
+#endif
+
+/* Some Mac compilers merge all .h files incorrectly: */
+#if defined(__MWERKS__)||defined(applec)||defined(THINK_C)||defined(__SC__)
+# define NO_DUMMY_DECL
+#endif
+
+/* Maximum value for memLevel in deflateInit2 */
+#ifndef MAX_MEM_LEVEL
+# ifdef MAXSEG_64K
+# define MAX_MEM_LEVEL 8
+# else
+# define MAX_MEM_LEVEL 9
+# endif
+#endif
+
+/* Maximum value for windowBits in deflateInit2 and inflateInit2.
+ * WARNING: reducing MAX_WBITS makes minigzip unable to extract .gz files
+ * created by gzip. (Files created by minigzip can still be extracted by
+ * gzip.)
+ */
+#ifndef MAX_WBITS
+# define MAX_WBITS 15 /* 32K LZ77 window */
+#endif
+
+/* The memory requirements for deflate are (in bytes):
+ (1 << (windowBits+2)) + (1 << (memLevel+9))
+ that is: 128K for windowBits=15 + 128K for memLevel = 8 (default values)
+ plus a few kilobytes for small objects. For example, if you want to reduce
+ the default memory requirements from 256K to 128K, compile with
+ make CFLAGS="-O -DMAX_WBITS=14 -DMAX_MEM_LEVEL=7"
+ Of course this will generally degrade compression (there's no free lunch).
+
+ The memory requirements for inflate are (in bytes) 1 << windowBits
+ that is, 32K for windowBits=15 (default value) plus a few kilobytes
+ for small objects.
+*/
+
+ /* Type declarations */
+
+#ifndef OF /* function prototypes */
+# ifdef STDC
+# define OF(args) args
+# else
+# define OF(args) ()
+# endif
+#endif
+
+#ifndef Z_ARG /* function prototypes for stdarg */
+# if defined(STDC) || defined(Z_HAVE_STDARG_H)
+# define Z_ARG(args) args
+# else
+# define Z_ARG(args) ()
+# endif
+#endif
+
+/* The following definitions for FAR are needed only for MSDOS mixed
+ * model programming (small or medium model with some far allocations).
+ * This was tested only with MSC; for other MSDOS compilers you may have
+ * to define NO_MEMCPY in zutil.h. If you don't need the mixed model,
+ * just define FAR to be empty.
+ */
+#ifdef SYS16BIT
+# if defined(M_I86SM) || defined(M_I86MM)
+ /* MSC small or medium model */
+# define SMALL_MEDIUM
+# ifdef _MSC_VER
+# define FAR _far
+# else
+# define FAR far
+# endif
+# endif
+# if (defined(__SMALL__) || defined(__MEDIUM__))
+ /* Turbo C small or medium model */
+# define SMALL_MEDIUM
+# ifdef __BORLANDC__
+# define FAR _far
+# else
+# define FAR far
+# endif
+# endif
+#endif
+
+#if defined(WINDOWS) || defined(WIN32)
+ /* If building or using zlib as a DLL, define ZLIB_DLL.
+ * This is not mandatory, but it offers a little performance increase.
+ */
+# ifdef ZLIB_DLL
+# if defined(WIN32) && (!defined(__BORLANDC__) || (__BORLANDC__ >= 0x500))
+# ifdef ZLIB_INTERNAL
+# define ZEXTERN extern __declspec(dllexport)
+# else
+# define ZEXTERN extern __declspec(dllimport)
+# endif
+# endif
+# endif /* ZLIB_DLL */
+ /* If building or using zlib with the WINAPI/WINAPIV calling convention,
+ * define ZLIB_WINAPI.
+ * Caution: the standard ZLIB1.DLL is NOT compiled using ZLIB_WINAPI.
+ */
+# ifdef ZLIB_WINAPI
+# ifdef FAR
+# undef FAR
+# endif
+# include <windows.h>
+ /* No need for _export, use ZLIB.DEF instead. */
+ /* For complete Windows compatibility, use WINAPI, not __stdcall. */
+# define ZEXPORT WINAPI
+# ifdef WIN32
+# define ZEXPORTVA WINAPIV
+# else
+# define ZEXPORTVA FAR CDECL
+# endif
+# endif
+#endif
+
+#if defined (__BEOS__)
+# ifdef ZLIB_DLL
+# ifdef ZLIB_INTERNAL
+# define ZEXPORT __declspec(dllexport)
+# define ZEXPORTVA __declspec(dllexport)
+# else
+# define ZEXPORT __declspec(dllimport)
+# define ZEXPORTVA __declspec(dllimport)
+# endif
+# endif
+#endif
+
+#ifndef ZEXTERN
+# define ZEXTERN extern
+#endif
+#ifndef ZEXPORT
+# define ZEXPORT
+#endif
+#ifndef ZEXPORTVA
+# define ZEXPORTVA
+#endif
+
+#ifndef FAR
+# define FAR
+#endif
+
+#if !defined(__MACTYPES__)
+typedef unsigned char Byte; /* 8 bits */
+#endif
+typedef unsigned int uInt; /* 16 bits or more */
+typedef unsigned long uLong; /* 32 bits or more */
+
+#ifdef SMALL_MEDIUM
+ /* Borland C/C++ and some old MSC versions ignore FAR inside typedef */
+# define Bytef Byte FAR
+#else
+ typedef Byte FAR Bytef;
+#endif
+typedef char FAR charf;
+typedef int FAR intf;
+typedef uInt FAR uIntf;
+typedef uLong FAR uLongf;
+
+#ifdef STDC
+ typedef void const *voidpc;
+ typedef void FAR *voidpf;
+ typedef void *voidp;
+#else
+ typedef Byte const *voidpc;
+ typedef Byte FAR *voidpf;
+ typedef Byte *voidp;
+#endif
+
+#if !defined(Z_U4) && !defined(Z_SOLO) && defined(STDC)
+# include <limits.h>
+# if (UINT_MAX == 0xffffffffUL)
+# define Z_U4 unsigned
+# elif (ULONG_MAX == 0xffffffffUL)
+# define Z_U4 unsigned long
+# elif (USHRT_MAX == 0xffffffffUL)
+# define Z_U4 unsigned short
+# endif
+#endif
+
+#ifdef Z_U4
+ typedef Z_U4 z_crc_t;
+#else
+ typedef unsigned long z_crc_t;
+#endif
+
+#ifdef HAVE_UNISTD_H /* may be set to #if 1 by ./configure */
+# define Z_HAVE_UNISTD_H
+#endif
+
+#ifdef HAVE_STDARG_H /* may be set to #if 1 by ./configure */
+# define Z_HAVE_STDARG_H
+#endif
+
+#ifdef STDC
+# ifndef Z_SOLO
+# include <sys/types.h> /* for off_t */
+# endif
+#endif
+
+#if defined(STDC) || defined(Z_HAVE_STDARG_H)
+# ifndef Z_SOLO
+# include <stdarg.h> /* for va_list */
+# endif
+#endif
+
+#ifdef _WIN32
+# ifndef Z_SOLO
+# include <stddef.h> /* for wchar_t */
+# endif
+#endif
+
+/* a little trick to accommodate both "#define _LARGEFILE64_SOURCE" and
+ * "#define _LARGEFILE64_SOURCE 1" as requesting 64-bit operations, (even
+ * though the former does not conform to the LFS document), but considering
+ * both "#undef _LARGEFILE64_SOURCE" and "#define _LARGEFILE64_SOURCE 0" as
+ * equivalently requesting no 64-bit operations
+ */
+#if defined(_LARGEFILE64_SOURCE) && -_LARGEFILE64_SOURCE - -1 == 1
+# undef _LARGEFILE64_SOURCE
+#endif
+
+#if defined(__WATCOMC__) && !defined(Z_HAVE_UNISTD_H)
+# define Z_HAVE_UNISTD_H
+#endif
+#ifndef Z_SOLO
+# if defined(Z_HAVE_UNISTD_H) || defined(_LARGEFILE64_SOURCE)
+# include <unistd.h> /* for SEEK_*, off_t, and _LFS64_LARGEFILE */
+# ifdef VMS
+# include <unixio.h> /* for off_t */
+# endif
+# ifndef z_off_t
+# define z_off_t off_t
+# endif
+# endif
+#endif
+
+#if defined(_LFS64_LARGEFILE) && _LFS64_LARGEFILE-0
+# define Z_LFS64
+#endif
+
+#if defined(_LARGEFILE64_SOURCE) && defined(Z_LFS64)
+# define Z_LARGE64
+#endif
+
+#if defined(_FILE_OFFSET_BITS) && _FILE_OFFSET_BITS-0 == 64 && defined(Z_LFS64)
+# define Z_WANT64
+#endif
+
+#if !defined(SEEK_SET) && !defined(Z_SOLO)
+# define SEEK_SET 0 /* Seek from beginning of file. */
+# define SEEK_CUR 1 /* Seek from current position. */
+# define SEEK_END 2 /* Set file pointer to EOF plus "offset" */
+#endif
+
+#ifndef z_off_t
+# define z_off_t long
+#endif
+
+#if !defined(_WIN32) && defined(Z_LARGE64)
+# define z_off64_t off64_t
+#else
+# if defined(_WIN32) && !defined(__GNUC__) && !defined(Z_SOLO)
+# define z_off64_t __int64
+# else
+# define z_off64_t z_off_t
+# endif
+#endif
+
+/* MVS linker does not support external names larger than 8 bytes */
+#if defined(__MVS__)
+ #pragma map(deflateInit_,"DEIN")
+ #pragma map(deflateInit2_,"DEIN2")
+ #pragma map(deflateEnd,"DEEND")
+ #pragma map(deflateBound,"DEBND")
+ #pragma map(inflateInit_,"ININ")
+ #pragma map(inflateInit2_,"ININ2")
+ #pragma map(inflateEnd,"INEND")
+ #pragma map(inflateSync,"INSY")
+ #pragma map(inflateSetDictionary,"INSEDI")
+ #pragma map(compressBound,"CMBND")
+ #pragma map(inflate_table,"INTABL")
+ #pragma map(inflate_fast,"INFA")
+ #pragma map(inflate_copyright,"INCOPY")
+#endif
+
+#endif /* ZCONF_H */
--- /dev/null
+/* zconf.h -- configuration of the zlib compression library
+ * Copyright (C) 1995-2013 Jean-loup Gailly.
+ * For conditions of distribution and use, see copyright notice in zlib.h
+ */
+
+/* @(#) $Id$ */
+
+#ifndef ZCONF_H
+#define ZCONF_H
+
+/*
+ * If you *really* need a unique prefix for all types and library functions,
+ * compile with -DZ_PREFIX. The "standard" zlib should be compiled without it.
+ * Even better than compiling with -DZ_PREFIX would be to use configure to set
+ * this permanently in zconf.h using "./configure --zprefix".
+ */
+#ifdef Z_PREFIX /* may be set to #if 1 by ./configure */
+# define Z_PREFIX_SET
+
+/* all linked symbols */
+# define _dist_code z__dist_code
+# define _length_code z__length_code
+# define _tr_align z__tr_align
+# define _tr_flush_bits z__tr_flush_bits
+# define _tr_flush_block z__tr_flush_block
+# define _tr_init z__tr_init
+# define _tr_stored_block z__tr_stored_block
+# define _tr_tally z__tr_tally
+# define adler32 z_adler32
+# define adler32_combine z_adler32_combine
+# define adler32_combine64 z_adler32_combine64
+# ifndef Z_SOLO
+# define compress z_compress
+# define compress2 z_compress2
+# define compressBound z_compressBound
+# endif
+# define crc32 z_crc32
+# define crc32_combine z_crc32_combine
+# define crc32_combine64 z_crc32_combine64
+# define deflate z_deflate
+# define deflateBound z_deflateBound
+# define deflateCopy z_deflateCopy
+# define deflateEnd z_deflateEnd
+# define deflateInit2_ z_deflateInit2_
+# define deflateInit_ z_deflateInit_
+# define deflateParams z_deflateParams
+# define deflatePending z_deflatePending
+# define deflatePrime z_deflatePrime
+# define deflateReset z_deflateReset
+# define deflateResetKeep z_deflateResetKeep
+# define deflateSetDictionary z_deflateSetDictionary
+# define deflateSetHeader z_deflateSetHeader
+# define deflateTune z_deflateTune
+# define deflate_copyright z_deflate_copyright
+# define get_crc_table z_get_crc_table
+# ifndef Z_SOLO
+# define gz_error z_gz_error
+# define gz_intmax z_gz_intmax
+# define gz_strwinerror z_gz_strwinerror
+# define gzbuffer z_gzbuffer
+# define gzclearerr z_gzclearerr
+# define gzclose z_gzclose
+# define gzclose_r z_gzclose_r
+# define gzclose_w z_gzclose_w
+# define gzdirect z_gzdirect
+# define gzdopen z_gzdopen
+# define gzeof z_gzeof
+# define gzerror z_gzerror
+# define gzflush z_gzflush
+# define gzgetc z_gzgetc
+# define gzgetc_ z_gzgetc_
+# define gzgets z_gzgets
+# define gzoffset z_gzoffset
+# define gzoffset64 z_gzoffset64
+# define gzopen z_gzopen
+# define gzopen64 z_gzopen64
+# ifdef _WIN32
+# define gzopen_w z_gzopen_w
+# endif
+# define gzprintf z_gzprintf
+# define gzvprintf z_gzvprintf
+# define gzputc z_gzputc
+# define gzputs z_gzputs
+# define gzread z_gzread
+# define gzrewind z_gzrewind
+# define gzseek z_gzseek
+# define gzseek64 z_gzseek64
+# define gzsetparams z_gzsetparams
+# define gztell z_gztell
+# define gztell64 z_gztell64
+# define gzungetc z_gzungetc
+# define gzwrite z_gzwrite
+# endif
+# define inflate z_inflate
+# define inflateBack z_inflateBack
+# define inflateBackEnd z_inflateBackEnd
+# define inflateBackInit_ z_inflateBackInit_
+# define inflateCopy z_inflateCopy
+# define inflateEnd z_inflateEnd
+# define inflateGetHeader z_inflateGetHeader
+# define inflateInit2_ z_inflateInit2_
+# define inflateInit_ z_inflateInit_
+# define inflateMark z_inflateMark
+# define inflatePrime z_inflatePrime
+# define inflateReset z_inflateReset
+# define inflateReset2 z_inflateReset2
+# define inflateSetDictionary z_inflateSetDictionary
+# define inflateGetDictionary z_inflateGetDictionary
+# define inflateSync z_inflateSync
+# define inflateSyncPoint z_inflateSyncPoint
+# define inflateUndermine z_inflateUndermine
+# define inflateResetKeep z_inflateResetKeep
+# define inflate_copyright z_inflate_copyright
+# define inflate_fast z_inflate_fast
+# define inflate_table z_inflate_table
+# ifndef Z_SOLO
+# define uncompress z_uncompress
+# endif
+# define zError z_zError
+# ifndef Z_SOLO
+# define zcalloc z_zcalloc
+# define zcfree z_zcfree
+# endif
+# define zlibCompileFlags z_zlibCompileFlags
+# define zlibVersion z_zlibVersion
+
+/* all zlib typedefs in zlib.h and zconf.h */
+# define Byte z_Byte
+# define Bytef z_Bytef
+# define alloc_func z_alloc_func
+# define charf z_charf
+# define free_func z_free_func
+# ifndef Z_SOLO
+# define gzFile z_gzFile
+# endif
+# define gz_header z_gz_header
+# define gz_headerp z_gz_headerp
+# define in_func z_in_func
+# define intf z_intf
+# define out_func z_out_func
+# define uInt z_uInt
+# define uIntf z_uIntf
+# define uLong z_uLong
+# define uLongf z_uLongf
+# define voidp z_voidp
+# define voidpc z_voidpc
+# define voidpf z_voidpf
+
+/* all zlib structs in zlib.h and zconf.h */
+# define gz_header_s z_gz_header_s
+# define internal_state z_internal_state
+
+#endif
+
+#if defined(__MSDOS__) && !defined(MSDOS)
+# define MSDOS
+#endif
+#if (defined(OS_2) || defined(__OS2__)) && !defined(OS2)
+# define OS2
+#endif
+#if defined(_WINDOWS) && !defined(WINDOWS)
+# define WINDOWS
+#endif
+#if defined(_WIN32) || defined(_WIN32_WCE) || defined(__WIN32__)
+# ifndef WIN32
+# define WIN32
+# endif
+#endif
+#if (defined(MSDOS) || defined(OS2) || defined(WINDOWS)) && !defined(WIN32)
+# if !defined(__GNUC__) && !defined(__FLAT__) && !defined(__386__)
+# ifndef SYS16BIT
+# define SYS16BIT
+# endif
+# endif
+#endif
+
+/*
+ * Compile with -DMAXSEG_64K if the alloc function cannot allocate more
+ * than 64k bytes at a time (needed on systems with 16-bit int).
+ */
+#ifdef SYS16BIT
+# define MAXSEG_64K
+#endif
+#ifdef MSDOS
+# define UNALIGNED_OK
+#endif
+
+#ifdef __STDC_VERSION__
+# ifndef STDC
+# define STDC
+# endif
+# if __STDC_VERSION__ >= 199901L
+# ifndef STDC99
+# define STDC99
+# endif
+# endif
+#endif
+#if !defined(STDC) && (defined(__STDC__) || defined(__cplusplus))
+# define STDC
+#endif
+#if !defined(STDC) && (defined(__GNUC__) || defined(__BORLANDC__))
+# define STDC
+#endif
+#if !defined(STDC) && (defined(MSDOS) || defined(WINDOWS) || defined(WIN32))
+# define STDC
+#endif
+#if !defined(STDC) && (defined(OS2) || defined(__HOS_AIX__))
+# define STDC
+#endif
+
+#if defined(__OS400__) && !defined(STDC) /* iSeries (formerly AS/400). */
+# define STDC
+#endif
+
+#ifndef STDC
+# ifndef const /* cannot use !defined(STDC) && !defined(const) on Mac */
+# define const /* note: need a more gentle solution here */
+# endif
+#endif
+
+#if defined(ZLIB_CONST) && !defined(z_const)
+# define z_const const
+#else
+# define z_const
+#endif
+
+/* Some Mac compilers merge all .h files incorrectly: */
+#if defined(__MWERKS__)||defined(applec)||defined(THINK_C)||defined(__SC__)
+# define NO_DUMMY_DECL
+#endif
+
+/* Maximum value for memLevel in deflateInit2 */
+#ifndef MAX_MEM_LEVEL
+# ifdef MAXSEG_64K
+# define MAX_MEM_LEVEL 8
+# else
+# define MAX_MEM_LEVEL 9
+# endif
+#endif
+
+/* Maximum value for windowBits in deflateInit2 and inflateInit2.
+ * WARNING: reducing MAX_WBITS makes minigzip unable to extract .gz files
+ * created by gzip. (Files created by minigzip can still be extracted by
+ * gzip.)
+ */
+#ifndef MAX_WBITS
+# define MAX_WBITS 15 /* 32K LZ77 window */
+#endif
+
+/* The memory requirements for deflate are (in bytes):
+ (1 << (windowBits+2)) + (1 << (memLevel+9))
+ that is: 128K for windowBits=15 + 128K for memLevel = 8 (default values)
+ plus a few kilobytes for small objects. For example, if you want to reduce
+ the default memory requirements from 256K to 128K, compile with
+ make CFLAGS="-O -DMAX_WBITS=14 -DMAX_MEM_LEVEL=7"
+ Of course this will generally degrade compression (there's no free lunch).
+
+ The memory requirements for inflate are (in bytes) 1 << windowBits
+ that is, 32K for windowBits=15 (default value) plus a few kilobytes
+ for small objects.
+*/
+
+ /* Type declarations */
+
+#ifndef OF /* function prototypes */
+# ifdef STDC
+# define OF(args) args
+# else
+# define OF(args) ()
+# endif
+#endif
+
+#ifndef Z_ARG /* function prototypes for stdarg */
+# if defined(STDC) || defined(Z_HAVE_STDARG_H)
+# define Z_ARG(args) args
+# else
+# define Z_ARG(args) ()
+# endif
+#endif
+
+/* The following definitions for FAR are needed only for MSDOS mixed
+ * model programming (small or medium model with some far allocations).
+ * This was tested only with MSC; for other MSDOS compilers you may have
+ * to define NO_MEMCPY in zutil.h. If you don't need the mixed model,
+ * just define FAR to be empty.
+ */
+#ifdef SYS16BIT
+# if defined(M_I86SM) || defined(M_I86MM)
+ /* MSC small or medium model */
+# define SMALL_MEDIUM
+# ifdef _MSC_VER
+# define FAR _far
+# else
+# define FAR far
+# endif
+# endif
+# if (defined(__SMALL__) || defined(__MEDIUM__))
+ /* Turbo C small or medium model */
+# define SMALL_MEDIUM
+# ifdef __BORLANDC__
+# define FAR _far
+# else
+# define FAR far
+# endif
+# endif
+#endif
+
+#if defined(WINDOWS) || defined(WIN32)
+ /* If building or using zlib as a DLL, define ZLIB_DLL.
+ * This is not mandatory, but it offers a little performance increase.
+ */
+# ifdef ZLIB_DLL
+# if defined(WIN32) && (!defined(__BORLANDC__) || (__BORLANDC__ >= 0x500))
+# ifdef ZLIB_INTERNAL
+# define ZEXTERN extern __declspec(dllexport)
+# else
+# define ZEXTERN extern __declspec(dllimport)
+# endif
+# endif
+# endif /* ZLIB_DLL */
+ /* If building or using zlib with the WINAPI/WINAPIV calling convention,
+ * define ZLIB_WINAPI.
+ * Caution: the standard ZLIB1.DLL is NOT compiled using ZLIB_WINAPI.
+ */
+# ifdef ZLIB_WINAPI
+# ifdef FAR
+# undef FAR
+# endif
+# include <windows.h>
+ /* No need for _export, use ZLIB.DEF instead. */
+ /* For complete Windows compatibility, use WINAPI, not __stdcall. */
+# define ZEXPORT WINAPI
+# ifdef WIN32
+# define ZEXPORTVA WINAPIV
+# else
+# define ZEXPORTVA FAR CDECL
+# endif
+# endif
+#endif
+
+#if defined (__BEOS__)
+# ifdef ZLIB_DLL
+# ifdef ZLIB_INTERNAL
+# define ZEXPORT __declspec(dllexport)
+# define ZEXPORTVA __declspec(dllexport)
+# else
+# define ZEXPORT __declspec(dllimport)
+# define ZEXPORTVA __declspec(dllimport)
+# endif
+# endif
+#endif
+
+#ifndef ZEXTERN
+# define ZEXTERN extern
+#endif
+#ifndef ZEXPORT
+# define ZEXPORT
+#endif
+#ifndef ZEXPORTVA
+# define ZEXPORTVA
+#endif
+
+#ifndef FAR
+# define FAR
+#endif
+
+#if !defined(__MACTYPES__)
+typedef unsigned char Byte; /* 8 bits */
+#endif
+typedef unsigned int uInt; /* 16 bits or more */
+typedef unsigned long uLong; /* 32 bits or more */
+
+#ifdef SMALL_MEDIUM
+ /* Borland C/C++ and some old MSC versions ignore FAR inside typedef */
+# define Bytef Byte FAR
+#else
+ typedef Byte FAR Bytef;
+#endif
+typedef char FAR charf;
+typedef int FAR intf;
+typedef uInt FAR uIntf;
+typedef uLong FAR uLongf;
+
+#ifdef STDC
+ typedef void const *voidpc;
+ typedef void FAR *voidpf;
+ typedef void *voidp;
+#else
+ typedef Byte const *voidpc;
+ typedef Byte FAR *voidpf;
+ typedef Byte *voidp;
+#endif
+
+#if !defined(Z_U4) && !defined(Z_SOLO) && defined(STDC)
+# include <limits.h>
+# if (UINT_MAX == 0xffffffffUL)
+# define Z_U4 unsigned
+# elif (ULONG_MAX == 0xffffffffUL)
+# define Z_U4 unsigned long
+# elif (USHRT_MAX == 0xffffffffUL)
+# define Z_U4 unsigned short
+# endif
+#endif
+
+#ifdef Z_U4
+ typedef Z_U4 z_crc_t;
+#else
+ typedef unsigned long z_crc_t;
+#endif
+
+#ifdef HAVE_UNISTD_H /* may be set to #if 1 by ./configure */
+# define Z_HAVE_UNISTD_H
+#endif
+
+#ifdef HAVE_STDARG_H /* may be set to #if 1 by ./configure */
+# define Z_HAVE_STDARG_H
+#endif
+
+#ifdef STDC
+# ifndef Z_SOLO
+# include <sys/types.h> /* for off_t */
+# endif
+#endif
+
+#if defined(STDC) || defined(Z_HAVE_STDARG_H)
+# ifndef Z_SOLO
+# include <stdarg.h> /* for va_list */
+# endif
+#endif
+
+#ifdef _WIN32
+# ifndef Z_SOLO
+# include <stddef.h> /* for wchar_t */
+# endif
+#endif
+
+/* a little trick to accommodate both "#define _LARGEFILE64_SOURCE" and
+ * "#define _LARGEFILE64_SOURCE 1" as requesting 64-bit operations, (even
+ * though the former does not conform to the LFS document), but considering
+ * both "#undef _LARGEFILE64_SOURCE" and "#define _LARGEFILE64_SOURCE 0" as
+ * equivalently requesting no 64-bit operations
+ */
+#if defined(_LARGEFILE64_SOURCE) && -_LARGEFILE64_SOURCE - -1 == 1
+# undef _LARGEFILE64_SOURCE
+#endif
+
+#if defined(__WATCOMC__) && !defined(Z_HAVE_UNISTD_H)
+# define Z_HAVE_UNISTD_H
+#endif
+#ifndef Z_SOLO
+# if defined(Z_HAVE_UNISTD_H) || defined(_LARGEFILE64_SOURCE)
+# include <unistd.h> /* for SEEK_*, off_t, and _LFS64_LARGEFILE */
+# ifdef VMS
+# include <unixio.h> /* for off_t */
+# endif
+# ifndef z_off_t
+# define z_off_t off_t
+# endif
+# endif
+#endif
+
+#if defined(_LFS64_LARGEFILE) && _LFS64_LARGEFILE-0
+# define Z_LFS64
+#endif
+
+#if defined(_LARGEFILE64_SOURCE) && defined(Z_LFS64)
+# define Z_LARGE64
+#endif
+
+#if defined(_FILE_OFFSET_BITS) && _FILE_OFFSET_BITS-0 == 64 && defined(Z_LFS64)
+# define Z_WANT64
+#endif
+
+#if !defined(SEEK_SET) && !defined(Z_SOLO)
+# define SEEK_SET 0 /* Seek from beginning of file. */
+# define SEEK_CUR 1 /* Seek from current position. */
+# define SEEK_END 2 /* Set file pointer to EOF plus "offset" */
+#endif
+
+#ifndef z_off_t
+# define z_off_t long
+#endif
+
+#if !defined(_WIN32) && defined(Z_LARGE64)
+# define z_off64_t off64_t
+#else
+# if defined(_WIN32) && !defined(__GNUC__) && !defined(Z_SOLO)
+# define z_off64_t __int64
+# else
+# define z_off64_t z_off_t
+# endif
+#endif
+
+/* MVS linker does not support external names larger than 8 bytes */
+#if defined(__MVS__)
+ #pragma map(deflateInit_,"DEIN")
+ #pragma map(deflateInit2_,"DEIN2")
+ #pragma map(deflateEnd,"DEEND")
+ #pragma map(deflateBound,"DEBND")
+ #pragma map(inflateInit_,"ININ")
+ #pragma map(inflateInit2_,"ININ2")
+ #pragma map(inflateEnd,"INEND")
+ #pragma map(inflateSync,"INSY")
+ #pragma map(inflateSetDictionary,"INSEDI")
+ #pragma map(compressBound,"CMBND")
+ #pragma map(inflate_table,"INTABL")
+ #pragma map(inflate_fast,"INFA")
+ #pragma map(inflate_copyright,"INCOPY")
+#endif
+
+#endif /* ZCONF_H */
--- /dev/null
+/* zlib.h -- interface of the 'zlib' general purpose compression library
+ version 1.2.8, April 28th, 2013
+
+ Copyright (C) 1995-2013 Jean-loup Gailly and Mark Adler
+
+ This software is provided 'as-is', without any express or implied
+ warranty. In no event will the authors be held liable for any damages
+ arising from the use of this software.
+
+ Permission is granted to anyone to use this software for any purpose,
+ including commercial applications, and to alter it and redistribute it
+ freely, subject to the following restrictions:
+
+ 1. The origin of this software must not be misrepresented; you must not
+ claim that you wrote the original software. If you use this software
+ in a product, an acknowledgment in the product documentation would be
+ appreciated but is not required.
+ 2. Altered source versions must be plainly marked as such, and must not be
+ misrepresented as being the original software.
+ 3. This notice may not be removed or altered from any source distribution.
+
+ Jean-loup Gailly Mark Adler
+ jloup@gzip.org madler@alumni.caltech.edu
+
+
+ The data format used by the zlib library is described by RFCs (Request for
+ Comments) 1950 to 1952 in the files http://tools.ietf.org/html/rfc1950
+ (zlib format), rfc1951 (deflate format) and rfc1952 (gzip format).
+*/
+
+#ifndef ZLIB_H
+#define ZLIB_H
+
+#include "zconf.h"
+
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+#define ZLIB_VERSION "1.2.8"
+#define ZLIB_VERNUM 0x1280
+#define ZLIB_VER_MAJOR 1
+#define ZLIB_VER_MINOR 2
+#define ZLIB_VER_REVISION 8
+#define ZLIB_VER_SUBREVISION 0
+
+/*
+ The 'zlib' compression library provides in-memory compression and
+ decompression functions, including integrity checks of the uncompressed data.
+ This version of the library supports only one compression method (deflation)
+ but other algorithms will be added later and will have the same stream
+ interface.
+
+ Compression can be done in a single step if the buffers are large enough,
+ or can be done by repeated calls of the compression function. In the latter
+ case, the application must provide more input and/or consume the output
+ (providing more output space) before each call.
+
+ The compressed data format used by default by the in-memory functions is
+ the zlib format, which is a zlib wrapper documented in RFC 1950, wrapped
+ around a deflate stream, which is itself documented in RFC 1951.
+
+ The library also supports reading and writing files in gzip (.gz) format
+ with an interface similar to that of stdio using the functions that start
+ with "gz". The gzip format is different from the zlib format. gzip is a
+ gzip wrapper, documented in RFC 1952, wrapped around a deflate stream.
+
+ This library can optionally read and write gzip streams in memory as well.
+
+ The zlib format was designed to be compact and fast for use in memory
+ and on communications channels. The gzip format was designed for single-
+ file compression on file systems, has a larger header than zlib to maintain
+ directory information, and uses a different, slower check method than zlib.
+
+ The library does not install any signal handler. The decoder checks
+ the consistency of the compressed data, so the library should never crash
+ even in case of corrupted input.
+*/
+
+typedef voidpf (*alloc_func) OF((voidpf opaque, uInt items, uInt size));
+typedef void (*free_func) OF((voidpf opaque, voidpf address));
+
+struct internal_state;
+
+typedef struct z_stream_s {
+ z_const Bytef *next_in; /* next input byte */
+ uInt avail_in; /* number of bytes available at next_in */
+ uLong total_in; /* total number of input bytes read so far */
+
+ Bytef *next_out; /* next output byte should be put there */
+ uInt avail_out; /* remaining free space at next_out */
+ uLong total_out; /* total number of bytes output so far */
+
+ z_const char *msg; /* last error message, NULL if no error */
+ void *state; /* not visible by applications */
+
+ alloc_func zalloc; /* used to allocate the internal state */
+ free_func zfree; /* used to free the internal state */
+ voidpf opaque; /* private data object passed to zalloc and zfree */
+
+ int data_type; /* best guess about the data type: binary or text */
+ uLong adler; /* adler32 value of the uncompressed data */
+ uLong reserved; /* reserved for future use */
+} z_stream;
+
+typedef z_stream FAR *z_streamp;
+
+/*
+ gzip header information passed to and from zlib routines. See RFC 1952
+ for more details on the meanings of these fields.
+*/
+typedef struct gz_header_s {
+ int text; /* true if compressed data believed to be text */
+ uLong time; /* modification time */
+ int xflags; /* extra flags (not used when writing a gzip file) */
+ int os; /* operating system */
+ Bytef *extra; /* pointer to extra field or Z_NULL if none */
+ uInt extra_len; /* extra field length (valid if extra != Z_NULL) */
+ uInt extra_max; /* space at extra (only when reading header) */
+ Bytef *name; /* pointer to zero-terminated file name or Z_NULL */
+ uInt name_max; /* space at name (only when reading header) */
+ Bytef *comment; /* pointer to zero-terminated comment or Z_NULL */
+ uInt comm_max; /* space at comment (only when reading header) */
+ int hcrc; /* true if there was or will be a header crc */
+ int done; /* true when done reading gzip header (not used
+ when writing a gzip file) */
+} gz_header;
+
+typedef gz_header FAR *gz_headerp;
+
+/*
+ The application must update next_in and avail_in when avail_in has dropped
+ to zero. It must update next_out and avail_out when avail_out has dropped
+ to zero. The application must initialize zalloc, zfree and opaque before
+ calling the init function. All other fields are set by the compression
+ library and must not be updated by the application.
+
+ The opaque value provided by the application will be passed as the first
+ parameter for calls of zalloc and zfree. This can be useful for custom
+ memory management. The compression library attaches no meaning to the
+ opaque value.
+
+ zalloc must return Z_NULL if there is not enough memory for the object.
+ If zlib is used in a multi-threaded application, zalloc and zfree must be
+ thread safe.
+
+ On 16-bit systems, the functions zalloc and zfree must be able to allocate
+ exactly 65536 bytes, but will not be required to allocate more than this if
+ the symbol MAXSEG_64K is defined (see zconf.h). WARNING: On MSDOS, pointers
+ returned by zalloc for objects of exactly 65536 bytes *must* have their
+ offset normalized to zero. The default allocation function provided by this
+ library ensures this (see zutil.c). To reduce memory requirements and avoid
+ any allocation of 64K objects, at the expense of compression ratio, compile
+ the library with -DMAX_WBITS=14 (see zconf.h).
+
+ The fields total_in and total_out can be used for statistics or progress
+ reports. After compression, total_in holds the total size of the
+ uncompressed data and may be saved for use in the decompressor (particularly
+ if the decompressor wants to decompress everything in a single step).
+*/
+
+ /* constants */
+
+#define Z_NO_FLUSH 0
+#define Z_PARTIAL_FLUSH 1
+#define Z_SYNC_FLUSH 2
+#define Z_FULL_FLUSH 3
+#define Z_FINISH 4
+#define Z_BLOCK 5
+#define Z_TREES 6
+/* Allowed flush values; see deflate() and inflate() below for details */
+
+#define Z_OK 0
+#define Z_STREAM_END 1
+#define Z_NEED_DICT 2
+#define Z_ERRNO (-1)
+#define Z_STREAM_ERROR (-2)
+#define Z_DATA_ERROR (-3)
+#define Z_MEM_ERROR (-4)
+#define Z_BUF_ERROR (-5)
+#define Z_VERSION_ERROR (-6)
+/* Return codes for the compression/decompression functions. Negative values
+ * are errors, positive values are used for special but normal events.
+ */
+
+#define Z_NO_COMPRESSION 0
+#define Z_BEST_SPEED 1
+#define Z_BEST_COMPRESSION 9
+#define Z_DEFAULT_COMPRESSION (-1)
+/* compression levels */
+
+#define Z_FILTERED 1
+#define Z_HUFFMAN_ONLY 2
+#define Z_RLE 3
+#define Z_FIXED 4
+#define Z_DEFAULT_STRATEGY 0
+/* compression strategy; see deflateInit2() below for details */
+
+#define Z_BINARY 0
+#define Z_TEXT 1
+#define Z_ASCII Z_TEXT /* for compatibility with 1.2.2 and earlier */
+#define Z_UNKNOWN 2
+/* Possible values of the data_type field (though see inflate()) */
+
+#define Z_DEFLATED 8
+/* The deflate compression method (the only one supported in this version) */
+
+#define Z_NULL 0 /* for initializing zalloc, zfree, opaque */
+
+#define zlib_version zlibVersion()
+/* for compatibility with versions < 1.0.2 */
+
+
+ /* basic functions */
+
+ZEXTERN const char * ZEXPORT zlibVersion OF((void));
+/* The application can compare zlibVersion and ZLIB_VERSION for consistency.
+ If the first character differs, the library code actually used is not
+ compatible with the zlib.h header file used by the application. This check
+ is automatically made by deflateInit and inflateInit.
+ */
+
+/*
+ZEXTERN int ZEXPORT deflateInit OF((z_streamp strm, int level));
+
+ Initializes the internal stream state for compression. The fields
+ zalloc, zfree and opaque must be initialized before by the caller. If
+ zalloc and zfree are set to Z_NULL, deflateInit updates them to use default
+ allocation functions.
+
+ The compression level must be Z_DEFAULT_COMPRESSION, or between 0 and 9:
+ 1 gives best speed, 9 gives best compression, 0 gives no compression at all
+ (the input data is simply copied a block at a time). Z_DEFAULT_COMPRESSION
+ requests a default compromise between speed and compression (currently
+ equivalent to level 6).
+
+ deflateInit returns Z_OK if success, Z_MEM_ERROR if there was not enough
+ memory, Z_STREAM_ERROR if level is not a valid compression level, or
+ Z_VERSION_ERROR if the zlib library version (zlib_version) is incompatible
+ with the version assumed by the caller (ZLIB_VERSION). msg is set to null
+ if there is no error message. deflateInit does not perform any compression:
+ this will be done by deflate().
+*/
+
+
+ZEXTERN int ZEXPORT deflate OF((z_streamp strm, int flush));
+/*
+ deflate compresses as much data as possible, and stops when the input
+ buffer becomes empty or the output buffer becomes full. It may introduce
+ some output latency (reading input without producing any output) except when
+ forced to flush.
+
+ The detailed semantics are as follows. deflate performs one or both of the
+ following actions:
+
+ - Compress more input starting at next_in and update next_in and avail_in
+ accordingly. If not all input can be processed (because there is not
+ enough room in the output buffer), next_in and avail_in are updated and
+ processing will resume at this point for the next call of deflate().
+
+ - Provide more output starting at next_out and update next_out and avail_out
+ accordingly. This action is forced if the parameter flush is non zero.
+ Forcing flush frequently degrades the compression ratio, so this parameter
+ should be set only when necessary (in interactive applications). Some
+ output may be provided even if flush is not set.
+
+ Before the call of deflate(), the application should ensure that at least
+ one of the actions is possible, by providing more input and/or consuming more
+ output, and updating avail_in or avail_out accordingly; avail_out should
+ never be zero before the call. The application can consume the compressed
+ output when it wants, for example when the output buffer is full (avail_out
+ == 0), or after each call of deflate(). If deflate returns Z_OK and with
+ zero avail_out, it must be called again after making room in the output
+ buffer because there might be more output pending.
+
+ Normally the parameter flush is set to Z_NO_FLUSH, which allows deflate to
+ decide how much data to accumulate before producing output, in order to
+ maximize compression.
+
+ If the parameter flush is set to Z_SYNC_FLUSH, all pending output is
+ flushed to the output buffer and the output is aligned on a byte boundary, so
+ that the decompressor can get all input data available so far. (In
+ particular avail_in is zero after the call if enough output space has been
+ provided before the call.) Flushing may degrade compression for some
+ compression algorithms and so it should be used only when necessary. This
+ completes the current deflate block and follows it with an empty stored block
+ that is three bits plus filler bits to the next byte, followed by four bytes
+ (00 00 ff ff).
+
+ If flush is set to Z_PARTIAL_FLUSH, all pending output is flushed to the
+ output buffer, but the output is not aligned to a byte boundary. All of the
+ input data so far will be available to the decompressor, as for Z_SYNC_FLUSH.
+ This completes the current deflate block and follows it with an empty fixed
+ codes block that is 10 bits long. This assures that enough bytes are output
+ in order for the decompressor to finish the block before the empty fixed code
+ block.
+
+ If flush is set to Z_BLOCK, a deflate block is completed and emitted, as
+ for Z_SYNC_FLUSH, but the output is not aligned on a byte boundary, and up to
+ seven bits of the current block are held to be written as the next byte after
+ the next deflate block is completed. In this case, the decompressor may not
+ be provided enough bits at this point in order to complete decompression of
+ the data provided so far to the compressor. It may need to wait for the next
+ block to be emitted. This is for advanced applications that need to control
+ the emission of deflate blocks.
+
+ If flush is set to Z_FULL_FLUSH, all output is flushed as with
+ Z_SYNC_FLUSH, and the compression state is reset so that decompression can
+ restart from this point if previous compressed data has been damaged or if
+ random access is desired. Using Z_FULL_FLUSH too often can seriously degrade
+ compression.
+
+ If deflate returns with avail_out == 0, this function must be called again
+ with the same value of the flush parameter and more output space (updated
+ avail_out), until the flush is complete (deflate returns with non-zero
+ avail_out). In the case of a Z_FULL_FLUSH or Z_SYNC_FLUSH, make sure that
+ avail_out is greater than six to avoid repeated flush markers due to
+ avail_out == 0 on return.
+
+ If the parameter flush is set to Z_FINISH, pending input is processed,
+ pending output is flushed and deflate returns with Z_STREAM_END if there was
+ enough output space; if deflate returns with Z_OK, this function must be
+ called again with Z_FINISH and more output space (updated avail_out) but no
+ more input data, until it returns with Z_STREAM_END or an error. After
+ deflate has returned Z_STREAM_END, the only possible operations on the stream
+ are deflateReset or deflateEnd.
+
+ Z_FINISH can be used immediately after deflateInit if all the compression
+ is to be done in a single step. In this case, avail_out must be at least the
+ value returned by deflateBound (see below). Then deflate is guaranteed to
+ return Z_STREAM_END. If not enough output space is provided, deflate will
+ not return Z_STREAM_END, and it must be called again as described above.
+
+ deflate() sets strm->adler to the adler32 checksum of all input read
+ so far (that is, total_in bytes).
+
+ deflate() may update strm->data_type if it can make a good guess about
+ the input data type (Z_BINARY or Z_TEXT). In doubt, the data is considered
+ binary. This field is only for information purposes and does not affect the
+ compression algorithm in any manner.
+
+ deflate() returns Z_OK if some progress has been made (more input
+ processed or more output produced), Z_STREAM_END if all input has been
+ consumed and all output has been produced (only when flush is set to
+ Z_FINISH), Z_STREAM_ERROR if the stream state was inconsistent (for example
+ if next_in or next_out was Z_NULL), Z_BUF_ERROR if no progress is possible
+ (for example avail_in or avail_out was zero). Note that Z_BUF_ERROR is not
+ fatal, and deflate() can be called again with more input and more output
+ space to continue compressing.
+*/
+
+
+ZEXTERN int ZEXPORT deflateEnd OF((z_streamp strm));
+/*
+ All dynamically allocated data structures for this stream are freed.
+ This function discards any unprocessed input and does not flush any pending
+ output.
+
+ deflateEnd returns Z_OK if success, Z_STREAM_ERROR if the
+ stream state was inconsistent, Z_DATA_ERROR if the stream was freed
+ prematurely (some input or output was discarded). In the error case, msg
+ may be set but then points to a static string (which must not be
+ deallocated).
+*/
+
+
+/*
+ZEXTERN int ZEXPORT inflateInit OF((z_streamp strm));
+
+ Initializes the internal stream state for decompression. The fields
+ next_in, avail_in, zalloc, zfree and opaque must be initialized before by
+ the caller. If next_in is not Z_NULL and avail_in is large enough (the
+ exact value depends on the compression method), inflateInit determines the
+ compression method from the zlib header and allocates all data structures
+ accordingly; otherwise the allocation will be deferred to the first call of
+ inflate. If zalloc and zfree are set to Z_NULL, inflateInit updates them to
+ use default allocation functions.
+
+ inflateInit returns Z_OK if success, Z_MEM_ERROR if there was not enough
+ memory, Z_VERSION_ERROR if the zlib library version is incompatible with the
+ version assumed by the caller, or Z_STREAM_ERROR if the parameters are
+ invalid, such as a null pointer to the structure. msg is set to null if
+ there is no error message. inflateInit does not perform any decompression
+ apart from possibly reading the zlib header if present: actual decompression
+ will be done by inflate(). (So next_in and avail_in may be modified, but
+ next_out and avail_out are unused and unchanged.) The current implementation
+ of inflateInit() does not process any header information -- that is deferred
+ until inflate() is called.
+*/
+
+
+ZEXTERN int ZEXPORT inflate OF((z_streamp strm, int flush));
+/*
+ inflate decompresses as much data as possible, and stops when the input
+ buffer becomes empty or the output buffer becomes full. It may introduce
+ some output latency (reading input without producing any output) except when
+ forced to flush.
+
+ The detailed semantics are as follows. inflate performs one or both of the
+ following actions:
+
+ - Decompress more input starting at next_in and update next_in and avail_in
+ accordingly. If not all input can be processed (because there is not
+ enough room in the output buffer), next_in is updated and processing will
+ resume at this point for the next call of inflate().
+
+ - Provide more output starting at next_out and update next_out and avail_out
+ accordingly. inflate() provides as much output as possible, until there is
+ no more input data or no more space in the output buffer (see below about
+ the flush parameter).
+
+ Before the call of inflate(), the application should ensure that at least
+ one of the actions is possible, by providing more input and/or consuming more
+ output, and updating the next_* and avail_* values accordingly. The
+ application can consume the uncompressed output when it wants, for example
+ when the output buffer is full (avail_out == 0), or after each call of
+ inflate(). If inflate returns Z_OK and with zero avail_out, it must be
+ called again after making room in the output buffer because there might be
+ more output pending.
+
+ The flush parameter of inflate() can be Z_NO_FLUSH, Z_SYNC_FLUSH, Z_FINISH,
+ Z_BLOCK, or Z_TREES. Z_SYNC_FLUSH requests that inflate() flush as much
+ output as possible to the output buffer. Z_BLOCK requests that inflate()
+ stop if and when it gets to the next deflate block boundary. When decoding
+ the zlib or gzip format, this will cause inflate() to return immediately
+ after the header and before the first block. When doing a raw inflate,
+ inflate() will go ahead and process the first block, and will return when it
+ gets to the end of that block, or when it runs out of data.
+
+ The Z_BLOCK option assists in appending to or combining deflate streams.
+ Also to assist in this, on return inflate() will set strm->data_type to the
+ number of unused bits in the last byte taken from strm->next_in, plus 64 if
+ inflate() is currently decoding the last block in the deflate stream, plus
+ 128 if inflate() returned immediately after decoding an end-of-block code or
+ decoding the complete header up to just before the first byte of the deflate
+ stream. The end-of-block will not be indicated until all of the uncompressed
+ data from that block has been written to strm->next_out. The number of
+ unused bits may in general be greater than seven, except when bit 7 of
+ data_type is set, in which case the number of unused bits will be less than
+ eight. data_type is set as noted here every time inflate() returns for all
+ flush options, and so can be used to determine the amount of currently
+ consumed input in bits.
+
+ The Z_TREES option behaves as Z_BLOCK does, but it also returns when the
+ end of each deflate block header is reached, before any actual data in that
+ block is decoded. This allows the caller to determine the length of the
+ deflate block header for later use in random access within a deflate block.
+ 256 is added to the value of strm->data_type when inflate() returns
+ immediately after reaching the end of the deflate block header.
+
+ inflate() should normally be called until it returns Z_STREAM_END or an
+ error. However if all decompression is to be performed in a single step (a
+ single call of inflate), the parameter flush should be set to Z_FINISH. In
+ this case all pending input is processed and all pending output is flushed;
+ avail_out must be large enough to hold all of the uncompressed data for the
+ operation to complete. (The size of the uncompressed data may have been
+ saved by the compressor for this purpose.) The use of Z_FINISH is not
+ required to perform an inflation in one step. However it may be used to
+ inform inflate that a faster approach can be used for the single inflate()
+ call. Z_FINISH also informs inflate to not maintain a sliding window if the
+ stream completes, which reduces inflate's memory footprint. If the stream
+ does not complete, either because not all of the stream is provided or not
+ enough output space is provided, then a sliding window will be allocated and
+ inflate() can be called again to continue the operation as if Z_NO_FLUSH had
+ been used.
+
+ In this implementation, inflate() always flushes as much output as
+ possible to the output buffer, and always uses the faster approach on the
+ first call. So the effects of the flush parameter in this implementation are
+ on the return value of inflate() as noted below, when inflate() returns early
+ when Z_BLOCK or Z_TREES is used, and when inflate() avoids the allocation of
+ memory for a sliding window when Z_FINISH is used.
+
+ If a preset dictionary is needed after this call (see inflateSetDictionary
+ below), inflate sets strm->adler to the Adler-32 checksum of the dictionary
+ chosen by the compressor and returns Z_NEED_DICT; otherwise it sets
+ strm->adler to the Adler-32 checksum of all output produced so far (that is,
+ total_out bytes) and returns Z_OK, Z_STREAM_END or an error code as described
+ below. At the end of the stream, inflate() checks that its computed adler32
+ checksum is equal to that saved by the compressor and returns Z_STREAM_END
+ only if the checksum is correct.
+
+ inflate() can decompress and check either zlib-wrapped or gzip-wrapped
+ deflate data. The header type is detected automatically, if requested when
+ initializing with inflateInit2(). Any information contained in the gzip
+ header is not retained, so applications that need that information should
+ instead use raw inflate, see inflateInit2() below, or inflateBack() and
+ perform their own processing of the gzip header and trailer. When processing
+ gzip-wrapped deflate data, strm->adler32 is set to the CRC-32 of the output
+ producted so far. The CRC-32 is checked against the gzip trailer.
+
+ inflate() returns Z_OK if some progress has been made (more input processed
+ or more output produced), Z_STREAM_END if the end of the compressed data has
+ been reached and all uncompressed output has been produced, Z_NEED_DICT if a
+ preset dictionary is needed at this point, Z_DATA_ERROR if the input data was
+ corrupted (input stream not conforming to the zlib format or incorrect check
+ value), Z_STREAM_ERROR if the stream structure was inconsistent (for example
+ next_in or next_out was Z_NULL), Z_MEM_ERROR if there was not enough memory,
+ Z_BUF_ERROR if no progress is possible or if there was not enough room in the
+ output buffer when Z_FINISH is used. Note that Z_BUF_ERROR is not fatal, and
+ inflate() can be called again with more input and more output space to
+ continue decompressing. If Z_DATA_ERROR is returned, the application may
+ then call inflateSync() to look for a good compression block if a partial
+ recovery of the data is desired.
+*/
+
+
+ZEXTERN int ZEXPORT inflateEnd OF((z_streamp strm));
+/*
+ All dynamically allocated data structures for this stream are freed.
+ This function discards any unprocessed input and does not flush any pending
+ output.
+
+ inflateEnd returns Z_OK if success, Z_STREAM_ERROR if the stream state
+ was inconsistent. In the error case, msg may be set but then points to a
+ static string (which must not be deallocated).
+*/
+
+
+ /* Advanced functions */
+
+/*
+ The following functions are needed only in some special applications.
+*/
+
+/*
+ZEXTERN int ZEXPORT deflateInit2 OF((z_streamp strm,
+ int level,
+ int method,
+ int windowBits,
+ int memLevel,
+ int strategy));
+
+ This is another version of deflateInit with more compression options. The
+ fields next_in, zalloc, zfree and opaque must be initialized before by the
+ caller.
+
+ The method parameter is the compression method. It must be Z_DEFLATED in
+ this version of the library.
+
+ The windowBits parameter is the base two logarithm of the window size
+ (the size of the history buffer). It should be in the range 8..15 for this
+ version of the library. Larger values of this parameter result in better
+ compression at the expense of memory usage. The default value is 15 if
+ deflateInit is used instead.
+
+ windowBits can also be -8..-15 for raw deflate. In this case, -windowBits
+ determines the window size. deflate() will then generate raw deflate data
+ with no zlib header or trailer, and will not compute an adler32 check value.
+
+ windowBits can also be greater than 15 for optional gzip encoding. Add
+ 16 to windowBits to write a simple gzip header and trailer around the
+ compressed data instead of a zlib wrapper. The gzip header will have no
+ file name, no extra data, no comment, no modification time (set to zero), no
+ header crc, and the operating system will be set to 255 (unknown). If a
+ gzip stream is being written, strm->adler is a crc32 instead of an adler32.
+
+ The memLevel parameter specifies how much memory should be allocated
+ for the internal compression state. memLevel=1 uses minimum memory but is
+ slow and reduces compression ratio; memLevel=9 uses maximum memory for
+ optimal speed. The default value is 8. See zconf.h for total memory usage
+ as a function of windowBits and memLevel.
+
+ The strategy parameter is used to tune the compression algorithm. Use the
+ value Z_DEFAULT_STRATEGY for normal data, Z_FILTERED for data produced by a
+ filter (or predictor), Z_HUFFMAN_ONLY to force Huffman encoding only (no
+ string match), or Z_RLE to limit match distances to one (run-length
+ encoding). Filtered data consists mostly of small values with a somewhat
+ random distribution. In this case, the compression algorithm is tuned to
+ compress them better. The effect of Z_FILTERED is to force more Huffman
+ coding and less string matching; it is somewhat intermediate between
+ Z_DEFAULT_STRATEGY and Z_HUFFMAN_ONLY. Z_RLE is designed to be almost as
+ fast as Z_HUFFMAN_ONLY, but give better compression for PNG image data. The
+ strategy parameter only affects the compression ratio but not the
+ correctness of the compressed output even if it is not set appropriately.
+ Z_FIXED prevents the use of dynamic Huffman codes, allowing for a simpler
+ decoder for special applications.
+
+ deflateInit2 returns Z_OK if success, Z_MEM_ERROR if there was not enough
+ memory, Z_STREAM_ERROR if any parameter is invalid (such as an invalid
+ method), or Z_VERSION_ERROR if the zlib library version (zlib_version) is
+ incompatible with the version assumed by the caller (ZLIB_VERSION). msg is
+ set to null if there is no error message. deflateInit2 does not perform any
+ compression: this will be done by deflate().
+*/
+
+ZEXTERN int ZEXPORT deflateSetDictionary OF((z_streamp strm,
+ const Bytef *dictionary,
+ uInt dictLength));
+/*
+ Initializes the compression dictionary from the given byte sequence
+ without producing any compressed output. When using the zlib format, this
+ function must be called immediately after deflateInit, deflateInit2 or
+ deflateReset, and before any call of deflate. When doing raw deflate, this
+ function must be called either before any call of deflate, or immediately
+ after the completion of a deflate block, i.e. after all input has been
+ consumed and all output has been delivered when using any of the flush
+ options Z_BLOCK, Z_PARTIAL_FLUSH, Z_SYNC_FLUSH, or Z_FULL_FLUSH. The
+ compressor and decompressor must use exactly the same dictionary (see
+ inflateSetDictionary).
+
+ The dictionary should consist of strings (byte sequences) that are likely
+ to be encountered later in the data to be compressed, with the most commonly
+ used strings preferably put towards the end of the dictionary. Using a
+ dictionary is most useful when the data to be compressed is short and can be
+ predicted with good accuracy; the data can then be compressed better than
+ with the default empty dictionary.
+
+ Depending on the size of the compression data structures selected by
+ deflateInit or deflateInit2, a part of the dictionary may in effect be
+ discarded, for example if the dictionary is larger than the window size
+ provided in deflateInit or deflateInit2. Thus the strings most likely to be
+ useful should be put at the end of the dictionary, not at the front. In
+ addition, the current implementation of deflate will use at most the window
+ size minus 262 bytes of the provided dictionary.
+
+ Upon return of this function, strm->adler is set to the adler32 value
+ of the dictionary; the decompressor may later use this value to determine
+ which dictionary has been used by the compressor. (The adler32 value
+ applies to the whole dictionary even if only a subset of the dictionary is
+ actually used by the compressor.) If a raw deflate was requested, then the
+ adler32 value is not computed and strm->adler is not set.
+
+ deflateSetDictionary returns Z_OK if success, or Z_STREAM_ERROR if a
+ parameter is invalid (e.g. dictionary being Z_NULL) or the stream state is
+ inconsistent (for example if deflate has already been called for this stream
+ or if not at a block boundary for raw deflate). deflateSetDictionary does
+ not perform any compression: this will be done by deflate().
+*/
+
+ZEXTERN int ZEXPORT deflateCopy OF((z_streamp dest,
+ z_streamp source));
+/*
+ Sets the destination stream as a complete copy of the source stream.
+
+ This function can be useful when several compression strategies will be
+ tried, for example when there are several ways of pre-processing the input
+ data with a filter. The streams that will be discarded should then be freed
+ by calling deflateEnd. Note that deflateCopy duplicates the internal
+ compression state which can be quite large, so this strategy is slow and can
+ consume lots of memory.
+
+ deflateCopy returns Z_OK if success, Z_MEM_ERROR if there was not
+ enough memory, Z_STREAM_ERROR if the source stream state was inconsistent
+ (such as zalloc being Z_NULL). msg is left unchanged in both source and
+ destination.
+*/
+
+ZEXTERN int ZEXPORT deflateReset OF((z_streamp strm));
+/*
+ This function is equivalent to deflateEnd followed by deflateInit,
+ but does not free and reallocate all the internal compression state. The
+ stream will keep the same compression level and any other attributes that
+ may have been set by deflateInit2.
+
+ deflateReset returns Z_OK if success, or Z_STREAM_ERROR if the source
+ stream state was inconsistent (such as zalloc or state being Z_NULL).
+*/
+
+ZEXTERN int ZEXPORT deflateParams OF((z_streamp strm,
+ int level,
+ int strategy));
+/*
+ Dynamically update the compression level and compression strategy. The
+ interpretation of level and strategy is as in deflateInit2. This can be
+ used to switch between compression and straight copy of the input data, or
+ to switch to a different kind of input data requiring a different strategy.
+ If the compression level is changed, the input available so far is
+ compressed with the old level (and may be flushed); the new level will take
+ effect only at the next call of deflate().
+
+ Before the call of deflateParams, the stream state must be set as for
+ a call of deflate(), since the currently available input may have to be
+ compressed and flushed. In particular, strm->avail_out must be non-zero.
+
+ deflateParams returns Z_OK if success, Z_STREAM_ERROR if the source
+ stream state was inconsistent or if a parameter was invalid, Z_BUF_ERROR if
+ strm->avail_out was zero.
+*/
+
+ZEXTERN int ZEXPORT deflateTune OF((z_streamp strm,
+ int good_length,
+ int max_lazy,
+ int nice_length,
+ int max_chain));
+/*
+ Fine tune deflate's internal compression parameters. This should only be
+ used by someone who understands the algorithm used by zlib's deflate for
+ searching for the best matching string, and even then only by the most
+ fanatic optimizer trying to squeeze out the last compressed bit for their
+ specific input data. Read the deflate.c source code for the meaning of the
+ max_lazy, good_length, nice_length, and max_chain parameters.
+
+ deflateTune() can be called after deflateInit() or deflateInit2(), and
+ returns Z_OK on success, or Z_STREAM_ERROR for an invalid deflate stream.
+ */
+
+ZEXTERN uLong ZEXPORT deflateBound OF((z_streamp strm,
+ uLong sourceLen));
+/*
+ deflateBound() returns an upper bound on the compressed size after
+ deflation of sourceLen bytes. It must be called after deflateInit() or
+ deflateInit2(), and after deflateSetHeader(), if used. This would be used
+ to allocate an output buffer for deflation in a single pass, and so would be
+ called before deflate(). If that first deflate() call is provided the
+ sourceLen input bytes, an output buffer allocated to the size returned by
+ deflateBound(), and the flush value Z_FINISH, then deflate() is guaranteed
+ to return Z_STREAM_END. Note that it is possible for the compressed size to
+ be larger than the value returned by deflateBound() if flush options other
+ than Z_FINISH or Z_NO_FLUSH are used.
+*/
+
+ZEXTERN int ZEXPORT deflatePending OF((z_streamp strm,
+ unsigned *pending,
+ int *bits));
+/*
+ deflatePending() returns the number of bytes and bits of output that have
+ been generated, but not yet provided in the available output. The bytes not
+ provided would be due to the available output space having being consumed.
+ The number of bits of output not provided are between 0 and 7, where they
+ await more bits to join them in order to fill out a full byte. If pending
+ or bits are Z_NULL, then those values are not set.
+
+ deflatePending returns Z_OK if success, or Z_STREAM_ERROR if the source
+ stream state was inconsistent.
+ */
+
+ZEXTERN int ZEXPORT deflatePrime OF((z_streamp strm,
+ int bits,
+ int value));
+/*
+ deflatePrime() inserts bits in the deflate output stream. The intent
+ is that this function is used to start off the deflate output with the bits
+ leftover from a previous deflate stream when appending to it. As such, this
+ function can only be used for raw deflate, and must be used before the first
+ deflate() call after a deflateInit2() or deflateReset(). bits must be less
+ than or equal to 16, and that many of the least significant bits of value
+ will be inserted in the output.
+
+ deflatePrime returns Z_OK if success, Z_BUF_ERROR if there was not enough
+ room in the internal buffer to insert the bits, or Z_STREAM_ERROR if the
+ source stream state was inconsistent.
+*/
+
+ZEXTERN int ZEXPORT deflateSetHeader OF((z_streamp strm,
+ gz_headerp head));
+/*
+ deflateSetHeader() provides gzip header information for when a gzip
+ stream is requested by deflateInit2(). deflateSetHeader() may be called
+ after deflateInit2() or deflateReset() and before the first call of
+ deflate(). The text, time, os, extra field, name, and comment information
+ in the provided gz_header structure are written to the gzip header (xflag is
+ ignored -- the extra flags are set according to the compression level). The
+ caller must assure that, if not Z_NULL, name and comment are terminated with
+ a zero byte, and that if extra is not Z_NULL, that extra_len bytes are
+ available there. If hcrc is true, a gzip header crc is included. Note that
+ the current versions of the command-line version of gzip (up through version
+ 1.3.x) do not support header crc's, and will report that it is a "multi-part
+ gzip file" and give up.
+
+ If deflateSetHeader is not used, the default gzip header has text false,
+ the time set to zero, and os set to 255, with no extra, name, or comment
+ fields. The gzip header is returned to the default state by deflateReset().
+
+ deflateSetHeader returns Z_OK if success, or Z_STREAM_ERROR if the source
+ stream state was inconsistent.
+*/
+
+/*
+ZEXTERN int ZEXPORT inflateInit2 OF((z_streamp strm,
+ int windowBits));
+
+ This is another version of inflateInit with an extra parameter. The
+ fields next_in, avail_in, zalloc, zfree and opaque must be initialized
+ before by the caller.
+
+ The windowBits parameter is the base two logarithm of the maximum window
+ size (the size of the history buffer). It should be in the range 8..15 for
+ this version of the library. The default value is 15 if inflateInit is used
+ instead. windowBits must be greater than or equal to the windowBits value
+ provided to deflateInit2() while compressing, or it must be equal to 15 if
+ deflateInit2() was not used. If a compressed stream with a larger window
+ size is given as input, inflate() will return with the error code
+ Z_DATA_ERROR instead of trying to allocate a larger window.
+
+ windowBits can also be zero to request that inflate use the window size in
+ the zlib header of the compressed stream.
+
+ windowBits can also be -8..-15 for raw inflate. In this case, -windowBits
+ determines the window size. inflate() will then process raw deflate data,
+ not looking for a zlib or gzip header, not generating a check value, and not
+ looking for any check values for comparison at the end of the stream. This
+ is for use with other formats that use the deflate compressed data format
+ such as zip. Those formats provide their own check values. If a custom
+ format is developed using the raw deflate format for compressed data, it is
+ recommended that a check value such as an adler32 or a crc32 be applied to
+ the uncompressed data as is done in the zlib, gzip, and zip formats. For
+ most applications, the zlib format should be used as is. Note that comments
+ above on the use in deflateInit2() applies to the magnitude of windowBits.
+
+ windowBits can also be greater than 15 for optional gzip decoding. Add
+ 32 to windowBits to enable zlib and gzip decoding with automatic header
+ detection, or add 16 to decode only the gzip format (the zlib format will
+ return a Z_DATA_ERROR). If a gzip stream is being decoded, strm->adler is a
+ crc32 instead of an adler32.
+
+ inflateInit2 returns Z_OK if success, Z_MEM_ERROR if there was not enough
+ memory, Z_VERSION_ERROR if the zlib library version is incompatible with the
+ version assumed by the caller, or Z_STREAM_ERROR if the parameters are
+ invalid, such as a null pointer to the structure. msg is set to null if
+ there is no error message. inflateInit2 does not perform any decompression
+ apart from possibly reading the zlib header if present: actual decompression
+ will be done by inflate(). (So next_in and avail_in may be modified, but
+ next_out and avail_out are unused and unchanged.) The current implementation
+ of inflateInit2() does not process any header information -- that is
+ deferred until inflate() is called.
+*/
+
+ZEXTERN int ZEXPORT inflateSetDictionary OF((z_streamp strm,
+ const Bytef *dictionary,
+ uInt dictLength));
+/*
+ Initializes the decompression dictionary from the given uncompressed byte
+ sequence. This function must be called immediately after a call of inflate,
+ if that call returned Z_NEED_DICT. The dictionary chosen by the compressor
+ can be determined from the adler32 value returned by that call of inflate.
+ The compressor and decompressor must use exactly the same dictionary (see
+ deflateSetDictionary). For raw inflate, this function can be called at any
+ time to set the dictionary. If the provided dictionary is smaller than the
+ window and there is already data in the window, then the provided dictionary
+ will amend what's there. The application must insure that the dictionary
+ that was used for compression is provided.
+
+ inflateSetDictionary returns Z_OK if success, Z_STREAM_ERROR if a
+ parameter is invalid (e.g. dictionary being Z_NULL) or the stream state is
+ inconsistent, Z_DATA_ERROR if the given dictionary doesn't match the
+ expected one (incorrect adler32 value). inflateSetDictionary does not
+ perform any decompression: this will be done by subsequent calls of
+ inflate().
+*/
+
+ZEXTERN int ZEXPORT inflateGetDictionary OF((z_streamp strm,
+ Bytef *dictionary,
+ uInt *dictLength));
+/*
+ Returns the sliding dictionary being maintained by inflate. dictLength is
+ set to the number of bytes in the dictionary, and that many bytes are copied
+ to dictionary. dictionary must have enough space, where 32768 bytes is
+ always enough. If inflateGetDictionary() is called with dictionary equal to
+ Z_NULL, then only the dictionary length is returned, and nothing is copied.
+ Similary, if dictLength is Z_NULL, then it is not set.
+
+ inflateGetDictionary returns Z_OK on success, or Z_STREAM_ERROR if the
+ stream state is inconsistent.
+*/
+
+ZEXTERN int ZEXPORT inflateSync OF((z_streamp strm));
+/*
+ Skips invalid compressed data until a possible full flush point (see above
+ for the description of deflate with Z_FULL_FLUSH) can be found, or until all
+ available input is skipped. No output is provided.
+
+ inflateSync searches for a 00 00 FF FF pattern in the compressed data.
+ All full flush points have this pattern, but not all occurrences of this
+ pattern are full flush points.
+
+ inflateSync returns Z_OK if a possible full flush point has been found,
+ Z_BUF_ERROR if no more input was provided, Z_DATA_ERROR if no flush point
+ has been found, or Z_STREAM_ERROR if the stream structure was inconsistent.
+ In the success case, the application may save the current current value of
+ total_in which indicates where valid compressed data was found. In the
+ error case, the application may repeatedly call inflateSync, providing more
+ input each time, until success or end of the input data.
+*/
+
+ZEXTERN int ZEXPORT inflateCopy OF((z_streamp dest,
+ z_streamp source));
+/*
+ Sets the destination stream as a complete copy of the source stream.
+
+ This function can be useful when randomly accessing a large stream. The
+ first pass through the stream can periodically record the inflate state,
+ allowing restarting inflate at those points when randomly accessing the
+ stream.
+
+ inflateCopy returns Z_OK if success, Z_MEM_ERROR if there was not
+ enough memory, Z_STREAM_ERROR if the source stream state was inconsistent
+ (such as zalloc being Z_NULL). msg is left unchanged in both source and
+ destination.
+*/
+
+ZEXTERN int ZEXPORT inflateReset OF((z_streamp strm));
+/*
+ This function is equivalent to inflateEnd followed by inflateInit,
+ but does not free and reallocate all the internal decompression state. The
+ stream will keep attributes that may have been set by inflateInit2.
+
+ inflateReset returns Z_OK if success, or Z_STREAM_ERROR if the source
+ stream state was inconsistent (such as zalloc or state being Z_NULL).
+*/
+
+ZEXTERN int ZEXPORT inflateReset2 OF((z_streamp strm,
+ int windowBits));
+/*
+ This function is the same as inflateReset, but it also permits changing
+ the wrap and window size requests. The windowBits parameter is interpreted
+ the same as it is for inflateInit2.
+
+ inflateReset2 returns Z_OK if success, or Z_STREAM_ERROR if the source
+ stream state was inconsistent (such as zalloc or state being Z_NULL), or if
+ the windowBits parameter is invalid.
+*/
+
+ZEXTERN int ZEXPORT inflatePrime OF((z_streamp strm,
+ int bits,
+ int value));
+/*
+ This function inserts bits in the inflate input stream. The intent is
+ that this function is used to start inflating at a bit position in the
+ middle of a byte. The provided bits will be used before any bytes are used
+ from next_in. This function should only be used with raw inflate, and
+ should be used before the first inflate() call after inflateInit2() or
+ inflateReset(). bits must be less than or equal to 16, and that many of the
+ least significant bits of value will be inserted in the input.
+
+ If bits is negative, then the input stream bit buffer is emptied. Then
+ inflatePrime() can be called again to put bits in the buffer. This is used
+ to clear out bits leftover after feeding inflate a block description prior
+ to feeding inflate codes.
+
+ inflatePrime returns Z_OK if success, or Z_STREAM_ERROR if the source
+ stream state was inconsistent.
+*/
+
+ZEXTERN long ZEXPORT inflateMark OF((z_streamp strm));
+/*
+ This function returns two values, one in the lower 16 bits of the return
+ value, and the other in the remaining upper bits, obtained by shifting the
+ return value down 16 bits. If the upper value is -1 and the lower value is
+ zero, then inflate() is currently decoding information outside of a block.
+ If the upper value is -1 and the lower value is non-zero, then inflate is in
+ the middle of a stored block, with the lower value equaling the number of
+ bytes from the input remaining to copy. If the upper value is not -1, then
+ it is the number of bits back from the current bit position in the input of
+ the code (literal or length/distance pair) currently being processed. In
+ that case the lower value is the number of bytes already emitted for that
+ code.
+
+ A code is being processed if inflate is waiting for more input to complete
+ decoding of the code, or if it has completed decoding but is waiting for
+ more output space to write the literal or match data.
+
+ inflateMark() is used to mark locations in the input data for random
+ access, which may be at bit positions, and to note those cases where the
+ output of a code may span boundaries of random access blocks. The current
+ location in the input stream can be determined from avail_in and data_type
+ as noted in the description for the Z_BLOCK flush parameter for inflate.
+
+ inflateMark returns the value noted above or -1 << 16 if the provided
+ source stream state was inconsistent.
+*/
+
+ZEXTERN int ZEXPORT inflateGetHeader OF((z_streamp strm,
+ gz_headerp head));
+/*
+ inflateGetHeader() requests that gzip header information be stored in the
+ provided gz_header structure. inflateGetHeader() may be called after
+ inflateInit2() or inflateReset(), and before the first call of inflate().
+ As inflate() processes the gzip stream, head->done is zero until the header
+ is completed, at which time head->done is set to one. If a zlib stream is
+ being decoded, then head->done is set to -1 to indicate that there will be
+ no gzip header information forthcoming. Note that Z_BLOCK or Z_TREES can be
+ used to force inflate() to return immediately after header processing is
+ complete and before any actual data is decompressed.
+
+ The text, time, xflags, and os fields are filled in with the gzip header
+ contents. hcrc is set to true if there is a header CRC. (The header CRC
+ was valid if done is set to one.) If extra is not Z_NULL, then extra_max
+ contains the maximum number of bytes to write to extra. Once done is true,
+ extra_len contains the actual extra field length, and extra contains the
+ extra field, or that field truncated if extra_max is less than extra_len.
+ If name is not Z_NULL, then up to name_max characters are written there,
+ terminated with a zero unless the length is greater than name_max. If
+ comment is not Z_NULL, then up to comm_max characters are written there,
+ terminated with a zero unless the length is greater than comm_max. When any
+ of extra, name, or comment are not Z_NULL and the respective field is not
+ present in the header, then that field is set to Z_NULL to signal its
+ absence. This allows the use of deflateSetHeader() with the returned
+ structure to duplicate the header. However if those fields are set to
+ allocated memory, then the application will need to save those pointers
+ elsewhere so that they can be eventually freed.
+
+ If inflateGetHeader is not used, then the header information is simply
+ discarded. The header is always checked for validity, including the header
+ CRC if present. inflateReset() will reset the process to discard the header
+ information. The application would need to call inflateGetHeader() again to
+ retrieve the header from the next gzip stream.
+
+ inflateGetHeader returns Z_OK if success, or Z_STREAM_ERROR if the source
+ stream state was inconsistent.
+*/
+
+/*
+ZEXTERN int ZEXPORT inflateBackInit OF((z_streamp strm, int windowBits,
+ unsigned char FAR *window));
+
+ Initialize the internal stream state for decompression using inflateBack()
+ calls. The fields zalloc, zfree and opaque in strm must be initialized
+ before the call. If zalloc and zfree are Z_NULL, then the default library-
+ derived memory allocation routines are used. windowBits is the base two
+ logarithm of the window size, in the range 8..15. window is a caller
+ supplied buffer of that size. Except for special applications where it is
+ assured that deflate was used with small window sizes, windowBits must be 15
+ and a 32K byte window must be supplied to be able to decompress general
+ deflate streams.
+
+ See inflateBack() for the usage of these routines.
+
+ inflateBackInit will return Z_OK on success, Z_STREAM_ERROR if any of
+ the parameters are invalid, Z_MEM_ERROR if the internal state could not be
+ allocated, or Z_VERSION_ERROR if the version of the library does not match
+ the version of the header file.
+*/
+
+typedef unsigned (*in_func) OF((void FAR *,
+ z_const unsigned char FAR * FAR *));
+typedef int (*out_func) OF((void FAR *, unsigned char FAR *, unsigned));
+
+ZEXTERN int ZEXPORT inflateBack OF((z_streamp strm,
+ in_func in, void FAR *in_desc,
+ out_func out, void FAR *out_desc));
+/*
+ inflateBack() does a raw inflate with a single call using a call-back
+ interface for input and output. This is potentially more efficient than
+ inflate() for file i/o applications, in that it avoids copying between the
+ output and the sliding window by simply making the window itself the output
+ buffer. inflate() can be faster on modern CPUs when used with large
+ buffers. inflateBack() trusts the application to not change the output
+ buffer passed by the output function, at least until inflateBack() returns.
+
+ inflateBackInit() must be called first to allocate the internal state
+ and to initialize the state with the user-provided window buffer.
+ inflateBack() may then be used multiple times to inflate a complete, raw
+ deflate stream with each call. inflateBackEnd() is then called to free the
+ allocated state.
+
+ A raw deflate stream is one with no zlib or gzip header or trailer.
+ This routine would normally be used in a utility that reads zip or gzip
+ files and writes out uncompressed files. The utility would decode the
+ header and process the trailer on its own, hence this routine expects only
+ the raw deflate stream to decompress. This is different from the normal
+ behavior of inflate(), which expects either a zlib or gzip header and
+ trailer around the deflate stream.
+
+ inflateBack() uses two subroutines supplied by the caller that are then
+ called by inflateBack() for input and output. inflateBack() calls those
+ routines until it reads a complete deflate stream and writes out all of the
+ uncompressed data, or until it encounters an error. The function's
+ parameters and return types are defined above in the in_func and out_func
+ typedefs. inflateBack() will call in(in_desc, &buf) which should return the
+ number of bytes of provided input, and a pointer to that input in buf. If
+ there is no input available, in() must return zero--buf is ignored in that
+ case--and inflateBack() will return a buffer error. inflateBack() will call
+ out(out_desc, buf, len) to write the uncompressed data buf[0..len-1]. out()
+ should return zero on success, or non-zero on failure. If out() returns
+ non-zero, inflateBack() will return with an error. Neither in() nor out()
+ are permitted to change the contents of the window provided to
+ inflateBackInit(), which is also the buffer that out() uses to write from.
+ The length written by out() will be at most the window size. Any non-zero
+ amount of input may be provided by in().
+
+ For convenience, inflateBack() can be provided input on the first call by
+ setting strm->next_in and strm->avail_in. If that input is exhausted, then
+ in() will be called. Therefore strm->next_in must be initialized before
+ calling inflateBack(). If strm->next_in is Z_NULL, then in() will be called
+ immediately for input. If strm->next_in is not Z_NULL, then strm->avail_in
+ must also be initialized, and then if strm->avail_in is not zero, input will
+ initially be taken from strm->next_in[0 .. strm->avail_in - 1].
+
+ The in_desc and out_desc parameters of inflateBack() is passed as the
+ first parameter of in() and out() respectively when they are called. These
+ descriptors can be optionally used to pass any information that the caller-
+ supplied in() and out() functions need to do their job.
+
+ On return, inflateBack() will set strm->next_in and strm->avail_in to
+ pass back any unused input that was provided by the last in() call. The
+ return values of inflateBack() can be Z_STREAM_END on success, Z_BUF_ERROR
+ if in() or out() returned an error, Z_DATA_ERROR if there was a format error
+ in the deflate stream (in which case strm->msg is set to indicate the nature
+ of the error), or Z_STREAM_ERROR if the stream was not properly initialized.
+ In the case of Z_BUF_ERROR, an input or output error can be distinguished
+ using strm->next_in which will be Z_NULL only if in() returned an error. If
+ strm->next_in is not Z_NULL, then the Z_BUF_ERROR was due to out() returning
+ non-zero. (in() will always be called before out(), so strm->next_in is
+ assured to be defined if out() returns non-zero.) Note that inflateBack()
+ cannot return Z_OK.
+*/
+
+ZEXTERN int ZEXPORT inflateBackEnd OF((z_streamp strm));
+/*
+ All memory allocated by inflateBackInit() is freed.
+
+ inflateBackEnd() returns Z_OK on success, or Z_STREAM_ERROR if the stream
+ state was inconsistent.
+*/
+
+ZEXTERN uLong ZEXPORT zlibCompileFlags OF((void));
+/* Return flags indicating compile-time options.
+
+ Type sizes, two bits each, 00 = 16 bits, 01 = 32, 10 = 64, 11 = other:
+ 1.0: size of uInt
+ 3.2: size of uLong
+ 5.4: size of voidpf (pointer)
+ 7.6: size of z_off_t
+
+ Compiler, assembler, and debug options:
+ 8: DEBUG
+ 9: ASMV or ASMINF -- use ASM code
+ 10: ZLIB_WINAPI -- exported functions use the WINAPI calling convention
+ 11: 0 (reserved)
+
+ One-time table building (smaller code, but not thread-safe if true):
+ 12: BUILDFIXED -- build static block decoding tables when needed
+ 13: DYNAMIC_CRC_TABLE -- build CRC calculation tables when needed
+ 14,15: 0 (reserved)
+
+ Library content (indicates missing functionality):
+ 16: NO_GZCOMPRESS -- gz* functions cannot compress (to avoid linking
+ deflate code when not needed)
+ 17: NO_GZIP -- deflate can't write gzip streams, and inflate can't detect
+ and decode gzip streams (to avoid linking crc code)
+ 18-19: 0 (reserved)
+
+ Operation variations (changes in library functionality):
+ 20: PKZIP_BUG_WORKAROUND -- slightly more permissive inflate
+ 21: FASTEST -- deflate algorithm with only one, lowest compression level
+ 22,23: 0 (reserved)
+
+ The sprintf variant used by gzprintf (zero is best):
+ 24: 0 = vs*, 1 = s* -- 1 means limited to 20 arguments after the format
+ 25: 0 = *nprintf, 1 = *printf -- 1 means gzprintf() not secure!
+ 26: 0 = returns value, 1 = void -- 1 means inferred string length returned
+
+ Remainder:
+ 27-31: 0 (reserved)
+ */
+
+#ifndef Z_SOLO
+
+ /* utility functions */
+
+/*
+ The following utility functions are implemented on top of the basic
+ stream-oriented functions. To simplify the interface, some default options
+ are assumed (compression level and memory usage, standard memory allocation
+ functions). The source code of these utility functions can be modified if
+ you need special options.
+*/
+
+ZEXTERN int ZEXPORT compress OF((Bytef *dest, uLongf *destLen,
+ const Bytef *source, uLong sourceLen));
+/*
+ Compresses the source buffer into the destination buffer. sourceLen is
+ the byte length of the source buffer. Upon entry, destLen is the total size
+ of the destination buffer, which must be at least the value returned by
+ compressBound(sourceLen). Upon exit, destLen is the actual size of the
+ compressed buffer.
+
+ compress returns Z_OK if success, Z_MEM_ERROR if there was not
+ enough memory, Z_BUF_ERROR if there was not enough room in the output
+ buffer.
+*/
+
+ZEXTERN int ZEXPORT compress2 OF((Bytef *dest, uLongf *destLen,
+ const Bytef *source, uLong sourceLen,
+ int level));
+/*
+ Compresses the source buffer into the destination buffer. The level
+ parameter has the same meaning as in deflateInit. sourceLen is the byte
+ length of the source buffer. Upon entry, destLen is the total size of the
+ destination buffer, which must be at least the value returned by
+ compressBound(sourceLen). Upon exit, destLen is the actual size of the
+ compressed buffer.
+
+ compress2 returns Z_OK if success, Z_MEM_ERROR if there was not enough
+ memory, Z_BUF_ERROR if there was not enough room in the output buffer,
+ Z_STREAM_ERROR if the level parameter is invalid.
+*/
+
+ZEXTERN uLong ZEXPORT compressBound OF((uLong sourceLen));
+/*
+ compressBound() returns an upper bound on the compressed size after
+ compress() or compress2() on sourceLen bytes. It would be used before a
+ compress() or compress2() call to allocate the destination buffer.
+*/
+
+ZEXTERN int ZEXPORT uncompress OF((Bytef *dest, uLongf *destLen,
+ const Bytef *source, uLong sourceLen));
+/*
+ Decompresses the source buffer into the destination buffer. sourceLen is
+ the byte length of the source buffer. Upon entry, destLen is the total size
+ of the destination buffer, which must be large enough to hold the entire
+ uncompressed data. (The size of the uncompressed data must have been saved
+ previously by the compressor and transmitted to the decompressor by some
+ mechanism outside the scope of this compression library.) Upon exit, destLen
+ is the actual size of the uncompressed buffer.
+
+ uncompress returns Z_OK if success, Z_MEM_ERROR if there was not
+ enough memory, Z_BUF_ERROR if there was not enough room in the output
+ buffer, or Z_DATA_ERROR if the input data was corrupted or incomplete. In
+ the case where there is not enough room, uncompress() will fill the output
+ buffer with the uncompressed data up to that point.
+*/
+
+ /* gzip file access functions */
+
+/*
+ This library supports reading and writing files in gzip (.gz) format with
+ an interface similar to that of stdio, using the functions that start with
+ "gz". The gzip format is different from the zlib format. gzip is a gzip
+ wrapper, documented in RFC 1952, wrapped around a deflate stream.
+*/
+
+typedef struct gzFile_s *gzFile; /* semi-opaque gzip file descriptor */
+
+/*
+ZEXTERN gzFile ZEXPORT gzopen OF((const char *path, const char *mode));
+
+ Opens a gzip (.gz) file for reading or writing. The mode parameter is as
+ in fopen ("rb" or "wb") but can also include a compression level ("wb9") or
+ a strategy: 'f' for filtered data as in "wb6f", 'h' for Huffman-only
+ compression as in "wb1h", 'R' for run-length encoding as in "wb1R", or 'F'
+ for fixed code compression as in "wb9F". (See the description of
+ deflateInit2 for more information about the strategy parameter.) 'T' will
+ request transparent writing or appending with no compression and not using
+ the gzip format.
+
+ "a" can be used instead of "w" to request that the gzip stream that will
+ be written be appended to the file. "+" will result in an error, since
+ reading and writing to the same gzip file is not supported. The addition of
+ "x" when writing will create the file exclusively, which fails if the file
+ already exists. On systems that support it, the addition of "e" when
+ reading or writing will set the flag to close the file on an execve() call.
+
+ These functions, as well as gzip, will read and decode a sequence of gzip
+ streams in a file. The append function of gzopen() can be used to create
+ such a file. (Also see gzflush() for another way to do this.) When
+ appending, gzopen does not test whether the file begins with a gzip stream,
+ nor does it look for the end of the gzip streams to begin appending. gzopen
+ will simply append a gzip stream to the existing file.
+
+ gzopen can be used to read a file which is not in gzip format; in this
+ case gzread will directly read from the file without decompression. When
+ reading, this will be detected automatically by looking for the magic two-
+ byte gzip header.
+
+ gzopen returns NULL if the file could not be opened, if there was
+ insufficient memory to allocate the gzFile state, or if an invalid mode was
+ specified (an 'r', 'w', or 'a' was not provided, or '+' was provided).
+ errno can be checked to determine if the reason gzopen failed was that the
+ file could not be opened.
+*/
+
+ZEXTERN gzFile ZEXPORT gzdopen OF((int fd, const char *mode));
+/*
+ gzdopen associates a gzFile with the file descriptor fd. File descriptors
+ are obtained from calls like open, dup, creat, pipe or fileno (if the file
+ has been previously opened with fopen). The mode parameter is as in gzopen.
+
+ The next call of gzclose on the returned gzFile will also close the file
+ descriptor fd, just like fclose(fdopen(fd, mode)) closes the file descriptor
+ fd. If you want to keep fd open, use fd = dup(fd_keep); gz = gzdopen(fd,
+ mode);. The duplicated descriptor should be saved to avoid a leak, since
+ gzdopen does not close fd if it fails. If you are using fileno() to get the
+ file descriptor from a FILE *, then you will have to use dup() to avoid
+ double-close()ing the file descriptor. Both gzclose() and fclose() will
+ close the associated file descriptor, so they need to have different file
+ descriptors.
+
+ gzdopen returns NULL if there was insufficient memory to allocate the
+ gzFile state, if an invalid mode was specified (an 'r', 'w', or 'a' was not
+ provided, or '+' was provided), or if fd is -1. The file descriptor is not
+ used until the next gz* read, write, seek, or close operation, so gzdopen
+ will not detect if fd is invalid (unless fd is -1).
+*/
+
+ZEXTERN int ZEXPORT gzbuffer OF((gzFile file, unsigned size));
+/*
+ Set the internal buffer size used by this library's functions. The
+ default buffer size is 8192 bytes. This function must be called after
+ gzopen() or gzdopen(), and before any other calls that read or write the
+ file. The buffer memory allocation is always deferred to the first read or
+ write. Two buffers are allocated, either both of the specified size when
+ writing, or one of the specified size and the other twice that size when
+ reading. A larger buffer size of, for example, 64K or 128K bytes will
+ noticeably increase the speed of decompression (reading).
+
+ The new buffer size also affects the maximum length for gzprintf().
+
+ gzbuffer() returns 0 on success, or -1 on failure, such as being called
+ too late.
+*/
+
+ZEXTERN int ZEXPORT gzsetparams OF((gzFile file, int level, int strategy));
+/*
+ Dynamically update the compression level or strategy. See the description
+ of deflateInit2 for the meaning of these parameters.
+
+ gzsetparams returns Z_OK if success, or Z_STREAM_ERROR if the file was not
+ opened for writing.
+*/
+
+ZEXTERN int ZEXPORT gzread OF((gzFile file, voidp buf, unsigned len));
+/*
+ Reads the given number of uncompressed bytes from the compressed file. If
+ the input file is not in gzip format, gzread copies the given number of
+ bytes into the buffer directly from the file.
+
+ After reaching the end of a gzip stream in the input, gzread will continue
+ to read, looking for another gzip stream. Any number of gzip streams may be
+ concatenated in the input file, and will all be decompressed by gzread().
+ If something other than a gzip stream is encountered after a gzip stream,
+ that remaining trailing garbage is ignored (and no error is returned).
+
+ gzread can be used to read a gzip file that is being concurrently written.
+ Upon reaching the end of the input, gzread will return with the available
+ data. If the error code returned by gzerror is Z_OK or Z_BUF_ERROR, then
+ gzclearerr can be used to clear the end of file indicator in order to permit
+ gzread to be tried again. Z_OK indicates that a gzip stream was completed
+ on the last gzread. Z_BUF_ERROR indicates that the input file ended in the
+ middle of a gzip stream. Note that gzread does not return -1 in the event
+ of an incomplete gzip stream. This error is deferred until gzclose(), which
+ will return Z_BUF_ERROR if the last gzread ended in the middle of a gzip
+ stream. Alternatively, gzerror can be used before gzclose to detect this
+ case.
+
+ gzread returns the number of uncompressed bytes actually read, less than
+ len for end of file, or -1 for error.
+*/
+
+ZEXTERN int ZEXPORT gzwrite OF((gzFile file,
+ voidpc buf, unsigned len));
+/*
+ Writes the given number of uncompressed bytes into the compressed file.
+ gzwrite returns the number of uncompressed bytes written or 0 in case of
+ error.
+*/
+
+ZEXTERN int ZEXPORTVA gzprintf Z_ARG((gzFile file, const char *format, ...));
+/*
+ Converts, formats, and writes the arguments to the compressed file under
+ control of the format string, as in fprintf. gzprintf returns the number of
+ uncompressed bytes actually written, or 0 in case of error. The number of
+ uncompressed bytes written is limited to 8191, or one less than the buffer
+ size given to gzbuffer(). The caller should assure that this limit is not
+ exceeded. If it is exceeded, then gzprintf() will return an error (0) with
+ nothing written. In this case, there may also be a buffer overflow with
+ unpredictable consequences, which is possible only if zlib was compiled with
+ the insecure functions sprintf() or vsprintf() because the secure snprintf()
+ or vsnprintf() functions were not available. This can be determined using
+ zlibCompileFlags().
+*/
+
+ZEXTERN int ZEXPORT gzputs OF((gzFile file, const char *s));
+/*
+ Writes the given null-terminated string to the compressed file, excluding
+ the terminating null character.
+
+ gzputs returns the number of characters written, or -1 in case of error.
+*/
+
+ZEXTERN char * ZEXPORT gzgets OF((gzFile file, char *buf, int len));
+/*
+ Reads bytes from the compressed file until len-1 characters are read, or a
+ newline character is read and transferred to buf, or an end-of-file
+ condition is encountered. If any characters are read or if len == 1, the
+ string is terminated with a null character. If no characters are read due
+ to an end-of-file or len < 1, then the buffer is left untouched.
+
+ gzgets returns buf which is a null-terminated string, or it returns NULL
+ for end-of-file or in case of error. If there was an error, the contents at
+ buf are indeterminate.
+*/
+
+ZEXTERN int ZEXPORT gzputc OF((gzFile file, int c));
+/*
+ Writes c, converted to an unsigned char, into the compressed file. gzputc
+ returns the value that was written, or -1 in case of error.
+*/
+
+ZEXTERN int ZEXPORT gzgetc OF((gzFile file));
+/*
+ Reads one byte from the compressed file. gzgetc returns this byte or -1
+ in case of end of file or error. This is implemented as a macro for speed.
+ As such, it does not do all of the checking the other functions do. I.e.
+ it does not check to see if file is NULL, nor whether the structure file
+ points to has been clobbered or not.
+*/
+
+ZEXTERN int ZEXPORT gzungetc OF((int c, gzFile file));
+/*
+ Push one character back onto the stream to be read as the first character
+ on the next read. At least one character of push-back is allowed.
+ gzungetc() returns the character pushed, or -1 on failure. gzungetc() will
+ fail if c is -1, and may fail if a character has been pushed but not read
+ yet. If gzungetc is used immediately after gzopen or gzdopen, at least the
+ output buffer size of pushed characters is allowed. (See gzbuffer above.)
+ The pushed character will be discarded if the stream is repositioned with
+ gzseek() or gzrewind().
+*/
+
+ZEXTERN int ZEXPORT gzflush OF((gzFile file, int flush));
+/*
+ Flushes all pending output into the compressed file. The parameter flush
+ is as in the deflate() function. The return value is the zlib error number
+ (see function gzerror below). gzflush is only permitted when writing.
+
+ If the flush parameter is Z_FINISH, the remaining data is written and the
+ gzip stream is completed in the output. If gzwrite() is called again, a new
+ gzip stream will be started in the output. gzread() is able to read such
+ concatented gzip streams.
+
+ gzflush should be called only when strictly necessary because it will
+ degrade compression if called too often.
+*/
+
+/*
+ZEXTERN z_off_t ZEXPORT gzseek OF((gzFile file,
+ z_off_t offset, int whence));
+
+ Sets the starting position for the next gzread or gzwrite on the given
+ compressed file. The offset represents a number of bytes in the
+ uncompressed data stream. The whence parameter is defined as in lseek(2);
+ the value SEEK_END is not supported.
+
+ If the file is opened for reading, this function is emulated but can be
+ extremely slow. If the file is opened for writing, only forward seeks are
+ supported; gzseek then compresses a sequence of zeroes up to the new
+ starting position.
+
+ gzseek returns the resulting offset location as measured in bytes from
+ the beginning of the uncompressed stream, or -1 in case of error, in
+ particular if the file is opened for writing and the new starting position
+ would be before the current position.
+*/
+
+ZEXTERN int ZEXPORT gzrewind OF((gzFile file));
+/*
+ Rewinds the given file. This function is supported only for reading.
+
+ gzrewind(file) is equivalent to (int)gzseek(file, 0L, SEEK_SET)
+*/
+
+/*
+ZEXTERN z_off_t ZEXPORT gztell OF((gzFile file));
+
+ Returns the starting position for the next gzread or gzwrite on the given
+ compressed file. This position represents a number of bytes in the
+ uncompressed data stream, and is zero when starting, even if appending or
+ reading a gzip stream from the middle of a file using gzdopen().
+
+ gztell(file) is equivalent to gzseek(file, 0L, SEEK_CUR)
+*/
+
+/*
+ZEXTERN z_off_t ZEXPORT gzoffset OF((gzFile file));
+
+ Returns the current offset in the file being read or written. This offset
+ includes the count of bytes that precede the gzip stream, for example when
+ appending or when using gzdopen() for reading. When reading, the offset
+ does not include as yet unused buffered input. This information can be used
+ for a progress indicator. On error, gzoffset() returns -1.
+*/
+
+ZEXTERN int ZEXPORT gzeof OF((gzFile file));
+/*
+ Returns true (1) if the end-of-file indicator has been set while reading,
+ false (0) otherwise. Note that the end-of-file indicator is set only if the
+ read tried to go past the end of the input, but came up short. Therefore,
+ just like feof(), gzeof() may return false even if there is no more data to
+ read, in the event that the last read request was for the exact number of
+ bytes remaining in the input file. This will happen if the input file size
+ is an exact multiple of the buffer size.
+
+ If gzeof() returns true, then the read functions will return no more data,
+ unless the end-of-file indicator is reset by gzclearerr() and the input file
+ has grown since the previous end of file was detected.
+*/
+
+ZEXTERN int ZEXPORT gzdirect OF((gzFile file));
+/*
+ Returns true (1) if file is being copied directly while reading, or false
+ (0) if file is a gzip stream being decompressed.
+
+ If the input file is empty, gzdirect() will return true, since the input
+ does not contain a gzip stream.
+
+ If gzdirect() is used immediately after gzopen() or gzdopen() it will
+ cause buffers to be allocated to allow reading the file to determine if it
+ is a gzip file. Therefore if gzbuffer() is used, it should be called before
+ gzdirect().
+
+ When writing, gzdirect() returns true (1) if transparent writing was
+ requested ("wT" for the gzopen() mode), or false (0) otherwise. (Note:
+ gzdirect() is not needed when writing. Transparent writing must be
+ explicitly requested, so the application already knows the answer. When
+ linking statically, using gzdirect() will include all of the zlib code for
+ gzip file reading and decompression, which may not be desired.)
+*/
+
+ZEXTERN int ZEXPORT gzclose OF((gzFile file));
+/*
+ Flushes all pending output if necessary, closes the compressed file and
+ deallocates the (de)compression state. Note that once file is closed, you
+ cannot call gzerror with file, since its structures have been deallocated.
+ gzclose must not be called more than once on the same file, just as free
+ must not be called more than once on the same allocation.
+
+ gzclose will return Z_STREAM_ERROR if file is not valid, Z_ERRNO on a
+ file operation error, Z_MEM_ERROR if out of memory, Z_BUF_ERROR if the
+ last read ended in the middle of a gzip stream, or Z_OK on success.
+*/
+
+ZEXTERN int ZEXPORT gzclose_r OF((gzFile file));
+ZEXTERN int ZEXPORT gzclose_w OF((gzFile file));
+/*
+ Same as gzclose(), but gzclose_r() is only for use when reading, and
+ gzclose_w() is only for use when writing or appending. The advantage to
+ using these instead of gzclose() is that they avoid linking in zlib
+ compression or decompression code that is not used when only reading or only
+ writing respectively. If gzclose() is used, then both compression and
+ decompression code will be included the application when linking to a static
+ zlib library.
+*/
+
+ZEXTERN const char * ZEXPORT gzerror OF((gzFile file, int *errnum));
+/*
+ Returns the error message for the last error which occurred on the given
+ compressed file. errnum is set to zlib error number. If an error occurred
+ in the file system and not in the compression library, errnum is set to
+ Z_ERRNO and the application may consult errno to get the exact error code.
+
+ The application must not modify the returned string. Future calls to
+ this function may invalidate the previously returned string. If file is
+ closed, then the string previously returned by gzerror will no longer be
+ available.
+
+ gzerror() should be used to distinguish errors from end-of-file for those
+ functions above that do not distinguish those cases in their return values.
+*/
+
+ZEXTERN void ZEXPORT gzclearerr OF((gzFile file));
+/*
+ Clears the error and end-of-file flags for file. This is analogous to the
+ clearerr() function in stdio. This is useful for continuing to read a gzip
+ file that is being written concurrently.
+*/
+
+#endif /* !Z_SOLO */
+
+ /* checksum functions */
+
+/*
+ These functions are not related to compression but are exported
+ anyway because they might be useful in applications using the compression
+ library.
+*/
+
+ZEXTERN uLong ZEXPORT adler32 OF((uLong adler, const Bytef *buf, uInt len));
+/*
+ Update a running Adler-32 checksum with the bytes buf[0..len-1] and
+ return the updated checksum. If buf is Z_NULL, this function returns the
+ required initial value for the checksum.
+
+ An Adler-32 checksum is almost as reliable as a CRC32 but can be computed
+ much faster.
+
+ Usage example:
+
+ uLong adler = adler32(0L, Z_NULL, 0);
+
+ while (read_buffer(buffer, length) != EOF) {
+ adler = adler32(adler, buffer, length);
+ }
+ if (adler != original_adler) error();
+*/
+
+/*
+ZEXTERN uLong ZEXPORT adler32_combine OF((uLong adler1, uLong adler2,
+ z_off_t len2));
+
+ Combine two Adler-32 checksums into one. For two sequences of bytes, seq1
+ and seq2 with lengths len1 and len2, Adler-32 checksums were calculated for
+ each, adler1 and adler2. adler32_combine() returns the Adler-32 checksum of
+ seq1 and seq2 concatenated, requiring only adler1, adler2, and len2. Note
+ that the z_off_t type (like off_t) is a signed integer. If len2 is
+ negative, the result has no meaning or utility.
+*/
+
+ZEXTERN uLong ZEXPORT crc32 OF((uLong crc, const Bytef *buf, uInt len));
+/*
+ Update a running CRC-32 with the bytes buf[0..len-1] and return the
+ updated CRC-32. If buf is Z_NULL, this function returns the required
+ initial value for the crc. Pre- and post-conditioning (one's complement) is
+ performed within this function so it shouldn't be done by the application.
+
+ Usage example:
+
+ uLong crc = crc32(0L, Z_NULL, 0);
+
+ while (read_buffer(buffer, length) != EOF) {
+ crc = crc32(crc, buffer, length);
+ }
+ if (crc != original_crc) error();
+*/
+
+/*
+ZEXTERN uLong ZEXPORT crc32_combine OF((uLong crc1, uLong crc2, z_off_t len2));
+
+ Combine two CRC-32 check values into one. For two sequences of bytes,
+ seq1 and seq2 with lengths len1 and len2, CRC-32 check values were
+ calculated for each, crc1 and crc2. crc32_combine() returns the CRC-32
+ check value of seq1 and seq2 concatenated, requiring only crc1, crc2, and
+ len2.
+*/
+
+
+ /* various hacks, don't look :) */
+
+/* deflateInit and inflateInit are macros to allow checking the zlib version
+ * and the compiler's view of z_stream:
+ */
+ZEXTERN int ZEXPORT deflateInit_ OF((z_streamp strm, int level,
+ const char *version, int stream_size));
+ZEXTERN int ZEXPORT inflateInit_ OF((z_streamp strm,
+ const char *version, int stream_size));
+ZEXTERN int ZEXPORT deflateInit2_ OF((z_streamp strm, int level, int method,
+ int windowBits, int memLevel,
+ int strategy, const char *version,
+ int stream_size));
+ZEXTERN int ZEXPORT inflateInit2_ OF((z_streamp strm, int windowBits,
+ const char *version, int stream_size));
+ZEXTERN int ZEXPORT inflateBackInit_ OF((z_streamp strm, int windowBits,
+ unsigned char FAR *window,
+ const char *version,
+ int stream_size));
+#define deflateInit(strm, level) \
+ deflateInit_((strm), (level), ZLIB_VERSION, (int)sizeof(z_stream))
+#define inflateInit(strm) \
+ inflateInit_((strm), ZLIB_VERSION, (int)sizeof(z_stream))
+#define deflateInit2(strm, level, method, windowBits, memLevel, strategy) \
+ deflateInit2_((strm),(level),(method),(windowBits),(memLevel),\
+ (strategy), ZLIB_VERSION, (int)sizeof(z_stream))
+#define inflateInit2(strm, windowBits) \
+ inflateInit2_((strm), (windowBits), ZLIB_VERSION, \
+ (int)sizeof(z_stream))
+#define inflateBackInit(strm, windowBits, window) \
+ inflateBackInit_((strm), (windowBits), (window), \
+ ZLIB_VERSION, (int)sizeof(z_stream))
+
+#ifndef Z_SOLO
+
+/* gzgetc() macro and its supporting function and exposed data structure. Note
+ * that the real internal state is much larger than the exposed structure.
+ * This abbreviated structure exposes just enough for the gzgetc() macro. The
+ * user should not mess with these exposed elements, since their names or
+ * behavior could change in the future, perhaps even capriciously. They can
+ * only be used by the gzgetc() macro. You have been warned.
+ */
+ZEXTERN int ZEXPORT gzgetc_ OF((gzFile file)); /* backward compatibility */
+#ifdef Z_PREFIX_SET
+# undef z_gzgetc
+# define z_gzgetc(g) \
+ ((g)->have ? ((g)->have--, (g)->pos++, *((g)->next)++) : gzgetc(g))
+#else
+# define gzgetc(g) \
+ ((g)->have ? ((g)->have--, (g)->pos++, *((g)->next)++) : gzgetc(g))
+#endif
+
+/* provide 64-bit offset functions if _LARGEFILE64_SOURCE defined, and/or
+ * change the regular functions to 64 bits if _FILE_OFFSET_BITS is 64 (if
+ * both are true, the application gets the *64 functions, and the regular
+ * functions are changed to 64 bits) -- in case these are set on systems
+ * without large file support, _LFS64_LARGEFILE must also be true
+ */
+#ifdef Z_LARGE64
+ ZEXTERN gzFile ZEXPORT gzopen64 OF((const char *, const char *));
+ ZEXTERN z_off64_t ZEXPORT gzseek64 OF((gzFile, z_off64_t, int));
+ ZEXTERN z_off64_t ZEXPORT gztell64 OF((gzFile));
+ ZEXTERN z_off64_t ZEXPORT gzoffset64 OF((gzFile));
+ ZEXTERN uLong ZEXPORT adler32_combine64 OF((uLong, uLong, z_off64_t));
+ ZEXTERN uLong ZEXPORT crc32_combine64 OF((uLong, uLong, z_off64_t));
+#endif
+
+#if !defined(ZLIB_INTERNAL) && defined(Z_WANT64)
+# ifdef Z_PREFIX_SET
+# define z_gzopen z_gzopen64
+# define z_gzseek z_gzseek64
+# define z_gztell z_gztell64
+# define z_gzoffset z_gzoffset64
+# define z_adler32_combine z_adler32_combine64
+# define z_crc32_combine z_crc32_combine64
+# else
+# define gzopen gzopen64
+# define gzseek gzseek64
+# define gztell gztell64
+# define gzoffset gzoffset64
+# define adler32_combine adler32_combine64
+# define crc32_combine crc32_combine64
+# endif
+# ifndef Z_LARGE64
+ ZEXTERN gzFile ZEXPORT gzopen64 OF((const char *, const char *));
+ ZEXTERN z_off_t ZEXPORT gzseek64 OF((gzFile, z_off_t, int));
+ ZEXTERN z_off_t ZEXPORT gztell64 OF((gzFile));
+ ZEXTERN z_off_t ZEXPORT gzoffset64 OF((gzFile));
+ ZEXTERN uLong ZEXPORT adler32_combine64 OF((uLong, uLong, z_off_t));
+ ZEXTERN uLong ZEXPORT crc32_combine64 OF((uLong, uLong, z_off_t));
+# endif
+#else
+ ZEXTERN gzFile ZEXPORT gzopen OF((const char *, const char *));
+ ZEXTERN z_off_t ZEXPORT gzseek OF((gzFile, z_off_t, int));
+ ZEXTERN z_off_t ZEXPORT gztell OF((gzFile));
+ ZEXTERN z_off_t ZEXPORT gzoffset OF((gzFile));
+ ZEXTERN uLong ZEXPORT adler32_combine OF((uLong, uLong, z_off_t));
+ ZEXTERN uLong ZEXPORT crc32_combine OF((uLong, uLong, z_off_t));
+#endif
+
+#else /* Z_SOLO */
+
+ ZEXTERN uLong ZEXPORT adler32_combine OF((uLong, uLong, z_off_t));
+ ZEXTERN uLong ZEXPORT crc32_combine OF((uLong, uLong, z_off_t));
+
+#endif /* !Z_SOLO */
+
+/* hack for buggy compilers */
+#if !defined(ZUTIL_H) && !defined(NO_DUMMY_DECL)
+ struct internal_state {int dummy;};
+#endif
+
+/* undocumented functions */
+ZEXTERN const char * ZEXPORT zError OF((int));
+ZEXTERN int ZEXPORT inflateSyncPoint OF((z_streamp));
+ZEXTERN const z_crc_t FAR * ZEXPORT get_crc_table OF((void));
+ZEXTERN int ZEXPORT inflateUndermine OF((z_streamp, int));
+ZEXTERN int ZEXPORT inflateResetKeep OF((z_streamp));
+ZEXTERN int ZEXPORT deflateResetKeep OF((z_streamp));
+#if defined(_WIN32) && !defined(Z_SOLO)
+ZEXTERN gzFile ZEXPORT gzopen_w OF((const wchar_t *path,
+ const char *mode));
+#endif
+#if defined(STDC) || defined(Z_HAVE_STDARG_H)
+# ifndef Z_SOLO
+ZEXTERN int ZEXPORTVA gzvprintf Z_ARG((gzFile file,
+ const char *format,
+ va_list va));
+# endif
+#endif
+
+#ifdef __cplusplus
+}
+#endif
+
+#endif /* ZLIB_H */
--- /dev/null
+/* zutil.c -- target dependent utility functions for the compression library
+ * Copyright (C) 1995-2005, 2010, 2011, 2012 Jean-loup Gailly.
+ * For conditions of distribution and use, see copyright notice in zlib.h
+ */
+
+/* @(#) $Id$ */
+
+#include "zutil.h"
+#ifndef Z_SOLO
+# include "gzguts.h"
+#endif
+
+char * const z_errmsg[10] = {
+ "need dictionary", /* Z_NEED_DICT 2 */
+ "stream end", /* Z_STREAM_END 1 */
+ "", /* Z_OK 0 */
+ "file error", /* Z_ERRNO (-1) */
+ "stream error", /* Z_STREAM_ERROR (-2) */
+ "data error", /* Z_DATA_ERROR (-3) */
+ "insufficient memory", /* Z_MEM_ERROR (-4) */
+ "buffer error", /* Z_BUF_ERROR (-5) */
+ "incompatible version",/* Z_VERSION_ERROR (-6) */
+ ""};
+
+
+const char * ZEXPORT zlibVersion(void)
+{
+ return ZLIB_VERSION;
+}
+
+uLong ZEXPORT zlibCompileFlags(void)
+{
+ uLong flags;
+
+ flags = 0;
+ switch ((int)(sizeof(uInt))) {
+ case 2: break;
+ case 4: flags += 1; break;
+ case 8: flags += 2; break;
+ default: flags += 3;
+ }
+ switch ((int)(sizeof(uLong))) {
+ case 2: break;
+ case 4: flags += 1 << 2; break;
+ case 8: flags += 2 << 2; break;
+ default: flags += 3 << 2;
+ }
+ switch ((int)(sizeof(voidpf))) {
+ case 2: break;
+ case 4: flags += 1 << 4; break;
+ case 8: flags += 2 << 4; break;
+ default: flags += 3 << 4;
+ }
+ switch ((int)(sizeof(z_off_t))) {
+ case 2: break;
+ case 4: flags += 1 << 6; break;
+ case 8: flags += 2 << 6; break;
+ default: flags += 3 << 6;
+ }
+#ifdef DEBUG
+ flags += 1 << 8;
+#endif
+#if defined(ASMV) || defined(ASMINF)
+ flags += 1 << 9;
+#endif
+#ifdef ZLIB_WINAPI
+ flags += 1 << 10;
+#endif
+#ifdef BUILDFIXED
+ flags += 1 << 12;
+#endif
+#ifdef DYNAMIC_CRC_TABLE
+ flags += 1 << 13;
+#endif
+#ifdef NO_GZCOMPRESS
+ flags += 1L << 16;
+#endif
+#ifdef NO_GZIP
+ flags += 1L << 17;
+#endif
+#ifdef PKZIP_BUG_WORKAROUND
+ flags += 1L << 20;
+#endif
+#ifdef FASTEST
+ flags += 1L << 21;
+#endif
+#if defined(STDC) || defined(Z_HAVE_STDARG_H)
+# ifdef NO_vsnprintf
+ flags += 1L << 25;
+# ifdef HAS_vsprintf_void
+ flags += 1L << 26;
+# endif
+# else
+# ifdef HAS_vsnprintf_void
+ flags += 1L << 26;
+# endif
+# endif
+#else
+ flags += 1L << 24;
+# ifdef NO_snprintf
+ flags += 1L << 25;
+# ifdef HAS_sprintf_void
+ flags += 1L << 26;
+# endif
+# else
+# ifdef HAS_snprintf_void
+ flags += 1L << 26;
+# endif
+# endif
+#endif
+ return flags;
+}
+
+#ifdef DEBUG
+
+# ifndef verbose
+# define verbose 0
+# endif
+int ZLIB_INTERNAL z_verbose = verbose;
+
+void ZLIB_INTERNAL z_error (char *m)
+{
+ fprintf(stderr, "%s\n", m);
+ exit(1);
+}
+#endif
+
+/* exported to allow conversion of error code to string for compress() and
+ * uncompress()
+ */
+const char * ZEXPORT zError(int err)
+{
+ return ERR_MSG(err);
+}
+
+#if defined(_WIN32_WCE)
+/* The Microsoft C Run-Time Library for Windows CE doesn't have
+ * errno. We define it as a global variable to simplify porting.
+ * Its value is always 0 and should not be used.
+ */
+int errno = 0;
+#endif
+
+#ifndef HAVE_MEMCPY
+
+void ZLIB_INTERNAL zmemcpy(Bytef *dest, const Bytef *source, uInt len)
+{
+ if (len == 0) return;
+ do {
+ *dest++ = *source++; /* ??? to be unrolled */
+ } while (--len != 0);
+}
+
+int ZLIB_INTERNAL zmemcmp(const Bytef *s1, const Bytef *s2, uInt len)
+{
+ uInt j;
+
+ for (j = 0; j < len; j++) {
+ if (s1[j] != s2[j]) return 2*(s1[j] > s2[j])-1;
+ }
+ return 0;
+}
+
+void ZLIB_INTERNAL zmemzero(Bytef *dest, uInt len)
+{
+ if (len == 0) return;
+ do {
+ *dest++ = 0; /* ??? to be unrolled */
+ } while (--len != 0);
+}
+#endif
+
+#ifndef Z_SOLO
+
+#ifdef SYS16BIT
+
+#ifdef __TURBOC__
+/* Turbo C in 16-bit mode */
+
+# define MY_ZCALLOC
+
+/* Turbo C malloc() does not allow dynamic allocation of 64K bytes
+ * and farmalloc(64K) returns a pointer with an offset of 8, so we
+ * must fix the pointer. Warning: the pointer must be put back to its
+ * original form in order to free it, use zcfree().
+ */
+
+#define MAX_PTR 10
+/* 10*64K = 640K */
+
+local int next_ptr = 0;
+
+typedef struct ptr_table_s {
+ voidpf org_ptr;
+ voidpf new_ptr;
+} ptr_table;
+
+local ptr_table table[MAX_PTR];
+/* This table is used to remember the original form of pointers
+ * to large buffers (64K). Such pointers are normalized with a zero offset.
+ * Since MSDOS is not a preemptive multitasking OS, this table is not
+ * protected from concurrent access. This hack doesn't work anyway on
+ * a protected system like OS/2. Use Microsoft C instead.
+ */
+
+voidpf ZLIB_INTERNAL zcalloc (voidpf opaque, unsigned items, unsigned size)
+{
+ voidpf buf = opaque; /* just to make some compilers happy */
+ ulg bsize = (ulg)items*size;
+
+ /* If we allocate less than 65520 bytes, we assume that farmalloc
+ * will return a usable pointer which doesn't have to be normalized.
+ */
+ if (bsize < 65520L) {
+ buf = farmalloc(bsize);
+ if (*(ush*)&buf != 0) return buf;
+ } else {
+ buf = farmalloc(bsize + 16L);
+ }
+ if (buf == NULL || next_ptr >= MAX_PTR) return NULL;
+ table[next_ptr].org_ptr = buf;
+
+ /* Normalize the pointer to seg:0 */
+ *((ush*)&buf+1) += ((ush)((uch*)buf-0) + 15) >> 4;
+ *(ush*)&buf = 0;
+ table[next_ptr++].new_ptr = buf;
+ return buf;
+}
+
+void ZLIB_INTERNAL zcfree (voidpf opaque, voidpf ptr)
+{
+ int n;
+ if (*(ush*)&ptr != 0) { /* object < 64K */
+ farfree(ptr);
+ return;
+ }
+ /* Find the original pointer */
+ for (n = 0; n < next_ptr; n++) {
+ if (ptr != table[n].new_ptr) continue;
+
+ farfree(table[n].org_ptr);
+ while (++n < next_ptr) {
+ table[n-1] = table[n];
+ }
+ next_ptr--;
+ return;
+ }
+ ptr = opaque; /* just to make some compilers happy */
+ Assert(0, "zcfree: ptr not found");
+}
+
+#endif /* __TURBOC__ */
+
+
+#ifdef M_I86
+/* Microsoft C in 16-bit mode */
+
+# define MY_ZCALLOC
+
+#if (!defined(_MSC_VER) || (_MSC_VER <= 600))
+# define _halloc halloc
+# define _hfree hfree
+#endif
+
+voidpf ZLIB_INTERNAL zcalloc (voidpf opaque, uInt items, uInt size)
+{
+ if (opaque) opaque = 0; /* to make compiler happy */
+ return _halloc((long)items, size);
+}
+
+void ZLIB_INTERNAL zcfree (voidpf opaque, voidpf ptr)
+{
+ if (opaque) opaque = 0; /* to make compiler happy */
+ _hfree(ptr);
+}
+
+#endif /* M_I86 */
+
+#endif /* SYS16BIT */
+
+
+#ifndef MY_ZCALLOC /* Any system without a special alloc function */
+
+#ifndef STDC
+extern voidp malloc OF((uInt size));
+extern voidp calloc OF((uInt items, uInt size));
+extern void free OF((voidpf ptr));
+#endif
+
+voidpf ZLIB_INTERNAL zcalloc (voidpf opaque, unsigned items, unsigned size)
+{
+ if (opaque) items += size - size; /* make compiler happy */
+ return sizeof(uInt) > 2 ? (voidpf)malloc(items * size) :
+ (voidpf)calloc(items, size);
+}
+
+void ZLIB_INTERNAL zcfree (voidpf opaque, voidpf ptr)
+{
+ free(ptr);
+ if (opaque) return; /* make compiler happy */
+}
+
+#endif /* MY_ZCALLOC */
+
+#endif /* !Z_SOLO */
--- /dev/null
+/* zutil.h -- internal interface and configuration of the compression library
+ * Copyright (C) 1995-2013 Jean-loup Gailly.
+ * For conditions of distribution and use, see copyright notice in zlib.h
+ */
+
+/* WARNING: this file should *not* be used by applications. It is
+ part of the implementation of the compression library and is
+ subject to change. Applications should only use zlib.h.
+ */
+
+/* @(#) $Id$ */
+
+#ifndef ZUTIL_H
+#define ZUTIL_H
+
+#ifdef HAVE_HIDDEN
+# define ZLIB_INTERNAL __attribute__((visibility ("hidden")))
+#else
+# define ZLIB_INTERNAL
+#endif
+
+#include "zlib.h"
+
+#if defined(STDC) && !defined(Z_SOLO)
+# if !(defined(_WIN32_WCE) && defined(_MSC_VER))
+# include <stddef.h>
+# endif
+# include <string.h>
+# include <stdlib.h>
+#endif
+
+#ifdef Z_SOLO
+ typedef long ptrdiff_t; /* guess -- will be caught if guess is wrong */
+#endif
+
+#ifndef local
+# define local static
+#endif
+/* compile with -Dlocal if your debugger can't find static symbols */
+
+typedef unsigned char uch;
+typedef uch FAR uchf;
+typedef unsigned short ush;
+typedef ush FAR ushf;
+typedef unsigned long ulg;
+
+extern char * const z_errmsg[10]; /* indexed by 2-zlib_error */
+/* (size given to avoid silly warnings with Visual C++) */
+
+#define ERR_MSG(err) z_errmsg[Z_NEED_DICT-(err)]
+
+#define ERR_RETURN(strm,err) \
+ return (strm->msg = ERR_MSG(err), (err))
+/* To be used only when the state is known to be valid */
+
+ /* common constants */
+
+#ifndef DEF_WBITS
+# define DEF_WBITS MAX_WBITS
+#endif
+/* default windowBits for decompression. MAX_WBITS is for compression only */
+
+#if MAX_MEM_LEVEL >= 8
+# define DEF_MEM_LEVEL 8
+#else
+# define DEF_MEM_LEVEL MAX_MEM_LEVEL
+#endif
+/* default memLevel */
+
+#define STORED_BLOCK 0
+#define STATIC_TREES 1
+#define DYN_TREES 2
+/* The three kinds of block type */
+
+#define MIN_MATCH 3
+#define MAX_MATCH 258
+/* The minimum and maximum match lengths */
+
+#define PRESET_DICT 0x20 /* preset dictionary flag in zlib header */
+
+ /* target dependencies */
+
+#if defined(MSDOS) || (defined(WINDOWS) && !defined(WIN32))
+# define OS_CODE 0x00
+# ifndef Z_SOLO
+# if defined(__TURBOC__) || defined(__BORLANDC__)
+# if (__STDC__ == 1) && (defined(__LARGE__) || defined(__COMPACT__))
+ /* Allow compilation with ANSI keywords only enabled */
+ void _Cdecl farfree( void *block );
+ void *_Cdecl farmalloc( unsigned long nbytes );
+# else
+# include <alloc.h>
+# endif
+# else /* MSC or DJGPP */
+# include <malloc.h>
+# endif
+# endif
+#endif
+
+#ifdef AMIGA
+# define OS_CODE 0x01
+#endif
+
+#if defined(VAXC) || defined(VMS)
+# define OS_CODE 0x02
+# define F_OPEN(name, mode) \
+ fopen((name), (mode), "mbc=60", "ctx=stm", "rfm=fix", "mrs=512")
+#endif
+
+#if defined(ATARI) || defined(atarist)
+# define OS_CODE 0x05
+#endif
+
+#ifdef OS2
+# define OS_CODE 0x06
+# if defined(M_I86) && !defined(Z_SOLO)
+# include <malloc.h>
+# endif
+#endif
+
+#if defined(MACOS) || defined(TARGET_OS_MAC)
+# define OS_CODE 0x07
+# ifndef Z_SOLO
+# if defined(__MWERKS__) && __dest_os != __be_os && __dest_os != __win32_os
+# include <unix.h> /* for fdopen */
+# else
+# ifndef fdopen
+# define fdopen(fd,mode) NULL /* No fdopen() */
+# endif
+# endif
+# endif
+#endif
+
+#ifdef TOPS20
+# define OS_CODE 0x0a
+#endif
+
+#ifdef WIN32
+# ifndef __CYGWIN__ /* Cygwin is Unix, not Win32 */
+# define OS_CODE 0x0b
+# endif
+#endif
+
+#ifdef __50SERIES /* Prime/PRIMOS */
+# define OS_CODE 0x0f
+#endif
+
+#if defined(_BEOS_) || defined(RISCOS)
+# define fdopen(fd,mode) NULL /* No fdopen() */
+#endif
+
+#if (defined(_MSC_VER) && (_MSC_VER > 600)) && !defined __INTERIX
+# if defined(_WIN32_WCE)
+# define fdopen(fd,mode) NULL /* No fdopen() */
+# ifndef _PTRDIFF_T_DEFINED
+ typedef int ptrdiff_t;
+# define _PTRDIFF_T_DEFINED
+# endif
+# else
+# define fdopen(fd,type) _fdopen(fd,type)
+# endif
+#endif
+
+#if defined(__BORLANDC__) && !defined(MSDOS)
+ #pragma warn -8004
+ #pragma warn -8008
+ #pragma warn -8066
+#endif
+
+/* provide prototypes for these when building zlib without LFS */
+#if !defined(_WIN32) && \
+ (!defined(_LARGEFILE64_SOURCE) || _LFS64_LARGEFILE-0 == 0)
+ ZEXTERN uLong ZEXPORT adler32_combine64 OF((uLong, uLong, z_off_t));
+ ZEXTERN uLong ZEXPORT crc32_combine64 OF((uLong, uLong, z_off_t));
+#endif
+
+ /* common defaults */
+
+#ifndef OS_CODE
+# define OS_CODE 0x03 /* assume Unix */
+#endif
+
+#ifndef F_OPEN
+# define F_OPEN(name, mode) fopen((name), (mode))
+#endif
+
+ /* functions */
+
+#if defined(pyr) || defined(Z_SOLO)
+# define NO_MEMCPY
+#endif
+#if defined(SMALL_MEDIUM) && !defined(_MSC_VER) && !defined(__SC__)
+ /* Use our own functions for small and medium model with MSC <= 5.0.
+ * You may have to use the same strategy for Borland C (untested).
+ * The __SC__ check is for Symantec.
+ */
+# define NO_MEMCPY
+#endif
+#if defined(STDC) && !defined(HAVE_MEMCPY) && !defined(NO_MEMCPY)
+# define HAVE_MEMCPY
+#endif
+#ifdef HAVE_MEMCPY
+# ifdef SMALL_MEDIUM /* MSDOS small or medium model */
+# define zmemcpy _fmemcpy
+# define zmemcmp _fmemcmp
+# define zmemzero(dest, len) _fmemset(dest, 0, len)
+# else
+# define zmemcpy memcpy
+# define zmemcmp memcmp
+# define zmemzero(dest, len) memset(dest, 0, len)
+# endif
+#else
+ void ZLIB_INTERNAL zmemcpy OF((Bytef* dest, const Bytef* source, uInt len));
+ int ZLIB_INTERNAL zmemcmp OF((const Bytef* s1, const Bytef* s2, uInt len));
+ void ZLIB_INTERNAL zmemzero OF((Bytef* dest, uInt len));
+#endif
+
+/* Diagnostic functions */
+#ifdef DEBUG
+# include <stdio.h>
+ extern int ZLIB_INTERNAL z_verbose;
+ extern void ZLIB_INTERNAL z_error OF((char *m));
+# define Assert(cond,msg) {if(!(cond)) z_error(msg);}
+# define Trace(x) {if (z_verbose>=0) fprintf x ;}
+# define Tracev(x) {if (z_verbose>0) fprintf x ;}
+# define Tracevv(x) {if (z_verbose>1) fprintf x ;}
+# define Tracec(c,x) {if (z_verbose>0 && (c)) fprintf x ;}
+# define Tracecv(c,x) {if (z_verbose>1 && (c)) fprintf x ;}
+#else
+# define Assert(cond,msg)
+# define Trace(x)
+# define Tracev(x)
+# define Tracevv(x)
+# define Tracec(c,x)
+# define Tracecv(c,x)
+#endif
+
+#ifndef Z_SOLO
+ voidpf ZLIB_INTERNAL zcalloc OF((voidpf opaque, unsigned items,
+ unsigned size));
+ void ZLIB_INTERNAL zcfree OF((voidpf opaque, voidpf ptr));
+#endif
+
+#define ZALLOC(strm, items, size) \
+ (*((strm)->zalloc))((strm)->opaque, (items), (size))
+#define ZFREE(strm, addr) (*((strm)->zfree))((strm)->opaque, (voidpf)(addr))
+#define TRY_FREE(s, p) {if (p) ZFREE(s, p);}
+
+/* Reverse the bytes in a 32-bit value */
+#define ZSWAP32(q) ((((q) >> 24) & 0xff) + (((q) >> 8) & 0xff00) + \
+ (((q) & 0xff00) << 8) + (((q) & 0xff) << 24))
+
+#endif /* ZUTIL_H */
+++ /dev/null
-#!/bin/sh
-
-# Wiz's timings are already good, apply this for Caanoo
-if [ -e /dev/accel ]; then
- ./pollux_set "ram_timings=3,9,4,1,1,1,1"
-fi
-
-# the sync mount causes problems when writing saves,
-# probably due to many write calls, so have to get rid of it
-if grep mmcblk /proc/mounts | grep -q '\<sync\>'; then
- oldmount=`grep mmcblk /proc/mounts | grep '\<sync\>' | awk '{print $4}'`
- mount /dev/mmcblk0p1 /mnt/sd/ -o remount,dirsync,noatime
-fi
-
-./pcsx "$@"
-sync
-
-if [ -n "$oldmount" ]; then
- mount /dev/mmcblk0p1 /mnt/sd/ -o remount,$oldmount
-fi
-
-cd /usr/gp2x
-exec ./gp2xmenu
+++ /dev/null
-0 126
-100 -126
-115 0
+++ /dev/null
-0 54
-100 -126
-105 0
+++ /dev/null
-[info]
-name="PCSX ReARMed"
-icon="/pcsx_rearmed/pcsx26.png"
-path="/pcsx_rearmed/pcsx.gpe"
-title="/pcsx_rearmed/pcsxb.png"
-group="GAMES"
+++ /dev/null
-/*
- * quick tool to set various timings for Wiz
- *
- * Copyright (c) Gražvydas "notaz" Ignotas, 2009
- *
- * Redistribution and use in source and binary forms, with or without
- * modification, are permitted provided that the following conditions are met:
- * * Redistributions of source code must retain the above copyright
- * notice, this list of conditions and the following disclaimer.
- * * Redistributions in binary form must reproduce the above copyright
- * notice, this list of conditions and the following disclaimer in the
- * documentation and/or other materials provided with the distribution.
- * * Neither the name of the organization nor the
- * names of its contributors may be used to endorse or promote products
- * derived from this software without specific prior written permission.
- *
- * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS"
- * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE
- * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE
- * ARE DISCLAIMED. IN NO EVENT SHALL COPYRIGHT HOLDER OR CONTRIBUTORS BE LIABLE
- * FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL
- * DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR
- * SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER
- * CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY,
- * OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE
- * OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
- *
- * HTOTAL: X VTOTAL: 341
- * HSWIDTH: 1 VSWIDTH: 0
- * HASTART: 37 VASTART: 17
- * HAEND: 277 VAEND: 337
- *
- * 120Hz
- * pcd 8, 447: + 594us
- * pcd 9, 397: + 36us
- * pcd 10, 357: - 523us
- * pcd 11, 325: +1153us
- *
- * 'lcd_timings=397,1,37,277,341,0,17,337;dpc_clkdiv0=9'
- * 'ram_timings=2,9,4,1,1,1,1'
- */
-
-#include <stdio.h>
-#include <stdlib.h>
-#include <string.h>
-//#include "pollux_set.h"
-#define BINARY
-
-/* parse stuff */
-static int parse_lcd_timings(const char *str, void *data)
-{
- int *lcd_timings = data;
- const char *p = str;
- int ret, c;
- ret = sscanf(str, "%d,%d,%d,%d,%d,%d,%d,%d",
- &lcd_timings[0], &lcd_timings[1], &lcd_timings[2], &lcd_timings[3],
- &lcd_timings[4], &lcd_timings[5], &lcd_timings[6], &lcd_timings[7]);
- if (ret != 8)
- return -1;
- /* skip seven commas */
- for (c = 0; c < 7 && *p != 0; p++)
- if (*p == ',')
- c++;
- if (c != 7)
- return -1;
- /* skip last number */
- while ('0' <= *p && *p <= '9')
- p++;
-
- return p - str;
-}
-
-static int parse_ram_timings(const char *str, void *data)
-{
- int *ram_timings = data;
- const char *p = str;
- int ret, c;
- float cas;
-
- ret = sscanf(p, "%f,%d,%d,%d,%d,%d,%d",
- &cas, &ram_timings[1], &ram_timings[2], &ram_timings[3],
- &ram_timings[4], &ram_timings[5], &ram_timings[6]);
- if (ret != 7)
- return -1;
- if (cas == 2)
- ram_timings[0] = 1;
- else if (cas == 2.5)
- ram_timings[0] = 2;
- else if (cas == 3)
- ram_timings[0] = 3;
- else
- return -1;
- for (c = 0; c < 6 && *p != 0; p++)
- if (*p == ',')
- c++;
- if (c != 6)
- return -1;
- while ('0' <= *p && *p <= '9')
- p++;
-
- return p - str;
-}
-
-static int parse_decimal(const char *str, void *data)
-{
- char *ep;
-
- *(int *)data = strtoul(str, &ep, 10);
- if (ep == str)
- return -1;
-
- return ep - str;
-}
-
-/* validate and apply stuff */
-static int apply_lcd_timings(volatile unsigned short *memregs, void *data)
-{
- int *lcd_timings = data;
- int i;
-
- for (i = 0; i < 8; i++) {
- if (lcd_timings[i] & ~0xffff) {
- fprintf(stderr, "pollux_set: invalid lcd timing %d: %d\n", i, lcd_timings[i]);
- return -1;
- }
- }
-
- for (i = 0; i < 8; i++)
- memregs[(0x307c>>1) + i] = lcd_timings[i];
-
- return 0;
-}
-
-static const struct {
- signed char adj; /* how to adjust value passed by user */
- signed short min; /* range of */
- signed short max; /* allowed values (inclusive) */
-}
-ram_ranges[] = {
- { 0, 1, 3 }, /* cas (cl) */
- { -2, 0, 15 }, /* trc */
- { -2, 0, 15 }, /* tras */
- { 0, 0, 15 }, /* twr */
- { 0, 0, 15 }, /* tmrd */
- { 0, 0, 15 }, /* trp */
- { 0, 0, 15 }, /* trcd */
-};
-
-static int apply_ram_timings(volatile unsigned short *memregs, void *data)
-{
- int *ram_timings = data;
- int i, val;
-
- for (i = 0; i < 7; i++)
- {
- ram_timings[i] += ram_ranges[i].adj;
- if (ram_timings[i] < ram_ranges[i].min || ram_timings[i] > ram_ranges[i].max) {
- fprintf(stderr, "pollux_set: invalid RAM timing %d\n", i);
- return -1;
- }
- }
-
- val = memregs[0x14802>>1] & 0x0f00;
- val |= (ram_timings[4] << 12) | (ram_timings[5] << 4) | ram_timings[6];
- memregs[0x14802>>1] = val;
-
- val = memregs[0x14804>>1] & 0x4000;
- val |= (ram_timings[0] << 12) | (ram_timings[1] << 8) |
- (ram_timings[2] << 4) | ram_timings[3];
- val |= 0x8000;
- memregs[0x14804>>1] = val;
-
- for (i = 0; i < 0x100000 && (memregs[0x14804>>1] & 0x8000); i++)
- ;
-
- return 0;
-}
-
-static int apply_dpc_clkdiv0(volatile unsigned short *memregs, void *data)
-{
- int pcd = *(int *)data;
- int tmp;
-
- if ((pcd - 1) & ~0x3f) {
- fprintf(stderr, "pollux_set: invalid lcd clkdiv0: %d\n", pcd);
- return -1;
- }
-
- pcd = (pcd - 1) & 0x3f;
- tmp = memregs[0x31c4>>1];
- memregs[0x31c4>>1] = (tmp & ~0x3f0) | (pcd << 4);
-
- return 0;
-}
-
-static int apply_cpuclk(volatile unsigned short *memregs, void *data)
-{
- volatile unsigned int *memregl = (volatile void *)memregs;
- int mhz = *(int *)data;
- int adiv, mdiv, pdiv, sdiv = 0;
- int i, vf000, vf004;
-
- // m = MDIV, p = PDIV, s = SDIV
- #define SYS_CLK_FREQ 27
- pdiv = 9;
- mdiv = (mhz * pdiv) / SYS_CLK_FREQ;
- if (mdiv & ~0x3ff)
- return -1;
- vf004 = (pdiv<<18) | (mdiv<<8) | sdiv;
-
- // attempt to keep AHB the divider close to 250, but not higher
- for (adiv = 1; mhz / adiv > 250; adiv++)
- ;
-
- vf000 = memregl[0xf000>>2];
- vf000 = (vf000 & ~0x3c0) | ((adiv - 1) << 6);
- memregl[0xf000>>2] = vf000;
- memregl[0xf004>>2] = vf004;
- memregl[0xf07c>>2] |= 0x8000;
- for (i = 0; (memregl[0xf07c>>2] & 0x8000) && i < 0x100000; i++)
- ;
-
- printf("clock set to %dMHz, AHB set to %dMHz\n", mhz, mhz / adiv);
- return 0;
-}
-
-static int lcd_timings[8];
-static int ram_timings[7];
-static int dpc_clkdiv0;
-static int cpuclk;
-
-static const char lcd_t_help[] = "htotal,hswidth,hastart,haend,vtotal,vswidth,vastart,vaend";
-static const char ram_t_help[] = "CAS,tRC,tRAS,tWR,tMRD,tRP,tRCD";
-
-static const struct {
- const char *name;
- const char *help;
- int (*parse)(const char *str, void *data);
- int (*apply)(volatile unsigned short *memregs, void *data);
- void *data;
-}
-all_params[] = {
- { "lcd_timings", lcd_t_help, parse_lcd_timings, apply_lcd_timings, lcd_timings },
- { "ram_timings", ram_t_help, parse_ram_timings, apply_ram_timings, ram_timings },
- { "dpc_clkdiv0", "divider", parse_decimal, apply_dpc_clkdiv0, &dpc_clkdiv0 },
- { "clkdiv0", "divider", parse_decimal, apply_dpc_clkdiv0, &dpc_clkdiv0 }, /* alias */
- { "cpuclk", "MHZ", parse_decimal, apply_cpuclk, &cpuclk },
-};
-#define ALL_PARAM_COUNT (sizeof(all_params) / sizeof(all_params[0]))
-
-/*
- * set timings based on preformated string
- * returns 0 on success.
- */
-int pollux_set(volatile unsigned short *memregs, const char *str)
-{
- int parsed_params[ALL_PARAM_COUNT];
- int applied_params[ALL_PARAM_COUNT];
- int applied_something = 0;
- const char *p, *po;
- int i, ret;
-
- if (str == NULL)
- return -1;
-
- memset(parsed_params, 0, sizeof(parsed_params));
- memset(applied_params, 0, sizeof(applied_params));
-
- p = str;
- while (1)
- {
-again:
- while (*p == ';' || *p == ' ')
- p++;
- if (*p == 0)
- break;
-
- for (i = 0; i < ALL_PARAM_COUNT; i++)
- {
- int param_len = strlen(all_params[i].name);
- if (strncmp(p, all_params[i].name, param_len) == 0 && p[param_len] == '=')
- {
- p += param_len + 1;
- ret = all_params[i].parse(p, all_params[i].data);
- if (ret < 0) {
- fprintf(stderr, "pollux_set parser: error at %-10s\n", p);
- fprintf(stderr, " valid format is: <%s>\n", all_params[i].help);
- return -1;
- }
- parsed_params[i] = 1;
- p += ret;
- goto again;
- }
- }
-
- /* Unknown param. Attempt to be forward compatible and ignore it. */
- for (po = p; *p != 0 && *p != ';'; p++)
- ;
-
- fprintf(stderr, "unhandled param: ");
- fwrite(po, 1, p - po, stderr);
- fprintf(stderr, "\n");
- }
-
- /* validate and apply */
- for (i = 0; i < ALL_PARAM_COUNT; i++)
- {
- if (!parsed_params[i])
- continue;
-
- ret = all_params[i].apply(memregs, all_params[i].data);
- if (ret < 0) {
- fprintf(stderr, "pollux_set: failed to apply %s (bad value?)\n",
- all_params[i].name);
- continue;
- }
-
- applied_something = 1;
- applied_params[i] = 1;
- }
-
- if (applied_something)
- {
- int c;
- printf("applied: ");
- for (i = c = 0; i < ALL_PARAM_COUNT; i++)
- {
- if (!applied_params[i])
- continue;
- if (c != 0)
- printf(", ");
- printf("%s", all_params[i].name);
- c++;
- }
- printf("\n");
- }
-
- return 0;
-}
-
-#ifdef BINARY
-#include <sys/types.h>
-#include <sys/stat.h>
-#include <fcntl.h>
-#include <sys/mman.h>
-#include <unistd.h>
-
-static void usage(const char *binary)
-{
- int i;
- printf("usage:\n%s <set_str[;set_str[;...]]>\n"
- "set_str:\n", binary);
- for (i = 0; i < ALL_PARAM_COUNT; i++)
- printf(" %s=<%s>\n", all_params[i].name, all_params[i].help);
-}
-
-int main(int argc, char *argv[])
-{
- volatile unsigned short *memregs;
- int ret, memdev;
-
- if (argc != 2) {
- usage(argv[0]);
- return 1;
- }
-
- memdev = open("/dev/mem", O_RDWR);
- if (memdev == -1)
- {
- perror("open(/dev/mem) failed");
- return 1;
- }
-
- memregs = mmap(0, 0x20000, PROT_READ|PROT_WRITE, MAP_SHARED, memdev, 0xc0000000);
- if (memregs == MAP_FAILED)
- {
- perror("mmap(memregs) failed");
- close(memdev);
- return 1;
- }
-
- ret = pollux_set(memregs, argv[1]);
-
- munmap((void *)memregs, 0x20000);
- close(memdev);
-
- return ret;
-}
-#endif
+++ /dev/null
-The skin images can be customized, but there are several limitations:\r
-\r
-background.png - must be 320x240 image with 24bit RGB colors.\r
-font.png - must be 128x160 8bit grayscale image.\r
-selector.png - must be 8x10 8bit grayscale image.\r
-\r
-Font and selector colors can be changed by editing skin.txt.\r
-\r
+++ /dev/null
-// html-style hex color codes, ex. ff0000 is red, 0000ff is blue, etc.\r
-text_color=ffffc0\r
-selection_color=808010\r
-\r
+++ /dev/null
-#ifndef UI_FEATURES_H
-#define UI_FEATURES_H
-
-#define MENU_BIOS_PATH "pcsx_rearmed/bios/"
-#define MENU_SHOW_VARSCALER 0
-#define MENU_SHOW_VOUTMODE 0
-#define MENU_SHOW_SCALER2 1
-#define MENU_SHOW_NUBS_BTNS 0
-#define MENU_SHOW_VIBRATION 1
-#define MENU_SHOW_DEADZONE 1
-#define MENU_SHOW_MINIMIZE 0
-#define MENU_SHOW_FULLSCREEN 0
-#define MENU_SHOW_VOLUME 1
-
-#endif // UI_FEATURES_H
--- /dev/null
+#ifndef _3DS_UTILS_H
+#define _3DS_UTILS_H
+
+#include <stdio.h>
+
+#define MEMOP_PROT 6
+#define MEMOP_MAP 4
+#define MEMOP_UNMAP 5
+
+void* linearMemAlign(size_t size, size_t alignment);
+void linearFree(void* mem);
+
+int32_t svcDuplicateHandle(uint32_t* out, uint32_t original);
+int32_t svcCloseHandle(uint32_t handle);
+int32_t svcControlMemory(void* addr_out, void* addr0, void* addr1, uint32_t size, uint32_t op, uint32_t perm);
+int32_t svcControlProcessMemory(uint32_t process, void* addr0, void* addr1, uint32_t size, uint32_t op, uint32_t perm);
+
+int32_t svcCreateThread(int32_t* thread, void *(*entrypoint)(void*), void* arg, void* stack_top, int32_t thread_priority, int32_t processor_id);
+int32_t svcWaitSynchronization(int32_t handle, int64_t nanoseconds);
+void svcExitThread(void) __attribute__((noreturn));
+
+int32_t svcBackdoor(int32_t (*callback)(void));
+
+#define DEBUG_HOLD() do{printf("%s@%s:%d.\n",__FUNCTION__, __FILE__, __LINE__);fflush(stdout);wait_for_input();}while(0)
+
+void wait_for_input(void);
+
+extern __attribute__((weak)) int __ctr_svchax;
+
+typedef int32_t (*ctr_callback_type)(void);
+
+static inline void ctr_invalidate_ICache_kernel(void)
+{
+ __asm__ volatile(
+ "cpsid aif\n\t"
+ "mov r0, #0\n\t"
+ "mcr p15, 0, r0, c7, c5, 0\n\t");
+}
+
+static inline void ctr_flush_DCache_kernel(void)
+{
+ __asm__ volatile(
+ "cpsid aif\n\t"
+ "mov r0, #0\n\t"
+ "mcr p15, 0, r0, c7, c10, 0\n\t");
+}
+
+static inline void ctr_invalidate_ICache(void)
+{
+ svcBackdoor((ctr_callback_type)ctr_invalidate_ICache_kernel);
+}
+
+static inline void ctr_flush_DCache(void)
+{
+ svcBackdoor((ctr_callback_type)ctr_flush_DCache_kernel);
+}
+
+
+static inline void ctr_flush_invalidate_cache(void)
+{
+ ctr_flush_DCache();
+ ctr_invalidate_ICache();
+}
+
+
+#endif // _3DS_UTILS_H
--- /dev/null
+
+#ifndef _3DS_PTHREAD_WRAP__
+#define _3DS_PTHREAD_WRAP__
+
+#include <stdlib.h>
+#include <string.h>
+#include <stdio.h>
+
+#include "3ds_utils.h"
+
+#define CTR_PTHREAD_STACK_SIZE 0x10000
+
+typedef struct
+{
+ int32_t handle;
+ uint32_t* stack;
+}pthread_t;
+typedef int pthread_attr_t;
+
+static inline int pthread_create(pthread_t *thread,
+ const pthread_attr_t *attr, void *(*start_routine)(void*), void *arg)
+{
+
+ thread->stack = linearMemAlign(CTR_PTHREAD_STACK_SIZE, 8);
+
+ svcCreateThread(&thread->handle, start_routine, arg,
+ (uint32_t*)((uint32_t)thread->stack + CTR_PTHREAD_STACK_SIZE),
+ 0x25, 1);
+
+ return 1;
+}
+
+
+static inline int pthread_join(pthread_t thread, void **retval)
+{
+ (void)retval;
+
+ if(svcWaitSynchronization(thread.handle, INT64_MAX))
+ return -1;
+
+ linearFree(thread.stack);
+
+ return 0;
+}
+
+
+static inline void pthread_exit(void *retval)
+{
+ (void)retval;
+
+ svcExitThread();
+}
+
+
+#endif //_3DS_PTHREAD_WRAP__
+
--- /dev/null
+#ifndef MMAN_H
+#define MMAN_H
+
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+#include <stdlib.h>
+#include <stdio.h>
+#include <stdint.h>
+#include <malloc.h>
+
+#include "3ds_utils.h"
+
+#define PROT_READ 0b001
+#define PROT_WRITE 0b010
+#define PROT_EXEC 0b100
+#define MAP_PRIVATE 2
+#define MAP_FIXED 0x10
+#define MAP_ANONYMOUS 0x20
+
+#define MAP_FAILED ((void *)-1)
+
+static void* dynarec_cache = NULL;
+static void* dynarec_cache_mapping = NULL;
+
+static inline void* mmap(void *addr, size_t len, int prot, int flags, int fd, off_t offset)
+{
+ (void)fd;
+ (void)offset;
+
+ void* addr_out;
+
+ if((prot == (PROT_READ | PROT_WRITE | PROT_EXEC)) &&
+ (flags == (MAP_PRIVATE | MAP_ANONYMOUS)))
+ {
+ if(__ctr_svchax)
+ {
+ /* this hack works only for pcsx_rearmed */
+ uint32_t currentHandle;
+
+ if(!dynarec_cache)
+ dynarec_cache = memalign(0x1000, len);
+
+ svcDuplicateHandle(¤tHandle, 0xFFFF8001);
+ svcControlProcessMemory(currentHandle, addr, dynarec_cache,
+ len, MEMOP_MAP, prot);
+ svcCloseHandle(currentHandle);
+ dynarec_cache_mapping = addr;
+ return addr;
+ }
+ else
+ {
+ printf("tried to mmap RWX pages without svcControlProcessMemory access !\n");
+ return MAP_FAILED;
+ }
+
+ }
+
+ addr_out = malloc(len);
+ if(!addr_out)
+ return MAP_FAILED;
+
+ return addr_out;
+}
+
+static inline int mprotect(void *addr, size_t len, int prot)
+{
+ if(__ctr_svchax)
+ {
+ uint32_t currentHandle;
+ svcDuplicateHandle(¤tHandle, 0xFFFF8001);
+ svcControlProcessMemory(currentHandle, addr, NULL,
+ len, MEMOP_PROT, prot);
+ svcCloseHandle(currentHandle);
+ return 0;
+ }
+
+ printf("mprotect called without svcControlProcessMemory access !\n");
+ return -1;
+}
+
+static inline int munmap(void *addr, size_t len)
+{
+ if((addr == dynarec_cache_mapping) && __ctr_svchax)
+ {
+ uint32_t currentHandle;
+ svcDuplicateHandle(¤tHandle, 0xFFFF8001);
+ svcControlProcessMemory(currentHandle,
+ dynarec_cache, dynarec_cache_mapping,
+ len, MEMOP_UNMAP, 0b111);
+ svcCloseHandle(currentHandle);
+ dynarec_cache_mapping = NULL;
+
+ }
+ else
+ free(addr);
+
+ return 0;
+}
+
+#ifdef __cplusplus
+};
+#endif
+
+#endif // MMAN_H
+
--- /dev/null
+/* zconf.h -- configuration of the zlib compression library
+ * Copyright (C) 1995-2013 Jean-loup Gailly.
+ * For conditions of distribution and use, see copyright notice in zlib.h
+ */
+
+/* @(#) $Id$ */
+
+#ifndef ZCONF_H
+#define ZCONF_H
+
+/*
+ * If you *really* need a unique prefix for all types and library functions,
+ * compile with -DZ_PREFIX. The "standard" zlib should be compiled without it.
+ * Even better than compiling with -DZ_PREFIX would be to use configure to set
+ * this permanently in zconf.h using "./configure --zprefix".
+ */
+#ifdef Z_PREFIX /* may be set to #if 1 by ./configure */
+# define Z_PREFIX_SET
+
+/* all linked symbols */
+# define _dist_code z__dist_code
+# define _length_code z__length_code
+# define _tr_align z__tr_align
+# define _tr_flush_bits z__tr_flush_bits
+# define _tr_flush_block z__tr_flush_block
+# define _tr_init z__tr_init
+# define _tr_stored_block z__tr_stored_block
+# define _tr_tally z__tr_tally
+# define adler32 z_adler32
+# define adler32_combine z_adler32_combine
+# define adler32_combine64 z_adler32_combine64
+# ifndef Z_SOLO
+# define compress z_compress
+# define compress2 z_compress2
+# define compressBound z_compressBound
+# endif
+# define crc32 z_crc32
+# define crc32_combine z_crc32_combine
+# define crc32_combine64 z_crc32_combine64
+# define deflate z_deflate
+# define deflateBound z_deflateBound
+# define deflateCopy z_deflateCopy
+# define deflateEnd z_deflateEnd
+# define deflateInit2_ z_deflateInit2_
+# define deflateInit_ z_deflateInit_
+# define deflateParams z_deflateParams
+# define deflatePending z_deflatePending
+# define deflatePrime z_deflatePrime
+# define deflateReset z_deflateReset
+# define deflateResetKeep z_deflateResetKeep
+# define deflateSetDictionary z_deflateSetDictionary
+# define deflateSetHeader z_deflateSetHeader
+# define deflateTune z_deflateTune
+# define deflate_copyright z_deflate_copyright
+# define get_crc_table z_get_crc_table
+# ifndef Z_SOLO
+# define gz_error z_gz_error
+# define gz_intmax z_gz_intmax
+# define gz_strwinerror z_gz_strwinerror
+# define gzbuffer z_gzbuffer
+# define gzclearerr z_gzclearerr
+# define gzclose z_gzclose
+# define gzclose_r z_gzclose_r
+# define gzclose_w z_gzclose_w
+# define gzdirect z_gzdirect
+# define gzdopen z_gzdopen
+# define gzeof z_gzeof
+# define gzerror z_gzerror
+# define gzflush z_gzflush
+# define gzgetc z_gzgetc
+# define gzgetc_ z_gzgetc_
+# define gzgets z_gzgets
+# define gzoffset z_gzoffset
+# define gzoffset64 z_gzoffset64
+# define gzopen z_gzopen
+# define gzopen64 z_gzopen64
+# ifdef _WIN32
+# define gzopen_w z_gzopen_w
+# endif
+# define gzprintf z_gzprintf
+# define gzvprintf z_gzvprintf
+# define gzputc z_gzputc
+# define gzputs z_gzputs
+# define gzread z_gzread
+# define gzrewind z_gzrewind
+# define gzseek z_gzseek
+# define gzseek64 z_gzseek64
+# define gzsetparams z_gzsetparams
+# define gztell z_gztell
+# define gztell64 z_gztell64
+# define gzungetc z_gzungetc
+# define gzwrite z_gzwrite
+# endif
+# define inflate z_inflate
+# define inflateBack z_inflateBack
+# define inflateBackEnd z_inflateBackEnd
+# define inflateBackInit_ z_inflateBackInit_
+# define inflateCopy z_inflateCopy
+# define inflateEnd z_inflateEnd
+# define inflateGetHeader z_inflateGetHeader
+# define inflateInit2_ z_inflateInit2_
+# define inflateInit_ z_inflateInit_
+# define inflateMark z_inflateMark
+# define inflatePrime z_inflatePrime
+# define inflateReset z_inflateReset
+# define inflateReset2 z_inflateReset2
+# define inflateSetDictionary z_inflateSetDictionary
+# define inflateGetDictionary z_inflateGetDictionary
+# define inflateSync z_inflateSync
+# define inflateSyncPoint z_inflateSyncPoint
+# define inflateUndermine z_inflateUndermine
+# define inflateResetKeep z_inflateResetKeep
+# define inflate_copyright z_inflate_copyright
+# define inflate_fast z_inflate_fast
+# define inflate_table z_inflate_table
+# ifndef Z_SOLO
+# define uncompress z_uncompress
+# endif
+# define zError z_zError
+# ifndef Z_SOLO
+# define zcalloc z_zcalloc
+# define zcfree z_zcfree
+# endif
+# define zlibCompileFlags z_zlibCompileFlags
+# define zlibVersion z_zlibVersion
+
+/* all zlib typedefs in zlib.h and zconf.h */
+# define Byte z_Byte
+# define Bytef z_Bytef
+# define alloc_func z_alloc_func
+# define charf z_charf
+# define free_func z_free_func
+# ifndef Z_SOLO
+# define gzFile z_gzFile
+# endif
+# define gz_header z_gz_header
+# define gz_headerp z_gz_headerp
+# define in_func z_in_func
+# define intf z_intf
+# define out_func z_out_func
+# define uInt z_uInt
+# define uIntf z_uIntf
+# define uLong z_uLong
+# define uLongf z_uLongf
+# define voidp z_voidp
+# define voidpc z_voidpc
+# define voidpf z_voidpf
+
+/* all zlib structs in zlib.h and zconf.h */
+# define gz_header_s z_gz_header_s
+# define internal_state z_internal_state
+
+#endif
+
+#if defined(__MSDOS__) && !defined(MSDOS)
+# define MSDOS
+#endif
+#if (defined(OS_2) || defined(__OS2__)) && !defined(OS2)
+# define OS2
+#endif
+#if defined(_WINDOWS) && !defined(WINDOWS)
+# define WINDOWS
+#endif
+#if defined(_WIN32) || defined(_WIN32_WCE) || defined(__WIN32__)
+# ifndef WIN32
+# define WIN32
+# endif
+#endif
+#if (defined(MSDOS) || defined(OS2) || defined(WINDOWS)) && !defined(WIN32)
+# if !defined(__GNUC__) && !defined(__FLAT__) && !defined(__386__)
+# ifndef SYS16BIT
+# define SYS16BIT
+# endif
+# endif
+#endif
+
+/*
+ * Compile with -DMAXSEG_64K if the alloc function cannot allocate more
+ * than 64k bytes at a time (needed on systems with 16-bit int).
+ */
+#ifdef SYS16BIT
+# define MAXSEG_64K
+#endif
+#ifdef MSDOS
+# define UNALIGNED_OK
+#endif
+
+#ifdef __STDC_VERSION__
+# ifndef STDC
+# define STDC
+# endif
+# if __STDC_VERSION__ >= 199901L
+# ifndef STDC99
+# define STDC99
+# endif
+# endif
+#endif
+#if !defined(STDC) && (defined(__STDC__) || defined(__cplusplus))
+# define STDC
+#endif
+#if !defined(STDC) && (defined(__GNUC__) || defined(__BORLANDC__))
+# define STDC
+#endif
+#if !defined(STDC) && (defined(MSDOS) || defined(WINDOWS) || defined(WIN32))
+# define STDC
+#endif
+#if !defined(STDC) && (defined(OS2) || defined(__HOS_AIX__))
+# define STDC
+#endif
+
+#if defined(__OS400__) && !defined(STDC) /* iSeries (formerly AS/400). */
+# define STDC
+#endif
+
+#ifndef STDC
+# ifndef const /* cannot use !defined(STDC) && !defined(const) on Mac */
+# define const /* note: need a more gentle solution here */
+# endif
+#endif
+
+#if defined(ZLIB_CONST) && !defined(z_const)
+# define z_const const
+#else
+# define z_const
+#endif
+
+/* Some Mac compilers merge all .h files incorrectly: */
+#if defined(__MWERKS__)||defined(applec)||defined(THINK_C)||defined(__SC__)
+# define NO_DUMMY_DECL
+#endif
+
+/* Maximum value for memLevel in deflateInit2 */
+#ifndef MAX_MEM_LEVEL
+# ifdef MAXSEG_64K
+# define MAX_MEM_LEVEL 8
+# else
+# define MAX_MEM_LEVEL 9
+# endif
+#endif
+
+/* Maximum value for windowBits in deflateInit2 and inflateInit2.
+ * WARNING: reducing MAX_WBITS makes minigzip unable to extract .gz files
+ * created by gzip. (Files created by minigzip can still be extracted by
+ * gzip.)
+ */
+#ifndef MAX_WBITS
+# define MAX_WBITS 15 /* 32K LZ77 window */
+#endif
+
+/* The memory requirements for deflate are (in bytes):
+ (1 << (windowBits+2)) + (1 << (memLevel+9))
+ that is: 128K for windowBits=15 + 128K for memLevel = 8 (default values)
+ plus a few kilobytes for small objects. For example, if you want to reduce
+ the default memory requirements from 256K to 128K, compile with
+ make CFLAGS="-O -DMAX_WBITS=14 -DMAX_MEM_LEVEL=7"
+ Of course this will generally degrade compression (there's no free lunch).
+
+ The memory requirements for inflate are (in bytes) 1 << windowBits
+ that is, 32K for windowBits=15 (default value) plus a few kilobytes
+ for small objects.
+*/
+
+ /* Type declarations */
+
+#ifndef OF /* function prototypes */
+# ifdef STDC
+# define OF(args) args
+# else
+# define OF(args) ()
+# endif
+#endif
+
+#ifndef Z_ARG /* function prototypes for stdarg */
+# if defined(STDC) || defined(Z_HAVE_STDARG_H)
+# define Z_ARG(args) args
+# else
+# define Z_ARG(args) ()
+# endif
+#endif
+
+/* The following definitions for FAR are needed only for MSDOS mixed
+ * model programming (small or medium model with some far allocations).
+ * This was tested only with MSC; for other MSDOS compilers you may have
+ * to define NO_MEMCPY in zutil.h. If you don't need the mixed model,
+ * just define FAR to be empty.
+ */
+#ifdef SYS16BIT
+# if defined(M_I86SM) || defined(M_I86MM)
+ /* MSC small or medium model */
+# define SMALL_MEDIUM
+# ifdef _MSC_VER
+# define FAR _far
+# else
+# define FAR far
+# endif
+# endif
+# if (defined(__SMALL__) || defined(__MEDIUM__))
+ /* Turbo C small or medium model */
+# define SMALL_MEDIUM
+# ifdef __BORLANDC__
+# define FAR _far
+# else
+# define FAR far
+# endif
+# endif
+#endif
+
+#if defined(WINDOWS) || defined(WIN32)
+ /* If building or using zlib as a DLL, define ZLIB_DLL.
+ * This is not mandatory, but it offers a little performance increase.
+ */
+# ifdef ZLIB_DLL
+# if defined(WIN32) && (!defined(__BORLANDC__) || (__BORLANDC__ >= 0x500))
+# ifdef ZLIB_INTERNAL
+# define ZEXTERN extern __declspec(dllexport)
+# else
+# define ZEXTERN extern __declspec(dllimport)
+# endif
+# endif
+# endif /* ZLIB_DLL */
+ /* If building or using zlib with the WINAPI/WINAPIV calling convention,
+ * define ZLIB_WINAPI.
+ * Caution: the standard ZLIB1.DLL is NOT compiled using ZLIB_WINAPI.
+ */
+# ifdef ZLIB_WINAPI
+# ifdef FAR
+# undef FAR
+# endif
+# include <windows.h>
+ /* No need for _export, use ZLIB.DEF instead. */
+ /* For complete Windows compatibility, use WINAPI, not __stdcall. */
+# define ZEXPORT WINAPI
+# ifdef WIN32
+# define ZEXPORTVA WINAPIV
+# else
+# define ZEXPORTVA FAR CDECL
+# endif
+# endif
+#endif
+
+#if defined (__BEOS__)
+# ifdef ZLIB_DLL
+# ifdef ZLIB_INTERNAL
+# define ZEXPORT __declspec(dllexport)
+# define ZEXPORTVA __declspec(dllexport)
+# else
+# define ZEXPORT __declspec(dllimport)
+# define ZEXPORTVA __declspec(dllimport)
+# endif
+# endif
+#endif
+
+#ifndef ZEXTERN
+# define ZEXTERN extern
+#endif
+#ifndef ZEXPORT
+# define ZEXPORT
+#endif
+#ifndef ZEXPORTVA
+# define ZEXPORTVA
+#endif
+
+#ifndef FAR
+# define FAR
+#endif
+
+#if !defined(__MACTYPES__)
+typedef unsigned char Byte; /* 8 bits */
+#endif
+typedef unsigned int uInt; /* 16 bits or more */
+typedef unsigned long uLong; /* 32 bits or more */
+
+#ifdef SMALL_MEDIUM
+ /* Borland C/C++ and some old MSC versions ignore FAR inside typedef */
+# define Bytef Byte FAR
+#else
+ typedef Byte FAR Bytef;
+#endif
+typedef char FAR charf;
+typedef int FAR intf;
+typedef uInt FAR uIntf;
+typedef uLong FAR uLongf;
+
+#ifdef STDC
+ typedef void const *voidpc;
+ typedef void FAR *voidpf;
+ typedef void *voidp;
+#else
+ typedef Byte const *voidpc;
+ typedef Byte FAR *voidpf;
+ typedef Byte *voidp;
+#endif
+
+#if !defined(Z_U4) && !defined(Z_SOLO) && defined(STDC)
+# include <limits.h>
+# if (UINT_MAX == 0xffffffffUL)
+# define Z_U4 unsigned
+# elif (ULONG_MAX == 0xffffffffUL)
+# define Z_U4 unsigned long
+# elif (USHRT_MAX == 0xffffffffUL)
+# define Z_U4 unsigned short
+# endif
+#endif
+
+#ifdef Z_U4
+ typedef Z_U4 z_crc_t;
+#else
+ typedef unsigned long z_crc_t;
+#endif
+
+#if 1 /* was set to #if 1 by ./configure */
+# define Z_HAVE_UNISTD_H
+#endif
+
+#if 1 /* was set to #if 1 by ./configure */
+# define Z_HAVE_STDARG_H
+#endif
+
+#ifdef STDC
+# ifndef Z_SOLO
+# include <sys/types.h> /* for off_t */
+# endif
+#endif
+
+#if defined(STDC) || defined(Z_HAVE_STDARG_H)
+# ifndef Z_SOLO
+# include <stdarg.h> /* for va_list */
+# endif
+#endif
+
+#ifdef _WIN32
+# ifndef Z_SOLO
+# include <stddef.h> /* for wchar_t */
+# endif
+#endif
+
+/* a little trick to accommodate both "#define _LARGEFILE64_SOURCE" and
+ * "#define _LARGEFILE64_SOURCE 1" as requesting 64-bit operations, (even
+ * though the former does not conform to the LFS document), but considering
+ * both "#undef _LARGEFILE64_SOURCE" and "#define _LARGEFILE64_SOURCE 0" as
+ * equivalently requesting no 64-bit operations
+ */
+#if defined(_LARGEFILE64_SOURCE) && -_LARGEFILE64_SOURCE - -1 == 1
+# undef _LARGEFILE64_SOURCE
+#endif
+
+#if defined(__WATCOMC__) && !defined(Z_HAVE_UNISTD_H)
+# define Z_HAVE_UNISTD_H
+#endif
+#ifndef Z_SOLO
+# if defined(Z_HAVE_UNISTD_H) || defined(_LARGEFILE64_SOURCE)
+# include <unistd.h> /* for SEEK_*, off_t, and _LFS64_LARGEFILE */
+# ifdef VMS
+# include <unixio.h> /* for off_t */
+# endif
+# ifndef z_off_t
+# define z_off_t off_t
+# endif
+# endif
+#endif
+
+#if defined(_LFS64_LARGEFILE) && _LFS64_LARGEFILE-0
+# define Z_LFS64
+#endif
+
+#if defined(_LARGEFILE64_SOURCE) && defined(Z_LFS64)
+# define Z_LARGE64
+#endif
+
+#if defined(_FILE_OFFSET_BITS) && _FILE_OFFSET_BITS-0 == 64 && defined(Z_LFS64)
+# define Z_WANT64
+#endif
+
+#if !defined(SEEK_SET) && !defined(Z_SOLO)
+# define SEEK_SET 0 /* Seek from beginning of file. */
+# define SEEK_CUR 1 /* Seek from current position. */
+# define SEEK_END 2 /* Set file pointer to EOF plus "offset" */
+#endif
+
+#ifndef z_off_t
+# define z_off_t long
+#endif
+
+#if !defined(_WIN32) && defined(Z_LARGE64)
+# define z_off64_t off64_t
+#else
+# if defined(_WIN32) && !defined(__GNUC__) && !defined(Z_SOLO)
+# define z_off64_t __int64
+# else
+# define z_off64_t z_off_t
+# endif
+#endif
+
+/* MVS linker does not support external names larger than 8 bytes */
+#if defined(__MVS__)
+ #pragma map(deflateInit_,"DEIN")
+ #pragma map(deflateInit2_,"DEIN2")
+ #pragma map(deflateEnd,"DEEND")
+ #pragma map(deflateBound,"DEBND")
+ #pragma map(inflateInit_,"ININ")
+ #pragma map(inflateInit2_,"ININ2")
+ #pragma map(inflateEnd,"INEND")
+ #pragma map(inflateSync,"INSY")
+ #pragma map(inflateSetDictionary,"INSEDI")
+ #pragma map(compressBound,"CMBND")
+ #pragma map(inflate_table,"INTABL")
+ #pragma map(inflate_fast,"INFA")
+ #pragma map(inflate_copyright,"INCOPY")
+#endif
+
+#endif /* ZCONF_H */
--- /dev/null
+/* zlib.h -- interface of the 'zlib' general purpose compression library
+ version 1.2.8, April 28th, 2013
+
+ Copyright (C) 1995-2013 Jean-loup Gailly and Mark Adler
+
+ This software is provided 'as-is', without any express or implied
+ warranty. In no event will the authors be held liable for any damages
+ arising from the use of this software.
+
+ Permission is granted to anyone to use this software for any purpose,
+ including commercial applications, and to alter it and redistribute it
+ freely, subject to the following restrictions:
+
+ 1. The origin of this software must not be misrepresented; you must not
+ claim that you wrote the original software. If you use this software
+ in a product, an acknowledgment in the product documentation would be
+ appreciated but is not required.
+ 2. Altered source versions must be plainly marked as such, and must not be
+ misrepresented as being the original software.
+ 3. This notice may not be removed or altered from any source distribution.
+
+ Jean-loup Gailly Mark Adler
+ jloup@gzip.org madler@alumni.caltech.edu
+
+
+ The data format used by the zlib library is described by RFCs (Request for
+ Comments) 1950 to 1952 in the files http://tools.ietf.org/html/rfc1950
+ (zlib format), rfc1951 (deflate format) and rfc1952 (gzip format).
+*/
+
+#ifndef ZLIB_H
+#define ZLIB_H
+
+#include "zconf.h"
+
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+#define ZLIB_VERSION "1.2.8"
+#define ZLIB_VERNUM 0x1280
+#define ZLIB_VER_MAJOR 1
+#define ZLIB_VER_MINOR 2
+#define ZLIB_VER_REVISION 8
+#define ZLIB_VER_SUBREVISION 0
+
+/*
+ The 'zlib' compression library provides in-memory compression and
+ decompression functions, including integrity checks of the uncompressed data.
+ This version of the library supports only one compression method (deflation)
+ but other algorithms will be added later and will have the same stream
+ interface.
+
+ Compression can be done in a single step if the buffers are large enough,
+ or can be done by repeated calls of the compression function. In the latter
+ case, the application must provide more input and/or consume the output
+ (providing more output space) before each call.
+
+ The compressed data format used by default by the in-memory functions is
+ the zlib format, which is a zlib wrapper documented in RFC 1950, wrapped
+ around a deflate stream, which is itself documented in RFC 1951.
+
+ The library also supports reading and writing files in gzip (.gz) format
+ with an interface similar to that of stdio using the functions that start
+ with "gz". The gzip format is different from the zlib format. gzip is a
+ gzip wrapper, documented in RFC 1952, wrapped around a deflate stream.
+
+ This library can optionally read and write gzip streams in memory as well.
+
+ The zlib format was designed to be compact and fast for use in memory
+ and on communications channels. The gzip format was designed for single-
+ file compression on file systems, has a larger header than zlib to maintain
+ directory information, and uses a different, slower check method than zlib.
+
+ The library does not install any signal handler. The decoder checks
+ the consistency of the compressed data, so the library should never crash
+ even in case of corrupted input.
+*/
+
+typedef voidpf (*alloc_func) OF((voidpf opaque, uInt items, uInt size));
+typedef void (*free_func) OF((voidpf opaque, voidpf address));
+
+struct internal_state;
+
+typedef struct z_stream_s {
+ z_const Bytef *next_in; /* next input byte */
+ uInt avail_in; /* number of bytes available at next_in */
+ uLong total_in; /* total number of input bytes read so far */
+
+ Bytef *next_out; /* next output byte should be put there */
+ uInt avail_out; /* remaining free space at next_out */
+ uLong total_out; /* total number of bytes output so far */
+
+ z_const char *msg; /* last error message, NULL if no error */
+ struct internal_state FAR *state; /* not visible by applications */
+
+ alloc_func zalloc; /* used to allocate the internal state */
+ free_func zfree; /* used to free the internal state */
+ voidpf opaque; /* private data object passed to zalloc and zfree */
+
+ int data_type; /* best guess about the data type: binary or text */
+ uLong adler; /* adler32 value of the uncompressed data */
+ uLong reserved; /* reserved for future use */
+} z_stream;
+
+typedef z_stream FAR *z_streamp;
+
+/*
+ gzip header information passed to and from zlib routines. See RFC 1952
+ for more details on the meanings of these fields.
+*/
+typedef struct gz_header_s {
+ int text; /* true if compressed data believed to be text */
+ uLong time; /* modification time */
+ int xflags; /* extra flags (not used when writing a gzip file) */
+ int os; /* operating system */
+ Bytef *extra; /* pointer to extra field or Z_NULL if none */
+ uInt extra_len; /* extra field length (valid if extra != Z_NULL) */
+ uInt extra_max; /* space at extra (only when reading header) */
+ Bytef *name; /* pointer to zero-terminated file name or Z_NULL */
+ uInt name_max; /* space at name (only when reading header) */
+ Bytef *comment; /* pointer to zero-terminated comment or Z_NULL */
+ uInt comm_max; /* space at comment (only when reading header) */
+ int hcrc; /* true if there was or will be a header crc */
+ int done; /* true when done reading gzip header (not used
+ when writing a gzip file) */
+} gz_header;
+
+typedef gz_header FAR *gz_headerp;
+
+/*
+ The application must update next_in and avail_in when avail_in has dropped
+ to zero. It must update next_out and avail_out when avail_out has dropped
+ to zero. The application must initialize zalloc, zfree and opaque before
+ calling the init function. All other fields are set by the compression
+ library and must not be updated by the application.
+
+ The opaque value provided by the application will be passed as the first
+ parameter for calls of zalloc and zfree. This can be useful for custom
+ memory management. The compression library attaches no meaning to the
+ opaque value.
+
+ zalloc must return Z_NULL if there is not enough memory for the object.
+ If zlib is used in a multi-threaded application, zalloc and zfree must be
+ thread safe.
+
+ On 16-bit systems, the functions zalloc and zfree must be able to allocate
+ exactly 65536 bytes, but will not be required to allocate more than this if
+ the symbol MAXSEG_64K is defined (see zconf.h). WARNING: On MSDOS, pointers
+ returned by zalloc for objects of exactly 65536 bytes *must* have their
+ offset normalized to zero. The default allocation function provided by this
+ library ensures this (see zutil.c). To reduce memory requirements and avoid
+ any allocation of 64K objects, at the expense of compression ratio, compile
+ the library with -DMAX_WBITS=14 (see zconf.h).
+
+ The fields total_in and total_out can be used for statistics or progress
+ reports. After compression, total_in holds the total size of the
+ uncompressed data and may be saved for use in the decompressor (particularly
+ if the decompressor wants to decompress everything in a single step).
+*/
+
+ /* constants */
+
+#define Z_NO_FLUSH 0
+#define Z_PARTIAL_FLUSH 1
+#define Z_SYNC_FLUSH 2
+#define Z_FULL_FLUSH 3
+#define Z_FINISH 4
+#define Z_BLOCK 5
+#define Z_TREES 6
+/* Allowed flush values; see deflate() and inflate() below for details */
+
+#define Z_OK 0
+#define Z_STREAM_END 1
+#define Z_NEED_DICT 2
+#define Z_ERRNO (-1)
+#define Z_STREAM_ERROR (-2)
+#define Z_DATA_ERROR (-3)
+#define Z_MEM_ERROR (-4)
+#define Z_BUF_ERROR (-5)
+#define Z_VERSION_ERROR (-6)
+/* Return codes for the compression/decompression functions. Negative values
+ * are errors, positive values are used for special but normal events.
+ */
+
+#define Z_NO_COMPRESSION 0
+#define Z_BEST_SPEED 1
+#define Z_BEST_COMPRESSION 9
+#define Z_DEFAULT_COMPRESSION (-1)
+/* compression levels */
+
+#define Z_FILTERED 1
+#define Z_HUFFMAN_ONLY 2
+#define Z_RLE 3
+#define Z_FIXED 4
+#define Z_DEFAULT_STRATEGY 0
+/* compression strategy; see deflateInit2() below for details */
+
+#define Z_BINARY 0
+#define Z_TEXT 1
+#define Z_ASCII Z_TEXT /* for compatibility with 1.2.2 and earlier */
+#define Z_UNKNOWN 2
+/* Possible values of the data_type field (though see inflate()) */
+
+#define Z_DEFLATED 8
+/* The deflate compression method (the only one supported in this version) */
+
+#define Z_NULL 0 /* for initializing zalloc, zfree, opaque */
+
+#define zlib_version zlibVersion()
+/* for compatibility with versions < 1.0.2 */
+
+
+ /* basic functions */
+
+ZEXTERN const char * ZEXPORT zlibVersion OF((void));
+/* The application can compare zlibVersion and ZLIB_VERSION for consistency.
+ If the first character differs, the library code actually used is not
+ compatible with the zlib.h header file used by the application. This check
+ is automatically made by deflateInit and inflateInit.
+ */
+
+/*
+ZEXTERN int ZEXPORT deflateInit OF((z_streamp strm, int level));
+
+ Initializes the internal stream state for compression. The fields
+ zalloc, zfree and opaque must be initialized before by the caller. If
+ zalloc and zfree are set to Z_NULL, deflateInit updates them to use default
+ allocation functions.
+
+ The compression level must be Z_DEFAULT_COMPRESSION, or between 0 and 9:
+ 1 gives best speed, 9 gives best compression, 0 gives no compression at all
+ (the input data is simply copied a block at a time). Z_DEFAULT_COMPRESSION
+ requests a default compromise between speed and compression (currently
+ equivalent to level 6).
+
+ deflateInit returns Z_OK if success, Z_MEM_ERROR if there was not enough
+ memory, Z_STREAM_ERROR if level is not a valid compression level, or
+ Z_VERSION_ERROR if the zlib library version (zlib_version) is incompatible
+ with the version assumed by the caller (ZLIB_VERSION). msg is set to null
+ if there is no error message. deflateInit does not perform any compression:
+ this will be done by deflate().
+*/
+
+
+ZEXTERN int ZEXPORT deflate OF((z_streamp strm, int flush));
+/*
+ deflate compresses as much data as possible, and stops when the input
+ buffer becomes empty or the output buffer becomes full. It may introduce
+ some output latency (reading input without producing any output) except when
+ forced to flush.
+
+ The detailed semantics are as follows. deflate performs one or both of the
+ following actions:
+
+ - Compress more input starting at next_in and update next_in and avail_in
+ accordingly. If not all input can be processed (because there is not
+ enough room in the output buffer), next_in and avail_in are updated and
+ processing will resume at this point for the next call of deflate().
+
+ - Provide more output starting at next_out and update next_out and avail_out
+ accordingly. This action is forced if the parameter flush is non zero.
+ Forcing flush frequently degrades the compression ratio, so this parameter
+ should be set only when necessary (in interactive applications). Some
+ output may be provided even if flush is not set.
+
+ Before the call of deflate(), the application should ensure that at least
+ one of the actions is possible, by providing more input and/or consuming more
+ output, and updating avail_in or avail_out accordingly; avail_out should
+ never be zero before the call. The application can consume the compressed
+ output when it wants, for example when the output buffer is full (avail_out
+ == 0), or after each call of deflate(). If deflate returns Z_OK and with
+ zero avail_out, it must be called again after making room in the output
+ buffer because there might be more output pending.
+
+ Normally the parameter flush is set to Z_NO_FLUSH, which allows deflate to
+ decide how much data to accumulate before producing output, in order to
+ maximize compression.
+
+ If the parameter flush is set to Z_SYNC_FLUSH, all pending output is
+ flushed to the output buffer and the output is aligned on a byte boundary, so
+ that the decompressor can get all input data available so far. (In
+ particular avail_in is zero after the call if enough output space has been
+ provided before the call.) Flushing may degrade compression for some
+ compression algorithms and so it should be used only when necessary. This
+ completes the current deflate block and follows it with an empty stored block
+ that is three bits plus filler bits to the next byte, followed by four bytes
+ (00 00 ff ff).
+
+ If flush is set to Z_PARTIAL_FLUSH, all pending output is flushed to the
+ output buffer, but the output is not aligned to a byte boundary. All of the
+ input data so far will be available to the decompressor, as for Z_SYNC_FLUSH.
+ This completes the current deflate block and follows it with an empty fixed
+ codes block that is 10 bits long. This assures that enough bytes are output
+ in order for the decompressor to finish the block before the empty fixed code
+ block.
+
+ If flush is set to Z_BLOCK, a deflate block is completed and emitted, as
+ for Z_SYNC_FLUSH, but the output is not aligned on a byte boundary, and up to
+ seven bits of the current block are held to be written as the next byte after
+ the next deflate block is completed. In this case, the decompressor may not
+ be provided enough bits at this point in order to complete decompression of
+ the data provided so far to the compressor. It may need to wait for the next
+ block to be emitted. This is for advanced applications that need to control
+ the emission of deflate blocks.
+
+ If flush is set to Z_FULL_FLUSH, all output is flushed as with
+ Z_SYNC_FLUSH, and the compression state is reset so that decompression can
+ restart from this point if previous compressed data has been damaged or if
+ random access is desired. Using Z_FULL_FLUSH too often can seriously degrade
+ compression.
+
+ If deflate returns with avail_out == 0, this function must be called again
+ with the same value of the flush parameter and more output space (updated
+ avail_out), until the flush is complete (deflate returns with non-zero
+ avail_out). In the case of a Z_FULL_FLUSH or Z_SYNC_FLUSH, make sure that
+ avail_out is greater than six to avoid repeated flush markers due to
+ avail_out == 0 on return.
+
+ If the parameter flush is set to Z_FINISH, pending input is processed,
+ pending output is flushed and deflate returns with Z_STREAM_END if there was
+ enough output space; if deflate returns with Z_OK, this function must be
+ called again with Z_FINISH and more output space (updated avail_out) but no
+ more input data, until it returns with Z_STREAM_END or an error. After
+ deflate has returned Z_STREAM_END, the only possible operations on the stream
+ are deflateReset or deflateEnd.
+
+ Z_FINISH can be used immediately after deflateInit if all the compression
+ is to be done in a single step. In this case, avail_out must be at least the
+ value returned by deflateBound (see below). Then deflate is guaranteed to
+ return Z_STREAM_END. If not enough output space is provided, deflate will
+ not return Z_STREAM_END, and it must be called again as described above.
+
+ deflate() sets strm->adler to the adler32 checksum of all input read
+ so far (that is, total_in bytes).
+
+ deflate() may update strm->data_type if it can make a good guess about
+ the input data type (Z_BINARY or Z_TEXT). In doubt, the data is considered
+ binary. This field is only for information purposes and does not affect the
+ compression algorithm in any manner.
+
+ deflate() returns Z_OK if some progress has been made (more input
+ processed or more output produced), Z_STREAM_END if all input has been
+ consumed and all output has been produced (only when flush is set to
+ Z_FINISH), Z_STREAM_ERROR if the stream state was inconsistent (for example
+ if next_in or next_out was Z_NULL), Z_BUF_ERROR if no progress is possible
+ (for example avail_in or avail_out was zero). Note that Z_BUF_ERROR is not
+ fatal, and deflate() can be called again with more input and more output
+ space to continue compressing.
+*/
+
+
+ZEXTERN int ZEXPORT deflateEnd OF((z_streamp strm));
+/*
+ All dynamically allocated data structures for this stream are freed.
+ This function discards any unprocessed input and does not flush any pending
+ output.
+
+ deflateEnd returns Z_OK if success, Z_STREAM_ERROR if the
+ stream state was inconsistent, Z_DATA_ERROR if the stream was freed
+ prematurely (some input or output was discarded). In the error case, msg
+ may be set but then points to a static string (which must not be
+ deallocated).
+*/
+
+
+/*
+ZEXTERN int ZEXPORT inflateInit OF((z_streamp strm));
+
+ Initializes the internal stream state for decompression. The fields
+ next_in, avail_in, zalloc, zfree and opaque must be initialized before by
+ the caller. If next_in is not Z_NULL and avail_in is large enough (the
+ exact value depends on the compression method), inflateInit determines the
+ compression method from the zlib header and allocates all data structures
+ accordingly; otherwise the allocation will be deferred to the first call of
+ inflate. If zalloc and zfree are set to Z_NULL, inflateInit updates them to
+ use default allocation functions.
+
+ inflateInit returns Z_OK if success, Z_MEM_ERROR if there was not enough
+ memory, Z_VERSION_ERROR if the zlib library version is incompatible with the
+ version assumed by the caller, or Z_STREAM_ERROR if the parameters are
+ invalid, such as a null pointer to the structure. msg is set to null if
+ there is no error message. inflateInit does not perform any decompression
+ apart from possibly reading the zlib header if present: actual decompression
+ will be done by inflate(). (So next_in and avail_in may be modified, but
+ next_out and avail_out are unused and unchanged.) The current implementation
+ of inflateInit() does not process any header information -- that is deferred
+ until inflate() is called.
+*/
+
+
+ZEXTERN int ZEXPORT inflate OF((z_streamp strm, int flush));
+/*
+ inflate decompresses as much data as possible, and stops when the input
+ buffer becomes empty or the output buffer becomes full. It may introduce
+ some output latency (reading input without producing any output) except when
+ forced to flush.
+
+ The detailed semantics are as follows. inflate performs one or both of the
+ following actions:
+
+ - Decompress more input starting at next_in and update next_in and avail_in
+ accordingly. If not all input can be processed (because there is not
+ enough room in the output buffer), next_in is updated and processing will
+ resume at this point for the next call of inflate().
+
+ - Provide more output starting at next_out and update next_out and avail_out
+ accordingly. inflate() provides as much output as possible, until there is
+ no more input data or no more space in the output buffer (see below about
+ the flush parameter).
+
+ Before the call of inflate(), the application should ensure that at least
+ one of the actions is possible, by providing more input and/or consuming more
+ output, and updating the next_* and avail_* values accordingly. The
+ application can consume the uncompressed output when it wants, for example
+ when the output buffer is full (avail_out == 0), or after each call of
+ inflate(). If inflate returns Z_OK and with zero avail_out, it must be
+ called again after making room in the output buffer because there might be
+ more output pending.
+
+ The flush parameter of inflate() can be Z_NO_FLUSH, Z_SYNC_FLUSH, Z_FINISH,
+ Z_BLOCK, or Z_TREES. Z_SYNC_FLUSH requests that inflate() flush as much
+ output as possible to the output buffer. Z_BLOCK requests that inflate()
+ stop if and when it gets to the next deflate block boundary. When decoding
+ the zlib or gzip format, this will cause inflate() to return immediately
+ after the header and before the first block. When doing a raw inflate,
+ inflate() will go ahead and process the first block, and will return when it
+ gets to the end of that block, or when it runs out of data.
+
+ The Z_BLOCK option assists in appending to or combining deflate streams.
+ Also to assist in this, on return inflate() will set strm->data_type to the
+ number of unused bits in the last byte taken from strm->next_in, plus 64 if
+ inflate() is currently decoding the last block in the deflate stream, plus
+ 128 if inflate() returned immediately after decoding an end-of-block code or
+ decoding the complete header up to just before the first byte of the deflate
+ stream. The end-of-block will not be indicated until all of the uncompressed
+ data from that block has been written to strm->next_out. The number of
+ unused bits may in general be greater than seven, except when bit 7 of
+ data_type is set, in which case the number of unused bits will be less than
+ eight. data_type is set as noted here every time inflate() returns for all
+ flush options, and so can be used to determine the amount of currently
+ consumed input in bits.
+
+ The Z_TREES option behaves as Z_BLOCK does, but it also returns when the
+ end of each deflate block header is reached, before any actual data in that
+ block is decoded. This allows the caller to determine the length of the
+ deflate block header for later use in random access within a deflate block.
+ 256 is added to the value of strm->data_type when inflate() returns
+ immediately after reaching the end of the deflate block header.
+
+ inflate() should normally be called until it returns Z_STREAM_END or an
+ error. However if all decompression is to be performed in a single step (a
+ single call of inflate), the parameter flush should be set to Z_FINISH. In
+ this case all pending input is processed and all pending output is flushed;
+ avail_out must be large enough to hold all of the uncompressed data for the
+ operation to complete. (The size of the uncompressed data may have been
+ saved by the compressor for this purpose.) The use of Z_FINISH is not
+ required to perform an inflation in one step. However it may be used to
+ inform inflate that a faster approach can be used for the single inflate()
+ call. Z_FINISH also informs inflate to not maintain a sliding window if the
+ stream completes, which reduces inflate's memory footprint. If the stream
+ does not complete, either because not all of the stream is provided or not
+ enough output space is provided, then a sliding window will be allocated and
+ inflate() can be called again to continue the operation as if Z_NO_FLUSH had
+ been used.
+
+ In this implementation, inflate() always flushes as much output as
+ possible to the output buffer, and always uses the faster approach on the
+ first call. So the effects of the flush parameter in this implementation are
+ on the return value of inflate() as noted below, when inflate() returns early
+ when Z_BLOCK or Z_TREES is used, and when inflate() avoids the allocation of
+ memory for a sliding window when Z_FINISH is used.
+
+ If a preset dictionary is needed after this call (see inflateSetDictionary
+ below), inflate sets strm->adler to the Adler-32 checksum of the dictionary
+ chosen by the compressor and returns Z_NEED_DICT; otherwise it sets
+ strm->adler to the Adler-32 checksum of all output produced so far (that is,
+ total_out bytes) and returns Z_OK, Z_STREAM_END or an error code as described
+ below. At the end of the stream, inflate() checks that its computed adler32
+ checksum is equal to that saved by the compressor and returns Z_STREAM_END
+ only if the checksum is correct.
+
+ inflate() can decompress and check either zlib-wrapped or gzip-wrapped
+ deflate data. The header type is detected automatically, if requested when
+ initializing with inflateInit2(). Any information contained in the gzip
+ header is not retained, so applications that need that information should
+ instead use raw inflate, see inflateInit2() below, or inflateBack() and
+ perform their own processing of the gzip header and trailer. When processing
+ gzip-wrapped deflate data, strm->adler32 is set to the CRC-32 of the output
+ producted so far. The CRC-32 is checked against the gzip trailer.
+
+ inflate() returns Z_OK if some progress has been made (more input processed
+ or more output produced), Z_STREAM_END if the end of the compressed data has
+ been reached and all uncompressed output has been produced, Z_NEED_DICT if a
+ preset dictionary is needed at this point, Z_DATA_ERROR if the input data was
+ corrupted (input stream not conforming to the zlib format or incorrect check
+ value), Z_STREAM_ERROR if the stream structure was inconsistent (for example
+ next_in or next_out was Z_NULL), Z_MEM_ERROR if there was not enough memory,
+ Z_BUF_ERROR if no progress is possible or if there was not enough room in the
+ output buffer when Z_FINISH is used. Note that Z_BUF_ERROR is not fatal, and
+ inflate() can be called again with more input and more output space to
+ continue decompressing. If Z_DATA_ERROR is returned, the application may
+ then call inflateSync() to look for a good compression block if a partial
+ recovery of the data is desired.
+*/
+
+
+ZEXTERN int ZEXPORT inflateEnd OF((z_streamp strm));
+/*
+ All dynamically allocated data structures for this stream are freed.
+ This function discards any unprocessed input and does not flush any pending
+ output.
+
+ inflateEnd returns Z_OK if success, Z_STREAM_ERROR if the stream state
+ was inconsistent. In the error case, msg may be set but then points to a
+ static string (which must not be deallocated).
+*/
+
+
+ /* Advanced functions */
+
+/*
+ The following functions are needed only in some special applications.
+*/
+
+/*
+ZEXTERN int ZEXPORT deflateInit2 OF((z_streamp strm,
+ int level,
+ int method,
+ int windowBits,
+ int memLevel,
+ int strategy));
+
+ This is another version of deflateInit with more compression options. The
+ fields next_in, zalloc, zfree and opaque must be initialized before by the
+ caller.
+
+ The method parameter is the compression method. It must be Z_DEFLATED in
+ this version of the library.
+
+ The windowBits parameter is the base two logarithm of the window size
+ (the size of the history buffer). It should be in the range 8..15 for this
+ version of the library. Larger values of this parameter result in better
+ compression at the expense of memory usage. The default value is 15 if
+ deflateInit is used instead.
+
+ windowBits can also be -8..-15 for raw deflate. In this case, -windowBits
+ determines the window size. deflate() will then generate raw deflate data
+ with no zlib header or trailer, and will not compute an adler32 check value.
+
+ windowBits can also be greater than 15 for optional gzip encoding. Add
+ 16 to windowBits to write a simple gzip header and trailer around the
+ compressed data instead of a zlib wrapper. The gzip header will have no
+ file name, no extra data, no comment, no modification time (set to zero), no
+ header crc, and the operating system will be set to 255 (unknown). If a
+ gzip stream is being written, strm->adler is a crc32 instead of an adler32.
+
+ The memLevel parameter specifies how much memory should be allocated
+ for the internal compression state. memLevel=1 uses minimum memory but is
+ slow and reduces compression ratio; memLevel=9 uses maximum memory for
+ optimal speed. The default value is 8. See zconf.h for total memory usage
+ as a function of windowBits and memLevel.
+
+ The strategy parameter is used to tune the compression algorithm. Use the
+ value Z_DEFAULT_STRATEGY for normal data, Z_FILTERED for data produced by a
+ filter (or predictor), Z_HUFFMAN_ONLY to force Huffman encoding only (no
+ string match), or Z_RLE to limit match distances to one (run-length
+ encoding). Filtered data consists mostly of small values with a somewhat
+ random distribution. In this case, the compression algorithm is tuned to
+ compress them better. The effect of Z_FILTERED is to force more Huffman
+ coding and less string matching; it is somewhat intermediate between
+ Z_DEFAULT_STRATEGY and Z_HUFFMAN_ONLY. Z_RLE is designed to be almost as
+ fast as Z_HUFFMAN_ONLY, but give better compression for PNG image data. The
+ strategy parameter only affects the compression ratio but not the
+ correctness of the compressed output even if it is not set appropriately.
+ Z_FIXED prevents the use of dynamic Huffman codes, allowing for a simpler
+ decoder for special applications.
+
+ deflateInit2 returns Z_OK if success, Z_MEM_ERROR if there was not enough
+ memory, Z_STREAM_ERROR if any parameter is invalid (such as an invalid
+ method), or Z_VERSION_ERROR if the zlib library version (zlib_version) is
+ incompatible with the version assumed by the caller (ZLIB_VERSION). msg is
+ set to null if there is no error message. deflateInit2 does not perform any
+ compression: this will be done by deflate().
+*/
+
+ZEXTERN int ZEXPORT deflateSetDictionary OF((z_streamp strm,
+ const Bytef *dictionary,
+ uInt dictLength));
+/*
+ Initializes the compression dictionary from the given byte sequence
+ without producing any compressed output. When using the zlib format, this
+ function must be called immediately after deflateInit, deflateInit2 or
+ deflateReset, and before any call of deflate. When doing raw deflate, this
+ function must be called either before any call of deflate, or immediately
+ after the completion of a deflate block, i.e. after all input has been
+ consumed and all output has been delivered when using any of the flush
+ options Z_BLOCK, Z_PARTIAL_FLUSH, Z_SYNC_FLUSH, or Z_FULL_FLUSH. The
+ compressor and decompressor must use exactly the same dictionary (see
+ inflateSetDictionary).
+
+ The dictionary should consist of strings (byte sequences) that are likely
+ to be encountered later in the data to be compressed, with the most commonly
+ used strings preferably put towards the end of the dictionary. Using a
+ dictionary is most useful when the data to be compressed is short and can be
+ predicted with good accuracy; the data can then be compressed better than
+ with the default empty dictionary.
+
+ Depending on the size of the compression data structures selected by
+ deflateInit or deflateInit2, a part of the dictionary may in effect be
+ discarded, for example if the dictionary is larger than the window size
+ provided in deflateInit or deflateInit2. Thus the strings most likely to be
+ useful should be put at the end of the dictionary, not at the front. In
+ addition, the current implementation of deflate will use at most the window
+ size minus 262 bytes of the provided dictionary.
+
+ Upon return of this function, strm->adler is set to the adler32 value
+ of the dictionary; the decompressor may later use this value to determine
+ which dictionary has been used by the compressor. (The adler32 value
+ applies to the whole dictionary even if only a subset of the dictionary is
+ actually used by the compressor.) If a raw deflate was requested, then the
+ adler32 value is not computed and strm->adler is not set.
+
+ deflateSetDictionary returns Z_OK if success, or Z_STREAM_ERROR if a
+ parameter is invalid (e.g. dictionary being Z_NULL) or the stream state is
+ inconsistent (for example if deflate has already been called for this stream
+ or if not at a block boundary for raw deflate). deflateSetDictionary does
+ not perform any compression: this will be done by deflate().
+*/
+
+ZEXTERN int ZEXPORT deflateCopy OF((z_streamp dest,
+ z_streamp source));
+/*
+ Sets the destination stream as a complete copy of the source stream.
+
+ This function can be useful when several compression strategies will be
+ tried, for example when there are several ways of pre-processing the input
+ data with a filter. The streams that will be discarded should then be freed
+ by calling deflateEnd. Note that deflateCopy duplicates the internal
+ compression state which can be quite large, so this strategy is slow and can
+ consume lots of memory.
+
+ deflateCopy returns Z_OK if success, Z_MEM_ERROR if there was not
+ enough memory, Z_STREAM_ERROR if the source stream state was inconsistent
+ (such as zalloc being Z_NULL). msg is left unchanged in both source and
+ destination.
+*/
+
+ZEXTERN int ZEXPORT deflateReset OF((z_streamp strm));
+/*
+ This function is equivalent to deflateEnd followed by deflateInit,
+ but does not free and reallocate all the internal compression state. The
+ stream will keep the same compression level and any other attributes that
+ may have been set by deflateInit2.
+
+ deflateReset returns Z_OK if success, or Z_STREAM_ERROR if the source
+ stream state was inconsistent (such as zalloc or state being Z_NULL).
+*/
+
+ZEXTERN int ZEXPORT deflateParams OF((z_streamp strm,
+ int level,
+ int strategy));
+/*
+ Dynamically update the compression level and compression strategy. The
+ interpretation of level and strategy is as in deflateInit2. This can be
+ used to switch between compression and straight copy of the input data, or
+ to switch to a different kind of input data requiring a different strategy.
+ If the compression level is changed, the input available so far is
+ compressed with the old level (and may be flushed); the new level will take
+ effect only at the next call of deflate().
+
+ Before the call of deflateParams, the stream state must be set as for
+ a call of deflate(), since the currently available input may have to be
+ compressed and flushed. In particular, strm->avail_out must be non-zero.
+
+ deflateParams returns Z_OK if success, Z_STREAM_ERROR if the source
+ stream state was inconsistent or if a parameter was invalid, Z_BUF_ERROR if
+ strm->avail_out was zero.
+*/
+
+ZEXTERN int ZEXPORT deflateTune OF((z_streamp strm,
+ int good_length,
+ int max_lazy,
+ int nice_length,
+ int max_chain));
+/*
+ Fine tune deflate's internal compression parameters. This should only be
+ used by someone who understands the algorithm used by zlib's deflate for
+ searching for the best matching string, and even then only by the most
+ fanatic optimizer trying to squeeze out the last compressed bit for their
+ specific input data. Read the deflate.c source code for the meaning of the
+ max_lazy, good_length, nice_length, and max_chain parameters.
+
+ deflateTune() can be called after deflateInit() or deflateInit2(), and
+ returns Z_OK on success, or Z_STREAM_ERROR for an invalid deflate stream.
+ */
+
+ZEXTERN uLong ZEXPORT deflateBound OF((z_streamp strm,
+ uLong sourceLen));
+/*
+ deflateBound() returns an upper bound on the compressed size after
+ deflation of sourceLen bytes. It must be called after deflateInit() or
+ deflateInit2(), and after deflateSetHeader(), if used. This would be used
+ to allocate an output buffer for deflation in a single pass, and so would be
+ called before deflate(). If that first deflate() call is provided the
+ sourceLen input bytes, an output buffer allocated to the size returned by
+ deflateBound(), and the flush value Z_FINISH, then deflate() is guaranteed
+ to return Z_STREAM_END. Note that it is possible for the compressed size to
+ be larger than the value returned by deflateBound() if flush options other
+ than Z_FINISH or Z_NO_FLUSH are used.
+*/
+
+ZEXTERN int ZEXPORT deflatePending OF((z_streamp strm,
+ unsigned *pending,
+ int *bits));
+/*
+ deflatePending() returns the number of bytes and bits of output that have
+ been generated, but not yet provided in the available output. The bytes not
+ provided would be due to the available output space having being consumed.
+ The number of bits of output not provided are between 0 and 7, where they
+ await more bits to join them in order to fill out a full byte. If pending
+ or bits are Z_NULL, then those values are not set.
+
+ deflatePending returns Z_OK if success, or Z_STREAM_ERROR if the source
+ stream state was inconsistent.
+ */
+
+ZEXTERN int ZEXPORT deflatePrime OF((z_streamp strm,
+ int bits,
+ int value));
+/*
+ deflatePrime() inserts bits in the deflate output stream. The intent
+ is that this function is used to start off the deflate output with the bits
+ leftover from a previous deflate stream when appending to it. As such, this
+ function can only be used for raw deflate, and must be used before the first
+ deflate() call after a deflateInit2() or deflateReset(). bits must be less
+ than or equal to 16, and that many of the least significant bits of value
+ will be inserted in the output.
+
+ deflatePrime returns Z_OK if success, Z_BUF_ERROR if there was not enough
+ room in the internal buffer to insert the bits, or Z_STREAM_ERROR if the
+ source stream state was inconsistent.
+*/
+
+ZEXTERN int ZEXPORT deflateSetHeader OF((z_streamp strm,
+ gz_headerp head));
+/*
+ deflateSetHeader() provides gzip header information for when a gzip
+ stream is requested by deflateInit2(). deflateSetHeader() may be called
+ after deflateInit2() or deflateReset() and before the first call of
+ deflate(). The text, time, os, extra field, name, and comment information
+ in the provided gz_header structure are written to the gzip header (xflag is
+ ignored -- the extra flags are set according to the compression level). The
+ caller must assure that, if not Z_NULL, name and comment are terminated with
+ a zero byte, and that if extra is not Z_NULL, that extra_len bytes are
+ available there. If hcrc is true, a gzip header crc is included. Note that
+ the current versions of the command-line version of gzip (up through version
+ 1.3.x) do not support header crc's, and will report that it is a "multi-part
+ gzip file" and give up.
+
+ If deflateSetHeader is not used, the default gzip header has text false,
+ the time set to zero, and os set to 255, with no extra, name, or comment
+ fields. The gzip header is returned to the default state by deflateReset().
+
+ deflateSetHeader returns Z_OK if success, or Z_STREAM_ERROR if the source
+ stream state was inconsistent.
+*/
+
+/*
+ZEXTERN int ZEXPORT inflateInit2 OF((z_streamp strm,
+ int windowBits));
+
+ This is another version of inflateInit with an extra parameter. The
+ fields next_in, avail_in, zalloc, zfree and opaque must be initialized
+ before by the caller.
+
+ The windowBits parameter is the base two logarithm of the maximum window
+ size (the size of the history buffer). It should be in the range 8..15 for
+ this version of the library. The default value is 15 if inflateInit is used
+ instead. windowBits must be greater than or equal to the windowBits value
+ provided to deflateInit2() while compressing, or it must be equal to 15 if
+ deflateInit2() was not used. If a compressed stream with a larger window
+ size is given as input, inflate() will return with the error code
+ Z_DATA_ERROR instead of trying to allocate a larger window.
+
+ windowBits can also be zero to request that inflate use the window size in
+ the zlib header of the compressed stream.
+
+ windowBits can also be -8..-15 for raw inflate. In this case, -windowBits
+ determines the window size. inflate() will then process raw deflate data,
+ not looking for a zlib or gzip header, not generating a check value, and not
+ looking for any check values for comparison at the end of the stream. This
+ is for use with other formats that use the deflate compressed data format
+ such as zip. Those formats provide their own check values. If a custom
+ format is developed using the raw deflate format for compressed data, it is
+ recommended that a check value such as an adler32 or a crc32 be applied to
+ the uncompressed data as is done in the zlib, gzip, and zip formats. For
+ most applications, the zlib format should be used as is. Note that comments
+ above on the use in deflateInit2() applies to the magnitude of windowBits.
+
+ windowBits can also be greater than 15 for optional gzip decoding. Add
+ 32 to windowBits to enable zlib and gzip decoding with automatic header
+ detection, or add 16 to decode only the gzip format (the zlib format will
+ return a Z_DATA_ERROR). If a gzip stream is being decoded, strm->adler is a
+ crc32 instead of an adler32.
+
+ inflateInit2 returns Z_OK if success, Z_MEM_ERROR if there was not enough
+ memory, Z_VERSION_ERROR if the zlib library version is incompatible with the
+ version assumed by the caller, or Z_STREAM_ERROR if the parameters are
+ invalid, such as a null pointer to the structure. msg is set to null if
+ there is no error message. inflateInit2 does not perform any decompression
+ apart from possibly reading the zlib header if present: actual decompression
+ will be done by inflate(). (So next_in and avail_in may be modified, but
+ next_out and avail_out are unused and unchanged.) The current implementation
+ of inflateInit2() does not process any header information -- that is
+ deferred until inflate() is called.
+*/
+
+ZEXTERN int ZEXPORT inflateSetDictionary OF((z_streamp strm,
+ const Bytef *dictionary,
+ uInt dictLength));
+/*
+ Initializes the decompression dictionary from the given uncompressed byte
+ sequence. This function must be called immediately after a call of inflate,
+ if that call returned Z_NEED_DICT. The dictionary chosen by the compressor
+ can be determined from the adler32 value returned by that call of inflate.
+ The compressor and decompressor must use exactly the same dictionary (see
+ deflateSetDictionary). For raw inflate, this function can be called at any
+ time to set the dictionary. If the provided dictionary is smaller than the
+ window and there is already data in the window, then the provided dictionary
+ will amend what's there. The application must insure that the dictionary
+ that was used for compression is provided.
+
+ inflateSetDictionary returns Z_OK if success, Z_STREAM_ERROR if a
+ parameter is invalid (e.g. dictionary being Z_NULL) or the stream state is
+ inconsistent, Z_DATA_ERROR if the given dictionary doesn't match the
+ expected one (incorrect adler32 value). inflateSetDictionary does not
+ perform any decompression: this will be done by subsequent calls of
+ inflate().
+*/
+
+ZEXTERN int ZEXPORT inflateGetDictionary OF((z_streamp strm,
+ Bytef *dictionary,
+ uInt *dictLength));
+/*
+ Returns the sliding dictionary being maintained by inflate. dictLength is
+ set to the number of bytes in the dictionary, and that many bytes are copied
+ to dictionary. dictionary must have enough space, where 32768 bytes is
+ always enough. If inflateGetDictionary() is called with dictionary equal to
+ Z_NULL, then only the dictionary length is returned, and nothing is copied.
+ Similary, if dictLength is Z_NULL, then it is not set.
+
+ inflateGetDictionary returns Z_OK on success, or Z_STREAM_ERROR if the
+ stream state is inconsistent.
+*/
+
+ZEXTERN int ZEXPORT inflateSync OF((z_streamp strm));
+/*
+ Skips invalid compressed data until a possible full flush point (see above
+ for the description of deflate with Z_FULL_FLUSH) can be found, or until all
+ available input is skipped. No output is provided.
+
+ inflateSync searches for a 00 00 FF FF pattern in the compressed data.
+ All full flush points have this pattern, but not all occurrences of this
+ pattern are full flush points.
+
+ inflateSync returns Z_OK if a possible full flush point has been found,
+ Z_BUF_ERROR if no more input was provided, Z_DATA_ERROR if no flush point
+ has been found, or Z_STREAM_ERROR if the stream structure was inconsistent.
+ In the success case, the application may save the current current value of
+ total_in which indicates where valid compressed data was found. In the
+ error case, the application may repeatedly call inflateSync, providing more
+ input each time, until success or end of the input data.
+*/
+
+ZEXTERN int ZEXPORT inflateCopy OF((z_streamp dest,
+ z_streamp source));
+/*
+ Sets the destination stream as a complete copy of the source stream.
+
+ This function can be useful when randomly accessing a large stream. The
+ first pass through the stream can periodically record the inflate state,
+ allowing restarting inflate at those points when randomly accessing the
+ stream.
+
+ inflateCopy returns Z_OK if success, Z_MEM_ERROR if there was not
+ enough memory, Z_STREAM_ERROR if the source stream state was inconsistent
+ (such as zalloc being Z_NULL). msg is left unchanged in both source and
+ destination.
+*/
+
+ZEXTERN int ZEXPORT inflateReset OF((z_streamp strm));
+/*
+ This function is equivalent to inflateEnd followed by inflateInit,
+ but does not free and reallocate all the internal decompression state. The
+ stream will keep attributes that may have been set by inflateInit2.
+
+ inflateReset returns Z_OK if success, or Z_STREAM_ERROR if the source
+ stream state was inconsistent (such as zalloc or state being Z_NULL).
+*/
+
+ZEXTERN int ZEXPORT inflateReset2 OF((z_streamp strm,
+ int windowBits));
+/*
+ This function is the same as inflateReset, but it also permits changing
+ the wrap and window size requests. The windowBits parameter is interpreted
+ the same as it is for inflateInit2.
+
+ inflateReset2 returns Z_OK if success, or Z_STREAM_ERROR if the source
+ stream state was inconsistent (such as zalloc or state being Z_NULL), or if
+ the windowBits parameter is invalid.
+*/
+
+ZEXTERN int ZEXPORT inflatePrime OF((z_streamp strm,
+ int bits,
+ int value));
+/*
+ This function inserts bits in the inflate input stream. The intent is
+ that this function is used to start inflating at a bit position in the
+ middle of a byte. The provided bits will be used before any bytes are used
+ from next_in. This function should only be used with raw inflate, and
+ should be used before the first inflate() call after inflateInit2() or
+ inflateReset(). bits must be less than or equal to 16, and that many of the
+ least significant bits of value will be inserted in the input.
+
+ If bits is negative, then the input stream bit buffer is emptied. Then
+ inflatePrime() can be called again to put bits in the buffer. This is used
+ to clear out bits leftover after feeding inflate a block description prior
+ to feeding inflate codes.
+
+ inflatePrime returns Z_OK if success, or Z_STREAM_ERROR if the source
+ stream state was inconsistent.
+*/
+
+ZEXTERN long ZEXPORT inflateMark OF((z_streamp strm));
+/*
+ This function returns two values, one in the lower 16 bits of the return
+ value, and the other in the remaining upper bits, obtained by shifting the
+ return value down 16 bits. If the upper value is -1 and the lower value is
+ zero, then inflate() is currently decoding information outside of a block.
+ If the upper value is -1 and the lower value is non-zero, then inflate is in
+ the middle of a stored block, with the lower value equaling the number of
+ bytes from the input remaining to copy. If the upper value is not -1, then
+ it is the number of bits back from the current bit position in the input of
+ the code (literal or length/distance pair) currently being processed. In
+ that case the lower value is the number of bytes already emitted for that
+ code.
+
+ A code is being processed if inflate is waiting for more input to complete
+ decoding of the code, or if it has completed decoding but is waiting for
+ more output space to write the literal or match data.
+
+ inflateMark() is used to mark locations in the input data for random
+ access, which may be at bit positions, and to note those cases where the
+ output of a code may span boundaries of random access blocks. The current
+ location in the input stream can be determined from avail_in and data_type
+ as noted in the description for the Z_BLOCK flush parameter for inflate.
+
+ inflateMark returns the value noted above or -1 << 16 if the provided
+ source stream state was inconsistent.
+*/
+
+ZEXTERN int ZEXPORT inflateGetHeader OF((z_streamp strm,
+ gz_headerp head));
+/*
+ inflateGetHeader() requests that gzip header information be stored in the
+ provided gz_header structure. inflateGetHeader() may be called after
+ inflateInit2() or inflateReset(), and before the first call of inflate().
+ As inflate() processes the gzip stream, head->done is zero until the header
+ is completed, at which time head->done is set to one. If a zlib stream is
+ being decoded, then head->done is set to -1 to indicate that there will be
+ no gzip header information forthcoming. Note that Z_BLOCK or Z_TREES can be
+ used to force inflate() to return immediately after header processing is
+ complete and before any actual data is decompressed.
+
+ The text, time, xflags, and os fields are filled in with the gzip header
+ contents. hcrc is set to true if there is a header CRC. (The header CRC
+ was valid if done is set to one.) If extra is not Z_NULL, then extra_max
+ contains the maximum number of bytes to write to extra. Once done is true,
+ extra_len contains the actual extra field length, and extra contains the
+ extra field, or that field truncated if extra_max is less than extra_len.
+ If name is not Z_NULL, then up to name_max characters are written there,
+ terminated with a zero unless the length is greater than name_max. If
+ comment is not Z_NULL, then up to comm_max characters are written there,
+ terminated with a zero unless the length is greater than comm_max. When any
+ of extra, name, or comment are not Z_NULL and the respective field is not
+ present in the header, then that field is set to Z_NULL to signal its
+ absence. This allows the use of deflateSetHeader() with the returned
+ structure to duplicate the header. However if those fields are set to
+ allocated memory, then the application will need to save those pointers
+ elsewhere so that they can be eventually freed.
+
+ If inflateGetHeader is not used, then the header information is simply
+ discarded. The header is always checked for validity, including the header
+ CRC if present. inflateReset() will reset the process to discard the header
+ information. The application would need to call inflateGetHeader() again to
+ retrieve the header from the next gzip stream.
+
+ inflateGetHeader returns Z_OK if success, or Z_STREAM_ERROR if the source
+ stream state was inconsistent.
+*/
+
+/*
+ZEXTERN int ZEXPORT inflateBackInit OF((z_streamp strm, int windowBits,
+ unsigned char FAR *window));
+
+ Initialize the internal stream state for decompression using inflateBack()
+ calls. The fields zalloc, zfree and opaque in strm must be initialized
+ before the call. If zalloc and zfree are Z_NULL, then the default library-
+ derived memory allocation routines are used. windowBits is the base two
+ logarithm of the window size, in the range 8..15. window is a caller
+ supplied buffer of that size. Except for special applications where it is
+ assured that deflate was used with small window sizes, windowBits must be 15
+ and a 32K byte window must be supplied to be able to decompress general
+ deflate streams.
+
+ See inflateBack() for the usage of these routines.
+
+ inflateBackInit will return Z_OK on success, Z_STREAM_ERROR if any of
+ the parameters are invalid, Z_MEM_ERROR if the internal state could not be
+ allocated, or Z_VERSION_ERROR if the version of the library does not match
+ the version of the header file.
+*/
+
+typedef unsigned (*in_func) OF((void FAR *,
+ z_const unsigned char FAR * FAR *));
+typedef int (*out_func) OF((void FAR *, unsigned char FAR *, unsigned));
+
+ZEXTERN int ZEXPORT inflateBack OF((z_streamp strm,
+ in_func in, void FAR *in_desc,
+ out_func out, void FAR *out_desc));
+/*
+ inflateBack() does a raw inflate with a single call using a call-back
+ interface for input and output. This is potentially more efficient than
+ inflate() for file i/o applications, in that it avoids copying between the
+ output and the sliding window by simply making the window itself the output
+ buffer. inflate() can be faster on modern CPUs when used with large
+ buffers. inflateBack() trusts the application to not change the output
+ buffer passed by the output function, at least until inflateBack() returns.
+
+ inflateBackInit() must be called first to allocate the internal state
+ and to initialize the state with the user-provided window buffer.
+ inflateBack() may then be used multiple times to inflate a complete, raw
+ deflate stream with each call. inflateBackEnd() is then called to free the
+ allocated state.
+
+ A raw deflate stream is one with no zlib or gzip header or trailer.
+ This routine would normally be used in a utility that reads zip or gzip
+ files and writes out uncompressed files. The utility would decode the
+ header and process the trailer on its own, hence this routine expects only
+ the raw deflate stream to decompress. This is different from the normal
+ behavior of inflate(), which expects either a zlib or gzip header and
+ trailer around the deflate stream.
+
+ inflateBack() uses two subroutines supplied by the caller that are then
+ called by inflateBack() for input and output. inflateBack() calls those
+ routines until it reads a complete deflate stream and writes out all of the
+ uncompressed data, or until it encounters an error. The function's
+ parameters and return types are defined above in the in_func and out_func
+ typedefs. inflateBack() will call in(in_desc, &buf) which should return the
+ number of bytes of provided input, and a pointer to that input in buf. If
+ there is no input available, in() must return zero--buf is ignored in that
+ case--and inflateBack() will return a buffer error. inflateBack() will call
+ out(out_desc, buf, len) to write the uncompressed data buf[0..len-1]. out()
+ should return zero on success, or non-zero on failure. If out() returns
+ non-zero, inflateBack() will return with an error. Neither in() nor out()
+ are permitted to change the contents of the window provided to
+ inflateBackInit(), which is also the buffer that out() uses to write from.
+ The length written by out() will be at most the window size. Any non-zero
+ amount of input may be provided by in().
+
+ For convenience, inflateBack() can be provided input on the first call by
+ setting strm->next_in and strm->avail_in. If that input is exhausted, then
+ in() will be called. Therefore strm->next_in must be initialized before
+ calling inflateBack(). If strm->next_in is Z_NULL, then in() will be called
+ immediately for input. If strm->next_in is not Z_NULL, then strm->avail_in
+ must also be initialized, and then if strm->avail_in is not zero, input will
+ initially be taken from strm->next_in[0 .. strm->avail_in - 1].
+
+ The in_desc and out_desc parameters of inflateBack() is passed as the
+ first parameter of in() and out() respectively when they are called. These
+ descriptors can be optionally used to pass any information that the caller-
+ supplied in() and out() functions need to do their job.
+
+ On return, inflateBack() will set strm->next_in and strm->avail_in to
+ pass back any unused input that was provided by the last in() call. The
+ return values of inflateBack() can be Z_STREAM_END on success, Z_BUF_ERROR
+ if in() or out() returned an error, Z_DATA_ERROR if there was a format error
+ in the deflate stream (in which case strm->msg is set to indicate the nature
+ of the error), or Z_STREAM_ERROR if the stream was not properly initialized.
+ In the case of Z_BUF_ERROR, an input or output error can be distinguished
+ using strm->next_in which will be Z_NULL only if in() returned an error. If
+ strm->next_in is not Z_NULL, then the Z_BUF_ERROR was due to out() returning
+ non-zero. (in() will always be called before out(), so strm->next_in is
+ assured to be defined if out() returns non-zero.) Note that inflateBack()
+ cannot return Z_OK.
+*/
+
+ZEXTERN int ZEXPORT inflateBackEnd OF((z_streamp strm));
+/*
+ All memory allocated by inflateBackInit() is freed.
+
+ inflateBackEnd() returns Z_OK on success, or Z_STREAM_ERROR if the stream
+ state was inconsistent.
+*/
+
+ZEXTERN uLong ZEXPORT zlibCompileFlags OF((void));
+/* Return flags indicating compile-time options.
+
+ Type sizes, two bits each, 00 = 16 bits, 01 = 32, 10 = 64, 11 = other:
+ 1.0: size of uInt
+ 3.2: size of uLong
+ 5.4: size of voidpf (pointer)
+ 7.6: size of z_off_t
+
+ Compiler, assembler, and debug options:
+ 8: DEBUG
+ 9: ASMV or ASMINF -- use ASM code
+ 10: ZLIB_WINAPI -- exported functions use the WINAPI calling convention
+ 11: 0 (reserved)
+
+ One-time table building (smaller code, but not thread-safe if true):
+ 12: BUILDFIXED -- build static block decoding tables when needed
+ 13: DYNAMIC_CRC_TABLE -- build CRC calculation tables when needed
+ 14,15: 0 (reserved)
+
+ Library content (indicates missing functionality):
+ 16: NO_GZCOMPRESS -- gz* functions cannot compress (to avoid linking
+ deflate code when not needed)
+ 17: NO_GZIP -- deflate can't write gzip streams, and inflate can't detect
+ and decode gzip streams (to avoid linking crc code)
+ 18-19: 0 (reserved)
+
+ Operation variations (changes in library functionality):
+ 20: PKZIP_BUG_WORKAROUND -- slightly more permissive inflate
+ 21: FASTEST -- deflate algorithm with only one, lowest compression level
+ 22,23: 0 (reserved)
+
+ The sprintf variant used by gzprintf (zero is best):
+ 24: 0 = vs*, 1 = s* -- 1 means limited to 20 arguments after the format
+ 25: 0 = *nprintf, 1 = *printf -- 1 means gzprintf() not secure!
+ 26: 0 = returns value, 1 = void -- 1 means inferred string length returned
+
+ Remainder:
+ 27-31: 0 (reserved)
+ */
+
+#ifndef Z_SOLO
+
+ /* utility functions */
+
+/*
+ The following utility functions are implemented on top of the basic
+ stream-oriented functions. To simplify the interface, some default options
+ are assumed (compression level and memory usage, standard memory allocation
+ functions). The source code of these utility functions can be modified if
+ you need special options.
+*/
+
+ZEXTERN int ZEXPORT compress OF((Bytef *dest, uLongf *destLen,
+ const Bytef *source, uLong sourceLen));
+/*
+ Compresses the source buffer into the destination buffer. sourceLen is
+ the byte length of the source buffer. Upon entry, destLen is the total size
+ of the destination buffer, which must be at least the value returned by
+ compressBound(sourceLen). Upon exit, destLen is the actual size of the
+ compressed buffer.
+
+ compress returns Z_OK if success, Z_MEM_ERROR if there was not
+ enough memory, Z_BUF_ERROR if there was not enough room in the output
+ buffer.
+*/
+
+ZEXTERN int ZEXPORT compress2 OF((Bytef *dest, uLongf *destLen,
+ const Bytef *source, uLong sourceLen,
+ int level));
+/*
+ Compresses the source buffer into the destination buffer. The level
+ parameter has the same meaning as in deflateInit. sourceLen is the byte
+ length of the source buffer. Upon entry, destLen is the total size of the
+ destination buffer, which must be at least the value returned by
+ compressBound(sourceLen). Upon exit, destLen is the actual size of the
+ compressed buffer.
+
+ compress2 returns Z_OK if success, Z_MEM_ERROR if there was not enough
+ memory, Z_BUF_ERROR if there was not enough room in the output buffer,
+ Z_STREAM_ERROR if the level parameter is invalid.
+*/
+
+ZEXTERN uLong ZEXPORT compressBound OF((uLong sourceLen));
+/*
+ compressBound() returns an upper bound on the compressed size after
+ compress() or compress2() on sourceLen bytes. It would be used before a
+ compress() or compress2() call to allocate the destination buffer.
+*/
+
+ZEXTERN int ZEXPORT uncompress OF((Bytef *dest, uLongf *destLen,
+ const Bytef *source, uLong sourceLen));
+/*
+ Decompresses the source buffer into the destination buffer. sourceLen is
+ the byte length of the source buffer. Upon entry, destLen is the total size
+ of the destination buffer, which must be large enough to hold the entire
+ uncompressed data. (The size of the uncompressed data must have been saved
+ previously by the compressor and transmitted to the decompressor by some
+ mechanism outside the scope of this compression library.) Upon exit, destLen
+ is the actual size of the uncompressed buffer.
+
+ uncompress returns Z_OK if success, Z_MEM_ERROR if there was not
+ enough memory, Z_BUF_ERROR if there was not enough room in the output
+ buffer, or Z_DATA_ERROR if the input data was corrupted or incomplete. In
+ the case where there is not enough room, uncompress() will fill the output
+ buffer with the uncompressed data up to that point.
+*/
+
+ /* gzip file access functions */
+
+/*
+ This library supports reading and writing files in gzip (.gz) format with
+ an interface similar to that of stdio, using the functions that start with
+ "gz". The gzip format is different from the zlib format. gzip is a gzip
+ wrapper, documented in RFC 1952, wrapped around a deflate stream.
+*/
+
+typedef struct gzFile_s *gzFile; /* semi-opaque gzip file descriptor */
+
+/*
+ZEXTERN gzFile ZEXPORT gzopen OF((const char *path, const char *mode));
+
+ Opens a gzip (.gz) file for reading or writing. The mode parameter is as
+ in fopen ("rb" or "wb") but can also include a compression level ("wb9") or
+ a strategy: 'f' for filtered data as in "wb6f", 'h' for Huffman-only
+ compression as in "wb1h", 'R' for run-length encoding as in "wb1R", or 'F'
+ for fixed code compression as in "wb9F". (See the description of
+ deflateInit2 for more information about the strategy parameter.) 'T' will
+ request transparent writing or appending with no compression and not using
+ the gzip format.
+
+ "a" can be used instead of "w" to request that the gzip stream that will
+ be written be appended to the file. "+" will result in an error, since
+ reading and writing to the same gzip file is not supported. The addition of
+ "x" when writing will create the file exclusively, which fails if the file
+ already exists. On systems that support it, the addition of "e" when
+ reading or writing will set the flag to close the file on an execve() call.
+
+ These functions, as well as gzip, will read and decode a sequence of gzip
+ streams in a file. The append function of gzopen() can be used to create
+ such a file. (Also see gzflush() for another way to do this.) When
+ appending, gzopen does not test whether the file begins with a gzip stream,
+ nor does it look for the end of the gzip streams to begin appending. gzopen
+ will simply append a gzip stream to the existing file.
+
+ gzopen can be used to read a file which is not in gzip format; in this
+ case gzread will directly read from the file without decompression. When
+ reading, this will be detected automatically by looking for the magic two-
+ byte gzip header.
+
+ gzopen returns NULL if the file could not be opened, if there was
+ insufficient memory to allocate the gzFile state, or if an invalid mode was
+ specified (an 'r', 'w', or 'a' was not provided, or '+' was provided).
+ errno can be checked to determine if the reason gzopen failed was that the
+ file could not be opened.
+*/
+
+ZEXTERN gzFile ZEXPORT gzdopen OF((int fd, const char *mode));
+/*
+ gzdopen associates a gzFile with the file descriptor fd. File descriptors
+ are obtained from calls like open, dup, creat, pipe or fileno (if the file
+ has been previously opened with fopen). The mode parameter is as in gzopen.
+
+ The next call of gzclose on the returned gzFile will also close the file
+ descriptor fd, just like fclose(fdopen(fd, mode)) closes the file descriptor
+ fd. If you want to keep fd open, use fd = dup(fd_keep); gz = gzdopen(fd,
+ mode);. The duplicated descriptor should be saved to avoid a leak, since
+ gzdopen does not close fd if it fails. If you are using fileno() to get the
+ file descriptor from a FILE *, then you will have to use dup() to avoid
+ double-close()ing the file descriptor. Both gzclose() and fclose() will
+ close the associated file descriptor, so they need to have different file
+ descriptors.
+
+ gzdopen returns NULL if there was insufficient memory to allocate the
+ gzFile state, if an invalid mode was specified (an 'r', 'w', or 'a' was not
+ provided, or '+' was provided), or if fd is -1. The file descriptor is not
+ used until the next gz* read, write, seek, or close operation, so gzdopen
+ will not detect if fd is invalid (unless fd is -1).
+*/
+
+ZEXTERN int ZEXPORT gzbuffer OF((gzFile file, unsigned size));
+/*
+ Set the internal buffer size used by this library's functions. The
+ default buffer size is 8192 bytes. This function must be called after
+ gzopen() or gzdopen(), and before any other calls that read or write the
+ file. The buffer memory allocation is always deferred to the first read or
+ write. Two buffers are allocated, either both of the specified size when
+ writing, or one of the specified size and the other twice that size when
+ reading. A larger buffer size of, for example, 64K or 128K bytes will
+ noticeably increase the speed of decompression (reading).
+
+ The new buffer size also affects the maximum length for gzprintf().
+
+ gzbuffer() returns 0 on success, or -1 on failure, such as being called
+ too late.
+*/
+
+ZEXTERN int ZEXPORT gzsetparams OF((gzFile file, int level, int strategy));
+/*
+ Dynamically update the compression level or strategy. See the description
+ of deflateInit2 for the meaning of these parameters.
+
+ gzsetparams returns Z_OK if success, or Z_STREAM_ERROR if the file was not
+ opened for writing.
+*/
+
+ZEXTERN int ZEXPORT gzread OF((gzFile file, voidp buf, unsigned len));
+/*
+ Reads the given number of uncompressed bytes from the compressed file. If
+ the input file is not in gzip format, gzread copies the given number of
+ bytes into the buffer directly from the file.
+
+ After reaching the end of a gzip stream in the input, gzread will continue
+ to read, looking for another gzip stream. Any number of gzip streams may be
+ concatenated in the input file, and will all be decompressed by gzread().
+ If something other than a gzip stream is encountered after a gzip stream,
+ that remaining trailing garbage is ignored (and no error is returned).
+
+ gzread can be used to read a gzip file that is being concurrently written.
+ Upon reaching the end of the input, gzread will return with the available
+ data. If the error code returned by gzerror is Z_OK or Z_BUF_ERROR, then
+ gzclearerr can be used to clear the end of file indicator in order to permit
+ gzread to be tried again. Z_OK indicates that a gzip stream was completed
+ on the last gzread. Z_BUF_ERROR indicates that the input file ended in the
+ middle of a gzip stream. Note that gzread does not return -1 in the event
+ of an incomplete gzip stream. This error is deferred until gzclose(), which
+ will return Z_BUF_ERROR if the last gzread ended in the middle of a gzip
+ stream. Alternatively, gzerror can be used before gzclose to detect this
+ case.
+
+ gzread returns the number of uncompressed bytes actually read, less than
+ len for end of file, or -1 for error.
+*/
+
+ZEXTERN int ZEXPORT gzwrite OF((gzFile file,
+ voidpc buf, unsigned len));
+/*
+ Writes the given number of uncompressed bytes into the compressed file.
+ gzwrite returns the number of uncompressed bytes written or 0 in case of
+ error.
+*/
+
+ZEXTERN int ZEXPORTVA gzprintf Z_ARG((gzFile file, const char *format, ...));
+/*
+ Converts, formats, and writes the arguments to the compressed file under
+ control of the format string, as in fprintf. gzprintf returns the number of
+ uncompressed bytes actually written, or 0 in case of error. The number of
+ uncompressed bytes written is limited to 8191, or one less than the buffer
+ size given to gzbuffer(). The caller should assure that this limit is not
+ exceeded. If it is exceeded, then gzprintf() will return an error (0) with
+ nothing written. In this case, there may also be a buffer overflow with
+ unpredictable consequences, which is possible only if zlib was compiled with
+ the insecure functions sprintf() or vsprintf() because the secure snprintf()
+ or vsnprintf() functions were not available. This can be determined using
+ zlibCompileFlags().
+*/
+
+ZEXTERN int ZEXPORT gzputs OF((gzFile file, const char *s));
+/*
+ Writes the given null-terminated string to the compressed file, excluding
+ the terminating null character.
+
+ gzputs returns the number of characters written, or -1 in case of error.
+*/
+
+ZEXTERN char * ZEXPORT gzgets OF((gzFile file, char *buf, int len));
+/*
+ Reads bytes from the compressed file until len-1 characters are read, or a
+ newline character is read and transferred to buf, or an end-of-file
+ condition is encountered. If any characters are read or if len == 1, the
+ string is terminated with a null character. If no characters are read due
+ to an end-of-file or len < 1, then the buffer is left untouched.
+
+ gzgets returns buf which is a null-terminated string, or it returns NULL
+ for end-of-file or in case of error. If there was an error, the contents at
+ buf are indeterminate.
+*/
+
+ZEXTERN int ZEXPORT gzputc OF((gzFile file, int c));
+/*
+ Writes c, converted to an unsigned char, into the compressed file. gzputc
+ returns the value that was written, or -1 in case of error.
+*/
+
+ZEXTERN int ZEXPORT gzgetc OF((gzFile file));
+/*
+ Reads one byte from the compressed file. gzgetc returns this byte or -1
+ in case of end of file or error. This is implemented as a macro for speed.
+ As such, it does not do all of the checking the other functions do. I.e.
+ it does not check to see if file is NULL, nor whether the structure file
+ points to has been clobbered or not.
+*/
+
+ZEXTERN int ZEXPORT gzungetc OF((int c, gzFile file));
+/*
+ Push one character back onto the stream to be read as the first character
+ on the next read. At least one character of push-back is allowed.
+ gzungetc() returns the character pushed, or -1 on failure. gzungetc() will
+ fail if c is -1, and may fail if a character has been pushed but not read
+ yet. If gzungetc is used immediately after gzopen or gzdopen, at least the
+ output buffer size of pushed characters is allowed. (See gzbuffer above.)
+ The pushed character will be discarded if the stream is repositioned with
+ gzseek() or gzrewind().
+*/
+
+ZEXTERN int ZEXPORT gzflush OF((gzFile file, int flush));
+/*
+ Flushes all pending output into the compressed file. The parameter flush
+ is as in the deflate() function. The return value is the zlib error number
+ (see function gzerror below). gzflush is only permitted when writing.
+
+ If the flush parameter is Z_FINISH, the remaining data is written and the
+ gzip stream is completed in the output. If gzwrite() is called again, a new
+ gzip stream will be started in the output. gzread() is able to read such
+ concatented gzip streams.
+
+ gzflush should be called only when strictly necessary because it will
+ degrade compression if called too often.
+*/
+
+/*
+ZEXTERN z_off_t ZEXPORT gzseek OF((gzFile file,
+ z_off_t offset, int whence));
+
+ Sets the starting position for the next gzread or gzwrite on the given
+ compressed file. The offset represents a number of bytes in the
+ uncompressed data stream. The whence parameter is defined as in lseek(2);
+ the value SEEK_END is not supported.
+
+ If the file is opened for reading, this function is emulated but can be
+ extremely slow. If the file is opened for writing, only forward seeks are
+ supported; gzseek then compresses a sequence of zeroes up to the new
+ starting position.
+
+ gzseek returns the resulting offset location as measured in bytes from
+ the beginning of the uncompressed stream, or -1 in case of error, in
+ particular if the file is opened for writing and the new starting position
+ would be before the current position.
+*/
+
+ZEXTERN int ZEXPORT gzrewind OF((gzFile file));
+/*
+ Rewinds the given file. This function is supported only for reading.
+
+ gzrewind(file) is equivalent to (int)gzseek(file, 0L, SEEK_SET)
+*/
+
+/*
+ZEXTERN z_off_t ZEXPORT gztell OF((gzFile file));
+
+ Returns the starting position for the next gzread or gzwrite on the given
+ compressed file. This position represents a number of bytes in the
+ uncompressed data stream, and is zero when starting, even if appending or
+ reading a gzip stream from the middle of a file using gzdopen().
+
+ gztell(file) is equivalent to gzseek(file, 0L, SEEK_CUR)
+*/
+
+/*
+ZEXTERN z_off_t ZEXPORT gzoffset OF((gzFile file));
+
+ Returns the current offset in the file being read or written. This offset
+ includes the count of bytes that precede the gzip stream, for example when
+ appending or when using gzdopen() for reading. When reading, the offset
+ does not include as yet unused buffered input. This information can be used
+ for a progress indicator. On error, gzoffset() returns -1.
+*/
+
+ZEXTERN int ZEXPORT gzeof OF((gzFile file));
+/*
+ Returns true (1) if the end-of-file indicator has been set while reading,
+ false (0) otherwise. Note that the end-of-file indicator is set only if the
+ read tried to go past the end of the input, but came up short. Therefore,
+ just like feof(), gzeof() may return false even if there is no more data to
+ read, in the event that the last read request was for the exact number of
+ bytes remaining in the input file. This will happen if the input file size
+ is an exact multiple of the buffer size.
+
+ If gzeof() returns true, then the read functions will return no more data,
+ unless the end-of-file indicator is reset by gzclearerr() and the input file
+ has grown since the previous end of file was detected.
+*/
+
+ZEXTERN int ZEXPORT gzdirect OF((gzFile file));
+/*
+ Returns true (1) if file is being copied directly while reading, or false
+ (0) if file is a gzip stream being decompressed.
+
+ If the input file is empty, gzdirect() will return true, since the input
+ does not contain a gzip stream.
+
+ If gzdirect() is used immediately after gzopen() or gzdopen() it will
+ cause buffers to be allocated to allow reading the file to determine if it
+ is a gzip file. Therefore if gzbuffer() is used, it should be called before
+ gzdirect().
+
+ When writing, gzdirect() returns true (1) if transparent writing was
+ requested ("wT" for the gzopen() mode), or false (0) otherwise. (Note:
+ gzdirect() is not needed when writing. Transparent writing must be
+ explicitly requested, so the application already knows the answer. When
+ linking statically, using gzdirect() will include all of the zlib code for
+ gzip file reading and decompression, which may not be desired.)
+*/
+
+ZEXTERN int ZEXPORT gzclose OF((gzFile file));
+/*
+ Flushes all pending output if necessary, closes the compressed file and
+ deallocates the (de)compression state. Note that once file is closed, you
+ cannot call gzerror with file, since its structures have been deallocated.
+ gzclose must not be called more than once on the same file, just as free
+ must not be called more than once on the same allocation.
+
+ gzclose will return Z_STREAM_ERROR if file is not valid, Z_ERRNO on a
+ file operation error, Z_MEM_ERROR if out of memory, Z_BUF_ERROR if the
+ last read ended in the middle of a gzip stream, or Z_OK on success.
+*/
+
+ZEXTERN int ZEXPORT gzclose_r OF((gzFile file));
+ZEXTERN int ZEXPORT gzclose_w OF((gzFile file));
+/*
+ Same as gzclose(), but gzclose_r() is only for use when reading, and
+ gzclose_w() is only for use when writing or appending. The advantage to
+ using these instead of gzclose() is that they avoid linking in zlib
+ compression or decompression code that is not used when only reading or only
+ writing respectively. If gzclose() is used, then both compression and
+ decompression code will be included the application when linking to a static
+ zlib library.
+*/
+
+ZEXTERN const char * ZEXPORT gzerror OF((gzFile file, int *errnum));
+/*
+ Returns the error message for the last error which occurred on the given
+ compressed file. errnum is set to zlib error number. If an error occurred
+ in the file system and not in the compression library, errnum is set to
+ Z_ERRNO and the application may consult errno to get the exact error code.
+
+ The application must not modify the returned string. Future calls to
+ this function may invalidate the previously returned string. If file is
+ closed, then the string previously returned by gzerror will no longer be
+ available.
+
+ gzerror() should be used to distinguish errors from end-of-file for those
+ functions above that do not distinguish those cases in their return values.
+*/
+
+ZEXTERN void ZEXPORT gzclearerr OF((gzFile file));
+/*
+ Clears the error and end-of-file flags for file. This is analogous to the
+ clearerr() function in stdio. This is useful for continuing to read a gzip
+ file that is being written concurrently.
+*/
+
+#endif /* !Z_SOLO */
+
+ /* checksum functions */
+
+/*
+ These functions are not related to compression but are exported
+ anyway because they might be useful in applications using the compression
+ library.
+*/
+
+ZEXTERN uLong ZEXPORT adler32 OF((uLong adler, const Bytef *buf, uInt len));
+/*
+ Update a running Adler-32 checksum with the bytes buf[0..len-1] and
+ return the updated checksum. If buf is Z_NULL, this function returns the
+ required initial value for the checksum.
+
+ An Adler-32 checksum is almost as reliable as a CRC32 but can be computed
+ much faster.
+
+ Usage example:
+
+ uLong adler = adler32(0L, Z_NULL, 0);
+
+ while (read_buffer(buffer, length) != EOF) {
+ adler = adler32(adler, buffer, length);
+ }
+ if (adler != original_adler) error();
+*/
+
+/*
+ZEXTERN uLong ZEXPORT adler32_combine OF((uLong adler1, uLong adler2,
+ z_off_t len2));
+
+ Combine two Adler-32 checksums into one. For two sequences of bytes, seq1
+ and seq2 with lengths len1 and len2, Adler-32 checksums were calculated for
+ each, adler1 and adler2. adler32_combine() returns the Adler-32 checksum of
+ seq1 and seq2 concatenated, requiring only adler1, adler2, and len2. Note
+ that the z_off_t type (like off_t) is a signed integer. If len2 is
+ negative, the result has no meaning or utility.
+*/
+
+ZEXTERN uLong ZEXPORT crc32 OF((uLong crc, const Bytef *buf, uInt len));
+/*
+ Update a running CRC-32 with the bytes buf[0..len-1] and return the
+ updated CRC-32. If buf is Z_NULL, this function returns the required
+ initial value for the crc. Pre- and post-conditioning (one's complement) is
+ performed within this function so it shouldn't be done by the application.
+
+ Usage example:
+
+ uLong crc = crc32(0L, Z_NULL, 0);
+
+ while (read_buffer(buffer, length) != EOF) {
+ crc = crc32(crc, buffer, length);
+ }
+ if (crc != original_crc) error();
+*/
+
+/*
+ZEXTERN uLong ZEXPORT crc32_combine OF((uLong crc1, uLong crc2, z_off_t len2));
+
+ Combine two CRC-32 check values into one. For two sequences of bytes,
+ seq1 and seq2 with lengths len1 and len2, CRC-32 check values were
+ calculated for each, crc1 and crc2. crc32_combine() returns the CRC-32
+ check value of seq1 and seq2 concatenated, requiring only crc1, crc2, and
+ len2.
+*/
+
+
+ /* various hacks, don't look :) */
+
+/* deflateInit and inflateInit are macros to allow checking the zlib version
+ * and the compiler's view of z_stream:
+ */
+ZEXTERN int ZEXPORT deflateInit_ OF((z_streamp strm, int level,
+ const char *version, int stream_size));
+ZEXTERN int ZEXPORT inflateInit_ OF((z_streamp strm,
+ const char *version, int stream_size));
+ZEXTERN int ZEXPORT deflateInit2_ OF((z_streamp strm, int level, int method,
+ int windowBits, int memLevel,
+ int strategy, const char *version,
+ int stream_size));
+ZEXTERN int ZEXPORT inflateInit2_ OF((z_streamp strm, int windowBits,
+ const char *version, int stream_size));
+ZEXTERN int ZEXPORT inflateBackInit_ OF((z_streamp strm, int windowBits,
+ unsigned char FAR *window,
+ const char *version,
+ int stream_size));
+#define deflateInit(strm, level) \
+ deflateInit_((strm), (level), ZLIB_VERSION, (int)sizeof(z_stream))
+#define inflateInit(strm) \
+ inflateInit_((strm), ZLIB_VERSION, (int)sizeof(z_stream))
+#define deflateInit2(strm, level, method, windowBits, memLevel, strategy) \
+ deflateInit2_((strm),(level),(method),(windowBits),(memLevel),\
+ (strategy), ZLIB_VERSION, (int)sizeof(z_stream))
+#define inflateInit2(strm, windowBits) \
+ inflateInit2_((strm), (windowBits), ZLIB_VERSION, \
+ (int)sizeof(z_stream))
+#define inflateBackInit(strm, windowBits, window) \
+ inflateBackInit_((strm), (windowBits), (window), \
+ ZLIB_VERSION, (int)sizeof(z_stream))
+
+#ifndef Z_SOLO
+
+/* gzgetc() macro and its supporting function and exposed data structure. Note
+ * that the real internal state is much larger than the exposed structure.
+ * This abbreviated structure exposes just enough for the gzgetc() macro. The
+ * user should not mess with these exposed elements, since their names or
+ * behavior could change in the future, perhaps even capriciously. They can
+ * only be used by the gzgetc() macro. You have been warned.
+ */
+struct gzFile_s {
+ unsigned have;
+ unsigned char *next;
+ z_off64_t pos;
+};
+ZEXTERN int ZEXPORT gzgetc_ OF((gzFile file)); /* backward compatibility */
+#ifdef Z_PREFIX_SET
+# undef z_gzgetc
+# define z_gzgetc(g) \
+ ((g)->have ? ((g)->have--, (g)->pos++, *((g)->next)++) : gzgetc(g))
+#else
+# define gzgetc(g) \
+ ((g)->have ? ((g)->have--, (g)->pos++, *((g)->next)++) : gzgetc(g))
+#endif
+
+/* provide 64-bit offset functions if _LARGEFILE64_SOURCE defined, and/or
+ * change the regular functions to 64 bits if _FILE_OFFSET_BITS is 64 (if
+ * both are true, the application gets the *64 functions, and the regular
+ * functions are changed to 64 bits) -- in case these are set on systems
+ * without large file support, _LFS64_LARGEFILE must also be true
+ */
+#ifdef Z_LARGE64
+ ZEXTERN gzFile ZEXPORT gzopen64 OF((const char *, const char *));
+ ZEXTERN z_off64_t ZEXPORT gzseek64 OF((gzFile, z_off64_t, int));
+ ZEXTERN z_off64_t ZEXPORT gztell64 OF((gzFile));
+ ZEXTERN z_off64_t ZEXPORT gzoffset64 OF((gzFile));
+ ZEXTERN uLong ZEXPORT adler32_combine64 OF((uLong, uLong, z_off64_t));
+ ZEXTERN uLong ZEXPORT crc32_combine64 OF((uLong, uLong, z_off64_t));
+#endif
+
+#if !defined(ZLIB_INTERNAL) && defined(Z_WANT64)
+# ifdef Z_PREFIX_SET
+# define z_gzopen z_gzopen64
+# define z_gzseek z_gzseek64
+# define z_gztell z_gztell64
+# define z_gzoffset z_gzoffset64
+# define z_adler32_combine z_adler32_combine64
+# define z_crc32_combine z_crc32_combine64
+# else
+# define gzopen gzopen64
+# define gzseek gzseek64
+# define gztell gztell64
+# define gzoffset gzoffset64
+# define adler32_combine adler32_combine64
+# define crc32_combine crc32_combine64
+# endif
+# ifndef Z_LARGE64
+ ZEXTERN gzFile ZEXPORT gzopen64 OF((const char *, const char *));
+ ZEXTERN z_off_t ZEXPORT gzseek64 OF((gzFile, z_off_t, int));
+ ZEXTERN z_off_t ZEXPORT gztell64 OF((gzFile));
+ ZEXTERN z_off_t ZEXPORT gzoffset64 OF((gzFile));
+ ZEXTERN uLong ZEXPORT adler32_combine64 OF((uLong, uLong, z_off_t));
+ ZEXTERN uLong ZEXPORT crc32_combine64 OF((uLong, uLong, z_off_t));
+# endif
+#else
+ ZEXTERN gzFile ZEXPORT gzopen OF((const char *, const char *));
+ ZEXTERN z_off_t ZEXPORT gzseek OF((gzFile, z_off_t, int));
+ ZEXTERN z_off_t ZEXPORT gztell OF((gzFile));
+ ZEXTERN z_off_t ZEXPORT gzoffset OF((gzFile));
+ ZEXTERN uLong ZEXPORT adler32_combine OF((uLong, uLong, z_off_t));
+ ZEXTERN uLong ZEXPORT crc32_combine OF((uLong, uLong, z_off_t));
+#endif
+
+#else /* Z_SOLO */
+
+ ZEXTERN uLong ZEXPORT adler32_combine OF((uLong, uLong, z_off_t));
+ ZEXTERN uLong ZEXPORT crc32_combine OF((uLong, uLong, z_off_t));
+
+#endif /* !Z_SOLO */
+
+/* hack for buggy compilers */
+#if !defined(ZUTIL_H) && !defined(NO_DUMMY_DECL)
+ struct internal_state {int dummy;};
+#endif
+
+/* undocumented functions */
+ZEXTERN const char * ZEXPORT zError OF((int));
+ZEXTERN int ZEXPORT inflateSyncPoint OF((z_streamp));
+ZEXTERN const z_crc_t FAR * ZEXPORT get_crc_table OF((void));
+ZEXTERN int ZEXPORT inflateUndermine OF((z_streamp, int));
+ZEXTERN int ZEXPORT inflateResetKeep OF((z_streamp));
+ZEXTERN int ZEXPORT deflateResetKeep OF((z_streamp));
+#if defined(_WIN32) && !defined(Z_SOLO)
+ZEXTERN gzFile ZEXPORT gzopen_w OF((const wchar_t *path,
+ const char *mode));
+#endif
+#if defined(STDC) || defined(Z_HAVE_STDARG_H)
+# ifndef Z_SOLO
+ZEXTERN int ZEXPORTVA gzvprintf Z_ARG((gzFile file,
+ const char *format,
+ va_list va));
+# endif
+#endif
+
+#ifdef __cplusplus
+}
+#endif
+
+#endif /* ZLIB_H */
#endif
+#ifdef __arm64__
+
+void bgr888_to_rgb565(void *dst_, const void *src_, int bytes)
+{
+ const unsigned char *src = src_;
+ unsigned int *dst = dst_;
+ unsigned int r1, g1, b1, r2, g2, b2;
+
+ for (; bytes >= 6; bytes -= 6, src += 6, dst++) {
+ r1 = src[0] & 0xf8;
+ g1 = src[1] & 0xfc;
+ b1 = src[2] & 0xf8;
+ r2 = src[3] & 0xf8;
+ g2 = src[4] & 0xfc;
+ b2 = src[5] & 0xf8;
+ *dst = (r2 << 24) | (g2 << 19) | (b2 << 13) |
+ (r1 << 8) | (g1 << 3) | (b1 >> 3);
+ }
+}
+
+#endif
+
#ifndef __ARM_NEON__
void bgr888_to_rgb565(void *dst_, const void *src_, int bytes)
{
- const unsigned char *src = src_;
- unsigned int *dst = dst_;
- unsigned int r1, g1, b1, r2, g2, b2;
-
- for (; bytes >= 6; bytes -= 6, src += 6, dst++) {
- r1 = src[0] & 0xf8;
- g1 = src[1] & 0xfc;
- b1 = src[2] & 0xf8;
- r2 = src[3] & 0xf8;
- g2 = src[4] & 0xfc;
- b2 = src[5] & 0xf8;
- *dst = (r2 << 24) | (g2 << 19) | (b2 << 13) |
- (r1 << 8) | (g1 << 3) | (b1 >> 3);
- }
+ const unsigned char *src = src_;
+ unsigned int *dst = dst_;
+ unsigned int r1, g1, b1, r2, g2, b2;
+
+ for (; bytes >= 6; bytes -= 6, src += 6, dst++) {
+ r1 = src[0] & 0xf8;
+ g1 = src[1] & 0xfc;
+ b1 = src[2] & 0xf8;
+ r2 = src[3] & 0xf8;
+ g2 = src[4] & 0xfc;
+ b2 = src[5] & 0xf8;
+ *dst = (r2 << 24) | (g2 << 19) | (b2 << 13) |
+ (r1 << 8) | (g1 << 3) | (b1 >> 3);
+ }
}
// TODO?
+++ /dev/null
-Subproject commit 21604a047941b8fe81d381ede0371c75da964afd
#include "../libpcsxcore/cdrom.h"
#include "../libpcsxcore/cdriso.h"
#include "../libpcsxcore/cheat.h"
+#include "../libpcsxcore/r3000a.h"
#include "../plugins/dfsound/out.h"
#include "../plugins/dfsound/spu_config.h"
#include "../plugins/dfinput/externals.h"
#include "revision.h"
#include "libretro.h"
+#ifdef _3DS
+#include "3ds/3ds_utils.h"
+#endif
+
+#define PORTS_NUMBER 8
+
+#ifndef MIN
+#define MIN(a, b) ((a) < (b) ? (a) : (b))
+#endif
+
+#ifndef MAX
+#define MAX(a, b) ((a) > (b) ? (a) : (b))
+#endif
+
+#define ISHEXDEC ((buf[cursor]>='0') && (buf[cursor]<='9')) || ((buf[cursor]>='a') && (buf[cursor]<='f')) || ((buf[cursor]>='A') && (buf[cursor]<='F'))
+
+//hack to prevent retroarch freezing when reseting in the menu but not while running with the hot key
+static int rebootemu = 0;
+
static retro_video_refresh_t video_cb;
static retro_input_poll_t input_poll_cb;
static retro_input_state_t input_state_cb;
static retro_environment_t environ_cb;
static retro_audio_sample_batch_t audio_batch_cb;
-static struct retro_rumble_interface rumble;
+static retro_set_rumble_state_t rumble_cb;
+static struct retro_log_callback logging;
+static retro_log_printf_t log_cb;
static void *vout_buf;
+static void * vout_buf_ptr;
static int vout_width, vout_height;
static int vout_doffs_old, vout_fb_dirty;
static bool vout_can_dupe;
static bool duping_enable;
+static bool found_bios;
static int plugins_opened;
static int is_pal_mode;
/* memory card data */
extern char Mcd1Data[MCD_SIZE];
+extern char Mcd2Data[MCD_SIZE];
extern char McdDisable[2];
/* PCSX ReARMed core calls and stuff */
-int in_type1, in_type2;
-int in_a1[2] = { 127, 127 }, in_a2[2] = { 127, 127 };
-int in_keystate;
+int in_type[8] = { PSE_PAD_TYPE_NONE, PSE_PAD_TYPE_NONE,
+ PSE_PAD_TYPE_NONE, PSE_PAD_TYPE_NONE,
+ PSE_PAD_TYPE_NONE, PSE_PAD_TYPE_NONE,
+ PSE_PAD_TYPE_NONE, PSE_PAD_TYPE_NONE };
+int in_analog_left[8][2] = {{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 }};
+int in_analog_right[8][2] = {{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 }};
+unsigned short in_keystate[PORTS_NUMBER];
+int multitap1 = 0;
+int multitap2 = 0;
int in_enable_vibration = 1;
+// NegCon adjustment parameters
+// > The NegCon 'twist' action is somewhat awkward when mapped
+// to a standard analog stick -> user should be able to tweak
+// response/deadzone for comfort
+// > When response is linear, 'additional' deadzone (set here)
+// may be left at zero, since this is normally handled via in-game
+// options menus
+// > When response is non-linear, deadzone should be set to match the
+// controller being used (otherwise precision may be lost)
+// > negcon_linearity:
+// - 1: Response is linear - recommended when using racing wheel
+// peripherals, not recommended for standard gamepads
+// - 2: Response is quadratic - optimal setting for gamepads
+// - 3: Response is cubic - enables precise fine control, but
+// difficult to use...
+#define NEGCON_RANGE 0x7FFF
+static int negcon_deadzone = 0;
+static int negcon_linearity = 1;
+
/* PSX max resolution is 640x512, but with enhancement it's 1024x512 */
#define VOUT_MAX_WIDTH 1024
#define VOUT_MAX_HEIGHT 512
+//Dummy functions
+bool retro_load_game_special(unsigned game_type, const struct retro_game_info *info, size_t num_info){return false;}
+void retro_unload_game(void){}
+static int vout_open(void){return 0;}
+static void vout_close(void){}
+static int snd_init(void){return 0;}
+static void snd_finish(void){}
+static int snd_busy(void){return 0;}
+
static void init_memcard(char *mcd_data)
{
unsigned off = 0;
}
}
-static int vout_open(void)
+static void set_vout_fb()
{
- return 0;
+ struct retro_framebuffer fb = {0};
+
+ fb.width = vout_width;
+ fb.height = vout_height;
+ fb.access_flags = RETRO_MEMORY_ACCESS_WRITE;
+
+ if (environ_cb(RETRO_ENVIRONMENT_GET_CURRENT_SOFTWARE_FRAMEBUFFER, &fb) && fb.format == RETRO_PIXEL_FORMAT_RGB565)
+ vout_buf_ptr = (uint16_t*)fb.data;
+ else
+ vout_buf_ptr = vout_buf;
}
static void vout_set_mode(int w, int h, int raw_w, int raw_h, int bpp)
{
- vout_width = w;
- vout_height = h;
+ vout_width = w;
+ vout_height = h;
+
+ set_vout_fb();
}
#ifndef FRONTEND_SUPPORTS_RGB565
static void vout_flip(const void *vram, int stride, int bgr24, int w, int h)
{
- unsigned short *dest = vout_buf;
+ unsigned short *dest = vout_buf_ptr;
const unsigned short *src = vram;
int dstride = vout_width, h1 = h;
int doffs;
if (vram == NULL) {
// blanking
- memset(vout_buf, 0, dstride * h * 2);
+ memset(vout_buf_ptr, 0, dstride * h * 2);
goto out;
}
doffs += (dstride - w) / 2 & ~1;
if (doffs != vout_doffs_old) {
// clear borders
- memset(vout_buf, 0, dstride * h * 2);
+ memset(vout_buf_ptr, 0, dstride * h * 2);
vout_doffs_old = doffs;
}
dest += doffs;
out:
#ifndef FRONTEND_SUPPORTS_RGB565
- convert(vout_buf, vout_width * vout_height * 2);
+ convert(vout_buf_ptr, vout_width * vout_height * 2);
#endif
vout_fb_dirty = 1;
pl_rearmed_cbs.flip_cnt++;
}
-static void vout_close(void)
+#ifdef _3DS
+typedef struct
+{
+ void* buffer;
+ uint32_t target_map;
+ size_t size;
+ enum psxMapTag tag;
+}psx_map_t;
+
+psx_map_t custom_psx_maps[] = {
+ {NULL, 0x13000000, 0x210000, MAP_TAG_RAM}, // 0x80000000
+ {NULL, 0x12800000, 0x010000, MAP_TAG_OTHER}, // 0x1f800000
+ {NULL, 0x12c00000, 0x080000, MAP_TAG_OTHER}, // 0x1fc00000
+ {NULL, 0x11000000, 0x800000, MAP_TAG_LUTS}, // 0x08000000
+ {NULL, 0x12000000, 0x200000, MAP_TAG_VRAM}, // 0x00000000
+};
+
+void* pl_3ds_mmap(unsigned long addr, size_t size, int is_fixed,
+ enum psxMapTag tag)
+{
+ (void)is_fixed;
+ (void)addr;
+
+ if (__ctr_svchax)
+ {
+ psx_map_t* custom_map = custom_psx_maps;
+
+ for (; custom_map->size; custom_map++)
+ {
+ if ((custom_map->size == size) && (custom_map->tag == tag))
+ {
+ uint32_t ptr_aligned, tmp;
+
+ custom_map->buffer = malloc(size + 0x1000);
+ ptr_aligned = (((u32)custom_map->buffer) + 0xFFF) & ~0xFFF;
+
+ if(svcControlMemory(&tmp, (void*)custom_map->target_map, (void*)ptr_aligned, size, MEMOP_MAP, 0x3) < 0)
+ {
+ SysPrintf("could not map memory @0x%08X\n", custom_map->target_map);
+ exit(1);
+ }
+
+ return (void*)custom_map->target_map;
+ }
+ }
+ }
+
+ return malloc(size);
+}
+
+void pl_3ds_munmap(void *ptr, size_t size, enum psxMapTag tag)
+{
+ (void)tag;
+
+ if (__ctr_svchax)
+ {
+ psx_map_t* custom_map = custom_psx_maps;
+
+ for (; custom_map->size; custom_map++)
+ {
+ if ((custom_map->target_map == (uint32_t)ptr))
+ {
+ uint32_t ptr_aligned, tmp;
+
+ ptr_aligned = (((u32)custom_map->buffer) + 0xFFF) & ~0xFFF;
+
+ svcControlMemory(&tmp, (void*)custom_map->target_map, (void*)ptr_aligned, size, MEMOP_UNMAP, 0x3);
+
+ free(custom_map->buffer);
+ custom_map->buffer = NULL;
+ return;
+ }
+ }
+ }
+
+ free(ptr);
+}
+#endif
+
+#ifdef VITA
+typedef struct
+{
+ void* buffer;
+ uint32_t target_map;
+ size_t size;
+ enum psxMapTag tag;
+}psx_map_t;
+
+void* addr = NULL;
+
+psx_map_t custom_psx_maps[] = {
+ {NULL, NULL, 0x210000, MAP_TAG_RAM}, // 0x80000000
+ {NULL, NULL, 0x010000, MAP_TAG_OTHER}, // 0x1f800000
+ {NULL, NULL, 0x080000, MAP_TAG_OTHER}, // 0x1fc00000
+ {NULL, NULL, 0x800000, MAP_TAG_LUTS}, // 0x08000000
+ {NULL, NULL, 0x200000, MAP_TAG_VRAM}, // 0x00000000
+};
+
+int init_vita_mmap(){
+ int n;
+ void * tmpaddr;
+ addr = malloc(64*1024*1024);
+ if(addr==NULL)
+ return -1;
+ tmpaddr = ((u32)(addr+0xFFFFFF))&~0xFFFFFF;
+ custom_psx_maps[0].buffer=tmpaddr+0x2000000;
+ custom_psx_maps[1].buffer=tmpaddr+0x1800000;
+ custom_psx_maps[2].buffer=tmpaddr+0x1c00000;
+ custom_psx_maps[3].buffer=tmpaddr+0x0000000;
+ custom_psx_maps[4].buffer=tmpaddr+0x1000000;
+#if 0
+ for(n = 0; n < 5; n++){
+ sceClibPrintf("addr reserved %x\n",custom_psx_maps[n].buffer);
+ }
+#endif
+ return 0;
+}
+
+void deinit_vita_mmap(){
+ free(addr);
+}
+
+void* pl_vita_mmap(unsigned long addr, size_t size, int is_fixed,
+ enum psxMapTag tag)
+{
+ (void)is_fixed;
+ (void)addr;
+
+
+ psx_map_t* custom_map = custom_psx_maps;
+
+ for (; custom_map->size; custom_map++)
+ {
+ if ((custom_map->size == size) && (custom_map->tag == tag))
+ {
+ return custom_map->buffer;
+ }
+ }
+
+
+ return malloc(size);
+}
+
+void pl_vita_munmap(void *ptr, size_t size, enum psxMapTag tag)
{
+ (void)tag;
+
+ psx_map_t* custom_map = custom_psx_maps;
+
+ for (; custom_map->size; custom_map++)
+ {
+ if ((custom_map->buffer == ptr))
+ {
+ return;
+ }
+ }
+
+ free(ptr);
}
+#endif
static void *pl_mmap(unsigned int size)
{
void plat_trigger_vibrate(int pad, int low, int high)
{
- rumble.set_rumble_state(pad, RETRO_RUMBLE_STRONG, high << 8);
- rumble.set_rumble_state(pad, RETRO_RUMBLE_WEAK, low ? 0xffff : 0x0);
+ if (!rumble_cb)
+ return;
+
+ if (in_enable_vibration)
+ {
+ rumble_cb(pad, RETRO_RUMBLE_STRONG, high << 8);
+ rumble_cb(pad, RETRO_RUMBLE_WEAK, low ? 0xffff : 0x0);
+ }
}
void pl_update_gun(int *xn, int *yn, int *xres, int *yres, int *in)
}
/* sound calls */
-static int snd_init(void)
-{
- return 0;
-}
-
-static void snd_finish(void)
-{
-}
-
-static int snd_busy(void)
-{
- return 0;
-}
-
static void snd_feed(void *buf, int bytes)
{
if (audio_batch_cb != NULL)
{
static const struct retro_variable vars[] = {
{ "pcsx_rearmed_frameskip", "Frameskip; 0|1|2|3" },
- { "pcsx_rearmed_region", "Region; Auto|NTSC|PAL" },
- { "pcsx_rearmed_pad1type", "Pad 1 Type; standard|analog" },
- { "pcsx_rearmed_pad2type", "Pad 2 Type; standard|analog" },
+ { "pcsx_rearmed_bios", "Use BIOS; auto|HLE" },
+ { "pcsx_rearmed_region", "Region; auto|NTSC|PAL" },
+ { "pcsx_rearmed_memcard2", "Enable second memory card; disabled|enabled" },
+ { "pcsx_rearmed_pad1type", "Pad 1 Type; standard|analog|dualshock|negcon|none" },
+ { "pcsx_rearmed_pad2type", "Pad 2 Type; standard|analog|dualshock|negcon|none" },
+ { "pcsx_rearmed_pad3type", "Pad 3 Type; none|standard|analog|dualshock|negcon" },
+ { "pcsx_rearmed_pad4type", "Pad 4 Type; none|standard|analog|dualshock|negcon" },
+ { "pcsx_rearmed_pad5type", "Pad 5 Type; none|standard|analog|dualshock|negcon" },
+ { "pcsx_rearmed_pad6type", "Pad 6 Type; none|standard|analog|dualshock|negcon" },
+ { "pcsx_rearmed_pad7type", "Pad 7 Type; none|standard|analog|dualshock|negcon" },
+ { "pcsx_rearmed_pad8type", "Pad 8 Type; none|standard|analog|dualshock|negcon" },
+ { "pcsx_rearmed_multitap1", "Multitap 1; auto|disabled|enabled" },
+ { "pcsx_rearmed_multitap2", "Multitap 2; auto|disabled|enabled" },
+ { "pcsx_rearmed_negcon_deadzone", "NegCon Twist Deadzone (percent); 0|5|10|15|20|25|30" },
+ { "pcsx_rearmed_negcon_response", "NegCon Twist Response; linear|quadratic|cubic" },
+ { "pcsx_rearmed_vibration", "Enable Vibration; enabled|disabled" },
+ { "pcsx_rearmed_dithering", "Enable Dithering; enabled|disabled" },
#ifndef DRC_DISABLE
{ "pcsx_rearmed_drc", "Dynamic recompiler; enabled|disabled" },
+#ifdef HAVE_PRE_ARMV7
+ { "pcsx_rearmed_psxclock", "PSX cpu clock (default 50); 50|51|52|53|54|55|5657|58|59|60|61|62|63|64|65|66|67|68|69|70|71|72|73|74|75|76|77|78|79|80|81|82|83|84|85|86|87|88|89|90|91|92|93|94|95|96|97|98|99|100|30|31|32|33|34|35|36|37|38|39|40|41|42|43|44|45|46|47|48|49" },
+#else
+ { "pcsx_rearmed_psxclock", "PSX cpu clock (default 57); 57|58|59|60|61|62|63|64|65|66|67|68|69|70|71|72|73|74|75|76|77|78|79|80|81|82|83|84|85|86|87|88|89|90|91|92|93|94|95|96|97|98|99|100|30|31|32|33|34|35|36|37|38|39|40|41|42|43|44|45|46|47|48|49|50|51|52|53|54|55|56" },
+#endif
#endif
#ifdef __ARM_NEON__
{ "pcsx_rearmed_neon_interlace_enable", "Enable interlacing mode(s); disabled|enabled" },
{ "pcsx_rearmed_neon_enhancement_enable", "Enhanced resolution (slow); disabled|enabled" },
{ "pcsx_rearmed_neon_enhancement_no_main", "Enhanced resolution speed hack; disabled|enabled" },
#endif
- { "pcsx_rearmed_duping_enable", "Frame duping; on|off" },
- { "pcsx_rearmed_spu_reverb", "Sound: Reverb; on|off" },
+ { "pcsx_rearmed_duping_enable", "Frame duping; enabled|disabled" },
+ { "pcsx_rearmed_show_bios_bootlogo", "Show Bios Bootlogo(Breaks some games); disabled|enabled" },
+ { "pcsx_rearmed_spu_reverb", "Sound: Reverb; enabled|disabled" },
{ "pcsx_rearmed_spu_interpolation", "Sound: Interpolation; simple|gaussian|cubic|off" },
+ { "pcsx_rearmed_idiablofix", "Diablo Music Fix; disabled|enabled" },
+ { "pcsx_rearmed_pe2_fix", "Parasite Eve 2/Vandal Hearts 1/2 Fix; disabled|enabled" },
+ { "pcsx_rearmed_inuyasha_fix", "InuYasha Sengoku Battle Fix; disabled|enabled" },
{ NULL, NULL },
};
+ if (cb(RETRO_ENVIRONMENT_GET_LOG_INTERFACE, &logging))
+ log_cb = logging.log;
+
environ_cb = cb;
cb(RETRO_ENVIRONMENT_SET_VARIABLES, (void*)vars);
return RETRO_API_VERSION;
}
+static int controller_port_variable(unsigned port, struct retro_variable *var)
+{
+ if (port >= PORTS_NUMBER)
+ return 0;
+
+ if (!environ_cb)
+ return 0;
+
+ var->value = NULL;
+ switch (port) {
+ case 0:
+ var->key = "pcsx_rearmed_pad1type";
+ break;
+ case 1:
+ var->key = "pcsx_rearmed_pad2type";
+ break;
+ case 2:
+ var->key = "pcsx_rearmed_pad3type";
+ break;
+ case 3:
+ var->key = "pcsx_rearmed_pad4type";
+ break;
+ case 4:
+ var->key = "pcsx_rearmed_pad5type";
+ break;
+ case 5:
+ var->key = "pcsx_rearmed_pad6type";
+ break;
+ case 6:
+ var->key = "pcsx_rearmed_pad7type";
+ break;
+ case 7:
+ var->key = "pcsx_rearmed_pad8type";
+ break;
+ }
+
+ return environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, var) || var->value;
+}
+
+static void update_controller_port_variable(unsigned port)
+{
+ if (port >= PORTS_NUMBER)
+ return;
+
+ struct retro_variable var;
+
+ if (controller_port_variable(port, &var))
+ {
+ if (strcmp(var.value, "standard") == 0)
+ in_type[port] = PSE_PAD_TYPE_STANDARD;
+ else if (strcmp(var.value, "analog") == 0)
+ in_type[port] = PSE_PAD_TYPE_ANALOGJOY;
+ else if (strcmp(var.value, "dualshock") == 0)
+ in_type[port] = PSE_PAD_TYPE_ANALOGPAD;
+ else if (strcmp(var.value, "negcon") == 0)
+ in_type[port] = PSE_PAD_TYPE_NEGCON;
+ else if (strcmp(var.value, "none") == 0)
+ in_type[port] = PSE_PAD_TYPE_NONE;
+ // else 'default' case, do nothing
+ }
+}
+
+static void update_controller_port_device(unsigned port, unsigned device)
+{
+ if (port >= PORTS_NUMBER)
+ return;
+
+ struct retro_variable var;
+
+ if (!controller_port_variable(port, &var))
+ return;
+
+ if (strcmp(var.value, "default") != 0)
+ return;
+
+ switch (device)
+ {
+ case RETRO_DEVICE_JOYPAD:
+ in_type[port] = PSE_PAD_TYPE_STANDARD;
+ break;
+ case RETRO_DEVICE_ANALOG:
+ in_type[port] = PSE_PAD_TYPE_ANALOGPAD;
+ break;
+ case RETRO_DEVICE_MOUSE:
+ in_type[port] = PSE_PAD_TYPE_MOUSE;
+ break;
+ case RETRO_DEVICE_LIGHTGUN:
+ in_type[port] = PSE_PAD_TYPE_GUN;
+ break;
+ case RETRO_DEVICE_NONE:
+ default:
+ in_type[port] = PSE_PAD_TYPE_NONE;
+ }
+}
+
+static void update_multitap()
+{
+ struct retro_variable var;
+ int auto_case, port;
+
+ var.value = NULL;
+ var.key = "pcsx_rearmed_multitap1";
+ auto_case = 0;
+ if (environ_cb && (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value))
+ {
+ if (strcmp(var.value, "enabled") == 0)
+ multitap1 = 1;
+ else if (strcmp(var.value, "disabled") == 0)
+ multitap1 = 0;
+ else // 'auto' case
+ auto_case = 1;
+ }
+ else
+ auto_case = 1;
+
+ if (auto_case)
+ {
+ // If a gamepad is plugged after port 2, we need a first multitap.
+ multitap1 = 0;
+ for (port = 2; port < PORTS_NUMBER; port++)
+ multitap1 |= in_type[port] != PSE_PAD_TYPE_NONE;
+ }
+
+ var.value = NULL;
+ var.key = "pcsx_rearmed_multitap2";
+ auto_case = 0;
+ if (environ_cb && (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value))
+ {
+ if (strcmp(var.value, "enabled") == 0)
+ multitap2 = 1;
+ else if (strcmp(var.value, "disabled") == 0)
+ multitap2 = 0;
+ else // 'auto' case
+ auto_case = 1;
+ }
+ else
+ auto_case = 1;
+
+ if (auto_case)
+ {
+ // If a gamepad is plugged after port 4, we need a second multitap.
+ multitap2 = 0;
+ for (port = 4; port < PORTS_NUMBER; port++)
+ multitap2 |= in_type[port] != PSE_PAD_TYPE_NONE;
+ }
+}
+
void retro_set_controller_port_device(unsigned port, unsigned device)
{
+ SysPrintf("port %u device %u",port,device);
+
+ if (port >= PORTS_NUMBER)
+ return;
+
+ update_controller_port_device(port, device);
+ update_multitap();
}
void retro_get_system_info(struct retro_system_info *info)
{
memset(info, 0, sizeof(*info));
info->library_name = "PCSX-ReARMed";
- info->library_version = "r22";
+#ifndef GIT_VERSION
+#define GIT_VERSION ""
+#endif
+ info->library_version = "r22" GIT_VERSION;
info->valid_extensions = "bin|cue|img|mdf|pbp|toc|cbn|m3u";
info->need_fullpath = true;
}
}
/* savestates */
-size_t retro_serialize_size(void)
-{
+size_t retro_serialize_size(void)
+{
// it's currently 4380651-4397047 bytes,
// but have some reserved for future
return 0x440000;
}
bool retro_serialize(void *data, size_t size)
-{
+{
int ret = SaveState(data);
return ret == 0 ? true : false;
}
strncpy(buf, code, sizeof(buf));
buf[sizeof(buf) - 1] = 0;
+ //Prepare buffered cheat for PCSX's AddCheat fucntion.
+ int cursor=0;
+ int nonhexdec=0;
+ while (buf[cursor]){
+ if (!(ISHEXDEC)){
+ if (++nonhexdec%2){
+ buf[cursor]=' ';
+ } else {
+ buf[cursor]='\n';
+ }
+ }
+ cursor++;
+ }
+
+
if (index < NumCheats)
ret = EditCheat(index, "", buf);
else
#define SLASH '/'
#endif
+#ifndef PATH_MAX
+#define PATH_MAX 4096
+#endif
+
static char base_dir[PATH_MAX];
static bool read_m3u(const char *file)
{ 5, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_R2, "R2" },
{ 5, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_R3, "R3" },
{ 5, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_SELECT, "Select" },
- { 5, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_START, "Start" },
+ { 5, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_START, "Start" },
{ 5, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_LEFT, RETRO_DEVICE_ID_ANALOG_X, "Left Analog X" },
{ 5, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_LEFT, RETRO_DEVICE_ID_ANALOG_Y, "Left Analog Y" },
{ 5, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_RIGHT, RETRO_DEVICE_ID_ANALOG_X, "Right Analog X" },
{ 6, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_R2, "R2" },
{ 6, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_R3, "R3" },
{ 6, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_SELECT, "Select" },
- { 6, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_START, "Start" },
+ { 6, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_START, "Start" },
{ 6, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_LEFT, RETRO_DEVICE_ID_ANALOG_X, "Left Analog X" },
{ 6, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_LEFT, RETRO_DEVICE_ID_ANALOG_Y, "Left Analog Y" },
{ 6, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_RIGHT, RETRO_DEVICE_ID_ANALOG_X, "Right Analog X" },
{ 7, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_R2, "R2" },
{ 7, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_R3, "R3" },
{ 7, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_SELECT, "Select" },
- { 7, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_START, "Start" },
+ { 7, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_START, "Start" },
{ 7, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_LEFT, RETRO_DEVICE_ID_ANALOG_X, "Left Analog X" },
{ 7, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_LEFT, RETRO_DEVICE_ID_ANALOG_Y, "Left Analog Y" },
{ 7, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_RIGHT, RETRO_DEVICE_ID_ANALOG_X, "Right Analog X" },
if (is_m3u) {
if (!read_m3u(info->path)) {
- SysPrintf("failed to read m3u file\n");
+ log_cb(RETRO_LOG_INFO, "failed to read m3u file\n");
return false;
}
} else {
/* have to reload after set_cd_image for correct cdr plugin */
if (LoadPlugins() == -1) {
- SysPrintf("failed to load plugins\n");
+ log_cb(RETRO_LOG_INFO, "failed to load plugins\n");
return false;
}
NetOpened = 0;
if (OpenPlugins() == -1) {
- SysPrintf("failed to open plugins\n");
+ log_cb(RETRO_LOG_INFO, "failed to open plugins\n");
return false;
}
plugin_call_rearmed_cbs();
dfinput_activate();
- Config.PsxAuto = 1;
if (CheckCdrom() == -1) {
- SysPrintf("unsupported/invalid CD image: %s\n", info->path);
+ log_cb(RETRO_LOG_INFO, "unsupported/invalid CD image: %s\n", info->path);
return false;
}
SysReset();
if (LoadCdrom() == -1) {
- SysPrintf("could not load CD-ROM!\n");
+ log_cb(RETRO_LOG_INFO, "could not load CD\n");
return false;
}
emu_on_new_cd(0);
return true;
}
-bool retro_load_game_special(unsigned game_type, const struct retro_game_info *info, size_t num_info)
-{
- return false;
-}
-
-void retro_unload_game(void)
-{
-}
-
unsigned retro_get_region(void)
{
return is_pal_mode ? RETRO_REGION_PAL : RETRO_REGION_NTSC;
void retro_reset(void)
{
- SysReset();
+ //hack to prevent retroarch freezing when reseting in the menu but not while running with the hot key
+ rebootemu = 1;
+ //SysReset();
}
static const unsigned short retro_psx_map[] = {
static void update_variables(bool in_flight)
{
struct retro_variable var;
-
+ int i;
+
var.value = NULL;
var.key = "pcsx_rearmed_frameskip";
-
if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value)
pl_rearmed_cbs.frameskip = atoi(var.value);
var.value = NULL;
var.key = "pcsx_rearmed_region";
-
if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value)
{
Config.PsxAuto = 0;
- if (strcmp(var.value, "Automatic") == 0)
+ if (strcmp(var.value, "auto") == 0)
Config.PsxAuto = 1;
else if (strcmp(var.value, "NTSC") == 0)
Config.PsxType = 0;
Config.PsxType = 1;
}
+ for (i = 0; i < PORTS_NUMBER; i++)
+ update_controller_port_variable(i);
+
+ update_multitap();
+
+ var.value = NULL;
+ var.key = "pcsx_rearmed_negcon_deadzone";
+ negcon_deadzone = 0;
+ if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value)
+ {
+ negcon_deadzone = (int)(atoi(var.value) * 0.01f * NEGCON_RANGE);
+ }
+
var.value = NULL;
- var.key = "pcsx_rearmed_pad1type";
+ var.key = "pcsx_rearmed_negcon_response";
+ negcon_linearity = 1;
+ if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value)
+ {
+ if (strcmp(var.value, "quadratic") == 0){
+ negcon_linearity = 2;
+ } else if (strcmp(var.value, "cubic") == 0){
+ negcon_linearity = 3;
+ }
+ }
+
+ var.value = NULL;
+ var.key = "pcsx_rearmed_vibration";
if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value)
{
- in_type1 = PSE_PAD_TYPE_STANDARD;
- if (strcmp(var.value, "analog") == 0)
- in_type1 = PSE_PAD_TYPE_ANALOGPAD;
+ if (strcmp(var.value, "disabled") == 0)
+ in_enable_vibration = 0;
+ else if (strcmp(var.value, "enabled") == 0)
+ in_enable_vibration = 1;
}
var.value = NULL;
- var.key = "pcsx_rearmed_pad2type";
+ var.key = "pcsx_rearmed_dithering";
if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value)
{
- in_type2 = PSE_PAD_TYPE_STANDARD;
- if (strcmp(var.value, "analog") == 0)
- in_type2 = PSE_PAD_TYPE_ANALOGPAD;
+ if (strcmp(var.value, "disabled") == 0) {
+ pl_rearmed_cbs.gpu_peops.iUseDither = 0;
+ pl_rearmed_cbs.gpu_peopsgl.bDrawDither = 0;
+#ifdef __ARM_NEON__
+ pl_rearmed_cbs.gpu_neon.allow_dithering = 0;
+#endif
+ }
+ else if (strcmp(var.value, "enabled") == 0) {
+ pl_rearmed_cbs.gpu_peops.iUseDither = 1;
+ pl_rearmed_cbs.gpu_peopsgl.bDrawDither = 1;
+#ifdef __ARM_NEON__
+ pl_rearmed_cbs.gpu_neon.allow_dithering = 1;
+#endif
+ }
}
#ifdef __ARM_NEON__
if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value)
{
- if (strcmp(var.value, "off") == 0)
+ if (strcmp(var.value, "disabled") == 0)
duping_enable = false;
- else if (strcmp(var.value, "on") == 0)
+ else if (strcmp(var.value, "enabled") == 0)
duping_enable = true;
}
{
R3000Acpu *prev_cpu = psxCpu;
+#ifdef _3DS
+ if(!__ctr_svchax)
+ Config.Cpu = CPU_INTERPRETER;
+ else
+#endif
if (strcmp(var.value, "disabled") == 0)
Config.Cpu = CPU_INTERPRETER;
else if (strcmp(var.value, "enabled") == 0)
if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value)
{
- if (strcmp(var.value, "off") == 0)
+ if (strcmp(var.value, "disabled") == 0)
spu_config.iUseReverb = false;
- else if (strcmp(var.value, "on") == 0)
+ else if (strcmp(var.value, "enabled") == 0)
spu_config.iUseReverb = true;
}
spu_config.iUseInterpolation = 0;
}
+ var.value = "NULL";
+ var.key = "pcsx_rearmed_pe2_fix";
+
+ if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value)
+ {
+ if (strcmp(var.value, "disabled") == 0)
+ Config.RCntFix = 0;
+ else if (strcmp(var.value, "enabled") == 0)
+ Config.RCntFix = 1;
+ }
+
+ var.value = "NULL";
+ var.key = "pcsx_rearmed_idiablofix";
+
+ if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value)
+ {
+ if (strcmp(var.value, "disabled") == 0)
+ spu_config.idiablofix = 0;
+ else if (strcmp(var.value, "enabled") == 0)
+ spu_config.idiablofix = 1;
+ }
+
+ var.value = "NULL";
+ var.key = "pcsx_rearmed_inuyasha_fix";
+
+ if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value)
+ {
+ if (strcmp(var.value, "disabled") == 0)
+ Config.VSyncWA = 0;
+ else if (strcmp(var.value, "enabled") == 0)
+ Config.VSyncWA = 1;
+ }
+
if (in_flight) {
// inform core things about possible config changes
plugin_call_rearmed_cbs();
dfinput_activate();
}
+ else
+ {
+ //not yet running
+
+ //bootlogo display hack
+ if (found_bios) {
+ var.value = "NULL";
+ var.key = "pcsx_rearmed_show_bios_bootlogo";
+ if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value)
+ {
+ Config.SlowBoot = 0;
+ rebootemu = 0;
+ if (strcmp(var.value, "enabled") == 0)
+ {
+ Config.SlowBoot = 1;
+ rebootemu = 1;
+ }
+ }
+ }
+#ifndef DRC_DISABLE
+ var.value = "NULL";
+ var.key = "pcsx_rearmed_psxclock";
+ if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value)
+ {
+ int psxclock = atoi(var.value);
+ cycle_multiplier = 10000 / psxclock;
+ }
+#endif
+ }
}
-void retro_run(void)
+// Taken from beetle-psx-libretro
+static uint16_t get_analog_button(retro_input_state_t input_state_cb, int player_index, int id)
+{
+ uint16_t button;
+
+ // NOTE: Analog buttons were added Nov 2017. Not all front-ends support this
+ // feature (or pre-date it) so we need to handle this in a graceful way.
+
+ // First, try and get an analog value using the new libretro API constant
+ button = input_state_cb(player_index,
+ RETRO_DEVICE_ANALOG,
+ RETRO_DEVICE_INDEX_ANALOG_BUTTON,
+ id);
+ button = MIN(button / 128, 255);
+
+ if (button == 0)
+ {
+ // If we got exactly zero, we're either not pressing the button, or the front-end
+ // is not reporting analog values. We need to do a second check using the classic
+ // digital API method, to at least get some response - better than nothing.
+
+ // NOTE: If we're really just not holding the button, we're still going to get zero.
+
+ button = input_state_cb(player_index,
+ RETRO_DEVICE_JOYPAD,
+ 0,
+ id) ? 255 : 0;
+ }
+
+ return button;
+}
+
+void retro_run(void)
{
int i;
+ //SysReset must be run while core is running,Not in menu (Locks up Retroarch)
+ if (rebootemu != 0) {
+ rebootemu = 0;
+ SysReset();
+ if (!Config.HLE && !Config.SlowBoot) {
+ // skip BIOS logos
+ psxRegs.pc = psxRegs.GPR.n.ra;
+ }
+ }
input_poll_cb();
if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE_UPDATE, &updated) && updated)
update_variables(true);
- in_keystate = 0;
- for (i = 0; i < RETRO_PSX_MAP_LEN; i++)
- if (input_state_cb(1, RETRO_DEVICE_JOYPAD, 0, i))
- in_keystate |= retro_psx_map[i];
- in_keystate <<= 16;
- for (i = 0; i < RETRO_PSX_MAP_LEN; i++)
- if (input_state_cb(0, RETRO_DEVICE_JOYPAD, 0, i))
- in_keystate |= retro_psx_map[i];
+ // reset all keystate, query libretro for keystate
+ int j;
+ int lsx;
+ int rsy;
+ float negcon_twist_amplitude;
+ int negcon_i_rs;
+ int negcon_ii_rs;
+ for(i = 0; i < PORTS_NUMBER; i++) {
+ in_keystate[i] = 0;
+
+ if (in_type[i] == PSE_PAD_TYPE_NONE)
+ continue;
- if (in_type1 == PSE_PAD_TYPE_ANALOGPAD)
- {
- in_a1[0] = (input_state_cb(0, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_LEFT, RETRO_DEVICE_ID_ANALOG_X) / 256) + 128;
- in_a1[1] = (input_state_cb(0, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_LEFT, RETRO_DEVICE_ID_ANALOG_Y) / 256) + 128;
- in_a2[0] = (input_state_cb(0, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_RIGHT, RETRO_DEVICE_ID_ANALOG_X) / 256) + 128;
- in_a2[1] = (input_state_cb(0, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_RIGHT, RETRO_DEVICE_ID_ANALOG_Y) / 256) + 128;
+ if (in_type[i] == PSE_PAD_TYPE_NEGCON)
+ {
+ // Query digital inputs
+ //
+ // > Pad-Up
+ if (input_state_cb(i, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_UP)){
+ in_keystate[i] |= (1 << DKEY_UP);
+ }
+ // > Pad-Right
+ if (input_state_cb(i, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_RIGHT)){
+ in_keystate[i] |= (1 << DKEY_RIGHT);
+ }
+ // > Pad-Down
+ if (input_state_cb(i, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_DOWN)){
+ in_keystate[i] |= (1 << DKEY_DOWN);
+ }
+ // > Pad-Left
+ if (input_state_cb(i, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_LEFT)){
+ in_keystate[i] |= (1 << DKEY_LEFT);
+ }
+ // > Start
+ if (input_state_cb(i, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_START)){
+ in_keystate[i] |= (1 << DKEY_START);
+ }
+ // > neGcon A
+ if (input_state_cb(i, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_A)){
+ in_keystate[i] |= (1 << DKEY_CIRCLE);
+ }
+ // > neGcon B
+ if (input_state_cb(i, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_X)){
+ in_keystate[i] |= (1 << DKEY_TRIANGLE);
+ }
+ // > neGcon R shoulder (digital)
+ if (input_state_cb(i, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_R)){
+ in_keystate[i] |= (1 << DKEY_R1);
+ }
+ // Query analog inputs
+ //
+ // From studying 'libpcsxcore/plugins.c' and 'frontend/plugin.c':
+ // >> pad->leftJoyX == in_analog_left[i][0] == NeGcon II
+ // >> pad->leftJoyY == in_analog_left[i][1] == NeGcon L
+ // >> pad->rightJoyX == in_analog_right[i][0] == NeGcon twist
+ // >> pad->rightJoyY == in_analog_right[i][1] == NeGcon I
+ // So we just have to map in_analog_left/right to more
+ // appropriate inputs...
+ //
+ // > NeGcon twist
+ // >> Get raw analog stick value and account for deadzone
+ lsx = input_state_cb(i, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_LEFT, RETRO_DEVICE_ID_ANALOG_X);
+ if (lsx > negcon_deadzone){
+ lsx = lsx - negcon_deadzone;
+ } else if (lsx < -negcon_deadzone){
+ lsx = lsx + negcon_deadzone;
+ } else {
+ lsx = 0;
+ }
+ // >> Convert to an 'amplitude' [-1.0,1.0] and adjust response
+ negcon_twist_amplitude = (float)lsx / (float)(NEGCON_RANGE - negcon_deadzone);
+ if (negcon_linearity == 2){
+ if (negcon_twist_amplitude < 0.0){
+ negcon_twist_amplitude = -(negcon_twist_amplitude * negcon_twist_amplitude);
+ } else {
+ negcon_twist_amplitude = negcon_twist_amplitude * negcon_twist_amplitude;
+ }
+ } else if (negcon_linearity == 3){
+ negcon_twist_amplitude = negcon_twist_amplitude * negcon_twist_amplitude * negcon_twist_amplitude;
+ }
+ // >> Convert to final 'in_analog' integer value [0,255]
+ in_analog_right[i][0] = MAX(MIN((int)(negcon_twist_amplitude * 128.0f) + 128, 255), 0);
+ // > NeGcon I + II
+ // >> Handle right analog stick vertical axis mapping...
+ // - Up (-Y) == accelerate == neGcon I
+ // - Down (+Y) == brake == neGcon II
+ negcon_i_rs = 0;
+ negcon_ii_rs = 0;
+ rsy = input_state_cb(i, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_RIGHT, RETRO_DEVICE_ID_ANALOG_Y);
+ if (rsy >= 0){
+ // Account for deadzone
+ // (Note: have never encountered a gamepad with significant differences
+ // in deadzone between left/right analog sticks, so use the regular 'twist'
+ // deadzone here)
+ if (rsy > negcon_deadzone){
+ rsy = rsy - negcon_deadzone;
+ } else {
+ rsy = 0;
+ }
+ // Convert to 'in_analog' integer value [0,255]
+ negcon_ii_rs = MIN((int)(((float)rsy / (float)(NEGCON_RANGE - negcon_deadzone)) * 255.0f), 255);
+ } else {
+ if (rsy < -negcon_deadzone){
+ rsy = -1 * (rsy + negcon_deadzone);
+ } else {
+ rsy = 0;
+ }
+ negcon_i_rs = MIN((int)(((float)rsy / (float)(NEGCON_RANGE - negcon_deadzone)) * 255.0f), 255);
+ }
+ // >> NeGcon I
+ in_analog_right[i][1] = MAX(
+ MAX(
+ get_analog_button(input_state_cb, i, RETRO_DEVICE_ID_JOYPAD_R2),
+ get_analog_button(input_state_cb, i, RETRO_DEVICE_ID_JOYPAD_B)
+ ),
+ negcon_i_rs
+ );
+ // >> NeGcon II
+ in_analog_left[i][0] = MAX(
+ MAX(
+ get_analog_button(input_state_cb, i, RETRO_DEVICE_ID_JOYPAD_L2),
+ get_analog_button(input_state_cb, i, RETRO_DEVICE_ID_JOYPAD_Y)
+ ),
+ negcon_ii_rs
+ );
+ // > NeGcon L
+ in_analog_left[i][1] = get_analog_button(input_state_cb, i, RETRO_DEVICE_ID_JOYPAD_L);
+ }
+ else
+ {
+ // Query digital inputs
+ for (j = 0; j < RETRO_PSX_MAP_LEN; j++){
+ if (input_state_cb(i, RETRO_DEVICE_JOYPAD, 0, j)){
+ in_keystate[i] |= retro_psx_map[j];
+ }
+ }
+ // Query analog inputs
+ if (in_type[i] == PSE_PAD_TYPE_ANALOGJOY || in_type[i] == PSE_PAD_TYPE_ANALOGPAD)
+ {
+ in_analog_left[i][0] = MIN((input_state_cb(i, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_LEFT, RETRO_DEVICE_ID_ANALOG_X) / 255) + 128, 255);
+ in_analog_left[i][1] = MIN((input_state_cb(i, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_LEFT, RETRO_DEVICE_ID_ANALOG_Y) / 255) + 128, 255);
+ in_analog_right[i][0] = MIN((input_state_cb(i, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_RIGHT, RETRO_DEVICE_ID_ANALOG_X) / 255) + 128, 255);
+ in_analog_right[i][1] = MIN((input_state_cb(i, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_RIGHT, RETRO_DEVICE_ID_ANALOG_Y) / 255) + 128, 255);
+ }
+ }
}
stop = 0;
psxCpu->Execute();
- video_cb((vout_fb_dirty || !vout_can_dupe || !duping_enable) ? vout_buf : NULL,
+ video_cb((vout_fb_dirty || !vout_can_dupe || !duping_enable) ? vout_buf_ptr : NULL,
vout_width, vout_height, vout_width * 2);
vout_fb_dirty = 0;
+
+ set_vout_fb();
}
static bool try_use_bios(const char *path)
return true;
}
-#if 1
+#ifndef VITA
#include <sys/types.h>
#include <dirent.h>
if (strncasecmp(ent->d_name, "scph", 4) != 0)
continue;
- snprintf(path, path_size, "%s/%s", dirpath, ent->d_name);
+ snprintf(path, path_size, "%s%c%s", dirpath, SLASH, ent->d_name);
ret = try_use_bios(path);
if (ret)
break;
environ_cb(RETRO_ENVIRONMENT_SET_PERFORMANCE_LEVEL, &level);
}
-void retro_init(void)
+static int init_memcards(void)
+{
+ int ret = 0;
+ const char *dir;
+ struct retro_variable var = { .key="pcsx_rearmed_memcard2", .value=NULL };
+ static const char CARD2_FILE[] = "pcsx-card2.mcd";
+
+ // Memcard2 will be handled and is re-enabled if needed using core
+ // operations.
+ // Memcard1 is handled by libretro, doing this will set core to
+ // skip file io operations for memcard1 like SaveMcd
+ snprintf(Config.Mcd1, sizeof(Config.Mcd1), "none");
+ snprintf(Config.Mcd2, sizeof(Config.Mcd2), "none");
+ init_memcard(Mcd1Data);
+ // Memcard 2 is managed by the emulator on the filesystem,
+ // There is no need to initialize Mcd2Data like Mcd1Data.
+
+ if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) && var.value) {
+ SysPrintf("Memcard 2: %s\n", var.value);
+ if (memcmp(var.value, "enabled", 7) == 0) {
+ if (environ_cb(RETRO_ENVIRONMENT_GET_SAVE_DIRECTORY, &dir) && dir) {
+ if (strlen(dir) + strlen(CARD2_FILE) + 2 > sizeof(Config.Mcd2)) {
+ SysPrintf("Path '%s' is too long. Cannot use memcard 2. Use a shorter path.\n", dir);
+ ret = -1;
+ } else {
+ McdDisable[1] = 0;
+ snprintf(Config.Mcd2, sizeof(Config.Mcd2), "%s/%s", dir, CARD2_FILE);
+ SysPrintf("Use memcard 2: %s\n", Config.Mcd2);
+ }
+ } else {
+ SysPrintf("Could not get save directory! Could not create memcard 2.");
+ ret = -1;
+ }
+ }
+ }
+ return ret;
+}
+
+static void loadPSXBios(void)
{
- const char *bios[] = { "scph1001", "scph5501", "scph7001" };
const char *dir;
char path[256];
- int i, ret;
- bool found_bios = false;
+ unsigned useHLE = 0;
+
+ const char *bios[] = {
+ "SCPH101", "scph101",
+ "SCPH5501", "scph5501",
+ "SCPH7001", "scph7001",
+ "SCPH1001", "scph1001"
+ };
+
+ struct retro_variable var = {
+ .key = "pcsx_rearmed_bios",
+ .value = NULL
+ };
+
+ found_bios = 0;
+
+ if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) && var.value) {
+ if (!strcmp(var.value, "HLE"))
+ useHLE = 1;
+ }
+
+ if (!useHLE)
+ {
+ if (environ_cb(RETRO_ENVIRONMENT_GET_SYSTEM_DIRECTORY, &dir) && dir)
+ {
+ unsigned i;
+ snprintf(Config.BiosDir, sizeof(Config.BiosDir), "%s", dir);
+
+ for (i = 0; i < sizeof(bios) / sizeof(bios[0]); i++) {
+ snprintf(path, sizeof(path), "%s%c%s.bin", dir, SLASH, bios[i]);
+ found_bios = try_use_bios(path);
+ if (found_bios)
+ break;
+ }
+
+ if (!found_bios)
+ found_bios = find_any_bios(dir, path, sizeof(path));
+ }
+ if (found_bios) {
+ SysPrintf("found BIOS file: %s\n", Config.Bios);
+ }
+ }
+
+ if (useHLE || !found_bios)
+ {
+ SysPrintf("no BIOS files found.\n");
+ struct retro_message msg =
+ {
+ "No PlayStation BIOS file found - add for better compatibility",
+ 180
+ };
+ environ_cb(RETRO_ENVIRONMENT_SET_MESSAGE, (void*)&msg);
+ }
+}
+
+void retro_init(void)
+{
+ struct retro_rumble_interface rumble;
+ int ret;
#ifdef __MACH__
// magic sauce to make the dynarec work on iOS
syscall(SYS_ptrace, 0 /*PTRACE_TRACEME*/, 0, 0, 0);
#endif
+#ifdef _3DS
+ psxMapHook = pl_3ds_mmap;
+ psxUnmapHook = pl_3ds_munmap;
+#endif
+#ifdef VITA
+ if(init_vita_mmap()<0)
+ abort();
+ psxMapHook = pl_vita_mmap;
+ psxUnmapHook = pl_vita_munmap;
+#endif
ret = emu_core_preinit();
+#ifdef _3DS
+ /* emu_core_preinit sets the cpu to dynarec */
+ if(!__ctr_svchax)
+ Config.Cpu = CPU_INTERPRETER;
+#endif
+ ret |= init_memcards();
+
ret |= emu_core_init();
if (ret != 0) {
SysPrintf("PCSX init failed.\n");
exit(1);
}
-#if defined(_POSIX_C_SOURCE) && (_POSIX_C_SOURCE >= 200112L)
+#ifdef _3DS
+ vout_buf = linearMemAlign(VOUT_MAX_WIDTH * VOUT_MAX_HEIGHT * 2, 0x80);
+#elif defined(_POSIX_C_SOURCE) && (_POSIX_C_SOURCE >= 200112L) && !defined(VITA)
posix_memalign(&vout_buf, 16, VOUT_MAX_WIDTH * VOUT_MAX_HEIGHT * 2);
#else
vout_buf = malloc(VOUT_MAX_WIDTH * VOUT_MAX_HEIGHT * 2);
#endif
- if (environ_cb(RETRO_ENVIRONMENT_GET_SYSTEM_DIRECTORY, &dir) && dir)
- {
- snprintf(Config.BiosDir, sizeof(Config.BiosDir), "%s/", dir);
+ vout_buf_ptr = vout_buf;
- for (i = 0; i < sizeof(bios) / sizeof(bios[0]); i++) {
- snprintf(path, sizeof(path), "%s/%s.bin", dir, bios[i]);
- found_bios = try_use_bios(path);
- if (found_bios)
- break;
- }
-
- if (!found_bios)
- found_bios = find_any_bios(dir, path, sizeof(path));
- }
- if (found_bios) {
- SysPrintf("found BIOS file: %s\n", Config.Bios);
- }
- else
- {
- SysPrintf("no BIOS files found.\n");
- struct retro_message msg =
- {
- "no BIOS found, expect bugs!",
- 180
- };
- environ_cb(RETRO_ENVIRONMENT_SET_MESSAGE, (void*)&msg);
- }
+ loadPSXBios();
environ_cb(RETRO_ENVIRONMENT_GET_CAN_DUPE, &vout_can_dupe);
environ_cb(RETRO_ENVIRONMENT_SET_DISK_CONTROL_INTERFACE, &disk_control);
- environ_cb(RETRO_ENVIRONMENT_GET_RUMBLE_INTERFACE, &rumble);
+
+ rumble_cb = NULL;
+ if (environ_cb(RETRO_ENVIRONMENT_GET_RUMBLE_INTERFACE, &rumble))
+ rumble_cb = rumble.set_rumble_state;
/* Set how much slower PSX CPU runs * 100 (so that 200 is 2 times)
* we have to do this because cache misses and some IO penalties
pl_rearmed_cbs.gpu_peops.iUseDither = 1;
spu_config.iUseFixedUpdates = 1;
- McdDisable[0] = 0;
- McdDisable[1] = 1;
- init_memcard(Mcd1Data);
-
SaveFuncs.open = save_open;
SaveFuncs.read = save_read;
SaveFuncs.write = save_write;
void retro_deinit(void)
{
SysClose();
+#ifdef _3DS
+ linearFree(vout_buf);
+#else
free(vout_buf);
+#endif
vout_buf = NULL;
+
+#ifdef VITA
+ deinit_vita_mmap();
+#endif
}
+
+#ifdef VITA
+#include <psp2/kernel/threadmgr.h>
+int usleep (unsigned long us)
+{
+ sceKernelDelayThread(us);
+}
+#endif
-/* Copyright (C) 2010-2014 The RetroArch team
+/* Copyright (C) 2010-2016 The RetroArch team
*
* ---------------------------------------------------------------------------------------
* The following license statement only applies to this libretro API header (libretro.h).
#endif
#endif
+#ifndef RETRO_CALLCONV
+# if defined(__GNUC__) && defined(__i386__) && !defined(__x86_64__)
+# define RETRO_CALLCONV __attribute__((cdecl))
+# elif defined(_MSC_VER) && defined(_M_X86) && !defined(_M_X64)
+# define RETRO_CALLCONV __cdecl
+# else
+# define RETRO_CALLCONV /* all other platforms only have one calling convention each */
+# endif
+#endif
+
+#ifndef RETRO_API
+# if defined(_WIN32) || defined(__CYGWIN__) || defined(__MINGW32__)
+# ifdef RETRO_IMPORT_SYMBOLS
+# ifdef __GNUC__
+# define RETRO_API RETRO_CALLCONV __attribute__((__dllimport__))
+# else
+# define RETRO_API RETRO_CALLCONV __declspec(dllimport)
+# endif
+# else
+# ifdef __GNUC__
+# define RETRO_API RETRO_CALLCONV __attribute__((__dllexport__))
+# else
+# define RETRO_API RETRO_CALLCONV __declspec(dllexport)
+# endif
+# endif
+# else
+# if defined(__GNUC__) && __GNUC__ >= 4 && !defined(__CELLOS_LV2__)
+# define RETRO_API RETRO_CALLCONV __attribute__((__visibility__("default")))
+# else
+# define RETRO_API RETRO_CALLCONV
+# endif
+# endif
+#endif
+
/* Used for checking API/ABI mismatches that can break libretro
* implementations.
* It is not incremented for compatible changes to the API.
/* Index / Id values for ANALOG device. */
#define RETRO_DEVICE_INDEX_ANALOG_LEFT 0
#define RETRO_DEVICE_INDEX_ANALOG_RIGHT 1
+#define RETRO_DEVICE_INDEX_ANALOG_BUTTON 2
#define RETRO_DEVICE_ID_ANALOG_X 0
#define RETRO_DEVICE_ID_ANALOG_Y 1
/* Id values for MOUSE. */
-#define RETRO_DEVICE_ID_MOUSE_X 0
-#define RETRO_DEVICE_ID_MOUSE_Y 1
-#define RETRO_DEVICE_ID_MOUSE_LEFT 2
-#define RETRO_DEVICE_ID_MOUSE_RIGHT 3
-#define RETRO_DEVICE_ID_MOUSE_WHEELUP 4
-#define RETRO_DEVICE_ID_MOUSE_WHEELDOWN 5
-#define RETRO_DEVICE_ID_MOUSE_MIDDLE 6
+#define RETRO_DEVICE_ID_MOUSE_X 0
+#define RETRO_DEVICE_ID_MOUSE_Y 1
+#define RETRO_DEVICE_ID_MOUSE_LEFT 2
+#define RETRO_DEVICE_ID_MOUSE_RIGHT 3
+#define RETRO_DEVICE_ID_MOUSE_WHEELUP 4
+#define RETRO_DEVICE_ID_MOUSE_WHEELDOWN 5
+#define RETRO_DEVICE_ID_MOUSE_MIDDLE 6
+#define RETRO_DEVICE_ID_MOUSE_HORIZ_WHEELUP 7
+#define RETRO_DEVICE_ID_MOUSE_HORIZ_WHEELDOWN 8
/* Id values for LIGHTGUN types. */
#define RETRO_DEVICE_ID_LIGHTGUN_X 0
RETRO_LANGUAGE_KOREAN = 9,
RETRO_LANGUAGE_CHINESE_TRADITIONAL = 10,
RETRO_LANGUAGE_CHINESE_SIMPLIFIED = 11,
+ RETRO_LANGUAGE_ESPERANTO = 12,
+ RETRO_LANGUAGE_POLISH = 13,
RETRO_LANGUAGE_LAST,
/* Ensure sizeof(enum) == sizeof(int) */
* location-based information from the host device,
* such as current latitude / longitude.
*/
-#define RETRO_ENVIRONMENT_GET_CONTENT_DIRECTORY 30
+#define RETRO_ENVIRONMENT_GET_CONTENT_DIRECTORY 30 /* Old name, kept for compatibility. */
+#define RETRO_ENVIRONMENT_GET_CORE_ASSETS_DIRECTORY 30
/* const char ** --
- * Returns the "content" directory of the frontend.
+ * Returns the "core assets" directory of the frontend.
* This directory can be used to store specific assets that the
* core relies upon, such as art assets,
* input data, etc etc.
* Returns the specified language of the frontend, if specified by the user.
* It can be used by the core for localization purposes.
*/
+#define RETRO_ENVIRONMENT_GET_CURRENT_SOFTWARE_FRAMEBUFFER (40 | RETRO_ENVIRONMENT_EXPERIMENTAL)
+ /* struct retro_framebuffer * --
+ * Returns a preallocated framebuffer which the core can use for rendering
+ * the frame into when not using SET_HW_RENDER.
+ * The framebuffer returned from this call must not be used
+ * after the current call to retro_run() returns.
+ *
+ * The goal of this call is to allow zero-copy behavior where a core
+ * can render directly into video memory, avoiding extra bandwidth cost by copying
+ * memory from core to video memory.
+ *
+ * If this call succeeds and the core renders into it,
+ * the framebuffer pointer and pitch can be passed to retro_video_refresh_t.
+ * If the buffer from GET_CURRENT_SOFTWARE_FRAMEBUFFER is to be used,
+ * the core must pass the exact
+ * same pointer as returned by GET_CURRENT_SOFTWARE_FRAMEBUFFER;
+ * i.e. passing a pointer which is offset from the
+ * buffer is undefined. The width, height and pitch parameters
+ * must also match exactly to the values obtained from GET_CURRENT_SOFTWARE_FRAMEBUFFER.
+ *
+ * It is possible for a frontend to return a different pixel format
+ * than the one used in SET_PIXEL_FORMAT. This can happen if the frontend
+ * needs to perform conversion.
+ *
+ * It is still valid for a core to render to a different buffer
+ * even if GET_CURRENT_SOFTWARE_FRAMEBUFFER succeeds.
+ *
+ * A frontend must make sure that the pointer obtained from this function is
+ * writeable (and readable).
+ */
+
+enum retro_hw_render_interface_type
+{
+ RETRO_HW_RENDER_INTERFACE_VULKAN = 0,
+ RETRO_HW_RENDER_INTERFACE_DUMMY = INT_MAX
+};
+
+/* Base struct. All retro_hw_render_interface_* types
+ * contain at least these fields. */
+struct retro_hw_render_interface
+{
+ enum retro_hw_render_interface_type interface_type;
+ unsigned interface_version;
+};
+#define RETRO_ENVIRONMENT_GET_HW_RENDER_INTERFACE (41 | RETRO_ENVIRONMENT_EXPERIMENTAL)
+ /* const struct retro_hw_render_interface ** --
+ * Returns an API specific rendering interface for accessing API specific data.
+ * Not all HW rendering APIs support or need this.
+ * The contents of the returned pointer is specific to the rendering API
+ * being used. See the various headers like libretro_vulkan.h, etc.
+ *
+ * GET_HW_RENDER_INTERFACE cannot be called before context_reset has been called.
+ * Similarly, after context_destroyed callback returns,
+ * the contents of the HW_RENDER_INTERFACE are invalidated.
+ */
#define RETRO_MEMDESC_CONST (1 << 0) /* The frontend will never change this memory area once retro_load_game has returned. */
#define RETRO_MEMDESC_BIGENDIAN (1 << 1) /* The memory area contains big endian data. Default is little endian. */
#define RETRO_SIMD_VFPU (1 << 13)
#define RETRO_SIMD_PS (1 << 14)
#define RETRO_SIMD_AES (1 << 15)
+#define RETRO_SIMD_VFPV3 (1 << 16)
+#define RETRO_SIMD_VFPV4 (1 << 17)
+#define RETRO_SIMD_POPCNT (1 << 18)
+#define RETRO_SIMD_MOVBE (1 << 19)
typedef uint64_t retro_perf_tick_t;
typedef int64_t retro_time_t;
* use the corresponding enums directly. */
RETRO_HW_CONTEXT_OPENGLES_VERSION = 5,
+ /* Vulkan, see RETRO_ENVIRONMENT_GET_HW_RENDER_INTERFACE. */
+ RETRO_HW_CONTEXT_VULKAN = 6,
+
RETRO_HW_CONTEXT_DUMMY = INT_MAX
};
*/
retro_hw_context_reset_t context_reset;
- /* Set by frontend. */
+ /* Set by frontend.
+ * TODO: This is rather obsolete. The frontend should not
+ * be providing preallocated framebuffers. */
retro_hw_get_current_framebuffer_t get_current_framebuffer;
/* Set by frontend. */
retro_hw_get_proc_address_t get_proc_address;
- /* Set if render buffers should have depth component attached. */
+ /* Set if render buffers should have depth component attached.
+ * TODO: Obsolete. */
bool depth;
- /* Set if stencil buffers should be attached. */
+ /* Set if stencil buffers should be attached.
+ * TODO: Obsolete. */
bool stencil;
/* If depth and stencil are true, a packed 24/8 buffer will be added.
* Only attaching stencil is invalid and will be ignored. */
/* Use conventional bottom-left origin convention. If false,
- * standard libretro top-left origin semantics are used. */
+ * standard libretro top-left origin semantics are used.
+ * TODO: Move to GL specific interface. */
bool bottom_left_origin;
/* Major version number for core GL context or GLES 3.1+. */
/* If this is true, the frontend will go very far to avoid
* resetting context in scenarios like toggling fullscreen, etc.
+ * TODO: Obsolete? Maybe frontend should just always assume this ...
*/
bool cache_context;
const char *meta; /* String of implementation specific meta-data. */
};
+#define RETRO_MEMORY_ACCESS_WRITE (1 << 0)
+ /* The core will write to the buffer provided by retro_framebuffer::data. */
+#define RETRO_MEMORY_ACCESS_READ (1 << 1)
+ /* The core will read from retro_framebuffer::data. */
+#define RETRO_MEMORY_TYPE_CACHED (1 << 0)
+ /* The memory in data is cached.
+ * If not cached, random writes and/or reading from the buffer is expected to be very slow. */
+struct retro_framebuffer
+{
+ void *data; /* The framebuffer which the core can render into.
+ Set by frontend in GET_CURRENT_SOFTWARE_FRAMEBUFFER.
+ The initial contents of data are unspecified. */
+ unsigned width; /* The framebuffer width used by the core. Set by core. */
+ unsigned height; /* The framebuffer height used by the core. Set by core. */
+ size_t pitch; /* The number of bytes between the beginning of a scanline,
+ and beginning of the next scanline.
+ Set by frontend in GET_CURRENT_SOFTWARE_FRAMEBUFFER. */
+ enum retro_pixel_format format; /* The pixel format the core must use to render into data.
+ This format could differ from the format used in
+ SET_PIXEL_FORMAT.
+ Set by frontend in GET_CURRENT_SOFTWARE_FRAMEBUFFER. */
+
+ unsigned access_flags; /* How the core will access the memory in the framebuffer.
+ RETRO_MEMORY_ACCESS_* flags.
+ Set by core. */
+ unsigned memory_flags; /* Flags telling core how the memory has been mapped.
+ RETRO_MEMORY_TYPE_* flags.
+ Set by frontend in GET_CURRENT_SOFTWARE_FRAMEBUFFER. */
+};
+
/* Callbacks */
/* Environment callback. Gives implementations a way of performing
*
* The rest of the set_* functions are guaranteed to have been called
* before the first call to retro_run() is made. */
-void retro_set_environment(retro_environment_t);
-void retro_set_video_refresh(retro_video_refresh_t);
-void retro_set_audio_sample(retro_audio_sample_t);
-void retro_set_audio_sample_batch(retro_audio_sample_batch_t);
-void retro_set_input_poll(retro_input_poll_t);
-void retro_set_input_state(retro_input_state_t);
+RETRO_API void retro_set_environment(retro_environment_t);
+RETRO_API void retro_set_video_refresh(retro_video_refresh_t);
+RETRO_API void retro_set_audio_sample(retro_audio_sample_t);
+RETRO_API void retro_set_audio_sample_batch(retro_audio_sample_batch_t);
+RETRO_API void retro_set_input_poll(retro_input_poll_t);
+RETRO_API void retro_set_input_state(retro_input_state_t);
/* Library global initialization/deinitialization. */
-void retro_init(void);
-void retro_deinit(void);
+RETRO_API void retro_init(void);
+RETRO_API void retro_deinit(void);
/* Must return RETRO_API_VERSION. Used to validate ABI compatibility
* when the API is revised. */
-unsigned retro_api_version(void);
+RETRO_API unsigned retro_api_version(void);
/* Gets statically known system info. Pointers provided in *info
* must be statically allocated.
* Can be called at any time, even before retro_init(). */
-void retro_get_system_info(struct retro_system_info *info);
+RETRO_API void retro_get_system_info(struct retro_system_info *info);
/* Gets information about system audio/video timings and geometry.
* Can be called only after retro_load_game() has successfully completed.
* variable if needed.
* E.g. geom.aspect_ratio might not be initialized if core doesn't
* desire a particular aspect ratio. */
-void retro_get_system_av_info(struct retro_system_av_info *info);
+RETRO_API void retro_get_system_av_info(struct retro_system_av_info *info);
/* Sets device to be used for player 'port'.
* By default, RETRO_DEVICE_JOYPAD is assumed to be plugged into all
* hint to the libretro core when a core cannot automatically detect the
* appropriate input device type on its own. It is also relevant when a
* core can change its behavior depending on device type. */
-void retro_set_controller_port_device(unsigned port, unsigned device);
+RETRO_API void retro_set_controller_port_device(unsigned port, unsigned device);
/* Resets the current game. */
-void retro_reset(void);
+RETRO_API void retro_reset(void);
/* Runs the game for one video frame.
* During retro_run(), input_poll callback must be called at least once.
* a frame if GET_CAN_DUPE returns true.
* In this case, the video callback can take a NULL argument for data.
*/
-void retro_run(void);
+RETRO_API void retro_run(void);
/* Returns the amount of data the implementation requires to serialize
* internal state (save states).
* returned size is never allowed to be larger than a previous returned
* value, to ensure that the frontend can allocate a save state buffer once.
*/
-size_t retro_serialize_size(void);
+RETRO_API size_t retro_serialize_size(void);
/* Serializes internal state. If failed, or size is lower than
* retro_serialize_size(), it should return false, true otherwise. */
-bool retro_serialize(void *data, size_t size);
-bool retro_unserialize(const void *data, size_t size);
+RETRO_API bool retro_serialize(void *data, size_t size);
+RETRO_API bool retro_unserialize(const void *data, size_t size);
-void retro_cheat_reset(void);
-void retro_cheat_set(unsigned index, bool enabled, const char *code);
+RETRO_API void retro_cheat_reset(void);
+RETRO_API void retro_cheat_set(unsigned index, bool enabled, const char *code);
/* Loads a game. */
-bool retro_load_game(const struct retro_game_info *game);
+RETRO_API bool retro_load_game(const struct retro_game_info *game);
/* Loads a "special" kind of game. Should not be used,
* except in extreme cases. */
-bool retro_load_game_special(
+RETRO_API bool retro_load_game_special(
unsigned game_type,
const struct retro_game_info *info, size_t num_info
);
/* Unloads a currently loaded game. */
-void retro_unload_game(void);
+RETRO_API void retro_unload_game(void);
/* Gets region of game. */
-unsigned retro_get_region(void);
+RETRO_API unsigned retro_get_region(void);
/* Gets region of memory. */
-void *retro_get_memory_data(unsigned id);
-size_t retro_get_memory_size(unsigned id);
+RETRO_API void *retro_get_memory_data(unsigned id);
+RETRO_API size_t retro_get_memory_size(unsigned id);
#ifdef __cplusplus
}
--- /dev/null
+{
+ global: retro_*;
+ local: *;
+};
+
#include <unistd.h>
#include <signal.h>
#include <time.h>
-#ifndef _WIN32
+#if !defined(_WIN32) && !defined(NO_DYLIB)
#include <dlfcn.h>
#endif
new_dynarec_hacks = 0;
cycle_multiplier = 200;
- in_type1 = PSE_PAD_TYPE_STANDARD;
- in_type2 = PSE_PAD_TYPE_STANDARD;
+ in_type[0] = PSE_PAD_TYPE_STANDARD;
+ in_type[1] = PSE_PAD_TYPE_STANDARD;
}
void do_emu_action(void)
// reset can run code, timing must be set
pl_timing_prepare(Config.PsxType);
- EmuReset();
-
- // hmh core forgets this
+ // hmh core forgets this
CDR_stop();
+
+ EmuReset();
GPU_updateLace = real_lace;
g_emu_resetting = 0;
return ret;
ret = SaveState(fname);
-#ifdef HAVE_PRE_ARMV7 /* XXX GPH hack */
+#if defined(HAVE_PRE_ARMV7) && !defined(_3DS) /* XXX GPH hack */
sync();
#endif
SysPrintf("* %s \"%s\" [%d]\n",
return (void *)(long)(PLUGIN_DL_BASE + builtin_plugin_ids[i]);
}
-#ifndef _WIN32
+#if !defined(_WIN32) && !defined(NO_DYLIB)
ret = dlopen(lib, RTLD_NOW);
if (ret == NULL)
SysMessage("dlopen: %s", dlerror());
if (PLUGIN_DL_BASE <= plugid && plugid < PLUGIN_DL_BASE + ARRAY_SIZE(builtin_plugins))
return plugin_link(plugid - PLUGIN_DL_BASE, sym);
-#ifndef _WIN32
+#if !defined(_WIN32) && !defined(NO_DYLIB)
return dlsym(lib, sym);
#else
return NULL;
}
const char *SysLibError() {
-#ifndef _WIN32
+#if defined(NO_DYLIB)
+ return NULL;
+#elif !defined(_WIN32)
return dlerror();
#else
return "not supported";
if (PLUGIN_DL_BASE <= plugid && plugid < PLUGIN_DL_BASE + ARRAY_SIZE(builtin_plugins))
return;
-#ifndef _WIN32
+#if !defined(_WIN32) && !defined(NO_DYLIB)
dlclose(lib);
#endif
}
-
int soft_scaling, analog_deadzone; // for Caanoo
int soft_filter;
-#ifndef HAVE_PRE_ARMV7
-#define DEFAULT_PSX_CLOCK 57
-#define DEFAULT_PSX_CLOCK_S "57"
-#else
-#define DEFAULT_PSX_CLOCK 50
-#define DEFAULT_PSX_CLOCK_S "50"
-#endif
+// Default to 100% CPU speed as most hardware can handle it nowadays using the dynamic recompiler.
+// If not, the option is in the advanced speed hacks menu, so in a logical place.
+#define DEFAULT_PSX_CLOCK 100
+#define DEFAULT_PSX_CLOCK_S "100"
static const char *bioses[24];
static const char *gpu_plugins[16];
switch (in_type_sel1) {
case 1: in_type1 = PSE_PAD_TYPE_ANALOGPAD; break;
- case 2: in_type1 = PSE_PAD_TYPE_GUNCON; break;
+ case 2: in_type1 = PSE_PAD_TYPE_NEGCON; break;
default: in_type1 = PSE_PAD_TYPE_STANDARD;
}
switch (in_type_sel2) {
case 1: in_type2 = PSE_PAD_TYPE_ANALOGPAD; break;
- case 2: in_type2 = PSE_PAD_TYPE_GUNCON; break;
+ case 2: in_type2 = PSE_PAD_TYPE_NEGCON; break;
default: in_type2 = PSE_PAD_TYPE_STANDARD;
}
if (in_evdev_allow_abs_only != allow_abs_only_old) {
+++ /dev/null
-<?xml version="1.0" encoding="UTF-8"?>
-<PXML xmlns="http://openpandora.org/namespaces/PXML" xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" xsi:noNamespaceSchemaLocation="PXML_schema.xsd">
-<package id="package.pcsx_rearmed.notaz">
- <titles>
- <title lang="en_US">PCSX ReARMed</title>
- </titles>
- <version major="1" minor="9" release="93" build="%PR%"/>
- <author name="PCSX team/notaz" website="http://notaz.gp2x.de/"/>
-</package>
-<application id="pcsx_rearmed.notaz.%PR%" appdata="pcsx_rearmed">
- <titles>
- <title lang="en_US">PCSX ReARMed %PR%</title>
- </titles>
- <title lang="en_US">PCSX ReARMed %PR%</title>
-
- <descriptions>
- <description lang="en_US">PCSX ReARMed is heavily optimized PlayStation Emulator. It's a PCSX fork based on the PCSX-Reloaded project, which itself contains code from PCSX, PCSX-df and PCSX-Revolution.
-
-The emulator features MIPS->ARM recompiler by Ari64 and ARM NEON GPU by Exophase, that in many cases produces pixel perfect graphics at very high performance. There is also NEON-optimized GTE code, optimized P.E.Op.S. (Pete's) SPU; PCSX4ALL and traditional P.E.Op.S. GPUs are also available.</description>
- </descriptions>
-
- <exec command="pcsx.sh"/>
-
- <icon src="pcsx.png"/>
-
- <author name="PCSX team/notaz" website="http://notaz.gp2x.de/"/>
-
- <version major="1" minor="9" release="93" build="%PR%"/>
-
- <licenses>
- <license name="GPLv2+" url="http://www.gnu.org/licenses/gpl-2.0.html" sourcecodeurl="http://notaz.gp2x.de/cgi-bin/gitweb.cgi?p=pcsx_rearmed.git"/>
- </licenses>
-
- <info name="PCSX ReARMed %PR% readme" type="text/plain" src="readme.txt"/>
-
- <categories>
- <category name="Game">
- <subcategory name="Emulator"/>
- </category>
- </categories>
-</application>
-</PXML>
+++ /dev/null
-#!/bin/sh
-
-# stupid nub mode thing
-nub0mode=`cat /proc/pandora/nub0/mode`
-nub1mode=`cat /proc/pandora/nub1/mode`
-/usr/pandora/scripts/op_nubchange.sh absolute absolute
-
-# 4MB for RAM (2+align) + 2MB for vram (1+overdraw)
-# + 10MB for gpu_neon (8+overdraw) + 8MB LUTs
-# no big deal if this fails, only performance loss
-sudo -n /usr/pandora/scripts/op_hugetlb.sh 24
-
-# C64x DSP for SPU
-sudo -n /usr/pandora/scripts/op_dsp_c64.sh
-
-./pcsx "$@"
-
-# restore stuff if pcsx crashes
-./picorestore
-sudo -n /usr/pandora/scripts/op_lcdrate.sh 60
-sudo -n /usr/pandora/scripts/op_gamma.sh 0
-sudo -n /usr/pandora/scripts/op_hugetlb.sh 0
-
-/usr/pandora/scripts/op_nubchange.sh $nub0mode $nub1mode
+++ /dev/null
-/*
- * picorestore - clean up after an omapfb program crash
- *
- * Copyright (c) Gražvydas "notaz" Ignotas, 2010
- *
- * Redistribution and use in source and binary forms, with or without
- * modification, are permitted provided that the following conditions are met:
- * * Redistributions of source code must retain the above copyright
- * notice, this list of conditions and the following disclaimer.
- * * Redistributions in binary form must reproduce the above copyright
- * notice, this list of conditions and the following disclaimer in the
- * documentation and/or other materials provided with the distribution.
- * * Neither the name of the organization nor the
- * names of its contributors may be used to endorse or promote products
- * derived from this software without specific prior written permission.
- *
- * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS"
- * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE
- * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE
- * ARE DISCLAIMED. IN NO EVENT SHALL COPYRIGHT HOLDER OR CONTRIBUTORS BE LIABLE
- * FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL
- * DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR
- * SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER
- * CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY,
- * OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE
- * OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
- */
-
-#include <stdio.h>
-#include <sys/types.h>
-#include <sys/stat.h>
-#include <fcntl.h>
-#include <unistd.h>
-#include <sys/ioctl.h>
-#include <linux/fb.h>
-#include <linux/omapfb.h>
-#include <linux/kd.h>
-
-int main()
-{
- struct fb_var_screeninfo fbvar;
- struct omapfb_plane_info pi;
- struct omapfb_mem_info mi;
- int ret, fbdev, kbdfd;
-
- fbdev = open("/dev/fb0", O_RDWR);
- if (fbdev == -1) {
- perror("open fb0");
- goto end_fb0;
- }
-
- ret = ioctl(fbdev, FBIOGET_VSCREENINFO, &fbvar);
- if (ret == -1) {
- perror("FBIOGET_VSCREENINFO ioctl");
- goto end_fb0;
- }
-
- if (fbvar.yoffset != 0) {
- printf("fixing yoffset.. ");
- fbvar.yoffset = 0;
- ret = ioctl(fbdev, FBIOPAN_DISPLAY, &fbvar);
- if (ret < 0)
- perror("ioctl FBIOPAN_DISPLAY");
- else
- printf("ok\n");
- }
-
-end_fb0:
- if (fbdev >= 0)
- close(fbdev);
-
- fbdev = open("/dev/fb1", O_RDWR);
- if (fbdev == -1) {
- perror("open fb1");
- goto end_fb1;
- }
-
- ret = ioctl(fbdev, OMAPFB_QUERY_PLANE, &pi);
- ret |= ioctl(fbdev, OMAPFB_QUERY_MEM, &mi);
- if (ret != 0)
- perror("QUERY_*");
-
- pi.enabled = 0;
- ret = ioctl(fbdev, OMAPFB_SETUP_PLANE, &pi);
- if (ret != 0)
- perror("SETUP_PLANE");
-
- mi.size = 0;
- ret = ioctl(fbdev, OMAPFB_SETUP_MEM, &mi);
- if (ret != 0)
- perror("SETUP_MEM");
-
-end_fb1:
- if (fbdev >= 0)
- close(fbdev);
-
- kbdfd = open("/dev/tty", O_RDWR);
- if (kbdfd == -1) {
- perror("open /dev/tty");
- return 1;
- }
-
- if (ioctl(kbdfd, KDSETMODE, KD_TEXT) == -1)
- perror("KDSETMODE KD_TEXT");
-
- close(kbdfd);
-
- return 0;
-}
+++ /dev/null
-The skin images can be customized, but there are several limitations:\r
-\r
-background.png - must be 320x240 image with 24bit RGB colors.\r
-font.png - must be 128x160 8bit grayscale image.\r
-selector.png - must be 8x10 8bit grayscale image.\r
-\r
-Font and selector colors can be changed by editing skin.txt.\r
-\r
+++ /dev/null
-// html-style hex color codes, ex. ff0000 is red, 0000ff is blue, etc.\r
-text_color=ffffc0\r
-selection_color=808010\r
-\r
+++ /dev/null
-#ifndef UI_FEATURES_H
-#define UI_FEATURES_H
-
-#define MENU_BIOS_PATH "<SD card>/pandora/appdata/pcsx_rearmed/bios/"
-#define BOOT_MSG "Booting up... (press SPACE for menu)"
-#define MENU_SHOW_VARSCALER 1
-#define MENU_SHOW_VOUTMODE 0
-#define MENU_SHOW_SCALER2 0
-#define MENU_SHOW_NUBS_BTNS 1
-#define MENU_SHOW_VIBRATION 0
-#define MENU_SHOW_DEADZONE 0
-#define MENU_SHOW_MINIMIZE 1
-#define MENU_SHOW_FULLSCREEN 0
-#define MENU_SHOW_VOLUME 0
-
-#endif // UI_FEATURES_H
extern int CALLBACK SPUplayCDDAchannel(short *, int);
/* PAD */
-static long PADreadPort1(PadDataS *pad)
-{
- pad->controllerType = in_type1;
- pad->buttonStatus = ~in_keystate;
- if (in_type1 == PSE_PAD_TYPE_ANALOGPAD) {
- pad->leftJoyX = in_a1[0];
- pad->leftJoyY = in_a1[1];
- pad->rightJoyX = in_a2[0];
- pad->rightJoyY = in_a2[1];
- }
- return 0;
+static long PADreadPort1(PadDataS *pad) {
+ int pad_index = pad->requestPadIndex;
+ pad->controllerType = in_type[pad_index];
+ pad->buttonStatus = ~in_keystate[pad_index];
+ if (multitap1 == 1)
+ pad->portMultitap = 1;
+ else
+ pad->portMultitap = 0;
+
+ if (in_type[pad_index] == PSE_PAD_TYPE_ANALOGJOY || in_type[pad_index] == PSE_PAD_TYPE_ANALOGPAD || in_type[pad_index] == PSE_PAD_TYPE_NEGCON)
+ {
+ pad->leftJoyX = in_analog_left[pad_index][0];
+ pad->leftJoyY = in_analog_left[pad_index][1];
+ pad->rightJoyX = in_analog_right[pad_index][0];
+ pad->rightJoyY = in_analog_right[pad_index][1];
+ }
+ return 0;
}
-static long PADreadPort2(PadDataS *pad)
-{
- pad->controllerType = in_type2;
- pad->buttonStatus = ~in_keystate >> 16;
- return 0;
+static long PADreadPort2(PadDataS *pad) {
+ int pad_index = pad->requestPadIndex;
+
+ pad->controllerType = in_type[pad_index];
+ pad->buttonStatus = ~in_keystate[pad_index];
+ if (multitap2 == 1)
+ pad->portMultitap = 2;
+ else
+ pad->portMultitap = 0;
+
+ if (in_type[pad_index] == PSE_PAD_TYPE_ANALOGJOY || in_type[pad_index] == PSE_PAD_TYPE_ANALOGPAD || in_type[pad_index] == PSE_PAD_TYPE_NEGCON)
+ {
+ pad->leftJoyX = in_analog_left[pad_index][0];
+ pad->leftJoyY = in_analog_left[pad_index][1];
+ pad->rightJoyX = in_analog_right[pad_index][0];
+ pad->rightJoyY = in_analog_right[pad_index][1];
+ }
+ return 0;
}
/* GPU */
#define HUD_HEIGHT 10
-int in_type1, in_type2;
-int in_a1[2] = { 127, 127 }, in_a2[2] = { 127, 127 };
+int in_type[8];
+int multitap1;
+int multitap2;
+int in_analog_left[8][2] = {{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 }};
+int in_analog_right[8][2] = {{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 }};
int in_adev[2] = { -1, -1 }, in_adev_axis[2][2] = {{ 0, 1 }, { 0, 1 }};
int in_adev_is_nublike[2];
-int in_keystate, in_state_gun;
+unsigned short in_keystate[8];
+int in_state_gun;
int in_enable_vibration;
void *tsdev;
void *pl_vout_buf;
static void update_analogs(void)
{
- int *nubp[2] = { in_a1, in_a2 };
+ int *nubp[2] = { in_analog_left[0], in_analog_right[0] };
int vals[2];
int i, a, v, ret;
unsigned int emu_act;
in_update(actions);
- if (in_type1 == PSE_PAD_TYPE_ANALOGPAD)
+ if (in_type[0] == PSE_PAD_TYPE_ANALOGJOY || in_type[0] == PSE_PAD_TYPE_ANALOGPAD)
update_analogs();
emu_act = actions[IN_BINDTYPE_EMU];
in_state_gun = (emu_act & SACTION_GUN_MASK) >> SACTION_GUN_TRIGGER;
}
emu_set_action(emu_act);
- in_keystate = actions[IN_BINDTYPE_PLAYER12];
+ in_keystate[0] = actions[IN_BINDTYPE_PLAYER12];
}
#else /* MAEMO */
extern void update_input(void);
DKEY_CROSS,
DKEY_SQUARE,
};
-extern int in_type1, in_type2;
-extern int in_keystate, in_state_gun, in_a1[2], in_a2[2];
+extern int in_state_gun;
+extern int in_type[8];
+extern int multitap1;
+extern int multitap2;
+extern int in_analog_left[8][2];
+extern int in_analog_right[8][2];
+extern unsigned short in_keystate[8];
+
extern int in_adev[2], in_adev_axis[2][2];
extern int in_adev_is_nublike[2];
extern int in_enable_vibration;
int allow_interlace; // 0 off, 1 on, 2 guess
int enhancement_enable;
int enhancement_no_main;
+ int allow_dithering;
} gpu_neon;
struct {
int iUseDither;
--- /dev/null
+/* Copyright (C) 2010-2015 The RetroArch team
+ *
+ * ---------------------------------------------------------------------------------------
+ * The following license statement only applies to this file (retro_inline.h).
+ * ---------------------------------------------------------------------------------------
+ *
+ * Permission is hereby granted, free of charge,
+ * to any person obtaining a copy of this software and associated documentation files (the "Software"),
+ * to deal in the Software without restriction, including without limitation the rights to
+ * use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software,
+ * and to permit persons to whom the Software is furnished to do so, subject to the following conditions:
+ *
+ * The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED,
+ * INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+ * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+ * IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY,
+ * WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+ * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+ */
+
+#ifndef __LIBRETRO_SDK_INLINE_H
+#define __LIBRETRO_SDK_INLINE_H
+
+#ifndef INLINE
+
+#if !defined(__cplusplus) && defined(_WIN32)
+#define INLINE _inline
+#elif defined(__STDC_VERSION__) && __STDC_VERSION__>=199901L
+#define INLINE inline
+#elif defined(__GNUC__)
+#define INLINE __inline__
+#else
+#define INLINE
+#endif
+
+#endif
+#endif
--- /dev/null
+#ifndef MMAN_H
+#define MMAN_H
+
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+#include "stdlib.h"
+#include "stdio.h"
+
+#define PROT_READ 0b001
+#define PROT_WRITE 0b010
+#define PROT_EXEC 0b100
+#define MAP_PRIVATE 2
+#define MAP_ANONYMOUS 0x20
+
+#define MAP_FAILED ((void *)-1)
+
+static inline void* mmap(void *addr, size_t len, int prot, int flags, int fd, off_t offset)
+{
+ (void)prot;
+ (void)flags;
+ (void)fd;
+ (void)offset;
+
+ int block, ret;
+
+ block = sceKernelAllocMemBlockForVM("code", len);
+ if(block<=0){
+ sceClibPrintf("could not alloc mem block @0x%08X 0x%08X \n", block, len);
+ exit(1);
+ }
+
+ // get base address
+ ret = sceKernelGetMemBlockBase(block, &addr);
+ if (ret < 0)
+ {
+ sceClibPrintf("could get address @0x%08X 0x%08X \n", block, addr);
+ exit(1);
+ }
+
+
+ if(!addr)
+ return MAP_FAILED;
+
+ return addr;
+}
+
+static inline int mprotect(void *addr, size_t len, int prot)
+{
+ (void)addr;
+ (void)len;
+ (void)prot;
+ return 0;
+}
+
+static inline int munmap(void *addr, size_t len)
+{
+ int uid = sceKernelFindMemBlockByAddr(addr, len);
+
+ return sceKernelFreeMemBlock(uid);
+
+}
+
+#ifdef __cplusplus
+};
+#endif
+
+#endif // MMAN_H
+++ /dev/null
-Subproject commit a6f015da3b10b82a476250793645c071340decbc
+// No controller
+#define PSE_PAD_TYPE_NONE 0
// MOUSE SCPH-1030
#define PSE_PAD_TYPE_MOUSE 1
// NEGCON - 16 button analog controller SLPH-00001
typedef struct
{
- // controler type - fill it withe predefined values above
+ // controller type - fill it withe predefined values above
unsigned char controllerType;
+ //0 : no multitap between psx and pad
+ //1 : multitap between psx and pad on port 1
+ //2 : multitap between psx and pad on port 2
+ int portMultitap;
+ int requestPadIndex;
+
// status of buttons - every controller fills this field
unsigned short buttonStatus;
unsigned char Vib[2];
unsigned char VibF[2];
-
+
+ //configuration mode Request 0x43
+ int configMode;
unsigned char reserved[87];
} PadDataS;
LOCAL_PATH := $(call my-dir)
-include $(CLEAR_VARS)
-
-APP_DIR := ../../src
-
-ifneq ($(TARGET_ARCH_ABI),armeabi-v7a)
- NO_NEON_BUILD := 1
-else
- NO_NEON_BUILD := $(NO_NEON)
-endif
+$(shell cd "$(LOCAL_PATH)" && ((git describe || echo) | sed -e 's/.*/#define REV "\0"/' > ../frontend/revision.h_))
+$(shell cd "$(LOCAL_PATH)" && (diff -q ../frontend/revision.h_ ../frontend/revision.h > /dev/null 2>&1 || cp ../frontend/revision.h_ ../frontend/revision.h))
+$(shell cd "$(LOCAL_PATH)" && (rm ../frontend/revision.h_))
-ifeq ($(NO_NEON_BUILD)$(TARGET_ARCH_ABI),1armeabi-v7a)
- LOCAL_MODULE := retro-noneon
-else
- LOCAL_MODULE := retro
-endif
+ROOT_DIR := $(LOCAL_PATH)/..
+CORE_DIR := $(ROOT_DIR)/libpcsxcore
+SPU_DIR := $(ROOT_DIR)/plugins/dfsound
+GPU_DIR := $(ROOT_DIR)/plugins/gpulib
+CDR_DIR := $(ROOT_DIR)/plugins/cdrcimg
+INPUT_DIR := $(ROOT_DIR)/plugins/dfinput
+FRONTEND_DIR := $(ROOT_DIR)/frontend
+NEON_DIR := $(ROOT_DIR)/plugins/gpu_neon
+UNAI_DIR := $(ROOT_DIR)/plugins/gpu_unai
+DYNAREC_DIR := $(ROOT_DIR)/libpcsxcore/new_dynarec
+
+# core
+SOURCES_C := $(CORE_DIR)/cdriso.c \
+ $(CORE_DIR)/cdrom.c \
+ $(CORE_DIR)/cheat.c \
+ $(CORE_DIR)/debug.c \
+ $(CORE_DIR)/decode_xa.c \
+ $(CORE_DIR)/disr3000a.c \
+ $(CORE_DIR)/mdec.c \
+ $(CORE_DIR)/misc.c \
+ $(CORE_DIR)/plugins.c \
+ $(CORE_DIR)/ppf.c \
+ $(CORE_DIR)/psxbios.c \
+ $(CORE_DIR)/psxcommon.c \
+ $(CORE_DIR)/psxcounters.c \
+ $(CORE_DIR)/psxdma.c \
+ $(CORE_DIR)/psxhle.c \
+ $(CORE_DIR)/psxhw.c \
+ $(CORE_DIR)/psxinterpreter.c \
+ $(CORE_DIR)/psxmem.c \
+ $(CORE_DIR)/r3000a.c \
+ $(CORE_DIR)/sio.c \
+ $(CORE_DIR)/socket.c \
+ $(CORE_DIR)/spu.c \
+ $(CORE_DIR)/gte.c \
+ $(CORE_DIR)/gte_nf.c \
+ $(CORE_DIR)/gte_divider.c
-ifeq ($(TARGET_ARCH),arm)
- LOCAL_ARM_MODE := arm
+# spu
+SOURCES_C += $(SPU_DIR)/dma.c \
+ $(SPU_DIR)/freeze.c \
+ $(SPU_DIR)/registers.c \
+ $(SPU_DIR)/spu.c \
+ $(SPU_DIR)/out.c \
+ $(SPU_DIR)/nullsnd.c
- LOCAL_CFLAGS += -DANDROID_ARM
+# gpu
+SOURCES_C += $(GPU_DIR)/gpu.c \
+ $(GPU_DIR)/vout_pl.c
- LOCAL_SRC_FILES += ../libpcsxcore/gte_arm.S
+# cdrcimg
+SOURCES_C += $(CDR_DIR)/cdrcimg.c
- # dynarec
- LOCAL_SRC_FILES += ../libpcsxcore/new_dynarec/new_dynarec.c ../libpcsxcore/new_dynarec/linkage_arm.S ../libpcsxcore/new_dynarec/emu_if.c ../libpcsxcore/new_dynarec/pcsxmem.c
+# dfinput
+SOURCES_C += $(INPUT_DIR)/main.c \
+ $(INPUT_DIR)/pad.c \
+ $(INPUT_DIR)/guncon.c
- # spu
- LOCAL_SRC_FILES += ../plugins/dfsound/arm_utils.S
+# frontend
+SOURCES_C += $(FRONTEND_DIR)/main.c \
+ $(FRONTEND_DIR)/plugin.c \
+ $(FRONTEND_DIR)/cspace.c \
+ $(FRONTEND_DIR)/libretro.c
- # misc
+# dynarec
+SOURCES_C += $(DYNAREC_DIR)/backends/psx/emu_if.c
- ifeq ($(NO_NEON_BUILD),1)
- # gpu
- LOCAL_CFLAGS += -DREARMED
- LOCAL_SRC_FILES += ../plugins/gpu_unai/gpulib_if.cpp ../plugins/gpu_unai/gpu_arm.s
- LOCAL_SRC_FILES += ../frontend/cspace_arm.S
- else
- LOCAL_ARM_NEON := true
- LOCAL_CFLAGS += -DNEON_BUILD -DTEXTURE_CACHE_4BPP -DTEXTURE_CACHE_8BPP
- LOCAL_SRC_FILES += ../libpcsxcore/gte_neon.S ../frontend/cspace_neon.S
+COREFLAGS := -ffast-math -funroll-loops -DHAVE_LIBRETRO -DNO_FRONTEND -DFRONTEND_SUPPORTS_RGB565 -DANDROID -DREARMED
- # gpu
- LOCAL_SRC_FILES += ../plugins/gpu_neon/psx_gpu_if.c ../plugins/gpu_neon/psx_gpu/psx_gpu_arm_neon.S
- endif
+ifeq ($(TARGET_ARCH),arm)
+ SOURCES_ASM := $(CORE_DIR)/gte_arm.S \
+ $(SPU_DIR)/arm_utils.S \
+ $(DYNAREC_DIR)/arm/linkage_arm.S
+ SOURCES_C += $(DYNAREC_DIR)/new_dynarec.c \
+ $(DYNAREC_DIR)/backends/psx/pcsxmem.c
+else
+ COREFLAGS += -DDRC_DISABLE
+ SOURCES_ASM :=
endif
-ifeq ($(TARGET_ARCH),x86)
- LOCAL_CFLAGS += -DANDROID_X86
+ifeq ($(TARGET_ARCH_ABI),armeabi-v7a)
+ COREFLAGS += -DNEON_BUILD -DTEXTURE_CACHE_4BPP -DTEXTURE_CACHE_8BPP
+ SOURCES_ASM += $(CORE_DIR)/gte_neon.S \
+ $(NEON_DIR)/psx_gpu/psx_gpu_arm_neon.S \
+ $(FRONTEND_DIR)/cspace_neon.S
+ SOURCES_C += $(NEON_DIR)/psx_gpu_if.c
+else ifeq ($(TARGET_ARCH_ABI),armeabi)
+ SOURCES_ASM += $(UNAI_DIR)/gpu_arm.S \
+ $(FRONTEND_DIR)/cspace_arm.S
+ SOURCES_C += $(UNAI_DIR)/gpulib_if.cpp
+else
+ SOURCES_C += $(UNAI_DIR)/gpulib_if.cpp
endif
-ifeq ($(TARGET_ARCH),mips)
- LOCAL_CFLAGS += -DANDROID_MIPS -D__mips__ -D__MIPSEL__
+GIT_VERSION := " $(shell git rev-parse --short HEAD || echo unknown)"
+ifneq ($(GIT_VERSION)," unknown")
+ COREFLAGS += -DGIT_VERSION=\"$(GIT_VERSION)\"
endif
-ifneq ($(TARGET_ARCH),arm)
- # gpu
- LOCAL_CFLAGS += -DREARMED
- LOCAL_SRC_FILES += ../plugins/gpu_unai/gpulib_if.cpp
+include $(CLEAR_VARS)
+LOCAL_MODULE := retro
+LOCAL_SRC_FILES := $(SOURCES_C) $(SOURCES_ASM)
+LOCAL_CFLAGS := $(COREFLAGS)
+LOCAL_C_INCLUDES := $(ROOT_DIR)/include
+LOCAL_LDFLAGS := -Wl,-version-script=$(FRONTEND_DIR)/link.T
+LOCAL_LDLIBS := -lz -llog
+LOCAL_ARM_MODE := arm
+
+ifeq ($(TARGET_ARCH_ABI),armeabi-v7a)
+ LOCAL_ARM_NEON := true
+endif
+ifeq ($(TARGET_ARCH),arm)
+ LOCAL_LDLIBS += -Wl,-no-warn-shared-textrel
endif
-
-$(shell cd "$(LOCAL_PATH)" && ((git describe || echo) | sed -e 's/.*/#define REV "\0"/' > ../frontend/revision.h_))
-$(shell cd "$(LOCAL_PATH)" && (diff -q ../frontend/revision.h_ ../frontend/revision.h > /dev/null 2>&1 || cp ../frontend/revision.h_ ../frontend/revision.h))
-$(shell cd "$(LOCAL_PATH)" && (rm ../frontend/revision.h_))
-
-LOCAL_SRC_FILES += ../libpcsxcore/cdriso.c ../libpcsxcore/cdrom.c ../libpcsxcore/cheat.c ../libpcsxcore/debug.c \
- ../libpcsxcore/decode_xa.c ../libpcsxcore/disr3000a.c ../libpcsxcore/mdec.c \
- ../libpcsxcore/misc.c ../libpcsxcore/plugins.c ../libpcsxcore/ppf.c ../libpcsxcore/psxbios.c \
- ../libpcsxcore/psxcommon.c ../libpcsxcore/psxcounters.c ../libpcsxcore/psxdma.c ../libpcsxcore/psxhle.c \
- ../libpcsxcore/psxhw.c ../libpcsxcore/psxinterpreter.c ../libpcsxcore/psxmem.c ../libpcsxcore/r3000a.c \
- ../libpcsxcore/sio.c ../libpcsxcore/socket.c ../libpcsxcore/spu.c
-LOCAL_SRC_FILES += ../libpcsxcore/gte.c ../libpcsxcore/gte_nf.c ../libpcsxcore/gte_divider.c
-
-# spu
-LOCAL_SRC_FILES += ../plugins/dfsound/dma.c ../plugins/dfsound/freeze.c \
- ../plugins/dfsound/registers.c ../plugins/dfsound/spu.c \
- ../plugins/dfsound/out.c ../plugins/dfsound/nullsnd.c
-
-# builtin gpu
-LOCAL_SRC_FILES += ../plugins/gpulib/gpu.c ../plugins/gpulib/vout_pl.c
-
-# cdrcimg
-LOCAL_SRC_FILES += ../plugins/cdrcimg/cdrcimg.c
-
-# dfinput
-LOCAL_SRC_FILES += ../plugins/dfinput/main.c ../plugins/dfinput/pad.c ../plugins/dfinput/guncon.c
-
-# misc
-LOCAL_SRC_FILES += ../frontend/main.c ../frontend/plugin.c ../frontend/cspace.c
-
-# libretro
-LOCAL_SRC_FILES += ../frontend/libretro.c
-
-LOCAL_CFLAGS += -O3 -ffast-math -funroll-loops -DNDEBUG -D_FILE_OFFSET_BITS=64 -DHAVE_LIBRETRO -DNO_FRONTEND -DFRONTEND_SUPPORTS_RGB565
-LOCAL_C_INCLUDES += $(LOCAL_PATH)/../include
-LOCAL_LDLIBS := -lz -llog
include $(BUILD_SHARED_LIBRARY)
-APP_ABI := armeabi armeabi-v7a
+APP_ABI := all
#include "cdriso.h"
#include "ppf.h"
+#include <errno.h>
+#include <zlib.h>
+
#ifdef _WIN32
#define WIN32_LEAN_AND_MEAN
#include <process.h>
#include <windows.h>
#define strcasecmp _stricmp
-#define usleep(x) Sleep((x) / 1000)
+#define usleep(x) (Sleep((x) / 1000))
#else
#include <pthread.h>
#include <sys/time.h>
#include <unistd.h>
#endif
-#include <errno.h>
-#include <zlib.h>
#define OFF_T_MSB ((off_t)1 << (sizeof(off_t) * 8 - 1))
do {
ret = SPU_playCDDAchannel((short *)sndbuffer, s);
if (ret == 0x7761)
+ {
usleep(6 * 1000);
+ }
} while (ret == 0x7761 && playing); // rearmed_wait
}
// HACK: stop feeding data while emu is paused
extern int stop;
while (stop && playing)
+ {
usleep(10000);
+ }
now = GetTickCount();
osleep = t - now;
if (t != 1)
sscanf(linebuf, " FILE %255s", tmpb);
- // absolute path?
- ti[numtracks + 1].handle = fopen(tmpb, "rb");
- if (ti[numtracks + 1].handle == NULL) {
- // relative to .cue?
- tmp = strrchr(tmpb, '\\');
- if (tmp == NULL)
- tmp = strrchr(tmpb, '/');
- if (tmp != NULL)
- tmp++;
- else
- tmp = tmpb;
- strncpy(incue_fname, tmp, incue_max_len);
- ti[numtracks + 1].handle = fopen(filepath, "rb");
- }
+ tmp = strrchr(tmpb, '\\');
+ if (tmp == NULL)
+ tmp = strrchr(tmpb, '/');
+ if (tmp != NULL)
+ tmp++;
+ else
+ tmp = tmpb;
+ strncpy(incue_fname, tmp, incue_max_len);
+ ti[numtracks + 1].handle = fopen(filepath, "rb");
// update global offset if this is not first file in this .cue
if (numtracks + 1 > 1) {
*/
#include "arm_features.h"
-#include "new_dynarec/linkage_offsets.h"
+#include "new_dynarec/arm/linkage_offsets.h"
.syntax unified
.text
// is just below, do it here
fake_bios_gpu_setup();
- if (!Config.HLE) {
+ if (!Config.HLE && !Config.SlowBoot) {
// skip BIOS logos
psxRegs.pc = psxRegs.GPR.n.ra;
return 0;
* 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. *
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * */
-#include "../gte.h"
+#include "../../gte.h"
#define FLAGLESS
-#include "../gte.h"
+#include "../../gte.h"
#undef FLAGLESS
-#include "../gte_arm.h"
-#include "../gte_neon.h"
+#include "../../gte_arm.h"
+#include "../../gte_neon.h"
#include "pcnt.h"
#include "arm_features.h"
}
}
-#include "pcsxmem.h"
-#include "pcsxmem_inline.c"
+#include "../backends/psx/pcsxmem.h"
+#include "../backends/psx/pcsxmem_inline.c"
static void do_readstub(int n)
{
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * */
#include "arm_features.h"
-#include "new_dynarec_config.h"
+#include "../new_dynarec_config.h"
#include "linkage_offsets.h"
#include "emu_if.h"
#include "pcsxmem.h"
-#include "../psxhle.h"
-#include "../r3000a.h"
-#include "../cdrom.h"
-#include "../psxdma.h"
-#include "../mdec.h"
-#include "../gte_arm.h"
-#include "../gte_neon.h"
+#include "../../../psxhle.h"
+#include "../../../r3000a.h"
+#include "../../../cdrom.h"
+#include "../../../psxdma.h"
+#include "../../../mdec.h"
+#include "../../../gte_arm.h"
+#include "../../../gte_neon.h"
+
+#include "../../../gte.h"
+
#define FLAGLESS
-#include "../gte.h"
+#include "../../../gte.h"
+#undef FLAGLESS
#define ARRAY_SIZE(x) (sizeof(x) / sizeof(x[0]))
#ifdef DRC_DBG
memcpy(gte_handlers_nf, gte_handlers, sizeof(gte_handlers_nf));
#endif
+
psxH_ptr = psxH;
zeromem_ptr = zero_mem;
scratch_buf_ptr = scratch_buf;
#ifdef DRC_DISABLE
unsigned int address;
int pending_exception, stop;
-unsigned int next_interupt;
+u32 next_interupt;
int new_dynarec_did_compile;
int cycle_multiplier;
int new_dynarec_hacks;
-#include "new_dynarec.h"
-#include "../r3000a.h"
+#include "../../new_dynarec.h"
+#include "../../../r3000a.h"
extern char invalid_code[0x100000];
extern u32 inv_code_start, inv_code_end;
/* cycles/irqs */
-extern unsigned int next_interupt;
+extern u32 next_interupt;
extern int pending_exception;
/* called by drc */
*/
#include <stdio.h>
-#include "../psxhw.h"
-#include "../cdrom.h"
-#include "../mdec.h"
-#include "../gpu.h"
-#include "../psxmem_map.h"
+#include "../../../psxhw.h"
+#include "../../../cdrom.h"
+#include "../../../mdec.h"
+#include "../../../gpu.h"
+#include "../../../psxmem_map.h"
#include "emu_if.h"
#include "pcsxmem.h"
#ifdef VITA
#include <psp2/kernel/sysmem.h>
static int sceBlock;
+int getVMBlock();
#endif
#include "new_dynarec_config.h"
-#include "emu_if.h" //emulator interface
+#include "backends/psx/emu_if.h" //emulator interface
//#define DISASM
//#define assem_debug printf
#define inv_debug(...)
#ifdef __i386__
-#include "assem_x86.h"
+#include "x86/assem_x86.h"
#endif
#ifdef __x86_64__
-#include "assem_x64.h"
+#include "x64/assem_x64.h"
#endif
#ifdef __arm__
-#include "assem_arm.h"
+#include "arm/assem_arm.h"
+#endif
+
+#ifdef VITA
+int _newlib_vm_size_user = 1 << TARGET_SIZE_2;
#endif
#define MAXBLOCK 4096
// This is called from the recompiled JR/JALR instructions
void *get_addr(u_int vaddr)
{
- u_int page=get_page(vaddr);
- u_int vpage=get_vpage(vaddr);
- struct ll_entry *head;
+ struct ll_entry *head = NULL;
+ u_int page = get_page(vaddr);
+ u_int vpage = get_vpage(vaddr);
//printf("TRACE: count=%d next=%d (get_addr %x,page %d)\n",Count,next_interupt,vaddr,page);
head=jump_in[page];
- while(head!=NULL) {
- if(head->vaddr==vaddr) {
- //printf("TRACE: count=%d next=%d (get_addr match %x: %x)\n",Count,next_interupt,vaddr,(int)head->addr);
+ while(head!=NULL)
+ {
+ if(head->vaddr==vaddr)
+ {
+ //printf("TRACE: count=%d next=%d (get_addr match %x: %x)\n",Count,next_interupt,vaddr,(int)head->addr);
u_int *ht_bin=hash_table[((vaddr>>16)^vaddr)&0xFFFF];
ht_bin[3]=ht_bin[1];
ht_bin[2]=ht_bin[0];
head=head->next;
}
head=jump_dirty[vpage];
- while(head!=NULL) {
- if(head->vaddr==vaddr) {
+ while(head!=NULL)
+ {
+ if(head->vaddr==vaddr)
+ {
//printf("TRACE: count=%d next=%d (get_addr match dirty %x: %x)\n",Count,next_interupt,vaddr,(int)head->addr);
// Don't restore blocks which are about to expire from the cache
if((((u_int)head->addr-(u_int)out)<<(32-TARGET_SIZE_2))>0x60000000+(MAX_OUTPUT_BLOCK_SIZE<<(32-TARGET_SIZE_2)))
- if(verify_dirty(head->addr)) {
- //printf("restore candidate: %x (%d) d=%d\n",vaddr,page,invalid_code[vaddr>>12]);
- invalid_code[vaddr>>12]=0;
- inv_code_start=inv_code_end=~0;
- if(vpage<2048) {
- restore_candidate[vpage>>3]|=1<<(vpage&7);
- }
- else restore_candidate[page>>3]|=1<<(page&7);
- u_int *ht_bin=hash_table[((vaddr>>16)^vaddr)&0xFFFF];
- if(ht_bin[0]==vaddr) {
- ht_bin[1]=(u_int)head->addr; // Replace existing entry
- }
- else
+ if(verify_dirty(head->addr))
{
- ht_bin[3]=ht_bin[1];
- ht_bin[2]=ht_bin[0];
- ht_bin[1]=(int)head->addr;
- ht_bin[0]=vaddr;
+ //printf("restore candidate: %x (%d) d=%d\n",vaddr,page,invalid_code[vaddr>>12]);
+ invalid_code[vaddr>>12]=0;
+ inv_code_start=inv_code_end=~0;
+ if(vpage<2048)
+ {
+ restore_candidate[vpage>>3]|=1<<(vpage&7);
+ }
+ else
+ {
+ restore_candidate[page>>3]|=1<<(page&7);
+ }
+ u_int *ht_bin=hash_table[((vaddr>>16)^vaddr)&0xFFFF];
+
+ if(ht_bin[0]==vaddr)
+ ht_bin[1]=(u_int)head->addr; // Replace existing entry
+ else
+ {
+ ht_bin[3]=ht_bin[1];
+ ht_bin[2]=ht_bin[0];
+ ht_bin[1]=(int)head->addr;
+ ht_bin[0]=vaddr;
+ }
+ return head->addr;
}
- return head->addr;
- }
}
head=head->next;
}
//printf("TRACE: count=%d next=%d (get_addr no-match %x)\n",Count,next_interupt,vaddr);
int r=new_recompile_block(vaddr);
- if(r==0) return get_addr(vaddr);
- // Execute in unmapped page, generate pagefault execption
+ if(r==0)
+ return get_addr(vaddr);
+ // Execute in unmapped page, generate pagefault exception
Status|=2;
Cause=(vaddr<<31)|0x8;
EPC=(vaddr&1)?vaddr-5:vaddr;
EntryHi=BadVAddr&0xFFFFE000;
return get_addr_ht(0x80000000);
}
+
// Look up address in hash table first
void *get_addr_ht(u_int vaddr)
{
}
#ifdef __i386__
-#include "assem_x86.c"
+#include "x86/assem_x86.c"
#endif
#ifdef __x86_64__
-#include "assem_x64.c"
+#include "x64/assem_x64.c"
#endif
#ifdef __arm__
-#include "assem_arm.c"
+#include "arm/assem_arm.c"
#endif
// Add virtual address mapping to linked list
assert(first+5>page); // NB: this assumes MAXBLOCK<=4096 (4 pages)
assert(last<page+5);
// Invalidate the adjacent pages if a block crosses a 4K boundary
- while(first<page) {
+ while(first<page)
+ {
invalidate_page(first);
first++;
}
- for(first=page+1;first<last;first++) {
+ for(first=page+1;first<last;first++)
+ {
invalidate_page(first);
}
- #ifdef __arm__
- do_clear_cache();
- #endif
+
+#ifdef __arm__
+ do_clear_cache();
+#endif
// Don't trap writes
invalid_code[block]=1;
- #ifdef USE_MINI_HT
+#ifdef USE_MINI_HT
memset(mini_ht,-1,sizeof(mini_ht));
- #endif
+#endif
}
void invalidate_block(u_int block)
u_int page=get_page(block<<12);
u_int vpage=get_vpage(block<<12);
inv_debug("INVALIDATE: %x (%d)\n",block<<12,page);
- //inv_debug("invalid_code[block]=%d\n",invalid_code[block]);
u_int first,last;
first=last=page;
struct ll_entry *head;
head=jump_dirty[vpage];
//printf("page=%d vpage=%d\n",page,vpage);
- while(head!=NULL) {
+ while(head!=NULL)
+ {
u_int start,end;
- if(vpage>2047||(head->vaddr>>12)==block) { // Ignore vaddr hash collision
+ if(vpage>2047||(head->vaddr>>12)==block)
+ { // Ignore vaddr hash collision
get_bounds((int)head->addr,&start,&end);
//printf("start: %x end: %x\n",start,end);
- if(page<2048&&start>=(u_int)rdram&&end<(u_int)rdram+RAM_SIZE) {
- if(((start-(u_int)rdram)>>12)<=page&&((end-1-(u_int)rdram)>>12)>=page) {
+ if(page<2048&&start>=(u_int)rdram&&end<(u_int)rdram+RAM_SIZE)
+ {
+ if(((start-(u_int)rdram)>>12)<=page&&((end-1-(u_int)rdram)>>12)>=page)
+ {
if((((start-(u_int)rdram)>>12)&2047)<first) first=((start-(u_int)rdram)>>12)&2047;
if((((end-1-(u_int)rdram)>>12)&2047)>last) last=((end-1-(u_int)rdram)>>12)&2047;
}
// This is called when loading a save state.
// Anything could have changed, so invalidate everything.
-void invalidate_all_pages()
+void invalidate_all_pages(void)
{
u_int page;
for(page=0;page<4096;page++)
invalidate_page(page);
for(page=0;page<1048576;page++)
- if(!invalid_code[page]) {
+ {
+ if(!invalid_code[page])
+ {
restore_candidate[(page&2047)>>3]|=1<<(page&7);
restore_candidate[((page&2047)>>3)+256]|=1<<(page&7);
}
- #ifdef USE_MINI_HT
+ }
+
+#ifdef USE_MINI_HT
memset(mini_ht,-1,sizeof(mini_ht));
- #endif
+#endif
}
// Add an entry to jump_out after making a link
struct ll_entry *head;
inv_debug("INV: clean_blocks page=%d\n",page);
head=jump_dirty[page];
- while(head!=NULL) {
- if(!invalid_code[head->vaddr>>12]) {
+ while(head!=NULL)
+ {
+ if(!invalid_code[head->vaddr>>12])
+ {
// Don't restore blocks which are about to expire from the cache
- if((((u_int)head->addr-(u_int)out)<<(32-TARGET_SIZE_2))>0x60000000+(MAX_OUTPUT_BLOCK_SIZE<<(32-TARGET_SIZE_2))) {
+ if((((u_int)head->addr-(u_int)out)<<(32-TARGET_SIZE_2))>0x60000000+(MAX_OUTPUT_BLOCK_SIZE<<(32-TARGET_SIZE_2)))
+ {
u_int start,end;
- if(verify_dirty(head->addr)) {
+ if(verify_dirty(head->addr))
+ {
//printf("Possibly Restore %x (%x)\n",head->vaddr, (int)head->addr);
u_int i;
u_int inv=0;
get_bounds((int)head->addr,&start,&end);
- if(start-(u_int)rdram<RAM_SIZE) {
- for(i=(start-(u_int)rdram+0x80000000)>>12;i<=(end-1-(u_int)rdram+0x80000000)>>12;i++) {
+ if(start-(u_int)rdram<RAM_SIZE)
+ {
+ for(i=(start-(u_int)rdram+0x80000000)>>12;i<=(end-1-(u_int)rdram+0x80000000)>>12;i++)
+ {
inv|=invalid_code[i];
}
}
- else if((signed int)head->vaddr>=(signed int)0x80000000+RAM_SIZE) {
+ else if((signed int)head->vaddr>=(signed int)0x80000000+RAM_SIZE)
+ {
inv=1;
}
- if(!inv) {
+ if(!inv)
+ {
void * clean_addr=(void *)get_clean_addr((int)head->addr);
- if((((u_int)clean_addr-(u_int)out)<<(32-TARGET_SIZE_2))>0x60000000+(MAX_OUTPUT_BLOCK_SIZE<<(32-TARGET_SIZE_2))) {
+ if((((u_int)clean_addr-(u_int)out)<<(32-TARGET_SIZE_2))>0x60000000+(MAX_OUTPUT_BLOCK_SIZE<<(32-TARGET_SIZE_2)))
+ {
u_int ppage=page;
inv_debug("INV: Restored %x (%x/%x)\n",head->vaddr, (int)head->addr, (int)clean_addr);
//printf("page=%x, addr=%x\n",page,head->vaddr);
//assert(head->vaddr>>12==(page|0x80000));
ll_add_flags(jump_in+ppage,head->vaddr,head->reg_sv_flags,clean_addr);
u_int *ht_bin=hash_table[((head->vaddr>>16)^head->vaddr)&0xFFFF];
- if(ht_bin[0]==head->vaddr) {
+ if(ht_bin[0]==head->vaddr)
+ {
ht_bin[1]=(u_int)clean_addr; // Replace existing entry
}
- if(ht_bin[2]==head->vaddr) {
+ if(ht_bin[2]==head->vaddr)
+ {
ht_bin[3]=(u_int)clean_addr; // Replace existing entry
}
}
}
}
-
-void mov_alloc(struct regstat *current,int i)
+static void mov_alloc(struct regstat *current,int i)
{
// Note: Don't need to actually alloc the source registers
- if((~current->is32>>rs1[i])&1) {
+ if((~current->is32>>rs1[i])&1)
+ {
//alloc_reg64(current,i,rs1[i]);
alloc_reg64(current,i,rt1[i]);
current->is32&=~(1LL<<rt1[i]);
- } else {
+ }
+ else
+ {
//alloc_reg(current,i,rs1[i]);
alloc_reg(current,i,rt1[i]);
current->is32|=(1LL<<rt1[i]);
void delayslot_alloc(struct regstat *current,int i)
{
- switch(itype[i]) {
+ switch(itype[i])
+ {
case UJUMP:
case CJUMP:
case SJUMP:
}
}
-int mchecksum()
+#if 0
+static int mchecksum(void)
{
//if(!tracedebug) return 0;
int i;
}
return sum;
}
-int rchecksum()
+
+static int rchecksum(void)
{
int i;
int sum=0;
sum^=((u_int *)reg)[i];
return sum;
}
-void rlist()
+
+static void rlist(void)
{
int i;
printf("TRACE: ");
printf("\n");
}
-void enabletrace()
+static void enabletrace(void)
{
tracedebug=1;
}
-void memdebug(int i)
+static void memdebug(int i)
{
//printf("TRACE: count=%d next=%d (checksum %x) lo=%8x%8x\n",Count,next_interupt,mchecksum(),(int)(reg[LOREG]>>32),(int)reg[LOREG]);
//printf("TRACE: count=%d next=%d (rchecksum %x)\n",Count,next_interupt,rchecksum());
}
//printf("TRACE: %x\n",(&i)[-1]);
}
+#endif
void alu_assemble(int i,struct regstat *i_regs)
{
// clear the state completely, instead of just marking
// things invalid like invalidate_all_pages() does
-void new_dynarec_clear_full()
+void new_dynarec_clear_full(void)
{
int n;
out=(u_char *)BASE_ADDR;
for(n=0;n<4096;n++) ll_clear(jump_dirty+n);
}
-void new_dynarec_init()
+void new_dynarec_init(void)
{
SysPrintf("Init new dynarec\n");
// see assem_arm.h for some explanation
#if defined(BASE_ADDR_FIXED)
if (mmap (translation_cache, 1 << TARGET_SIZE_2,
- PROT_READ | PROT_WRITE | PROT_EXEC,
- MAP_PRIVATE | MAP_ANONYMOUS,
- -1, 0) != translation_cache) {
+ PROT_READ | PROT_WRITE | PROT_EXEC,
+ MAP_PRIVATE | MAP_ANONYMOUS,
+ -1, 0) != translation_cache)
+ {
SysPrintf("mmap() failed: %s\n", strerror(errno));
SysPrintf("disable BASE_ADDR_FIXED and recompile\n");
abort();
}
#elif defined(BASE_ADDR_DYNAMIC)
- #ifdef VITA
- sceBlock = sceKernelAllocMemBlockForVM("code", 1 << TARGET_SIZE_2);
+#ifdef VITA
+ sceBlock = getVMBlock();//sceKernelAllocMemBlockForVM("code", 1 << TARGET_SIZE_2);
if (sceBlock < 0)
SysPrintf("sceKernelAllocMemBlockForVM failed\n");
int ret = sceKernelGetMemBlockBase(sceBlock, (void **)&translation_cache);
if (ret < 0)
SysPrintf("sceKernelGetMemBlockBase failed\n");
- #else
+
+ sceKernelOpenVMDomain();
+ sceClibPrintf("translation_cache = 0x%08X \n ", translation_cache);
+#elif defined(_MSC_VER)
+ base_addr = VirtualAlloc(NULL, 1<<TARGET_SIZE_2, MEM_COMMIT | MEM_RESERVE,
+ PAGE_EXECUTE_READWRITE);
+#else
translation_cache = mmap (NULL, 1 << TARGET_SIZE_2,
- PROT_READ | PROT_WRITE | PROT_EXEC,
- MAP_PRIVATE | MAP_ANONYMOUS, -1, 0);
+ PROT_READ | PROT_WRITE | PROT_EXEC,
+ MAP_PRIVATE | MAP_ANONYMOUS, -1, 0);
if (translation_cache == MAP_FAILED) {
SysPrintf("mmap() failed: %s\n", strerror(errno));
abort();
}
- #endif
+#endif
#else
- #ifndef NO_WRITE_EXEC
+#ifndef NO_WRITE_EXEC
// not all systems allow execute in data segment by default
if (mprotect((void *)BASE_ADDR, 1<<TARGET_SIZE_2, PROT_READ | PROT_WRITE | PROT_EXEC) != 0)
SysPrintf("mprotect() failed: %s\n", strerror(errno));
- #endif
#endif
+#endif
+
out=(u_char *)BASE_ADDR;
cycle_multiplier=200;
new_dynarec_clear_full();
SysPrintf("warning: RAM is not directly mapped, performance will suffer\n");
}
-void new_dynarec_cleanup()
+void new_dynarec_cleanup(void)
{
int n;
#if defined(BASE_ADDR_FIXED) || defined(BASE_ADDR_DYNAMIC)
- #ifdef VITA
- sceKernelFreeMemBlock(sceBlock);
- sceBlock = -1;
- #else
+#ifndef VITA
+#if defined(_MSC_VER)
+ VirtualFree(base_addr, 0, MEM_RELEASE);
+#else
if (munmap ((void *)BASE_ADDR, 1<<TARGET_SIZE_2) < 0)
SysPrintf("munmap() failed\n");
- #endif
#endif
- for(n=0;n<4096;n++) ll_clear(jump_in+n);
- for(n=0;n<4096;n++) ll_clear(jump_out+n);
- for(n=0;n<4096;n++) ll_clear(jump_dirty+n);
- #ifdef ROM_COPY
+#endif
+#endif
+ for(n=0;n<4096;n++)
+ ll_clear(jump_in+n);
+ for(n=0;n<4096;n++)
+ ll_clear(jump_out+n);
+ for(n=0;n<4096;n++)
+ ll_clear(jump_dirty+n);
+#ifdef ROM_COPY
if (munmap (ROM_COPY, 67108864) < 0) {SysPrintf("munmap() failed\n");}
- #endif
+#endif
}
static u_int *get_source_start(u_int addr, u_int *limit)
#define NDHACK_GTE_NO_FLAGS (1<<2)
extern int new_dynarec_hacks;
-void new_dynarec_init();
-void new_dynarec_cleanup();
-void new_dynarec_clear_full();
-void new_dyna_start();
+void new_dynarec_init(void);
+void new_dynarec_cleanup(void);
+void new_dynarec_clear_full(void);
+void new_dyna_start(void);
int new_dynarec_save_blocks(void *save, int size);
void new_dynarec_load_blocks(const void *save, int size);
-void invalidate_all_pages();
+void invalidate_all_pages(void);
void invalidate_block(unsigned int block);
#define USE_MINI_HT 1
//#define REG_PREFETCH 1
-#if defined(__MACH__) || defined(VITA)
+#if defined(__MACH__)
#define NO_WRITE_EXEC 1
#endif
#ifdef VITA
-/***************************************************************************\r
- * Copyright (C) 2007 Ryan Schultz, PCSX-df Team, PCSX team *\r
- * *\r
- * This program is free software; you can redistribute it and/or modify *\r
- * it under the terms of the GNU General Public License as published by *\r
- * the Free Software Foundation; either version 2 of the License, or *\r
- * (at your option) any later version. *\r
- * *\r
- * This program is distributed in the hope that it will be useful, *\r
- * but WITHOUT ANY WARRANTY; without even the implied warranty of *\r
- * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the *\r
- * GNU General Public License for more details. *\r
- * *\r
- * You should have received a copy of the GNU General Public License *\r
- * along with this program; if not, write to the *\r
- * Free Software Foundation, Inc., *\r
- * 51 Franklin Street, Fifth Floor, Boston, MA 02111-1307 USA. *\r
- ***************************************************************************/\r
-\r
-/*\r
-* Plugin library callback/access functions.\r
-*/\r
-\r
-#include "plugins.h"\r
-#include "cdriso.h"\r
-\r
-static char IsoFile[MAXPATHLEN] = "";\r
-static s64 cdOpenCaseTime = 0;\r
-\r
-GPUupdateLace GPU_updateLace;\r
-GPUinit GPU_init;\r
-GPUshutdown GPU_shutdown; \r
-GPUconfigure GPU_configure;\r
-GPUtest GPU_test;\r
-GPUabout GPU_about;\r
-GPUopen GPU_open;\r
-GPUclose GPU_close;\r
-GPUreadStatus GPU_readStatus;\r
-GPUreadData GPU_readData;\r
-GPUreadDataMem GPU_readDataMem;\r
-GPUwriteStatus GPU_writeStatus; \r
-GPUwriteData GPU_writeData;\r
-GPUwriteDataMem GPU_writeDataMem;\r
-GPUdmaChain GPU_dmaChain;\r
-GPUkeypressed GPU_keypressed;\r
-GPUdisplayText GPU_displayText;\r
-GPUmakeSnapshot GPU_makeSnapshot;\r
-GPUfreeze GPU_freeze;\r
-GPUgetScreenPic GPU_getScreenPic;\r
-GPUshowScreenPic GPU_showScreenPic;\r
-GPUclearDynarec GPU_clearDynarec;\r
-GPUvBlank GPU_vBlank;\r
-\r
-CDRinit CDR_init;\r
-CDRshutdown CDR_shutdown;\r
-CDRopen CDR_open;\r
-CDRclose CDR_close; \r
-CDRtest CDR_test;\r
-CDRgetTN CDR_getTN;\r
-CDRgetTD CDR_getTD;\r
-CDRreadTrack CDR_readTrack;\r
-CDRgetBuffer CDR_getBuffer;\r
-CDRplay CDR_play;\r
-CDRstop CDR_stop;\r
-CDRgetStatus CDR_getStatus;\r
-CDRgetDriveLetter CDR_getDriveLetter;\r
-CDRgetBufferSub CDR_getBufferSub;\r
-CDRconfigure CDR_configure;\r
-CDRabout CDR_about;\r
-CDRsetfilename CDR_setfilename;\r
-CDRreadCDDA CDR_readCDDA;\r
-CDRgetTE CDR_getTE;\r
-\r
-SPUconfigure SPU_configure;\r
-SPUabout SPU_about;\r
-SPUinit SPU_init;\r
-SPUshutdown SPU_shutdown;\r
-SPUtest SPU_test;\r
-SPUopen SPU_open;\r
-SPUclose SPU_close;\r
-SPUplaySample SPU_playSample;\r
-SPUwriteRegister SPU_writeRegister;\r
-SPUreadRegister SPU_readRegister;\r
-SPUwriteDMA SPU_writeDMA;\r
-SPUreadDMA SPU_readDMA;\r
-SPUwriteDMAMem SPU_writeDMAMem;\r
-SPUreadDMAMem SPU_readDMAMem;\r
-SPUplayADPCMchannel SPU_playADPCMchannel;\r
-SPUfreeze SPU_freeze;\r
-SPUregisterCallback SPU_registerCallback;\r
-SPUregisterScheduleCb SPU_registerScheduleCb;\r
-SPUasync SPU_async;\r
-SPUplayCDDAchannel SPU_playCDDAchannel;\r
-\r
-PADconfigure PAD1_configure;\r
-PADabout PAD1_about;\r
-PADinit PAD1_init;\r
-PADshutdown PAD1_shutdown;\r
-PADtest PAD1_test;\r
-PADopen PAD1_open;\r
-PADclose PAD1_close;\r
-PADquery PAD1_query;\r
-PADreadPort1 PAD1_readPort1;\r
-PADkeypressed PAD1_keypressed;\r
-PADstartPoll PAD1_startPoll;\r
-PADpoll PAD1_poll;\r
-PADsetSensitive PAD1_setSensitive;\r
-\r
-PADconfigure PAD2_configure;\r
-PADabout PAD2_about;\r
-PADinit PAD2_init;\r
-PADshutdown PAD2_shutdown;\r
-PADtest PAD2_test;\r
-PADopen PAD2_open;\r
-PADclose PAD2_close;\r
-PADquery PAD2_query;\r
-PADreadPort2 PAD2_readPort2;\r
-PADkeypressed PAD2_keypressed;\r
-PADstartPoll PAD2_startPoll;\r
-PADpoll PAD2_poll;\r
-PADsetSensitive PAD2_setSensitive;\r
-\r
-NETinit NET_init;\r
-NETshutdown NET_shutdown;\r
-NETopen NET_open;\r
-NETclose NET_close; \r
-NETtest NET_test;\r
-NETconfigure NET_configure;\r
-NETabout NET_about;\r
-NETpause NET_pause;\r
-NETresume NET_resume;\r
-NETqueryPlayer NET_queryPlayer;\r
-NETsendData NET_sendData;\r
-NETrecvData NET_recvData;\r
-NETsendPadData NET_sendPadData;\r
-NETrecvPadData NET_recvPadData;\r
-NETsetInfo NET_setInfo;\r
-NETkeypressed NET_keypressed;\r
-\r
-#ifdef ENABLE_SIO1API\r
-\r
-SIO1init SIO1_init;\r
-SIO1shutdown SIO1_shutdown;\r
-SIO1open SIO1_open;\r
-SIO1close SIO1_close; \r
-SIO1test SIO1_test;\r
-SIO1configure SIO1_configure;\r
-SIO1about SIO1_about;\r
-SIO1pause SIO1_pause;\r
-SIO1resume SIO1_resume;\r
-SIO1keypressed SIO1_keypressed;\r
-SIO1writeData8 SIO1_writeData8;\r
-SIO1writeData16 SIO1_writeData16;\r
-SIO1writeData32 SIO1_writeData32;\r
-SIO1writeStat16 SIO1_writeStat16;\r
-SIO1writeStat32 SIO1_writeStat32;\r
-SIO1writeMode16 SIO1_writeMode16;\r
-SIO1writeMode32 SIO1_writeMode32;\r
-SIO1writeCtrl16 SIO1_writeCtrl16;\r
-SIO1writeCtrl32 SIO1_writeCtrl32;\r
-SIO1writeBaud16 SIO1_writeBaud16;\r
-SIO1writeBaud32 SIO1_writeBaud32;\r
-SIO1readData8 SIO1_readData8;\r
-SIO1readData16 SIO1_readData16;\r
-SIO1readData32 SIO1_readData32;\r
-SIO1readStat16 SIO1_readStat16;\r
-SIO1readStat32 SIO1_readStat32;\r
-SIO1readMode16 SIO1_readMode16;\r
-SIO1readMode32 SIO1_readMode32;\r
-SIO1readCtrl16 SIO1_readCtrl16;\r
-SIO1readCtrl32 SIO1_readCtrl32;\r
-SIO1readBaud16 SIO1_readBaud16;\r
-SIO1readBaud32 SIO1_readBaud32;\r
-SIO1registerCallback SIO1_registerCallback;\r
-\r
-#endif\r
-\r
-static const char *err;\r
-\r
-#define CheckErr(func) { \\r
- err = SysLibError(); \\r
- if (err != NULL) { SysMessage(_("Error loading %s: %s"), func, err); return -1; } \\r
-}\r
-\r
-#define LoadSym(dest, src, name, checkerr) { \\r
- dest = (src)SysLoadSym(drv, name); \\r
- if (checkerr) { CheckErr(name); } else SysLibError(); \\r
-}\r
-\r
-void *hGPUDriver = NULL;\r
-\r
-void CALLBACK GPU__displayText(char *pText) {\r
- SysPrintf("%s\n", pText);\r
-}\r
-\r
-long CALLBACK GPU__configure(void) { return 0; }\r
-long CALLBACK GPU__test(void) { return 0; }\r
-void CALLBACK GPU__about(void) {}\r
-void CALLBACK GPU__makeSnapshot(void) {}\r
-void CALLBACK GPU__keypressed(int key) {}\r
-long CALLBACK GPU__getScreenPic(unsigned char *pMem) { return -1; }\r
-long CALLBACK GPU__showScreenPic(unsigned char *pMem) { return -1; }\r
-void CALLBACK GPU__clearDynarec(void (CALLBACK *callback)(void)) {}\r
-void CALLBACK GPU__vBlank(int val) {}\r
-\r
-#define LoadGpuSym1(dest, name) \\r
- LoadSym(GPU_##dest, GPU##dest, name, TRUE);\r
-\r
-#define LoadGpuSym0(dest, name) \\r
- LoadSym(GPU_##dest, GPU##dest, name, FALSE); \\r
- if (GPU_##dest == NULL) GPU_##dest = (GPU##dest) GPU__##dest;\r
-\r
-#define LoadGpuSymN(dest, name) \\r
- LoadSym(GPU_##dest, GPU##dest, name, FALSE);\r
-\r
-static int LoadGPUplugin(const char *GPUdll) {\r
- void *drv;\r
-\r
- hGPUDriver = SysLoadLibrary(GPUdll);\r
- if (hGPUDriver == NULL) { \r
- GPU_configure = NULL;\r
- SysMessage (_("Could not load GPU plugin %s!"), GPUdll); return -1; \r
- }\r
- drv = hGPUDriver;\r
- LoadGpuSym1(init, "GPUinit");\r
- LoadGpuSym1(shutdown, "GPUshutdown");\r
- LoadGpuSym1(open, "GPUopen");\r
- LoadGpuSym1(close, "GPUclose");\r
- LoadGpuSym1(readData, "GPUreadData");\r
- LoadGpuSym1(readDataMem, "GPUreadDataMem");\r
- LoadGpuSym1(readStatus, "GPUreadStatus");\r
- LoadGpuSym1(writeData, "GPUwriteData");\r
- LoadGpuSym1(writeDataMem, "GPUwriteDataMem");\r
- LoadGpuSym1(writeStatus, "GPUwriteStatus");\r
- LoadGpuSym1(dmaChain, "GPUdmaChain");\r
- LoadGpuSym1(updateLace, "GPUupdateLace");\r
- LoadGpuSym0(keypressed, "GPUkeypressed");\r
- LoadGpuSym0(displayText, "GPUdisplayText");\r
- LoadGpuSym0(makeSnapshot, "GPUmakeSnapshot");\r
- LoadGpuSym1(freeze, "GPUfreeze");\r
- LoadGpuSym0(getScreenPic, "GPUgetScreenPic");\r
- LoadGpuSym0(showScreenPic, "GPUshowScreenPic");\r
- LoadGpuSym0(clearDynarec, "GPUclearDynarec");\r
- LoadGpuSym0(vBlank, "GPUvBlank");\r
- LoadGpuSym0(configure, "GPUconfigure");\r
- LoadGpuSym0(test, "GPUtest");\r
- LoadGpuSym0(about, "GPUabout");\r
-\r
- return 0;\r
-}\r
-\r
-void *hCDRDriver = NULL;\r
-\r
-long CALLBACK CDR__play(unsigned char *sector) { return 0; }\r
-long CALLBACK CDR__stop(void) { return 0; }\r
-\r
-long CALLBACK CDR__getStatus(struct CdrStat *stat) {\r
- if (cdOpenCaseTime < 0 || cdOpenCaseTime > (s64)time(NULL))\r
- stat->Status = 0x10;\r
- else\r
- stat->Status = 0;\r
-\r
- return 0;\r
-}\r
-\r
-char* CALLBACK CDR__getDriveLetter(void) { return NULL; }\r
-long CALLBACK CDR__configure(void) { return 0; }\r
-long CALLBACK CDR__test(void) { return 0; }\r
-void CALLBACK CDR__about(void) {}\r
-long CALLBACK CDR__setfilename(char*filename) { return 0; }\r
-\r
-#define LoadCdrSym1(dest, name) \\r
- LoadSym(CDR_##dest, CDR##dest, name, TRUE);\r
-\r
-#define LoadCdrSym0(dest, name) \\r
- LoadSym(CDR_##dest, CDR##dest, name, FALSE); \\r
- if (CDR_##dest == NULL) CDR_##dest = (CDR##dest) CDR__##dest;\r
-\r
-#define LoadCdrSymN(dest, name) \\r
- LoadSym(CDR_##dest, CDR##dest, name, FALSE);\r
-\r
-static int LoadCDRplugin(const char *CDRdll) {\r
- void *drv;\r
-\r
- if (CDRdll == NULL) {\r
- cdrIsoInit();\r
- return 0;\r
- }\r
-\r
- hCDRDriver = SysLoadLibrary(CDRdll);\r
- if (hCDRDriver == NULL) {\r
- CDR_configure = NULL;\r
- SysMessage (_("Could not load CD-ROM plugin %s!"), CDRdll); return -1;\r
- }\r
- drv = hCDRDriver;\r
- LoadCdrSym1(init, "CDRinit");\r
- LoadCdrSym1(shutdown, "CDRshutdown");\r
- LoadCdrSym1(open, "CDRopen");\r
- LoadCdrSym1(close, "CDRclose");\r
- LoadCdrSym1(getTN, "CDRgetTN");\r
- LoadCdrSym1(getTD, "CDRgetTD");\r
- LoadCdrSym1(readTrack, "CDRreadTrack");\r
- LoadCdrSym1(getBuffer, "CDRgetBuffer");\r
- LoadCdrSym1(getBufferSub, "CDRgetBufferSub");\r
- LoadCdrSym0(play, "CDRplay");\r
- LoadCdrSym0(stop, "CDRstop");\r
- LoadCdrSym0(getStatus, "CDRgetStatus");\r
- LoadCdrSym0(getDriveLetter, "CDRgetDriveLetter");\r
- LoadCdrSym0(configure, "CDRconfigure");\r
- LoadCdrSym0(test, "CDRtest");\r
- LoadCdrSym0(about, "CDRabout");\r
- LoadCdrSym0(setfilename, "CDRsetfilename");\r
- LoadCdrSymN(readCDDA, "CDRreadCDDA");\r
- LoadCdrSymN(getTE, "CDRgetTE");\r
-\r
- return 0;\r
-}\r
-\r
-void *hSPUDriver = NULL;\r
-\r
-long CALLBACK SPU__configure(void) { return 0; }\r
-void CALLBACK SPU__about(void) {}\r
-long CALLBACK SPU__test(void) { return 0; }\r
-void CALLBACK SPU__registerScheduleCb(void (CALLBACK *cb)(unsigned int)) {}\r
-\r
-#define LoadSpuSym1(dest, name) \\r
- LoadSym(SPU_##dest, SPU##dest, name, TRUE);\r
-\r
-#define LoadSpuSym0(dest, name) \\r
- LoadSym(SPU_##dest, SPU##dest, name, FALSE); \\r
- if (SPU_##dest == NULL) SPU_##dest = (SPU##dest) SPU__##dest;\r
-\r
-#define LoadSpuSymN(dest, name) \\r
- LoadSym(SPU_##dest, SPU##dest, name, FALSE);\r
-\r
-static int LoadSPUplugin(const char *SPUdll) {\r
- void *drv;\r
-\r
- hSPUDriver = SysLoadLibrary(SPUdll);\r
- if (hSPUDriver == NULL) {\r
- SPU_configure = NULL;\r
- SysMessage (_("Could not load SPU plugin %s!"), SPUdll); return -1;\r
- }\r
- drv = hSPUDriver;\r
- LoadSpuSym1(init, "SPUinit");\r
- LoadSpuSym1(shutdown, "SPUshutdown");\r
- LoadSpuSym1(open, "SPUopen");\r
- LoadSpuSym1(close, "SPUclose");\r
- LoadSpuSym0(configure, "SPUconfigure");\r
- LoadSpuSym0(about, "SPUabout");\r
- LoadSpuSym0(test, "SPUtest");\r
- LoadSpuSym1(writeRegister, "SPUwriteRegister");\r
- LoadSpuSym1(readRegister, "SPUreadRegister"); \r
- LoadSpuSym1(writeDMA, "SPUwriteDMA");\r
- LoadSpuSym1(readDMA, "SPUreadDMA");\r
- LoadSpuSym1(writeDMAMem, "SPUwriteDMAMem");\r
- LoadSpuSym1(readDMAMem, "SPUreadDMAMem");\r
- LoadSpuSym1(playADPCMchannel, "SPUplayADPCMchannel");\r
- LoadSpuSym1(freeze, "SPUfreeze");\r
- LoadSpuSym1(registerCallback, "SPUregisterCallback");\r
- LoadSpuSym0(registerScheduleCb, "SPUregisterScheduleCb");\r
- LoadSpuSymN(async, "SPUasync");\r
- LoadSpuSymN(playCDDAchannel, "SPUplayCDDAchannel");\r
-\r
- return 0;\r
-}\r
-\r
-void *hPAD1Driver = NULL;\r
-void *hPAD2Driver = NULL;\r
-\r
-static unsigned char buf[256];\r
-unsigned char stdpar[10] = { 0x00, 0x41, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff };\r
-unsigned char mousepar[8] = { 0x00, 0x12, 0x5a, 0xff, 0xff, 0xff, 0xff };\r
-unsigned char analogpar[9] = { 0x00, 0xff, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff };\r
-\r
-static int bufcount, bufc;\r
-\r
-PadDataS padd1, padd2;\r
-\r
-unsigned char _PADstartPoll(PadDataS *pad) {\r
- bufc = 0;\r
-\r
- switch (pad->controllerType) {\r
- case PSE_PAD_TYPE_MOUSE:\r
- mousepar[3] = pad->buttonStatus & 0xff;\r
- mousepar[4] = pad->buttonStatus >> 8;\r
- mousepar[5] = pad->moveX;\r
- mousepar[6] = pad->moveY;\r
-\r
- memcpy(buf, mousepar, 7);\r
- bufcount = 6;\r
- break;\r
- case PSE_PAD_TYPE_NEGCON: // npc101/npc104(slph00001/slph00069)\r
- analogpar[1] = 0x23;\r
- analogpar[3] = pad->buttonStatus & 0xff;\r
- analogpar[4] = pad->buttonStatus >> 8;\r
- analogpar[5] = pad->rightJoyX;\r
- analogpar[6] = pad->rightJoyY;\r
- analogpar[7] = pad->leftJoyX;\r
- analogpar[8] = pad->leftJoyY;\r
-\r
- memcpy(buf, analogpar, 9);\r
- bufcount = 8;\r
- break;\r
- case PSE_PAD_TYPE_ANALOGPAD: // scph1150\r
- analogpar[1] = 0x73;\r
- analogpar[3] = pad->buttonStatus & 0xff;\r
- analogpar[4] = pad->buttonStatus >> 8;\r
- analogpar[5] = pad->rightJoyX;\r
- analogpar[6] = pad->rightJoyY;\r
- analogpar[7] = pad->leftJoyX;\r
- analogpar[8] = pad->leftJoyY;\r
-\r
- memcpy(buf, analogpar, 9);\r
- bufcount = 8;\r
- break;\r
- case PSE_PAD_TYPE_ANALOGJOY: // scph1110\r
- analogpar[1] = 0x53;\r
- analogpar[3] = pad->buttonStatus & 0xff;\r
- analogpar[4] = pad->buttonStatus >> 8;\r
- analogpar[5] = pad->rightJoyX;\r
- analogpar[6] = pad->rightJoyY;\r
- analogpar[7] = pad->leftJoyX;\r
- analogpar[8] = pad->leftJoyY;\r
-\r
- memcpy(buf, analogpar, 9);\r
- bufcount = 8;\r
- break;\r
- case PSE_PAD_TYPE_STANDARD:\r
- default:\r
- stdpar[3] = pad->buttonStatus & 0xff;\r
- stdpar[4] = pad->buttonStatus >> 8;\r
-\r
- memcpy(buf, stdpar, 5);\r
- bufcount = 4;\r
- }\r
-\r
- return buf[bufc++];\r
-}\r
-\r
-unsigned char _PADpoll(unsigned char value) {\r
- if (bufc > bufcount) return 0;\r
- return buf[bufc++];\r
-}\r
-\r
-unsigned char CALLBACK PAD1__startPoll(int pad) {\r
- PadDataS padd;\r
-\r
- PAD1_readPort1(&padd);\r
-\r
- return _PADstartPoll(&padd);\r
-}\r
-\r
-unsigned char CALLBACK PAD1__poll(unsigned char value) {\r
- return _PADpoll(value);\r
-}\r
-\r
-long CALLBACK PAD1__configure(void) { return 0; }\r
-void CALLBACK PAD1__about(void) {}\r
-long CALLBACK PAD1__test(void) { return 0; }\r
-long CALLBACK PAD1__query(void) { return 3; }\r
-long CALLBACK PAD1__keypressed() { return 0; }\r
-\r
-#define LoadPad1Sym1(dest, name) \\r
- LoadSym(PAD1_##dest, PAD##dest, name, TRUE);\r
-\r
-#define LoadPad1SymN(dest, name) \\r
- LoadSym(PAD1_##dest, PAD##dest, name, FALSE);\r
-\r
-#define LoadPad1Sym0(dest, name) \\r
- LoadSym(PAD1_##dest, PAD##dest, name, FALSE); \\r
- if (PAD1_##dest == NULL) PAD1_##dest = (PAD##dest) PAD1__##dest;\r
-\r
-static int LoadPAD1plugin(const char *PAD1dll) {\r
- void *drv;\r
-\r
- hPAD1Driver = SysLoadLibrary(PAD1dll);\r
- if (hPAD1Driver == NULL) {\r
- PAD1_configure = NULL;\r
- SysMessage (_("Could not load Controller 1 plugin %s!"), PAD1dll); return -1;\r
- }\r
- drv = hPAD1Driver;\r
- LoadPad1Sym1(init, "PADinit");\r
- LoadPad1Sym1(shutdown, "PADshutdown");\r
- LoadPad1Sym1(open, "PADopen");\r
- LoadPad1Sym1(close, "PADclose");\r
- LoadPad1Sym0(query, "PADquery");\r
- LoadPad1Sym1(readPort1, "PADreadPort1");\r
- LoadPad1Sym0(configure, "PADconfigure");\r
- LoadPad1Sym0(test, "PADtest");\r
- LoadPad1Sym0(about, "PADabout");\r
- LoadPad1Sym0(keypressed, "PADkeypressed");\r
- LoadPad1Sym0(startPoll, "PADstartPoll");\r
- LoadPad1Sym0(poll, "PADpoll");\r
- LoadPad1SymN(setSensitive, "PADsetSensitive");\r
-\r
- return 0;\r
-}\r
-\r
-unsigned char CALLBACK PAD2__startPoll(int pad) {\r
- PadDataS padd;\r
-\r
- PAD2_readPort2(&padd);\r
- \r
- return _PADstartPoll(&padd);\r
-}\r
-\r
-unsigned char CALLBACK PAD2__poll(unsigned char value) {\r
- return _PADpoll(value);\r
-}\r
-\r
-long CALLBACK PAD2__configure(void) { return 0; }\r
-void CALLBACK PAD2__about(void) {}\r
-long CALLBACK PAD2__test(void) { return 0; }\r
-long CALLBACK PAD2__query(void) { return PSE_PAD_USE_PORT1 | PSE_PAD_USE_PORT2; }\r
-long CALLBACK PAD2__keypressed() { return 0; }\r
-\r
-#define LoadPad2Sym1(dest, name) \\r
- LoadSym(PAD2_##dest, PAD##dest, name, TRUE);\r
-\r
-#define LoadPad2Sym0(dest, name) \\r
- LoadSym(PAD2_##dest, PAD##dest, name, FALSE); \\r
- if (PAD2_##dest == NULL) PAD2_##dest = (PAD##dest) PAD2__##dest;\r
-\r
-#define LoadPad2SymN(dest, name) \\r
- LoadSym(PAD2_##dest, PAD##dest, name, FALSE);\r
-\r
-static int LoadPAD2plugin(const char *PAD2dll) {\r
- void *drv;\r
-\r
- hPAD2Driver = SysLoadLibrary(PAD2dll);\r
- if (hPAD2Driver == NULL) {\r
- PAD2_configure = NULL;\r
- SysMessage (_("Could not load Controller 2 plugin %s!"), PAD2dll); return -1;\r
- }\r
- drv = hPAD2Driver;\r
- LoadPad2Sym1(init, "PADinit");\r
- LoadPad2Sym1(shutdown, "PADshutdown");\r
- LoadPad2Sym1(open, "PADopen");\r
- LoadPad2Sym1(close, "PADclose");\r
- LoadPad2Sym0(query, "PADquery");\r
- LoadPad2Sym1(readPort2, "PADreadPort2");\r
- LoadPad2Sym0(configure, "PADconfigure");\r
- LoadPad2Sym0(test, "PADtest");\r
- LoadPad2Sym0(about, "PADabout");\r
- LoadPad2Sym0(keypressed, "PADkeypressed");\r
- LoadPad2Sym0(startPoll, "PADstartPoll");\r
- LoadPad2Sym0(poll, "PADpoll");\r
- LoadPad2SymN(setSensitive, "PADsetSensitive");\r
-\r
- return 0;\r
-}\r
-\r
-void *hNETDriver = NULL;\r
-\r
-void CALLBACK NET__setInfo(netInfo *info) {}\r
-void CALLBACK NET__keypressed(int key) {}\r
-long CALLBACK NET__configure(void) { return 0; }\r
-long CALLBACK NET__test(void) { return 0; }\r
-void CALLBACK NET__about(void) {}\r
-\r
-#define LoadNetSym1(dest, name) \\r
- LoadSym(NET_##dest, NET##dest, name, TRUE);\r
-\r
-#define LoadNetSymN(dest, name) \\r
- LoadSym(NET_##dest, NET##dest, name, FALSE);\r
-\r
-#define LoadNetSym0(dest, name) \\r
- LoadSym(NET_##dest, NET##dest, name, FALSE); \\r
- if (NET_##dest == NULL) NET_##dest = (NET##dest) NET__##dest;\r
-\r
-static int LoadNETplugin(const char *NETdll) {\r
- void *drv;\r
-\r
- hNETDriver = SysLoadLibrary(NETdll);\r
- if (hNETDriver == NULL) {\r
- SysMessage (_("Could not load NetPlay plugin %s!"), NETdll); return -1;\r
- }\r
- drv = hNETDriver;\r
- LoadNetSym1(init, "NETinit");\r
- LoadNetSym1(shutdown, "NETshutdown");\r
- LoadNetSym1(open, "NETopen");\r
- LoadNetSym1(close, "NETclose");\r
- LoadNetSymN(sendData, "NETsendData");\r
- LoadNetSymN(recvData, "NETrecvData");\r
- LoadNetSym1(sendPadData, "NETsendPadData");\r
- LoadNetSym1(recvPadData, "NETrecvPadData");\r
- LoadNetSym1(queryPlayer, "NETqueryPlayer");\r
- LoadNetSym1(pause, "NETpause");\r
- LoadNetSym1(resume, "NETresume");\r
- LoadNetSym0(setInfo, "NETsetInfo");\r
- LoadNetSym0(keypressed, "NETkeypressed");\r
- LoadNetSym0(configure, "NETconfigure");\r
- LoadNetSym0(test, "NETtest");\r
- LoadNetSym0(about, "NETabout");\r
-\r
- return 0;\r
-}\r
-\r
-#ifdef ENABLE_SIO1API\r
-\r
-void *hSIO1Driver = NULL;\r
-\r
-long CALLBACK SIO1__init(void) { return 0; }\r
-long CALLBACK SIO1__shutdown(void) { return 0; }\r
-long CALLBACK SIO1__open(void) { return 0; }\r
-long CALLBACK SIO1__close(void) { return 0; }\r
-long CALLBACK SIO1__configure(void) { return 0; }\r
-long CALLBACK SIO1__test(void) { return 0; }\r
-void CALLBACK SIO1__about(void) {}\r
-void CALLBACK SIO1__pause(void) {}\r
-void CALLBACK SIO1__resume(void) {}\r
-long CALLBACK SIO1__keypressed(int key) { return 0; }\r
-void CALLBACK SIO1__writeData8(unsigned char val) {}\r
-void CALLBACK SIO1__writeData16(unsigned short val) {}\r
-void CALLBACK SIO1__writeData32(unsigned long val) {}\r
-void CALLBACK SIO1__writeStat16(unsigned short val) {}\r
-void CALLBACK SIO1__writeStat32(unsigned long val) {}\r
-void CALLBACK SIO1__writeMode16(unsigned short val) {}\r
-void CALLBACK SIO1__writeMode32(unsigned long val) {}\r
-void CALLBACK SIO1__writeCtrl16(unsigned short val) {}\r
-void CALLBACK SIO1__writeCtrl32(unsigned long val) {}\r
-void CALLBACK SIO1__writeBaud16(unsigned short val) {}\r
-void CALLBACK SIO1__writeBaud32(unsigned long val) {}\r
-unsigned char CALLBACK SIO1__readData8(void) { return 0; }\r
-unsigned short CALLBACK SIO1__readData16(void) { return 0; }\r
-unsigned long CALLBACK SIO1__readData32(void) { return 0; }\r
-unsigned short CALLBACK SIO1__readStat16(void) { return 0; }\r
-unsigned long CALLBACK SIO1__readStat32(void) { return 0; }\r
-unsigned short CALLBACK SIO1__readMode16(void) { return 0; }\r
-unsigned long CALLBACK SIO1__readMode32(void) { return 0; }\r
-unsigned short CALLBACK SIO1__readCtrl16(void) { return 0; }\r
-unsigned long CALLBACK SIO1__readCtrl32(void) { return 0; }\r
-unsigned short CALLBACK SIO1__readBaud16(void) { return 0; }\r
-unsigned long CALLBACK SIO1__readBaud32(void) { return 0; }\r
-void CALLBACK SIO1__registerCallback(void (CALLBACK *callback)(void)) {};\r
-\r
-void CALLBACK SIO1irq(void) {\r
- psxHu32ref(0x1070) |= SWAPu32(0x100);\r
-}\r
-\r
-#define LoadSio1Sym1(dest, name) \\r
- LoadSym(SIO1_##dest, SIO1##dest, name, TRUE);\r
-\r
-#define LoadSio1SymN(dest, name) \\r
- LoadSym(SIO1_##dest, SIO1##dest, name, FALSE);\r
-\r
-#define LoadSio1Sym0(dest, name) \\r
- LoadSym(SIO1_##dest, SIO1##dest, name, FALSE); \\r
- if (SIO1_##dest == NULL) SIO1_##dest = (SIO1##dest) SIO1__##dest;\r
-\r
-static int LoadSIO1plugin(const char *SIO1dll) {\r
- void *drv;\r
-\r
- hSIO1Driver = SysLoadLibrary(SIO1dll);\r
- if (hSIO1Driver == NULL) {\r
- SysMessage (_("Could not load SIO1 plugin %s!"), SIO1dll); return -1;\r
- }\r
- drv = hSIO1Driver;\r
-\r
- LoadSio1Sym0(init, "SIO1init");\r
- LoadSio1Sym0(shutdown, "SIO1shutdown");\r
- LoadSio1Sym0(open, "SIO1open");\r
- LoadSio1Sym0(close, "SIO1close");\r
- LoadSio1Sym0(pause, "SIO1pause");\r
- LoadSio1Sym0(resume, "SIO1resume");\r
- LoadSio1Sym0(keypressed, "SIO1keypressed");\r
- LoadSio1Sym0(configure, "SIO1configure");\r
- LoadSio1Sym0(test, "SIO1test");\r
- LoadSio1Sym0(about, "SIO1about");\r
- LoadSio1Sym0(writeData8, "SIO1writeData8");\r
- LoadSio1Sym0(writeData16, "SIO1writeData16");\r
- LoadSio1Sym0(writeData32, "SIO1writeData32");\r
- LoadSio1Sym0(writeStat16, "SIO1writeStat16");\r
- LoadSio1Sym0(writeStat32, "SIO1writeStat32");\r
- LoadSio1Sym0(writeMode16, "SIO1writeMode16");\r
- LoadSio1Sym0(writeMode32, "SIO1writeMode32");\r
- LoadSio1Sym0(writeCtrl16, "SIO1writeCtrl16");\r
- LoadSio1Sym0(writeCtrl32, "SIO1writeCtrl32");\r
- LoadSio1Sym0(writeBaud16, "SIO1writeBaud16");\r
- LoadSio1Sym0(writeBaud32, "SIO1writeBaud32");\r
- LoadSio1Sym0(readData16, "SIO1readData16");\r
- LoadSio1Sym0(readData32, "SIO1readData32");\r
- LoadSio1Sym0(readStat16, "SIO1readStat16");\r
- LoadSio1Sym0(readStat32, "SIO1readStat32");\r
- LoadSio1Sym0(readMode16, "SIO1readMode16");\r
- LoadSio1Sym0(readMode32, "SIO1readMode32");\r
- LoadSio1Sym0(readCtrl16, "SIO1readCtrl16");\r
- LoadSio1Sym0(readCtrl32, "SIO1readCtrl32");\r
- LoadSio1Sym0(readBaud16, "SIO1readBaud16");\r
- LoadSio1Sym0(readBaud32, "SIO1readBaud32");\r
- LoadSio1Sym0(registerCallback, "SIO1registerCallback");\r
-\r
- return 0;\r
-}\r
-\r
-#endif\r
-\r
-void CALLBACK clearDynarec(void) {\r
- psxCpu->Reset();\r
-}\r
-\r
-int LoadPlugins() {\r
- int ret;\r
- char Plugin[MAXPATHLEN];\r
-\r
- ReleasePlugins();\r
- SysLibError();\r
-\r
- if (UsingIso()) {\r
- LoadCDRplugin(NULL);\r
- } else {\r
- sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Cdr);\r
- if (LoadCDRplugin(Plugin) == -1) return -1;\r
- }\r
-\r
- sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Gpu);\r
- if (LoadGPUplugin(Plugin) == -1) return -1;\r
-\r
- sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Spu);\r
- if (LoadSPUplugin(Plugin) == -1) return -1;\r
-\r
- sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Pad1);\r
- if (LoadPAD1plugin(Plugin) == -1) return -1;\r
-\r
- sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Pad2);\r
- if (LoadPAD2plugin(Plugin) == -1) return -1;\r
-\r
- if (strcmp("Disabled", Config.Net) == 0 || strcmp("", Config.Net) == 0)\r
- Config.UseNet = FALSE;\r
- else {\r
- Config.UseNet = TRUE;\r
- sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Net);\r
- if (LoadNETplugin(Plugin) == -1) Config.UseNet = FALSE;\r
- }\r
-\r
-#ifdef ENABLE_SIO1API\r
- sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Sio1);\r
- if (LoadSIO1plugin(Plugin) == -1) return -1;\r
-#endif\r
-\r
- ret = CDR_init();\r
- if (ret < 0) { SysMessage (_("Error initializing CD-ROM plugin: %d"), ret); return -1; }\r
- ret = GPU_init();\r
- if (ret < 0) { SysMessage (_("Error initializing GPU plugin: %d"), ret); return -1; }\r
- ret = SPU_init();\r
- if (ret < 0) { SysMessage (_("Error initializing SPU plugin: %d"), ret); return -1; }\r
- ret = PAD1_init(1);\r
- if (ret < 0) { SysMessage (_("Error initializing Controller 1 plugin: %d"), ret); return -1; }\r
- ret = PAD2_init(2);\r
- if (ret < 0) { SysMessage (_("Error initializing Controller 2 plugin: %d"), ret); return -1; }\r
-\r
- if (Config.UseNet) {\r
- ret = NET_init();\r
- if (ret < 0) { SysMessage (_("Error initializing NetPlay plugin: %d"), ret); return -1; }\r
- }\r
-\r
-#ifdef ENABLE_SIO1API\r
- ret = SIO1_init();\r
- if (ret < 0) { SysMessage (_("Error initializing SIO1 plugin: %d"), ret); return -1; }\r
-#endif\r
-\r
- SysPrintf(_("Plugins loaded.\n"));\r
- return 0;\r
-}\r
-\r
-void ReleasePlugins() {\r
- if (Config.UseNet) {\r
- int ret = NET_close();\r
- if (ret < 0) Config.UseNet = FALSE;\r
- }\r
- NetOpened = FALSE;\r
-\r
- if (hCDRDriver != NULL || cdrIsoActive()) CDR_shutdown();\r
- if (hGPUDriver != NULL) GPU_shutdown();\r
- if (hSPUDriver != NULL) SPU_shutdown();\r
- if (hPAD1Driver != NULL) PAD1_shutdown();\r
- if (hPAD2Driver != NULL) PAD2_shutdown();\r
-\r
- if (Config.UseNet && hNETDriver != NULL) NET_shutdown(); \r
-\r
- if (hCDRDriver != NULL) SysCloseLibrary(hCDRDriver); hCDRDriver = NULL;\r
- if (hGPUDriver != NULL) SysCloseLibrary(hGPUDriver); hGPUDriver = NULL;\r
- if (hSPUDriver != NULL) SysCloseLibrary(hSPUDriver); hSPUDriver = NULL;\r
- if (hPAD1Driver != NULL) SysCloseLibrary(hPAD1Driver); hPAD1Driver = NULL;\r
- if (hPAD2Driver != NULL) SysCloseLibrary(hPAD2Driver); hPAD2Driver = NULL;\r
-\r
- if (Config.UseNet && hNETDriver != NULL) {\r
- SysCloseLibrary(hNETDriver); hNETDriver = NULL;\r
- }\r
-\r
-#ifdef ENABLE_SIO1API\r
- if (hSIO1Driver != NULL) {\r
- SIO1_shutdown();\r
- SysCloseLibrary(hSIO1Driver);\r
- hSIO1Driver = NULL;\r
- }\r
-#endif\r
-}\r
-\r
-// for CD swap\r
-int ReloadCdromPlugin()\r
-{\r
- if (hCDRDriver != NULL || cdrIsoActive()) CDR_shutdown();\r
- if (hCDRDriver != NULL) SysCloseLibrary(hCDRDriver); hCDRDriver = NULL;\r
-\r
- if (UsingIso()) {\r
- LoadCDRplugin(NULL);\r
- } else {\r
- char Plugin[MAXPATHLEN];\r
- sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Cdr);\r
- if (LoadCDRplugin(Plugin) == -1) return -1;\r
- }\r
-\r
- return CDR_init();\r
-}\r
-\r
-void SetIsoFile(const char *filename) {\r
- if (filename == NULL) {\r
- IsoFile[0] = '\0';\r
- return;\r
- }\r
- strncpy(IsoFile, filename, MAXPATHLEN);\r
-}\r
-\r
-const char *GetIsoFile(void) {\r
- return IsoFile;\r
-}\r
-\r
-boolean UsingIso(void) {\r
- return (IsoFile[0] != '\0');\r
-}\r
-\r
-void SetCdOpenCaseTime(s64 time) {\r
- cdOpenCaseTime = time;\r
-}\r
+/***************************************************************************
+ * Copyright (C) 2007 Ryan Schultz, PCSX-df Team, PCSX team *
+ * *
+ * This program is free software; you can redistribute it and/or modify *
+ * it under the terms of the GNU General Public License as published by *
+ * the Free Software Foundation; either version 2 of the License, or *
+ * (at your option) any later version. *
+ * *
+ * This program is distributed in the hope that it will be useful, *
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of *
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the *
+ * GNU General Public License for more details. *
+ * *
+ * You should have received a copy of the GNU General Public License *
+ * along with this program; if not, write to the *
+ * Free Software Foundation, Inc., *
+ * 51 Franklin Street, Fifth Floor, Boston, MA 02111-1307 USA. *
+ ***************************************************************************/
+
+/*
+* Plugin library callback/access functions.
+*/
+
+#include "plugins.h"
+#include "cdriso.h"
+#include "../plugins/dfinput/externals.h"
+
+static char IsoFile[MAXPATHLEN] = "";
+static s64 cdOpenCaseTime = 0;
+
+GPUupdateLace GPU_updateLace;
+GPUinit GPU_init;
+GPUshutdown GPU_shutdown;
+GPUconfigure GPU_configure;
+GPUtest GPU_test;
+GPUabout GPU_about;
+GPUopen GPU_open;
+GPUclose GPU_close;
+GPUreadStatus GPU_readStatus;
+GPUreadData GPU_readData;
+GPUreadDataMem GPU_readDataMem;
+GPUwriteStatus GPU_writeStatus;
+GPUwriteData GPU_writeData;
+GPUwriteDataMem GPU_writeDataMem;
+GPUdmaChain GPU_dmaChain;
+GPUkeypressed GPU_keypressed;
+GPUdisplayText GPU_displayText;
+GPUmakeSnapshot GPU_makeSnapshot;
+GPUfreeze GPU_freeze;
+GPUgetScreenPic GPU_getScreenPic;
+GPUshowScreenPic GPU_showScreenPic;
+GPUclearDynarec GPU_clearDynarec;
+GPUvBlank GPU_vBlank;
+
+CDRinit CDR_init;
+CDRshutdown CDR_shutdown;
+CDRopen CDR_open;
+CDRclose CDR_close;
+CDRtest CDR_test;
+CDRgetTN CDR_getTN;
+CDRgetTD CDR_getTD;
+CDRreadTrack CDR_readTrack;
+CDRgetBuffer CDR_getBuffer;
+CDRplay CDR_play;
+CDRstop CDR_stop;
+CDRgetStatus CDR_getStatus;
+CDRgetDriveLetter CDR_getDriveLetter;
+CDRgetBufferSub CDR_getBufferSub;
+CDRconfigure CDR_configure;
+CDRabout CDR_about;
+CDRsetfilename CDR_setfilename;
+CDRreadCDDA CDR_readCDDA;
+CDRgetTE CDR_getTE;
+
+SPUconfigure SPU_configure;
+SPUabout SPU_about;
+SPUinit SPU_init;
+SPUshutdown SPU_shutdown;
+SPUtest SPU_test;
+SPUopen SPU_open;
+SPUclose SPU_close;
+SPUplaySample SPU_playSample;
+SPUwriteRegister SPU_writeRegister;
+SPUreadRegister SPU_readRegister;
+SPUwriteDMA SPU_writeDMA;
+SPUreadDMA SPU_readDMA;
+SPUwriteDMAMem SPU_writeDMAMem;
+SPUreadDMAMem SPU_readDMAMem;
+SPUplayADPCMchannel SPU_playADPCMchannel;
+SPUfreeze SPU_freeze;
+SPUregisterCallback SPU_registerCallback;
+SPUregisterScheduleCb SPU_registerScheduleCb;
+SPUasync SPU_async;
+SPUplayCDDAchannel SPU_playCDDAchannel;
+
+PADconfigure PAD1_configure;
+PADabout PAD1_about;
+PADinit PAD1_init;
+PADshutdown PAD1_shutdown;
+PADtest PAD1_test;
+PADopen PAD1_open;
+PADclose PAD1_close;
+PADquery PAD1_query;
+PADreadPort1 PAD1_readPort1;
+PADkeypressed PAD1_keypressed;
+PADstartPoll PAD1_startPoll;
+PADpoll PAD1_poll;
+PADsetSensitive PAD1_setSensitive;
+
+PADconfigure PAD2_configure;
+PADabout PAD2_about;
+PADinit PAD2_init;
+PADshutdown PAD2_shutdown;
+PADtest PAD2_test;
+PADopen PAD2_open;
+PADclose PAD2_close;
+PADquery PAD2_query;
+PADreadPort2 PAD2_readPort2;
+PADkeypressed PAD2_keypressed;
+PADstartPoll PAD2_startPoll;
+PADpoll PAD2_poll;
+PADsetSensitive PAD2_setSensitive;
+
+NETinit NET_init;
+NETshutdown NET_shutdown;
+NETopen NET_open;
+NETclose NET_close;
+NETtest NET_test;
+NETconfigure NET_configure;
+NETabout NET_about;
+NETpause NET_pause;
+NETresume NET_resume;
+NETqueryPlayer NET_queryPlayer;
+NETsendData NET_sendData;
+NETrecvData NET_recvData;
+NETsendPadData NET_sendPadData;
+NETrecvPadData NET_recvPadData;
+NETsetInfo NET_setInfo;
+NETkeypressed NET_keypressed;
+
+#ifdef ENABLE_SIO1API
+
+SIO1init SIO1_init;
+SIO1shutdown SIO1_shutdown;
+SIO1open SIO1_open;
+SIO1close SIO1_close;
+SIO1test SIO1_test;
+SIO1configure SIO1_configure;
+SIO1about SIO1_about;
+SIO1pause SIO1_pause;
+SIO1resume SIO1_resume;
+SIO1keypressed SIO1_keypressed;
+SIO1writeData8 SIO1_writeData8;
+SIO1writeData16 SIO1_writeData16;
+SIO1writeData32 SIO1_writeData32;
+SIO1writeStat16 SIO1_writeStat16;
+SIO1writeStat32 SIO1_writeStat32;
+SIO1writeMode16 SIO1_writeMode16;
+SIO1writeMode32 SIO1_writeMode32;
+SIO1writeCtrl16 SIO1_writeCtrl16;
+SIO1writeCtrl32 SIO1_writeCtrl32;
+SIO1writeBaud16 SIO1_writeBaud16;
+SIO1writeBaud32 SIO1_writeBaud32;
+SIO1readData8 SIO1_readData8;
+SIO1readData16 SIO1_readData16;
+SIO1readData32 SIO1_readData32;
+SIO1readStat16 SIO1_readStat16;
+SIO1readStat32 SIO1_readStat32;
+SIO1readMode16 SIO1_readMode16;
+SIO1readMode32 SIO1_readMode32;
+SIO1readCtrl16 SIO1_readCtrl16;
+SIO1readCtrl32 SIO1_readCtrl32;
+SIO1readBaud16 SIO1_readBaud16;
+SIO1readBaud32 SIO1_readBaud32;
+SIO1registerCallback SIO1_registerCallback;
+
+#endif
+
+static const char *err;
+
+#define CheckErr(func) { \
+ err = SysLibError(); \
+ if (err != NULL) { SysMessage(_("Error loading %s: %s"), func, err); return -1; } \
+}
+
+#define LoadSym(dest, src, name, checkerr) { \
+ dest = (src)SysLoadSym(drv, name); \
+ if (checkerr) { CheckErr(name); } else SysLibError(); \
+}
+
+void *hGPUDriver = NULL;
+
+void CALLBACK GPU__displayText(char *pText) {
+ SysPrintf("%s\n", pText);
+}
+
+long CALLBACK GPU__configure(void) { return 0; }
+long CALLBACK GPU__test(void) { return 0; }
+void CALLBACK GPU__about(void) {}
+void CALLBACK GPU__makeSnapshot(void) {}
+void CALLBACK GPU__keypressed(int key) {}
+long CALLBACK GPU__getScreenPic(unsigned char *pMem) { return -1; }
+long CALLBACK GPU__showScreenPic(unsigned char *pMem) { return -1; }
+void CALLBACK GPU__clearDynarec(void (CALLBACK *callback)(void)) {}
+void CALLBACK GPU__vBlank(int val) {}
+
+#define LoadGpuSym1(dest, name) \
+ LoadSym(GPU_##dest, GPU##dest, name, TRUE);
+
+#define LoadGpuSym0(dest, name) \
+ LoadSym(GPU_##dest, GPU##dest, name, FALSE); \
+ if (GPU_##dest == NULL) GPU_##dest = (GPU##dest) GPU__##dest;
+
+#define LoadGpuSymN(dest, name) \
+ LoadSym(GPU_##dest, GPU##dest, name, FALSE);
+
+static int LoadGPUplugin(const char *GPUdll) {
+ void *drv;
+
+ hGPUDriver = SysLoadLibrary(GPUdll);
+ if (hGPUDriver == NULL) {
+ GPU_configure = NULL;
+ SysMessage (_("Could not load GPU plugin %s!"), GPUdll); return -1;
+ }
+ drv = hGPUDriver;
+ LoadGpuSym1(init, "GPUinit");
+ LoadGpuSym1(shutdown, "GPUshutdown");
+ LoadGpuSym1(open, "GPUopen");
+ LoadGpuSym1(close, "GPUclose");
+ LoadGpuSym1(readData, "GPUreadData");
+ LoadGpuSym1(readDataMem, "GPUreadDataMem");
+ LoadGpuSym1(readStatus, "GPUreadStatus");
+ LoadGpuSym1(writeData, "GPUwriteData");
+ LoadGpuSym1(writeDataMem, "GPUwriteDataMem");
+ LoadGpuSym1(writeStatus, "GPUwriteStatus");
+ LoadGpuSym1(dmaChain, "GPUdmaChain");
+ LoadGpuSym1(updateLace, "GPUupdateLace");
+ LoadGpuSym0(keypressed, "GPUkeypressed");
+ LoadGpuSym0(displayText, "GPUdisplayText");
+ LoadGpuSym0(makeSnapshot, "GPUmakeSnapshot");
+ LoadGpuSym1(freeze, "GPUfreeze");
+ LoadGpuSym0(getScreenPic, "GPUgetScreenPic");
+ LoadGpuSym0(showScreenPic, "GPUshowScreenPic");
+ LoadGpuSym0(clearDynarec, "GPUclearDynarec");
+ LoadGpuSym0(vBlank, "GPUvBlank");
+ LoadGpuSym0(configure, "GPUconfigure");
+ LoadGpuSym0(test, "GPUtest");
+ LoadGpuSym0(about, "GPUabout");
+
+ return 0;
+}
+
+void *hCDRDriver = NULL;
+
+long CALLBACK CDR__play(unsigned char *sector) { return 0; }
+long CALLBACK CDR__stop(void) { return 0; }
+
+long CALLBACK CDR__getStatus(struct CdrStat *stat) {
+ if (cdOpenCaseTime < 0 || cdOpenCaseTime > (s64)time(NULL))
+ stat->Status = 0x10;
+ else
+ stat->Status = 0;
+
+ return 0;
+}
+
+char* CALLBACK CDR__getDriveLetter(void) { return NULL; }
+long CALLBACK CDR__configure(void) { return 0; }
+long CALLBACK CDR__test(void) { return 0; }
+void CALLBACK CDR__about(void) {}
+long CALLBACK CDR__setfilename(char*filename) { return 0; }
+
+#define LoadCdrSym1(dest, name) \
+ LoadSym(CDR_##dest, CDR##dest, name, TRUE);
+
+#define LoadCdrSym0(dest, name) \
+ LoadSym(CDR_##dest, CDR##dest, name, FALSE); \
+ if (CDR_##dest == NULL) CDR_##dest = (CDR##dest) CDR__##dest;
+
+#define LoadCdrSymN(dest, name) \
+ LoadSym(CDR_##dest, CDR##dest, name, FALSE);
+
+static int LoadCDRplugin(const char *CDRdll) {
+ void *drv;
+
+ if (CDRdll == NULL) {
+ cdrIsoInit();
+ return 0;
+ }
+
+ hCDRDriver = SysLoadLibrary(CDRdll);
+ if (hCDRDriver == NULL) {
+ CDR_configure = NULL;
+ SysMessage (_("Could not load CD-ROM plugin %s!"), CDRdll); return -1;
+ }
+ drv = hCDRDriver;
+ LoadCdrSym1(init, "CDRinit");
+ LoadCdrSym1(shutdown, "CDRshutdown");
+ LoadCdrSym1(open, "CDRopen");
+ LoadCdrSym1(close, "CDRclose");
+ LoadCdrSym1(getTN, "CDRgetTN");
+ LoadCdrSym1(getTD, "CDRgetTD");
+ LoadCdrSym1(readTrack, "CDRreadTrack");
+ LoadCdrSym1(getBuffer, "CDRgetBuffer");
+ LoadCdrSym1(getBufferSub, "CDRgetBufferSub");
+ LoadCdrSym0(play, "CDRplay");
+ LoadCdrSym0(stop, "CDRstop");
+ LoadCdrSym0(getStatus, "CDRgetStatus");
+ LoadCdrSym0(getDriveLetter, "CDRgetDriveLetter");
+ LoadCdrSym0(configure, "CDRconfigure");
+ LoadCdrSym0(test, "CDRtest");
+ LoadCdrSym0(about, "CDRabout");
+ LoadCdrSym0(setfilename, "CDRsetfilename");
+ LoadCdrSymN(readCDDA, "CDRreadCDDA");
+ LoadCdrSymN(getTE, "CDRgetTE");
+
+ return 0;
+}
+
+void *hSPUDriver = NULL;
+
+long CALLBACK SPU__configure(void) { return 0; }
+void CALLBACK SPU__about(void) {}
+long CALLBACK SPU__test(void) { return 0; }
+void CALLBACK SPU__registerScheduleCb(void (CALLBACK *cb)(unsigned int)) {}
+
+#define LoadSpuSym1(dest, name) \
+ LoadSym(SPU_##dest, SPU##dest, name, TRUE);
+
+#define LoadSpuSym0(dest, name) \
+ LoadSym(SPU_##dest, SPU##dest, name, FALSE); \
+ if (SPU_##dest == NULL) SPU_##dest = (SPU##dest) SPU__##dest;
+
+#define LoadSpuSymN(dest, name) \
+ LoadSym(SPU_##dest, SPU##dest, name, FALSE);
+
+static int LoadSPUplugin(const char *SPUdll) {
+ void *drv;
+
+ hSPUDriver = SysLoadLibrary(SPUdll);
+ if (hSPUDriver == NULL) {
+ SPU_configure = NULL;
+ SysMessage (_("Could not load SPU plugin %s!"), SPUdll); return -1;
+ }
+ drv = hSPUDriver;
+ LoadSpuSym1(init, "SPUinit");
+ LoadSpuSym1(shutdown, "SPUshutdown");
+ LoadSpuSym1(open, "SPUopen");
+ LoadSpuSym1(close, "SPUclose");
+ LoadSpuSym0(configure, "SPUconfigure");
+ LoadSpuSym0(about, "SPUabout");
+ LoadSpuSym0(test, "SPUtest");
+ LoadSpuSym1(writeRegister, "SPUwriteRegister");
+ LoadSpuSym1(readRegister, "SPUreadRegister");
+ LoadSpuSym1(writeDMA, "SPUwriteDMA");
+ LoadSpuSym1(readDMA, "SPUreadDMA");
+ LoadSpuSym1(writeDMAMem, "SPUwriteDMAMem");
+ LoadSpuSym1(readDMAMem, "SPUreadDMAMem");
+ LoadSpuSym1(playADPCMchannel, "SPUplayADPCMchannel");
+ LoadSpuSym1(freeze, "SPUfreeze");
+ LoadSpuSym1(registerCallback, "SPUregisterCallback");
+ LoadSpuSym0(registerScheduleCb, "SPUregisterScheduleCb");
+ LoadSpuSymN(async, "SPUasync");
+ LoadSpuSymN(playCDDAchannel, "SPUplayCDDAchannel");
+
+ return 0;
+}
+
+void *hPAD1Driver = NULL;
+void *hPAD2Driver = NULL;
+
+static int multitap1 = -1;
+static int multitap2 = -1;
+//Pad information, keystate, mode, config mode, vibration
+static PadDataS pad[8];
+
+static int reqPos, respSize, req;
+static int ledStateReq44[8];
+
+static unsigned char buf[256];
+static unsigned char bufMulti[34] = { 0x80, 0x5a,
+ 0x41, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0x41, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0x41, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0x41, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff};
+
+unsigned char stdpar[8] = { 0x41, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff};
+unsigned char multitappar[34] = { 0x80, 0x5a,
+ 0x41, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0x41, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0x41, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0x41, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff};
+
+//response for request 44, 45, 46, 47, 4C, 4D
+static unsigned char resp45[8] = {0xF3, 0x5A, 0x01, 0x02, 0x00, 0x02, 0x01, 0x00};
+static unsigned char resp46_00[8] = {0xF3, 0x5A, 0x00, 0x00, 0x01, 0x02, 0x00, 0x0A};
+static unsigned char resp46_01[8] = {0xF3, 0x5A, 0x00, 0x00, 0x01, 0x01, 0x01, 0x14};
+static unsigned char resp47[8] = {0xF3, 0x5A, 0x00, 0x00, 0x02, 0x00, 0x01, 0x00};
+static unsigned char resp4C_00[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x04, 0x00, 0x00};
+static unsigned char resp4C_01[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x07, 0x00, 0x00};
+static unsigned char resp4D[8] = {0xF3, 0x5A, 0x00, 0x01, 0xFF, 0xFF, 0xFF, 0xFF};
+
+//fixed reponse of request number 41, 48, 49, 4A, 4B, 4E, 4F
+static unsigned char resp40[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00};
+static unsigned char resp41[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00};
+static unsigned char resp43[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00};
+static unsigned char resp44[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00};
+static unsigned char resp49[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00};
+static unsigned char resp4A[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00};
+static unsigned char resp4B[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00};
+static unsigned char resp4E[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00};
+static unsigned char resp4F[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00};
+
+// Resquest of psx core
+enum {
+ // REQUEST
+ // first call of this request for the pad, the pad is configured as an digital pad.
+ // 0x0X, 0x42, 0x0Y, 0xZZ, 0xAA, 0x00, 0x00, 0x00, 0x00
+ // X pad number (used for the multitap, first request response 0x00, 0x80, 0x5A, (8 bytes pad A), (8 bytes pad B), (8 bytes pad C), (8 bytes pad D)
+ // Y if 1 : psx request the full length response for the multitap, 3 bytes header and 4 block of 8 bytes per pad
+ // Y if 0 : psx request a pad key state
+ // ZZ rumble small motor 00-> OFF, 01 -> ON
+ // AA rumble large motor speed 0x00 -> 0xFF
+ // RESPONSE
+ // header 3 Bytes
+ // 0x00
+ // PadId -> 0x41 for digital pas, 0x73 for analog pad
+ // 0x5A mode has not change (no press on analog button on the center of pad), 0x00 the analog button have been pressed and the mode switch
+ // 6 Bytes for keystates
+ CMD_READ_DATA_AND_VIBRATE = 0x42,
+
+ // REQUEST
+ // Header
+ // 0x0N, 0x43, 0x00, XX, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00
+ // XX = 00 -> Normal mode : Seconde bytes of response = padId
+ // XX = 01 -> Configuration mode : Seconde bytes of response = 0xF3
+ // RESPONSE
+ // enter in config mode example :
+ // req : 01 43 00 01 00 00 00 00 00 00
+ // res : 00 41 5A buttons state, analog states
+ // exit config mode :
+ // req : 01 43 00 00 00 00 00 00 00 00
+ // res : 00 F3 5A buttons state, analog states
+ CMD_CONFIG_MODE = 0x43,
+
+ // Set led State
+ // REQUEST
+ // 0x0N, 0x44, 0x00, VAL, SEL, 0x00, 0x00, 0x00, 0x00
+ // If sel = 2 then
+ // VAL = 00 -> OFF
+ // VAL = 01 -> ON
+ // RESPONSE
+ // 0x00, 0xF3, 0x5A, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00
+ CMD_SET_MODE_AND_LOCK = 0x44,
+
+ // Get Analog Led state
+ // REQUEST
+ // 0x0N, 0x45, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00
+ // RESPONSE
+ // 0x00, 0xF3, 0x5A, 0x01, 0x02, VAL, 0x02, 0x01, 0x00
+ // VAL = 00 Led OFF
+ // VAL = 01 Led ON
+ CMD_QUERY_MODEL_AND_MODE = 0x45,
+
+ //Get Variable A
+ // REQUEST
+ // 0x0N, 0x46, 0x00, 0xXX, 0x00, 0x00, 0x00, 0x00, 0x00
+ // RESPONSE
+ // XX=00
+ // 0x00, 0xF3, 0x5A, 0x00, 0x00, 0x01, 0x02, 0x00, 0x0A
+ // XX=01
+ // 0x00, 0xF3, 0x5A, 0x00, 0x00, 0x01, 0x01, 0x01, 0x14
+ CMD_QUERY_ACT = 0x46,
+
+ // REQUEST
+ // 0x0N, 0x47, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00
+ // RESPONSE
+ // 0x00, 0xF3, 0x5A, 0x00, 0x00, 0x02, 0x00, 0x01, 0x00
+ CMD_QUERY_COMB = 0x47,
+
+ // REQUEST
+ // 0x0N, 0x4C, 0x00, 0xXX, 0x00, 0x00, 0x00, 0x00, 0x00
+ // RESPONSE
+ // XX = 0
+ // 0x00, 0xF3, 0x5A, 0x00, 0x00, 0x00, 0x04, 0x00, 0x00
+ // XX = 1
+ // 0x00, 0xF3, 0x5A, 0x00, 0x00, 0x00, 0x07, 0x00, 0x00
+ CMD_QUERY_MODE = 0x4C,
+
+ // REQUEST
+ // 0x0N, 0x4D, 0x00, 0xAA, 0xBB, 0xCC, 0xDD, 0xEE, 0xFF
+ // RESPONSE
+ // 0x00, 0xF3, 0x5A, old value or
+ // AA = 01 unlock large motor (and swap VAL1 and VAL2)
+ // BB = 01 unlock large motor (default)
+ // CC, DD, EE, FF = all FF -> unlock small motor
+ //
+ // default repsonse for analog pad with 2 motor : 0x00 0xF3 0x5A 0x00 0x01 0xFF 0xFF 0xFF 0xFF
+ //
+ CMD_VIBRATION_TOGGLE = 0x4D,
+ REQ40 = 0x40,
+ REQ41 = 0x41,
+ REQ49 = 0x49,
+ REQ4A = 0x4A,
+ REQ4B = 0x4B,
+ REQ4E = 0x4E,
+ REQ4F = 0x4F
+};
+
+
+
+
+//NO MULTITAP
+
+void initBufForRequest(int padIndex, char value){
+ switch (value){
+ //Pad keystate already in buffer
+ //case CMD_READ_DATA_AND_VIBRATE :
+ // break;
+ case CMD_CONFIG_MODE :
+ if (pad[padIndex].configMode == 1) {
+ memcpy(buf, resp43, 8);
+ break;
+ }
+ //else, not in config mode, pad keystate return (already in the buffer)
+ break;
+ case CMD_SET_MODE_AND_LOCK :
+ memcpy(buf, resp44, 8);
+ break;
+ case CMD_QUERY_MODEL_AND_MODE :
+ memcpy(buf, resp45, 8);
+ break;
+ case CMD_QUERY_ACT :
+ memcpy(buf, resp46_00, 8);
+ break;
+ case CMD_QUERY_COMB :
+ memcpy(buf, resp47, 8);
+ break;
+ case CMD_QUERY_MODE :
+ memcpy(buf, resp4C_00, 8);
+ break;
+ case CMD_VIBRATION_TOGGLE :
+ memcpy(buf, resp4D, 8);
+ break;
+ case REQ40 :
+ memcpy(buf, resp40, 8);
+ break;
+ case REQ41 :
+ memcpy(buf, resp41, 8);
+ break;
+ case REQ49 :
+ memcpy(buf, resp49, 8);
+ break;
+ case REQ4A :
+ memcpy(buf, resp4A, 8);
+ break;
+ case REQ4B :
+ memcpy(buf, resp4B, 8);
+ break;
+ case REQ4E :
+ memcpy(buf, resp4E, 8);
+ break;
+ case REQ4F :
+ memcpy(buf, resp4F, 8);
+ break;
+ }
+}
+
+
+
+
+void reqIndex2Treatment(int padIndex, char value){
+ switch (req){
+ case CMD_CONFIG_MODE :
+ //0x43
+ if (value == 0) {
+ pad[padIndex].configMode = 0;
+ } else {
+ pad[padIndex].configMode = 1;
+ }
+ break;
+ case CMD_SET_MODE_AND_LOCK :
+ //0x44 store the led state for change mode if the next value = 0x02
+ //0x01 analog ON
+ //0x00 analog OFF
+ ledStateReq44[padIndex] = value;
+ break;
+ case CMD_QUERY_ACT :
+ //0x46
+ if (value == 1) {
+ memcpy(buf, resp46_01, 8);
+ }
+ break;
+ case CMD_QUERY_MODE :
+ if (value == 1) {
+ memcpy(buf, resp4C_01, 8);
+ }
+ break;
+ case CMD_VIBRATION_TOGGLE :
+ //0x4D
+ memcpy(buf, resp4D, 8);
+ break;
+ case CMD_READ_DATA_AND_VIBRATE:
+ //mem the vibration value for small motor;
+ pad[padIndex].Vib[0] = value;
+ break;
+ }
+}
+
+void vibrate(int padIndex){
+ if (pad[padIndex].Vib[0] != pad[padIndex].VibF[0] || pad[padIndex].Vib[1] != pad[padIndex].VibF[1]) {
+ //value is different update Value and call libretro for vibration
+ pad[padIndex].VibF[0] = pad[padIndex].Vib[0];
+ pad[padIndex].VibF[1] = pad[padIndex].Vib[1];
+ plat_trigger_vibrate(padIndex, pad[padIndex].VibF[0], pad[padIndex].VibF[1]);
+ //printf("vibration pad %i", padIndex);
+ }
+}
+
+
+
+
+//Build response for 0x42 request Pad in port
+void _PADstartPoll(PadDataS *pad) {
+ switch (pad->controllerType) {
+ case PSE_PAD_TYPE_MOUSE:
+ stdpar[0] = 0x12;
+ stdpar[2] = pad->buttonStatus & 0xff;
+ stdpar[3] = pad->buttonStatus >> 8;
+ stdpar[4] = pad->moveX;
+ stdpar[5] = pad->moveY;
+ memcpy(buf, stdpar, 6);
+ respSize = 6;
+ break;
+ case PSE_PAD_TYPE_NEGCON: // npc101/npc104(slph00001/slph00069)
+ stdpar[0] = 0x23;
+ stdpar[2] = pad->buttonStatus & 0xff;
+ stdpar[3] = pad->buttonStatus >> 8;
+ stdpar[4] = pad->rightJoyX;
+ stdpar[5] = pad->rightJoyY;
+ stdpar[6] = pad->leftJoyX;
+ stdpar[7] = pad->leftJoyY;
+ memcpy(buf, stdpar, 8);
+ respSize = 8;
+ break;
+ case PSE_PAD_TYPE_ANALOGPAD: // scph1150
+ stdpar[0] = 0x73;
+ stdpar[2] = pad->buttonStatus & 0xff;
+ stdpar[3] = pad->buttonStatus >> 8;
+ stdpar[4] = pad->rightJoyX;
+ stdpar[5] = pad->rightJoyY;
+ stdpar[6] = pad->leftJoyX;
+ stdpar[7] = pad->leftJoyY;
+ memcpy(buf, stdpar, 8);
+ respSize = 8;
+ break;
+ case PSE_PAD_TYPE_ANALOGJOY: // scph1110
+ stdpar[0] = 0x53;
+ stdpar[2] = pad->buttonStatus & 0xff;
+ stdpar[3] = pad->buttonStatus >> 8;
+ stdpar[4] = pad->rightJoyX;
+ stdpar[5] = pad->rightJoyY;
+ stdpar[6] = pad->leftJoyX;
+ stdpar[7] = pad->leftJoyY;
+ memcpy(buf, stdpar, 8);
+ respSize = 8;
+ break;
+ case PSE_PAD_TYPE_STANDARD:
+ default:
+ stdpar[0] = 0x41;
+ stdpar[2] = pad->buttonStatus & 0xff;
+ stdpar[3] = pad->buttonStatus >> 8;
+ //avoid analog value in multitap mode if change pad type in game.
+ stdpar[4] = 0xff;
+ stdpar[5] = 0xff;
+ stdpar[6] = 0xff;
+ stdpar[7] = 0xff;
+ memcpy(buf, stdpar, 8);
+ respSize = 8;
+ }
+}
+
+
+//Build response for 0x42 request Multitap in port
+//Response header for multitap : 0x80, 0x5A, (Pad information port 1-2A), (Pad information port 1-2B), (Pad information port 1-2C), (Pad information port 1-2D)
+void _PADstartPollMultitap(PadDataS* padd) {
+ int i, offset;
+ for(i = 0; i < 4; i++) {
+ offset = 2 + (i * 8);
+ _PADstartPoll(&padd[i]);
+ memcpy(multitappar+offset, stdpar, 8);
+ }
+ memcpy(bufMulti, multitappar, 34);
+ respSize = 34;
+}
+
+
+unsigned char _PADpoll(int port, unsigned char value) {
+ if (reqPos == 0) {
+ //mem the request number
+ req = value;
+ //copy the default value of request response in buffer instead of the keystate
+ initBufForRequest(port, value);
+ }
+
+ //if no new request the pad return 0xff, for signaling connected
+ if (reqPos >= respSize) return 0xff;
+
+ switch(reqPos){
+ case 2:
+ reqIndex2Treatment(port, value);
+ break;
+ case 3:
+ switch(req) {
+ case CMD_SET_MODE_AND_LOCK :
+ //change mode on pad
+ break;
+ case CMD_READ_DATA_AND_VIBRATE:
+ //mem the vibration value for Large motor;
+ pad[port].Vib[1] = value;
+ //vibration
+ vibrate(port);
+ break;
+ }
+ break;
+ }
+ return buf[reqPos++];
+}
+
+
+unsigned char _PADpollMultitap(int port, unsigned char value) {
+ if (reqPos >= respSize) return 0xff;
+ return bufMulti[reqPos++];
+}
+
+
+// refresh the button state on port 1.
+// int pad is not needed.
+unsigned char CALLBACK PAD1__startPoll(int pad) {
+ reqPos = 0;
+ // first call the pad provide if a multitap is connected between the psx and himself
+ if (multitap1 == -1) {
+ PadDataS padd;
+ padd.requestPadIndex = 0;
+ PAD1_readPort1(&padd);
+ multitap1 = padd.portMultitap;
+ }
+ // just one pad is on port 1 : NO MULTITAP
+ if (multitap1 == 0) {
+ PadDataS padd;
+ padd.requestPadIndex = 0;
+ PAD1_readPort1(&padd);
+ _PADstartPoll(&padd);
+ } else {
+ // a multitap is plugged : refresh all pad.
+ int i;
+ PadDataS padd[4];
+ for(i = 0; i < 4; i++) {
+ padd[i].requestPadIndex = i;
+ PAD1_readPort1(&padd[i]);
+ }
+ _PADstartPollMultitap(padd);
+ }
+ //printf("\npad 1 : ");
+ return 0x00;
+}
+
+unsigned char CALLBACK PAD1__poll(unsigned char value) {
+ char tmp;
+ if (multitap1 == 1) {
+ tmp = _PADpollMultitap(0, value);
+ } else {
+ tmp = _PADpoll(0, value);
+ }
+ //printf("%2x:%2x, ",value,tmp);
+ return tmp;
+
+}
+
+
+long CALLBACK PAD1__configure(void) { return 0; }
+void CALLBACK PAD1__about(void) {}
+long CALLBACK PAD1__test(void) { return 0; }
+long CALLBACK PAD1__query(void) { return 3; }
+long CALLBACK PAD1__keypressed() { return 0; }
+
+#define LoadPad1Sym1(dest, name) \
+ LoadSym(PAD1_##dest, PAD##dest, name, TRUE);
+
+#define LoadPad1SymN(dest, name) \
+ LoadSym(PAD1_##dest, PAD##dest, name, FALSE);
+
+#define LoadPad1Sym0(dest, name) \
+ LoadSym(PAD1_##dest, PAD##dest, name, FALSE); \
+ if (PAD1_##dest == NULL) PAD1_##dest = (PAD##dest) PAD1__##dest;
+
+static int LoadPAD1plugin(const char *PAD1dll) {
+ void *drv;
+
+ hPAD1Driver = SysLoadLibrary(PAD1dll);
+ if (hPAD1Driver == NULL) {
+ PAD1_configure = NULL;
+ SysMessage (_("Could not load Controller 1 plugin %s!"), PAD1dll); return -1;
+ }
+ drv = hPAD1Driver;
+ LoadPad1Sym1(init, "PADinit");
+ LoadPad1Sym1(shutdown, "PADshutdown");
+ LoadPad1Sym1(open, "PADopen");
+ LoadPad1Sym1(close, "PADclose");
+ LoadPad1Sym0(query, "PADquery");
+ LoadPad1Sym1(readPort1, "PADreadPort1");
+ LoadPad1Sym0(configure, "PADconfigure");
+ LoadPad1Sym0(test, "PADtest");
+ LoadPad1Sym0(about, "PADabout");
+ LoadPad1Sym0(keypressed, "PADkeypressed");
+ LoadPad1Sym0(startPoll, "PADstartPoll");
+ LoadPad1Sym0(poll, "PADpoll");
+ LoadPad1SymN(setSensitive, "PADsetSensitive");
+
+ return 0;
+}
+
+unsigned char CALLBACK PAD2__startPoll(int pad) {
+ int pad_index;
+
+ reqPos = 0;
+ if (multitap1 == 0 && (multitap2 == 0 || multitap2 == 2)) {
+ pad_index = 1;
+ } else if(multitap1 == 1 && (multitap2 == 0 || multitap2 == 2)) {
+ pad_index = 4;
+ } else {
+ pad_index = 0;
+ }
+
+ //first call the pad provide if a multitap is connected between the psx and himself
+ if (multitap2 == -1) {
+ PadDataS padd;
+ padd.requestPadIndex = pad_index;
+ PAD2_readPort2(&padd);
+ multitap2 = padd.portMultitap;
+ }
+
+ // just one pad is on port 1 : NO MULTITAP
+ if (multitap2 == 0) {
+ PadDataS padd;
+ padd.requestPadIndex = pad_index;
+ PAD2_readPort2(&padd);
+ _PADstartPoll(&padd);
+ } else {
+ // a multitap is plugged : refresh all pad.
+ int i;
+ PadDataS padd[4];
+ for(i = 0; i < 4; i++) {
+ padd[i].requestPadIndex = i+pad_index;
+ PAD2_readPort2(&padd[i]);
+ }
+ _PADstartPollMultitap(padd);
+ }
+ //printf("\npad 2 : ");
+ return 0x00;
+}
+
+unsigned char CALLBACK PAD2__poll(unsigned char value) {
+ char tmp;
+ if (multitap2 == 2) {
+ tmp = _PADpollMultitap(1, value);
+ } else {
+ tmp = _PADpoll(1, value);
+ }
+ //printf("%2x:%2x, ",value,tmp);
+ return tmp;
+}
+
+long CALLBACK PAD2__configure(void) { return 0; }
+void CALLBACK PAD2__about(void) {}
+long CALLBACK PAD2__test(void) { return 0; }
+long CALLBACK PAD2__query(void) { return PSE_PAD_USE_PORT1 | PSE_PAD_USE_PORT2; }
+long CALLBACK PAD2__keypressed() { return 0; }
+
+#define LoadPad2Sym1(dest, name) \
+ LoadSym(PAD2_##dest, PAD##dest, name, TRUE);
+
+#define LoadPad2Sym0(dest, name) \
+ LoadSym(PAD2_##dest, PAD##dest, name, FALSE); \
+ if (PAD2_##dest == NULL) PAD2_##dest = (PAD##dest) PAD2__##dest;
+
+#define LoadPad2SymN(dest, name) \
+ LoadSym(PAD2_##dest, PAD##dest, name, FALSE);
+
+static int LoadPAD2plugin(const char *PAD2dll) {
+ void *drv;
+
+ hPAD2Driver = SysLoadLibrary(PAD2dll);
+ if (hPAD2Driver == NULL) {
+ PAD2_configure = NULL;
+ SysMessage (_("Could not load Controller 2 plugin %s!"), PAD2dll); return -1;
+ }
+ drv = hPAD2Driver;
+ LoadPad2Sym1(init, "PADinit");
+ LoadPad2Sym1(shutdown, "PADshutdown");
+ LoadPad2Sym1(open, "PADopen");
+ LoadPad2Sym1(close, "PADclose");
+ LoadPad2Sym0(query, "PADquery");
+ LoadPad2Sym1(readPort2, "PADreadPort2");
+ LoadPad2Sym0(configure, "PADconfigure");
+ LoadPad2Sym0(test, "PADtest");
+ LoadPad2Sym0(about, "PADabout");
+ LoadPad2Sym0(keypressed, "PADkeypressed");
+ LoadPad2Sym0(startPoll, "PADstartPoll");
+ LoadPad2Sym0(poll, "PADpoll");
+ LoadPad2SymN(setSensitive, "PADsetSensitive");
+
+ return 0;
+}
+
+void *hNETDriver = NULL;
+
+void CALLBACK NET__setInfo(netInfo *info) {}
+void CALLBACK NET__keypressed(int key) {}
+long CALLBACK NET__configure(void) { return 0; }
+long CALLBACK NET__test(void) { return 0; }
+void CALLBACK NET__about(void) {}
+
+#define LoadNetSym1(dest, name) \
+ LoadSym(NET_##dest, NET##dest, name, TRUE);
+
+#define LoadNetSymN(dest, name) \
+ LoadSym(NET_##dest, NET##dest, name, FALSE);
+
+#define LoadNetSym0(dest, name) \
+ LoadSym(NET_##dest, NET##dest, name, FALSE); \
+ if (NET_##dest == NULL) NET_##dest = (NET##dest) NET__##dest;
+
+static int LoadNETplugin(const char *NETdll) {
+ void *drv;
+
+ hNETDriver = SysLoadLibrary(NETdll);
+ if (hNETDriver == NULL) {
+ SysMessage (_("Could not load NetPlay plugin %s!"), NETdll); return -1;
+ }
+ drv = hNETDriver;
+ LoadNetSym1(init, "NETinit");
+ LoadNetSym1(shutdown, "NETshutdown");
+ LoadNetSym1(open, "NETopen");
+ LoadNetSym1(close, "NETclose");
+ LoadNetSymN(sendData, "NETsendData");
+ LoadNetSymN(recvData, "NETrecvData");
+ LoadNetSym1(sendPadData, "NETsendPadData");
+ LoadNetSym1(recvPadData, "NETrecvPadData");
+ LoadNetSym1(queryPlayer, "NETqueryPlayer");
+ LoadNetSym1(pause, "NETpause");
+ LoadNetSym1(resume, "NETresume");
+ LoadNetSym0(setInfo, "NETsetInfo");
+ LoadNetSym0(keypressed, "NETkeypressed");
+ LoadNetSym0(configure, "NETconfigure");
+ LoadNetSym0(test, "NETtest");
+ LoadNetSym0(about, "NETabout");
+
+ return 0;
+}
+
+#ifdef ENABLE_SIO1API
+
+void *hSIO1Driver = NULL;
+
+long CALLBACK SIO1__init(void) { return 0; }
+long CALLBACK SIO1__shutdown(void) { return 0; }
+long CALLBACK SIO1__open(void) { return 0; }
+long CALLBACK SIO1__close(void) { return 0; }
+long CALLBACK SIO1__configure(void) { return 0; }
+long CALLBACK SIO1__test(void) { return 0; }
+void CALLBACK SIO1__about(void) {}
+void CALLBACK SIO1__pause(void) {}
+void CALLBACK SIO1__resume(void) {}
+long CALLBACK SIO1__keypressed(int key) { return 0; }
+void CALLBACK SIO1__writeData8(unsigned char val) {}
+void CALLBACK SIO1__writeData16(unsigned short val) {}
+void CALLBACK SIO1__writeData32(unsigned long val) {}
+void CALLBACK SIO1__writeStat16(unsigned short val) {}
+void CALLBACK SIO1__writeStat32(unsigned long val) {}
+void CALLBACK SIO1__writeMode16(unsigned short val) {}
+void CALLBACK SIO1__writeMode32(unsigned long val) {}
+void CALLBACK SIO1__writeCtrl16(unsigned short val) {}
+void CALLBACK SIO1__writeCtrl32(unsigned long val) {}
+void CALLBACK SIO1__writeBaud16(unsigned short val) {}
+void CALLBACK SIO1__writeBaud32(unsigned long val) {}
+unsigned char CALLBACK SIO1__readData8(void) { return 0; }
+unsigned short CALLBACK SIO1__readData16(void) { return 0; }
+unsigned long CALLBACK SIO1__readData32(void) { return 0; }
+unsigned short CALLBACK SIO1__readStat16(void) { return 0; }
+unsigned long CALLBACK SIO1__readStat32(void) { return 0; }
+unsigned short CALLBACK SIO1__readMode16(void) { return 0; }
+unsigned long CALLBACK SIO1__readMode32(void) { return 0; }
+unsigned short CALLBACK SIO1__readCtrl16(void) { return 0; }
+unsigned long CALLBACK SIO1__readCtrl32(void) { return 0; }
+unsigned short CALLBACK SIO1__readBaud16(void) { return 0; }
+unsigned long CALLBACK SIO1__readBaud32(void) { return 0; }
+void CALLBACK SIO1__registerCallback(void (CALLBACK *callback)(void)) {};
+
+void CALLBACK SIO1irq(void) {
+ psxHu32ref(0x1070) |= SWAPu32(0x100);
+}
+
+#define LoadSio1Sym1(dest, name) \
+ LoadSym(SIO1_##dest, SIO1##dest, name, TRUE);
+
+#define LoadSio1SymN(dest, name) \
+ LoadSym(SIO1_##dest, SIO1##dest, name, FALSE);
+
+#define LoadSio1Sym0(dest, name) \
+ LoadSym(SIO1_##dest, SIO1##dest, name, FALSE); \
+ if (SIO1_##dest == NULL) SIO1_##dest = (SIO1##dest) SIO1__##dest;
+
+static int LoadSIO1plugin(const char *SIO1dll) {
+ void *drv;
+
+ hSIO1Driver = SysLoadLibrary(SIO1dll);
+ if (hSIO1Driver == NULL) {
+ SysMessage (_("Could not load SIO1 plugin %s!"), SIO1dll); return -1;
+ }
+ drv = hSIO1Driver;
+
+ LoadSio1Sym0(init, "SIO1init");
+ LoadSio1Sym0(shutdown, "SIO1shutdown");
+ LoadSio1Sym0(open, "SIO1open");
+ LoadSio1Sym0(close, "SIO1close");
+ LoadSio1Sym0(pause, "SIO1pause");
+ LoadSio1Sym0(resume, "SIO1resume");
+ LoadSio1Sym0(keypressed, "SIO1keypressed");
+ LoadSio1Sym0(configure, "SIO1configure");
+ LoadSio1Sym0(test, "SIO1test");
+ LoadSio1Sym0(about, "SIO1about");
+ LoadSio1Sym0(writeData8, "SIO1writeData8");
+ LoadSio1Sym0(writeData16, "SIO1writeData16");
+ LoadSio1Sym0(writeData32, "SIO1writeData32");
+ LoadSio1Sym0(writeStat16, "SIO1writeStat16");
+ LoadSio1Sym0(writeStat32, "SIO1writeStat32");
+ LoadSio1Sym0(writeMode16, "SIO1writeMode16");
+ LoadSio1Sym0(writeMode32, "SIO1writeMode32");
+ LoadSio1Sym0(writeCtrl16, "SIO1writeCtrl16");
+ LoadSio1Sym0(writeCtrl32, "SIO1writeCtrl32");
+ LoadSio1Sym0(writeBaud16, "SIO1writeBaud16");
+ LoadSio1Sym0(writeBaud32, "SIO1writeBaud32");
+ LoadSio1Sym0(readData16, "SIO1readData16");
+ LoadSio1Sym0(readData32, "SIO1readData32");
+ LoadSio1Sym0(readStat16, "SIO1readStat16");
+ LoadSio1Sym0(readStat32, "SIO1readStat32");
+ LoadSio1Sym0(readMode16, "SIO1readMode16");
+ LoadSio1Sym0(readMode32, "SIO1readMode32");
+ LoadSio1Sym0(readCtrl16, "SIO1readCtrl16");
+ LoadSio1Sym0(readCtrl32, "SIO1readCtrl32");
+ LoadSio1Sym0(readBaud16, "SIO1readBaud16");
+ LoadSio1Sym0(readBaud32, "SIO1readBaud32");
+ LoadSio1Sym0(registerCallback, "SIO1registerCallback");
+
+ return 0;
+}
+
+#endif
+
+void CALLBACK clearDynarec(void) {
+ psxCpu->Reset();
+}
+
+int LoadPlugins() {
+ int ret;
+ char Plugin[MAXPATHLEN];
+
+ ReleasePlugins();
+ SysLibError();
+
+ if (UsingIso()) {
+ LoadCDRplugin(NULL);
+ } else {
+ sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Cdr);
+ if (LoadCDRplugin(Plugin) == -1) return -1;
+ }
+
+ sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Gpu);
+ if (LoadGPUplugin(Plugin) == -1) return -1;
+
+ sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Spu);
+ if (LoadSPUplugin(Plugin) == -1) return -1;
+
+ sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Pad1);
+ if (LoadPAD1plugin(Plugin) == -1) return -1;
+
+ sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Pad2);
+ if (LoadPAD2plugin(Plugin) == -1) return -1;
+
+ if (strcmp("Disabled", Config.Net) == 0 || strcmp("", Config.Net) == 0)
+ Config.UseNet = FALSE;
+ else {
+ Config.UseNet = TRUE;
+ sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Net);
+ if (LoadNETplugin(Plugin) == -1) Config.UseNet = FALSE;
+ }
+
+#ifdef ENABLE_SIO1API
+ sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Sio1);
+ if (LoadSIO1plugin(Plugin) == -1) return -1;
+#endif
+
+ ret = CDR_init();
+ if (ret < 0) { SysMessage (_("Error initializing CD-ROM plugin: %d"), ret); return -1; }
+ ret = GPU_init();
+ if (ret < 0) { SysMessage (_("Error initializing GPU plugin: %d"), ret); return -1; }
+ ret = SPU_init();
+ if (ret < 0) { SysMessage (_("Error initializing SPU plugin: %d"), ret); return -1; }
+ ret = PAD1_init(1);
+ if (ret < 0) { SysMessage (_("Error initializing Controller 1 plugin: %d"), ret); return -1; }
+ ret = PAD2_init(2);
+ if (ret < 0) { SysMessage (_("Error initializing Controller 2 plugin: %d"), ret); return -1; }
+
+ if (Config.UseNet) {
+ ret = NET_init();
+ if (ret < 0) { SysMessage (_("Error initializing NetPlay plugin: %d"), ret); return -1; }
+ }
+
+#ifdef ENABLE_SIO1API
+ ret = SIO1_init();
+ if (ret < 0) { SysMessage (_("Error initializing SIO1 plugin: %d"), ret); return -1; }
+#endif
+
+ SysPrintf(_("Plugins loaded.\n"));
+ return 0;
+}
+
+void ReleasePlugins() {
+ if (Config.UseNet) {
+ int ret = NET_close();
+ if (ret < 0) Config.UseNet = FALSE;
+ }
+ NetOpened = FALSE;
+
+ if (hCDRDriver != NULL || cdrIsoActive()) CDR_shutdown();
+ if (hGPUDriver != NULL) GPU_shutdown();
+ if (hSPUDriver != NULL) SPU_shutdown();
+ if (hPAD1Driver != NULL) PAD1_shutdown();
+ if (hPAD2Driver != NULL) PAD2_shutdown();
+
+ if (Config.UseNet && hNETDriver != NULL) NET_shutdown();
+
+ if (hCDRDriver != NULL) SysCloseLibrary(hCDRDriver); hCDRDriver = NULL;
+ if (hGPUDriver != NULL) SysCloseLibrary(hGPUDriver); hGPUDriver = NULL;
+ if (hSPUDriver != NULL) SysCloseLibrary(hSPUDriver); hSPUDriver = NULL;
+ if (hPAD1Driver != NULL) SysCloseLibrary(hPAD1Driver); hPAD1Driver = NULL;
+ if (hPAD2Driver != NULL) SysCloseLibrary(hPAD2Driver); hPAD2Driver = NULL;
+
+ if (Config.UseNet && hNETDriver != NULL) {
+ SysCloseLibrary(hNETDriver); hNETDriver = NULL;
+ }
+
+#ifdef ENABLE_SIO1API
+ if (hSIO1Driver != NULL) {
+ SIO1_shutdown();
+ SysCloseLibrary(hSIO1Driver);
+ hSIO1Driver = NULL;
+ }
+#endif
+}
+
+// for CD swap
+int ReloadCdromPlugin()
+{
+ if (hCDRDriver != NULL || cdrIsoActive()) CDR_shutdown();
+ if (hCDRDriver != NULL) SysCloseLibrary(hCDRDriver); hCDRDriver = NULL;
+
+ if (UsingIso()) {
+ LoadCDRplugin(NULL);
+ } else {
+ char Plugin[MAXPATHLEN];
+ sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Cdr);
+ if (LoadCDRplugin(Plugin) == -1) return -1;
+ }
+
+ return CDR_init();
+}
+
+void SetIsoFile(const char *filename) {
+ if (filename == NULL) {
+ IsoFile[0] = '\0';
+ return;
+ }
+ strncpy(IsoFile, filename, MAXPATHLEN);
+}
+
+const char *GetIsoFile(void) {
+ return IsoFile;
+}
+
+boolean UsingIso(void) {
+ return (IsoFile[0] != '\0');
+}
+
+void SetCdOpenCaseTime(s64 time) {
+ cdOpenCaseTime = time;
+}
#include "psxbios.h"
#include "psxhw.h"
#include "gpu.h"
+#include "sio.h"
#include <zlib.h>
#undef SysPrintf
static TCB Thread[8];
static int CurThread = 0;
static FileDesc FDesc[32];
-static u32 card_active_chan;
+static u32 card_active_chan = 0;
boolean hleSoftCall = FALSE;
}
void psxBios__card_info() { // ab
+ u8 ret, port;
#ifdef PSXBIOS_LOG
PSXBIOS_LOG("psxBios_%s: %x\n", biosA0n[0xab], a0);
#endif
card_active_chan = a0;
+ port = card_active_chan >> 4;
+
+ switch (port) {
+ case 0x0:
+ case 0x1:
+ ret = 0x2;
+ if (McdDisable[port & 1])
+ ret = 0x8;
+ break;
+ default:
+#ifdef PSXBIOS_LOG
+ PSXBIOS_LOG("psxBios_%s: UNKNOWN PORT 0x%x\n", biosA0n[0xab], card_active_chan);
+#endif
+ ret = 0x11;
+ break;
+ }
+
+ if (McdDisable[0] && McdDisable[1])
+ ret = 0x8;
// DeliverEvent(0x11, 0x2); // 0xf0000011, 0x0004
- DeliverEvent(0x81, 0x2); // 0xf4000001, 0x0004
+// DeliverEvent(0x81, 0x2); // 0xf4000001, 0x0004
+ DeliverEvent(0x81, ret); // 0xf4000001, 0x0004
v0 = 1; pc0 = ra;
}
pc0 = ra;
}
+void psxBios__card_status() { // 5c
+#ifdef PSXBIOS_LOG
+ PSXBIOS_LOG("psxBios_%s: %x\n", biosB0n[0x5c], a0);
+#endif
+
+ v0 = 1;
+ pc0 = ra;
+}
+
/* System calls C0 */
/*
//biosB0[0x59] = psxBios_sys_b0_59;
//biosB0[0x5a] = psxBios_sys_b0_5a;
biosB0[0x5b] = psxBios_ChangeClearPad;
- //biosB0[0x5c] = psxBios__card_status;
+ biosB0[0x5c] = psxBios__card_status;
//biosB0[0x5d] = psxBios__card_wait;
//*******************C0 CALLS****************************
//biosC0[0x00] = psxBios_InitRCnt;
CardState = -1;
CurThread = 0;
memset(FDesc, 0, sizeof(FDesc));
+ card_active_chan = 0;
psxMu32ref(0x0150) = SWAPu32(0x160);
psxMu32ref(0x0154) = SWAPu32(0x320);
boolean PsxAuto;
boolean Cdda;
boolean HLE;
+ boolean SlowBoot;
boolean Debug;
boolean PsxOut;
boolean SpuIrq;
void psxReset() {
psxMemReset();
- memset(&psxRegs, 0, sizeof(psxRegs));
+ memset(&psxRegs, 0x00, sizeof(psxRegs));
psxRegs.pc = 0xbfc00000; // Start in bootstrap
break;
}
}
+ // NegCon - Wipeout 3
+ if( buf[parp] == 0x23 ) {
+ switch (value) {
+ // enter config mode
+ case 0x43:
+ buf[1] = 0x79;
+ break;
+
+ // get status
+ case 0x45:
+ buf[1] = 0xf3;
+ break;
+ }
+ }
}
else padst = 0;
return;
}
McdDisable[mcd - 1] = 0;
+#ifdef HAVE_LIBRETRO
+ // memcard1 is handled by libretro
+ if (mcd == 1)
+ return;
+#endif
+
if (str == NULL || strcmp(str, "none") == 0) {
McdDisable[mcd - 1] = 1;
return;
#define MCD_SIZE (1024 * 8 * 16)
extern char Mcd1Data[MCD_SIZE], Mcd2Data[MCD_SIZE];
+extern char McdDisable[2];
void sioWrite8(unsigned char value);
void sioWriteStat16(unsigned short value);
* along with this program; if not, see <http://www.gnu.org/licenses>.
*/
+#ifdef NO_SOCKET
+
+int StartServer() { return 0;}
+void StopServer() {}
+void GetClient() {}
+void CloseClient() {}
+int HasClient() { return 0;}
+int ReadSocket(char * buffer, int len) { return 0;}
+int RawReadSocket(char * buffer, int len) { return 0;}
+void WriteSocket(char * buffer, int len) {}
+
+void SetsBlock() {}
+void SetsNonblock() {}
+
+#else // NO_SOCKET
+
#ifdef _WIN32
#include <winsock2.h>
#endif
fcntl(server_socket, F_SETFL, flags | O_NONBLOCK);
#endif
}
+#endif // NO_SOCKET
+++ /dev/null
-#include <gtk/gtk.h>
-#include <glib.h>
-#include <stdlib.h>
-#include <stdint.h>
-#include <unistd.h>
-#include <hildon/hildon.h>
-#include <string.h>
-#include <pthread.h>
-
-#include "../frontend/plugin_lib.h"
-#include "../frontend/main.h"
-#include "../libpcsxcore/misc.h"
-#include "../include/psemu_plugin_defs.h"
-#include "../libpcsxcore/cdrom.h"
-#include "../libpcsxcore/cdriso.h"
-#include "../plugins/dfinput/main.h"
-#include "../frontend/libpicofe/readpng.h"
-#include "maemo_common.h"
-#include <libosso.h>
-#include <dbus/dbus.h>
-
-#define X_RES 800
-#define Y_RES 480
-#define D_WIDTH 640
-#define D_HEIGHT 480
-
-#define CALL_SIGNAL_IF "com.nokia.csd.Call"
-#define CALL_SIGNAL_PATH "/com/nokia/csd/call"
-#define CALL_INCOMING_SIG "Coming"
-
-#define DBUS_RULE_CALL_INCOMING "type='signal',interface='" CALL_SIGNAL_IF \
- "',path='" CALL_SIGNAL_PATH \
- "',member='" CALL_INCOMING_SIG "'"
-
-osso_context_t* osso = NULL;
-int bRunning = TRUE;
-extern int bKeepDisplayOn;
-extern int bAutosaveOnExit;
-extern int cornerActions[4];
-extern char keys_config_file[MAXPATHLEN];
-static pthread_t display_thread = (pthread_t)0;
-int g_layer_x = (X_RES - D_WIDTH) / 2;
-int g_layer_y = (Y_RES - D_HEIGHT) / 2;
-int g_layer_w = D_WIDTH, g_layer_h = D_HEIGHT;
-
-static GdkImage *image;
-static HildonAnimationActor *actor;
-static GtkWidget *window, *drawing = NULL;
-
-static int pl_buf_w, pl_buf_h;
-int keymap[65536];
-int direction_keys[4];
-
-// map psx4m compatible keymap to PSX keys
-static const unsigned char keymap2[14] = {
- DKEY_LEFT, // 0
- DKEY_RIGHT,
- DKEY_UP,
- DKEY_DOWN,
- DKEY_CIRCLE,
- DKEY_CROSS, // 5
- DKEY_TRIANGLE,
- DKEY_SQUARE,
- DKEY_SELECT,
- DKEY_START,
- DKEY_L1, // 10
- DKEY_R1,
- DKEY_L2,
- DKEY_R2,
-};
-
-void hildon_quit()
-{
- maemo_finish();
- gtk_main_quit();
- exit(0);
-}
-
-gdouble press_x = -1;
-gdouble press_y = -1;
-
-int maemo_x11_update_keys();
-void show_notification(char* text);
-
-void change_slot(int delta)
-{
- state_slot += delta;
- if (state_slot > 9)
- state_slot = 0;
- else if (state_slot < 0)
- state_slot = 9;
- char message[50];
- sprintf(message,"Savestate slot: %i",state_slot + 1);
- show_notification(message);
-}
-
-void save(int state_slot)
-{
- emu_save_state(state_slot);
- char buf[MAXPATHLEN];
- if (image && image->mem){
- sprintf (buf,"/opt/maemo/usr/games/screenshots%s.%3.3d",file_name,state_slot);
- writepng(buf, image->mem, pl_buf_w,pl_buf_h);
- }
- char message[50];
- sprintf(message,"Saved savestate slot: %i",state_slot + 1);
- show_notification(message);
-}
-
-void quit()
-{
- if (bAutosaveOnExit){
- show_notification("Autosaving");
- emu_save_state(99);
- char buf[MAXPATHLEN];
- if (image && image->mem){
- sprintf (buf,"/opt/maemo/usr/games/screenshots%s.%3.3d",file_name,99);
- writepng(buf, image->mem, pl_buf_w,pl_buf_h);
- }
- }
- hildon_quit();
-}
-
-int show_confirmbox(char* text)
-{
- if (!window)
- return TRUE;
-
- GtkWidget *dialog;
- dialog = gtk_message_dialog_new (GTK_WINDOW(window),
- GTK_DIALOG_DESTROY_WITH_PARENT,
- GTK_MESSAGE_QUESTION,
- GTK_BUTTONS_YES_NO,
- text);
- gint result = gtk_dialog_run (GTK_DIALOG (dialog));
- gtk_widget_destroy (dialog);
- if (result == GTK_RESPONSE_YES)
- return TRUE;
- return FALSE;
-}
-
-static void
-window_button_proxy(GtkWidget *widget,
- GdkEventButton *event,
- gpointer user_data)
-{
- int corner = -1;
- int sens = 100;
-
- switch (event->type){
- case GDK_BUTTON_PRESS:
- //printf("GDK_BUTTON_PRESS: x=%f y=%f\n", event->x, event->y);
- press_x = event->x;
- press_y = event->y;
- break;
- case GDK_BUTTON_RELEASE:
- //printf("GDK_BUTTON_RELEASE: x=%f y=%f\n", event->x, event->y);
- if (press_x < sens && press_y < sens && event->x < sens && event->y < sens)
- corner = 0;
- else if (press_x > 800 - sens && press_y < sens && event->x > 800 - sens && event->y < sens)
- corner = 1;
- else if (press_x > 800 - sens && press_y > 480 - sens && event->x > 800 - sens && event->y > 480 - sens)
- corner = 2;
- else if (press_x < sens && press_y > 480 - sens && event->x < sens && event->y > 480 - sens)
- corner = 3;
-
- press_x = -1;
- press_y = -1;
- break;
- default:
- break;
- }
-
- if (corner >= 0){
- switch (cornerActions[corner]){
- case 1:
- if (show_confirmbox("Save savestate?"))
- save(state_slot);
- break;
- case 2:
- if (show_confirmbox("Load savestate?"))
- emu_load_state(state_slot);
- break;
- case 3:
- change_slot(1);
- break;
- case 4:
- change_slot(-1);
- break;
- case 5:
- if (show_confirmbox("Quit?"))
- quit();
- break;
- }
- }
-}
-
-static void *displayThread(void *arg)
-{
- DBusConnection* system_bus = (DBusConnection*)osso_get_sys_dbus_connection(osso);
- DBusMessage* msg = dbus_message_new_method_call("com.nokia.mce",
- "/com/nokia/mce/request",
- "com.nokia.mce.request",
- "req_display_blanking_pause");
- if (msg && system_bus) {
- bRunning = TRUE;
- while (bRunning) {
- dbus_connection_send(system_bus, msg, NULL);
- dbus_connection_flush(system_bus);
- int i = 0;
- for (i=0; i<8; i++){
- usleep(500000);
- if (!bRunning)
- break;
- }
- }
- dbus_message_unref(msg);
- }
-
- pthread_exit(0);
- return NULL;
-}
-
-void show_notification(char* text)
-{
- if (window){
- GtkWidget* banner = hildon_banner_show_information(GTK_WIDGET(window), NULL, text);
- hildon_banner_set_timeout(HILDON_BANNER(banner), 3000);
- }else{
- DBusConnection* session_bus = (DBusConnection*)osso_get_dbus_connection(osso);
- DBusMessageIter args;
- DBusMessage*msg = dbus_message_new_method_call("org.freedesktop.Notifications",
- "/org/freedesktop/Notifications",
- "org.freedesktop.Notifications",
- "SystemNoteInfoprint");
- if (msg) {
- dbus_message_iter_init_append(msg, &args);
- char* param = text;
- if (dbus_message_iter_append_basic(&args, DBUS_TYPE_STRING, ¶m)) {
- dbus_connection_send(session_bus, msg, NULL);
- dbus_connection_flush(session_bus);
- }
- dbus_message_unref(msg);
- }
- }
-}
-
-void show_messagebox(char* text)
-{
- if (!window)
- return;
-
- GtkWidget *dialog;
- dialog = gtk_message_dialog_new (GTK_WINDOW(window),
- GTK_DIALOG_DESTROY_WITH_PARENT,
- GTK_MESSAGE_INFO,
- GTK_BUTTONS_OK,
- text);
- gtk_dialog_run (GTK_DIALOG (dialog));
- gtk_widget_destroy (dialog);
-}
-
-#include <hildon/hildon-file-chooser-dialog.h>
-void change_disc()
-{
- GtkWidget *dialog;
- dialog = hildon_file_chooser_dialog_new (GTK_WINDOW(window), GTK_FILE_CHOOSER_ACTION_OPEN);
- gtk_window_set_title (GTK_WINDOW (dialog), "Change disc");
-
- char currentFile[MAXPATHLEN];
- strcpy(currentFile, GetIsoFile());
- if (strlen(currentFile))
- gtk_file_chooser_set_filename (GTK_FILE_CHOOSER(dialog), currentFile);
- else
- gtk_file_chooser_set_current_folder (GTK_FILE_CHOOSER(dialog), "/home/user/MyDocs/");
-
- GtkFileFilter *filter=gtk_file_filter_new();
- gtk_file_filter_add_pattern (filter,"*.bin");
- gtk_file_filter_add_pattern (filter,"*.BIN");
- gtk_file_filter_add_pattern (filter,"*.iso");
- gtk_file_filter_add_pattern (filter,"*.ISO");
- gtk_file_filter_add_pattern (filter,"*.img");
- gtk_file_filter_add_pattern (filter,"*.IMG");
- gtk_file_filter_add_pattern (filter,"*.z");
- gtk_file_filter_add_pattern (filter,"*.Z");
- gtk_file_filter_add_pattern (filter,"*.znx");
- gtk_file_filter_add_pattern (filter,"*.ZNX");
- gtk_file_filter_add_pattern (filter,"*.pbp");
- gtk_file_filter_add_pattern (filter,"*.PBP");
- gtk_file_filter_add_pattern (filter,"*.mdf");
- gtk_file_filter_add_pattern (filter,"*.MDF");
- gtk_file_chooser_set_filter (GTK_FILE_CHOOSER (dialog),filter);
-
- if (gtk_dialog_run (GTK_DIALOG (dialog)) == GTK_RESPONSE_OK) {
- char *filename = gtk_file_chooser_get_filename (GTK_FILE_CHOOSER (dialog));
-
- //if (strcmp(filename, currentFile)) {
- CdromId[0] = '\0';
- CdromLabel[0] = '\0';
-
- set_cd_image(filename);
- if (ReloadCdromPlugin() < 0)
- printf("Failed to load cdr plugin\n");
-
- if (CDR_open() < 0)
- printf("Failed to open cdr plugin\n");
-
- strcpy(file_name, strrchr(filename,'/'));
-
- SetCdOpenCaseTime(time(NULL) + 3);
- LidInterrupt();
- //}
- g_free (filename);
- }
-
- gtk_widget_destroy (dialog);
-}
-
-void change_multi_disc()
-{
- HildonDialog* window = HILDON_DIALOG(hildon_dialog_new());
- gtk_window_set_title (GTK_WINDOW (window), "Change disc");
- gtk_window_set_default_size(GTK_WINDOW (window), 480, 300);
-
- GtkWidget* sw = hildon_pannable_area_new ();
- gtk_box_pack_start (GTK_BOX(GTK_DIALOG(window)->vbox), sw, TRUE, TRUE, 0);
-
- GtkWidget* tree_view = hildon_gtk_tree_view_new (HILDON_UI_MODE_EDIT);
- gtk_widget_set_name (tree_view, "fremantle-widget");
-
- gtk_tree_view_set_rules_hint (GTK_TREE_VIEW (tree_view), TRUE);
-
- int i;
- GtkListStore *store = gtk_list_store_new (1, G_TYPE_STRING);
- for (i = 0; i < cdrIsoMultidiskCount; i++) {
- gchar *str;
-
- str = g_strdup_printf ("Disc %d", i+1);
- gtk_list_store_insert_with_values (store, NULL, i, 0, str, -1);
- g_free (str);
- }
- GtkTreeModel* model = GTK_TREE_MODEL (store);
-
- gtk_tree_view_set_model (GTK_TREE_VIEW (tree_view), model);
- g_object_unref (model);
-
- GtkTreeSelection* selection = gtk_tree_view_get_selection (GTK_TREE_VIEW (tree_view));
- gtk_tree_selection_set_mode (selection, GTK_SELECTION_SINGLE);
-
- GtkCellRenderer* renderer = gtk_cell_renderer_text_new ();
- g_object_set (renderer,
- "xalign", 0.5,
- "weight", PANGO_WEIGHT_NORMAL,
- NULL);
-
- gtk_tree_view_insert_column_with_attributes (GTK_TREE_VIEW (tree_view),
- 0, "Column 0",
- renderer,
- "text", 0,
- NULL);
-
- char current[5];
- sprintf(current, "%i", cdrIsoMultidiskSelect);
- GtkTreePath* path = gtk_tree_path_new_from_string(current);
- gtk_tree_selection_select_path (selection, path);
- gtk_tree_path_free(path);
-
- gtk_widget_set_size_request (tree_view, 480, 800);
- gtk_container_add (GTK_CONTAINER (sw), tree_view);
-
- hildon_dialog_add_button (HILDON_DIALOG(window), GTK_STOCK_OK, GTK_RESPONSE_ACCEPT);
-
- gtk_widget_show_all (GTK_WIDGET(window));
- gint result = gtk_dialog_run (GTK_DIALOG (window));
- if (result == GTK_RESPONSE_ACCEPT) {
- GtkTreeModel* model;
- GtkTreeIter iter;
- GtkTreeSelection* selection = gtk_tree_view_get_selection(GTK_TREE_VIEW(tree_view));
- if (gtk_tree_selection_get_selected(selection, &model, &iter)){
- GtkTreePath* path = gtk_tree_model_get_path(model , &iter);
- int* i = gtk_tree_path_get_indices(path) ;
-
- cdrIsoMultidiskSelect = *i;
- CdromId[0] = '\0';
- CdromLabel[0] = '\0';
-
- CDR_close();
- if (CDR_open() < 0) {
- printf("Failed to load cdr plugin\n");
- return;
- }
-
- SetCdOpenCaseTime(time(NULL) + 3);
- LidInterrupt();
- }
- }
- gtk_widget_destroy(GTK_WIDGET(window));
-}
-
-static DBusHandlerResult on_msg_recieved(DBusConnection* connection G_GNUC_UNUSED, DBusMessage* message, void* data)
-{
- const char* path = dbus_message_get_path(message);
- if (path && g_str_equal(path, CALL_SIGNAL_PATH)){
- const char* mbr = dbus_message_get_member(message);
- if (mbr && g_str_equal(mbr, CALL_INCOMING_SIG))
- show_messagebox("Paused");
- }
-
- return DBUS_HANDLER_RESULT_NOT_YET_HANDLED;
-}
-
-static void
-window_key_proxy(GtkWidget *widget,
- GdkEventKey *event,
- gpointer user_data)
-{
- key_press_event(event->hardware_keycode, event->type == GDK_KEY_PRESS ? 1 : (event->type == GDK_KEY_RELEASE ? 2 : 0) );
-}
-
-int last_key_pressed = 0;
-inline void key_press_event(int key2,int type)
-{
- int psxkey1 = -1, psxkey2 = -1;
- int key=keymap[key2];
-
- if (key < 0)
- return;
-
- if (type == 1 && key2 == last_key_pressed)
- return;
- last_key_pressed = type == 1 ? key2 : 0;
-
- //printf("Key: %i %s\n", key2, type == 1 ? "Pressed" : (type == 2 ? "Released" : "Unknown"));
- if (key < ARRAY_SIZE(keymap2)){
- psxkey1 = keymap2[key];
- }else switch (key) {
- case 14:
- quit();
- break;
- case 15:
- psxkey1 = DKEY_UP;
- psxkey2 = DKEY_LEFT;
- break;
- case 16:
- psxkey1 = DKEY_UP;
- psxkey2 = DKEY_RIGHT;
- break;
- case 17:
- psxkey1 = DKEY_DOWN;
- psxkey2 = DKEY_LEFT;
- break;
- case 18:
- psxkey1 = DKEY_DOWN;
- psxkey2 = DKEY_RIGHT;
- break;
- case 19:
- if (type == 1)
- save(state_slot);
- return;
- case 20:
- if (type == 1)
- emu_load_state(state_slot);
- return;
- case 21:
- if (type == 1)
- change_slot(1);
- return;
- case 22:
- if (type == 1)
- change_slot(-1);
- return;
- case 23:
- if (type == 1){
- if (cdrIsoMultidiskCount > 1)
- change_multi_disc();
- else
- change_disc();
- }
- return;
- }
-
- if (in_type1 == PSE_PAD_TYPE_GUNCON){
- if (type == 1) {
- switch (psxkey1){
- case DKEY_CROSS:
- in_state_gun |= SACTION_GUN_A;
- break;
- case DKEY_CIRCLE:
- in_state_gun |= SACTION_GUN_B;
- break;
- case DKEY_TRIANGLE:
- in_state_gun |= SACTION_GUN_TRIGGER2;
- break;
- case DKEY_SQUARE:
- in_state_gun |= SACTION_GUN_TRIGGER;
- break;
- }
- }else if (type == 2) {
- switch (psxkey1){
- case DKEY_CROSS:
- in_state_gun &= ~SACTION_GUN_A;
- break;
- case DKEY_CIRCLE:
- in_state_gun &= ~SACTION_GUN_B;
- break;
- case DKEY_TRIANGLE:
- in_state_gun &= ~SACTION_GUN_TRIGGER2;
- break;
- case DKEY_SQUARE:
- in_state_gun &= ~SACTION_GUN_TRIGGER;
- break;
- }
- }
- }else{
- if (type == 1) {
- if (psxkey1 >= 0)
- in_keystate |= 1 << psxkey1;
- if (psxkey2 >= 0)
- in_keystate |= 1 << psxkey2;
-
- if (in_type1 == PSE_PAD_TYPE_ANALOGPAD){
- switch(psxkey1){
- case DKEY_LEFT:
- in_a1[0] = 0;
- break;
- case DKEY_RIGHT:
- in_a1[0] = 255;
- break;
- case DKEY_UP:
- in_a1[1] = 0;
- break;
- case DKEY_DOWN:
- in_a1[1] = 255;
- break;
- }
- }
- }
- else if (type == 2) {
- if (psxkey1 >= 0)
- in_keystate &= ~(1 << psxkey1);
- if (psxkey2 >= 0)
- in_keystate &= ~(1 << psxkey2);
-
- if (in_type1 == PSE_PAD_TYPE_ANALOGPAD){
- switch(psxkey1){
- case DKEY_LEFT:
- case DKEY_RIGHT:
- in_a1[0] = 127;
- break;
- case DKEY_UP:
- case DKEY_DOWN:
- in_a1[1] = 127;
- break;
- }
- }
- emu_set_action(SACTION_NONE);
- }
- }
-}
-
-void plat_finish()
-{
- hildon_quit();
-}
-
-void set_accel_multipliers()
-{
- accelOptions.xMultiplier = 255.0 / ( (accelOptions.maxValue - accelOptions.sens) * 2.0);
- accelOptions.yMultiplier = 255.0 / ( (accelOptions.maxValue - accelOptions.sens) * 2.0);
-}
-
-#include <gdk/gdkx.h>
-int maemo_init(int *argc, char ***argv)
-{
- osso = osso_initialize("pcsxrearmed", PACKAGE_VERSION, FALSE, NULL);
-
- DBusConnection* system_bus = (DBusConnection*)osso_get_sys_dbus_connection(osso);
- dbus_bus_add_match(system_bus, DBUS_RULE_CALL_INCOMING, NULL);
- dbus_connection_add_filter(system_bus, on_msg_recieved, NULL, NULL);
-
- FILE* pFile;
- pFile = fopen(keys_config_file, "r");
- if (pFile == NULL){
- fprintf(stderr, "Error opening keys config file %s\n", keys_config_file);
- return 1;
- }
- printf("Keys config read from %s\n", keys_config_file);
-
- int ch;
- int i=0;
- for (i=0;i<65536;i++)
- keymap[i]=-1;
- if (NULL != pFile) {
- for(i=0;i<24;i++){
- fscanf(pFile, "%i",&ch);
- keymap[ch]=i;
- if (i < 4)
- direction_keys[i] = ch;
- }
- fclose(pFile);
- }
-
- switch (in_type1){
- case PSE_PAD_TYPE_GUNCON:
- memset(cornerActions, 0, sizeof(cornerActions));
- printf("Controller set to GUNCON (SLPH-00034)\n");
- break;
- case PSE_PAD_TYPE_STANDARD:
- printf("Controller set to standard (SCPH-1080)\n");
- break;
- case PSE_PAD_TYPE_ANALOGPAD:
- printf("Controller set to analog (SCPH-1150)\n");
- break;
- }
-
- if (in_enable_vibration)
- printf("Vibration enabled\n");
-
- if (!(g_maemo_opts&8)){
- gtk_init (argc, argv);
-
- window = hildon_stackable_window_new ();
- gtk_widget_realize (window);
- gtk_window_fullscreen (GTK_WINDOW(window));
-
- if (cornerActions[0] + cornerActions[1] + cornerActions[2] + cornerActions[3] > 0){
- g_signal_connect (G_OBJECT (window), "button_release_event",
- G_CALLBACK (window_button_proxy), NULL);
- g_signal_connect (G_OBJECT (window), "button_press_event",
- G_CALLBACK (window_button_proxy), NULL);
- }
-
- g_signal_connect (G_OBJECT (window), "key-press-event",
- G_CALLBACK (window_key_proxy), NULL);
- g_signal_connect (G_OBJECT (window), "key-release-event",
- G_CALLBACK (window_key_proxy), NULL);
- g_signal_connect (G_OBJECT (window), "delete_event",
- G_CALLBACK (hildon_quit), NULL);
- gtk_widget_add_events (window,
- GDK_BUTTON_PRESS_MASK | GDK_BUTTON_RELEASE_MASK);
-
- actor = HILDON_ANIMATION_ACTOR (hildon_animation_actor_new());
- if (g_maemo_opts & 2)
- hildon_animation_actor_set_position (actor, 0, 0 );
- else
- hildon_animation_actor_set_position (actor, (X_RES - D_WIDTH)/2, (Y_RES - D_HEIGHT)/2 );
- hildon_animation_actor_set_parent (actor, GTK_WINDOW (window));
-
- drawing = gtk_image_new ();
-
- gtk_container_add (GTK_CONTAINER (actor), drawing);
-
- gtk_widget_show_all (GTK_WIDGET (actor));
- gtk_widget_show_all (GTK_WIDGET (window));
- }else{
- gtk_init (argc, argv);
- /*GdkScreen* scr = gdk_screen_get_default();
- window = GTK_WIDGET(gdk_screen_get_root_window(scr));
- if (!window)
- window = GTK_WIDGET(gdk_get_default_root_window());*/
- }
-
- set_accel_multipliers();
-
- if (bKeepDisplayOn){
- if (pthread_create(&display_thread, NULL, displayThread, NULL))
- printf("Failed to create display thread.\n");
- }
-
- pl_rearmed_cbs.only_16bpp = 1;
- return 0;
-}
-
-void maemo_finish()
-{
- if (display_thread > 0){
- bRunning = FALSE;
- pthread_join(display_thread, NULL);
- }
-
- if (osso){
- osso_deinitialize(osso);
- osso = NULL;
- }
- printf("Exiting\n");
-}
-
-void menu_loop(void)
-{
-}
-
-void *plat_gvideo_set_mode(int *w_, int *h_, int *bpp_)
-{
- int w = *w_, h = *h_;
-
- if (g_maemo_opts&8) return pl_vout_buf;
- //printf("Setting video mode %ix%i\n", w, h);
-
- if (w <= 0 || h <= 0)
- return pl_vout_buf;
-
- if (image) gdk_image_destroy(image);
- image = gdk_image_new( GDK_IMAGE_FASTEST, gdk_visual_get_system(), w, h );
-
- pl_vout_buf = (void *) image->mem;
-
- gtk_image_set_from_image (GTK_IMAGE(drawing), image, NULL);
-
- gtk_window_resize (GTK_WINDOW (actor), w, h);
- if (g_maemo_opts & 2)
- hildon_animation_actor_set_scale (actor,
- (gdouble)800 / (gdouble)w,
- (gdouble)480 / (gdouble)h
- );
- else
- hildon_animation_actor_set_scale (actor,
- (gdouble)D_WIDTH / (gdouble)w,
- (gdouble)D_HEIGHT / (gdouble)h
- );
- pl_buf_w=w;pl_buf_h=h;
- return pl_vout_buf;
-}
-
-void *plat_gvideo_flip(void)
-{
- if (!(g_maemo_opts&8))
- gtk_widget_queue_draw(drawing);
-
- // process accelometer
- if (g_maemo_opts & 4) {
- float x, y, z;
- FILE* f = fopen( "/sys/class/i2c-adapter/i2c-3/3-001d/coord", "r" );
- if( !f ) {printf ("err in accel"); exit(1);}
- fscanf( f, "%f %f %f", &x, &y, &z );
- fclose( f );
-
- if (in_type1 == PSE_PAD_TYPE_ANALOGPAD){
- if (x > accelOptions.maxValue) x = accelOptions.maxValue;
- else if (x < -accelOptions.maxValue) x = -accelOptions.maxValue;
-
- const int maxValue = accelOptions.maxValue - accelOptions.sens;
- if(x > accelOptions.sens){
- x -= accelOptions.sens;
- in_a1[0] = (-x + maxValue ) * accelOptions.xMultiplier;
- }else if (x < -accelOptions.sens){
- x += accelOptions.sens;
- in_a1[0] = (-x + maxValue ) * accelOptions.xMultiplier;
- }else in_a1[0] = 127;
-
- y += accelOptions.y_def;
- if (y > accelOptions.maxValue) y = accelOptions.maxValue;
- else if (y < -accelOptions.maxValue) y = -accelOptions.maxValue;
-
- if(y > accelOptions.sens){
- y -= accelOptions.sens;
- in_a1[1] = (-y + maxValue ) * accelOptions.yMultiplier;
- }else if (y < -accelOptions.sens){
- y += accelOptions.sens;
- in_a1[1] = (-y + maxValue ) * accelOptions.yMultiplier;
- }else in_a1[1] = 127;
-
- //printf("x: %i y: %i\n", in_a1[0], in_a1[1]);
- }else{
- if( x > accelOptions.sens ) in_keystate |= 1 << DKEY_LEFT;
- else if( x < -accelOptions.sens ) in_keystate |= 1 << DKEY_RIGHT;
- else {in_keystate &= ~(1 << DKEY_LEFT);in_keystate &= ~(1 << DKEY_RIGHT);}
-
- y += accelOptions.y_def;
- if( y > accelOptions.sens )in_keystate |= 1 << DKEY_UP;
- else if( y < -accelOptions.sens ) in_keystate |= 1 << DKEY_DOWN;
- else {in_keystate &= ~(1 << DKEY_DOWN);in_keystate &= ~(1 << DKEY_UP);}
- }
- }
-
- return pl_vout_buf;
-}
-
-// for frontend/plugin_lib.c
-void update_input(void)
-{
- if (g_maemo_opts & 8)
- maemo_x11_update_keys();
- else {
- /* process GTK+ events */
- while (gtk_events_pending())
- gtk_main_iteration();
- }
-}
-
-int omap_enable_layer(int enabled)
-{
- return 0;
-}
-
-void menu_notify_mode_change(int w, int h, int bpp)
-{
-}
-
-void *plat_prepare_screenshot(int *w, int *h, int *bpp)
-{
- return NULL;
-}
-
-void plat_step_volume(int is_up)
-{
-}
-
-void plat_trigger_vibrate(int pad, int low, int high)
-{
- const int vDuration = 10;
-
- DBusConnection* system_bus = (DBusConnection*)osso_get_sys_dbus_connection(osso);
- DBusMessageIter args;
- DBusMessage*msg = dbus_message_new_method_call("com.nokia.mce",
- "/com/nokia/mce/request",
- "com.nokia.mce.request",
- "req_start_manual_vibration");
- if (msg) {
- dbus_message_iter_init_append(msg, &args);
- // FIXME: somebody with hardware should tune this
- int speed = high; // is_strong ? 200 : 150;
- int duration = vDuration;
- if (dbus_message_iter_append_basic(&args, DBUS_TYPE_INT32, &speed)) {
- if (dbus_message_iter_append_basic(&args, DBUS_TYPE_INT32, &duration)) {
- dbus_connection_send(system_bus, msg, NULL);
- //dbus_connection_flush(system_bus);
- }
- }
- dbus_message_unref(msg);
- }
-}
-
-void plat_minimize(void)
-{
-}
-
-void plat_gvideo_close(void)
-{
-}
-
-void plat_gvideo_open(int is_pal)
-{
-}
+++ /dev/null
-int maemo_init(int *argc, char ***argv);
-void maemo_finish();
-
-extern char file_name[MAXPATHLEN];
-extern int g_maemo_opts;
-
-extern inline void key_press_event(int key,int type);
-
-typedef struct
-{
- int sens;
- int y_def;
- float maxValue;
- float xMultiplier;
- float yMultiplier;
-} accel_option;
-
-extern accel_option accelOptions;
+++ /dev/null
-/*
- * Copyright (c) 2009, Wei Mingzhi <whistler@openoffice.org>.
- * All Rights Reserved.
- *
- * This program is free software; you can redistribute it and/or modify
- * it under the terms of the GNU General Public License as published by
- * the Free Software Foundation; either version 2 of the License, or
- * (at your option) any later version.
- *
- * This program is distributed in the hope that it will be useful,
- * but WITHOUT ANY WARRANTY; without even the implied warranty of
- * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
- * GNU General Public License for more details.
- *
- * You should have received a copy of the GNU General Public License
- * along with this program; if not, see <http://www.gnu.org/licenses>.
- */
-
-#include <stdio.h>
-#include <stdlib.h>
-#include <stdint.h>
-#include <X11/Xlib.h>
-#include <X11/Xutil.h>
-#include <X11/keysym.h>
-#include <X11/XKBlib.h>
-
-#include "../frontend/main.h"
-#include "../frontend/plugin_lib.h"
-
-static Atom wmprotocols, wmdelwindow;
-static int initialized;
-
-
-
-static void InitKeyboard(void) {
- Display *disp = (Display *)gpuDisp;
- if (disp){
- wmprotocols = XInternAtom(disp, "WM_PROTOCOLS", 0);
- wmdelwindow = XInternAtom(disp, "WM_DELETE_WINDOW", 0);
- XkbSetDetectableAutoRepeat(disp, 1, NULL);
- }
-}
-
-static void DestroyKeyboard(void) {
- Display *disp = (Display *)gpuDisp;
- if (disp)
- XkbSetDetectableAutoRepeat(disp, 0, NULL);
-}
-#include "maemo_common.h"
-
-int maemo_x11_update_keys() {
-
- XEvent evt;
- XClientMessageEvent *xce;
- int leave = 0;
- Display *disp = (Display *)gpuDisp;
-
- if (!disp)
- return 0;
-
- if (!initialized) {
- initialized++;
- InitKeyboard();
- }
-
- while (XPending(disp)>0) {
- XNextEvent(disp, &evt);
- switch (evt.type) {
- case KeyPress:
- case KeyRelease:
- key_press_event(evt.xkey.keycode, evt.type==KeyPress ? 1 : (evt.type==KeyRelease ? 2 : 0) );
- break;
-
- case ClientMessage:
- xce = (XClientMessageEvent *)&evt;
- if (xce->message_type == wmprotocols && (Atom)xce->data.l[0] == wmdelwindow)
- leave = 1;
- break;
- }
- }
-
- if (leave) {
- DestroyKeyboard();
- exit(1);
- }
-
- return 0;
-}
#include <zlib.h>
#ifndef _WIN32
#define CALLBACK
+#ifndef NO_DYLIB
#include <dlfcn.h>
+#endif
#else
#define WIN32_LEAN_AND_MEAN
#include <windows.h>
return -1;
}
}
-#ifndef _WIN32
+#if !defined(_WIN32) && !defined(NO_DYLIB)
if (pBZ2_bzBuffToBuffDecompress == NULL) {
void *h = dlopen("/usr/lib/libbz2.so.1", RTLD_LAZY);
if (h == NULL)
PAD##n##_poll = PADpoll_guncon; \
guncon_init(); \
break; \
+ case PSE_PAD_TYPE_NEGCON: \
case PSE_PAD_TYPE_GUN: \
default: \
PAD##n##_startPoll = PAD##n##__startPoll; \
} \
}
+
void dfinput_activate(void)
{
+ #ifndef HAVE_LIBRETRO
PadDataS pad;
+ pad.portMultitap = -1;
+ pad.requestPadIndex = 0;
PAD1_readPort1(&pad);
select_pad(1);
+ pad.requestPadIndex = 1;
PAD2_readPort2(&pad);
select_pad(2);
+ #endif
}
#define PADpoll PADpoll_
#endif
+#ifndef HAVE_LIBRETRO
unsigned char PADpoll_pad(unsigned char value) {
if (CurByte == 0) {
CurCmd = value;
padstate[i].PadMode = padstate[i].pad.controllerType == PSE_PAD_TYPE_ANALOGPAD;
}
}
+#endif
copyright : (C) 2003 by Chris Moeller, eh, whatever\r
email : chris@kode54.tk\r
***************************************************************************/\r
+ \r
/***************************************************************************\r
* *\r
* This program is free software; you can redistribute it and/or modify *\r
* *\r
***************************************************************************/\r
\r
+//*************************************************************************//\r
+// History of changes:\r
+//\r
+// 2003/02/08 - kode54\r
+// - generated by interleaving table from gauss.h from the libopenspc\r
+// project; a gaussian bell curve table logged from the SPC-700,\r
+// though Neill says he logged the same curve from a PSX SPU. Also\r
+// says that interleaving the coefficients together runs faster. Meh.\r
+//\r
+//*************************************************************************//\r
+\r
#ifndef GAUSS_H\r
#define GAUSS_H\r
\r
-static const short gauss[]={\r
- 0x172, 0x519, 0x176, 0x000, 0x16E, 0x519, 0x17A, 0x000, \r
- 0x16A, 0x518, 0x17D, 0x000, 0x166, 0x518, 0x181, 0x000, \r
- 0x162, 0x518, 0x185, 0x000, 0x15F, 0x518, 0x189, 0x000, \r
- 0x15B, 0x518, 0x18D, 0x000, 0x157, 0x517, 0x191, 0x000, \r
- 0x153, 0x517, 0x195, 0x000, 0x150, 0x517, 0x19A, 0x000, \r
- 0x14C, 0x516, 0x19E, 0x000, 0x148, 0x516, 0x1A2, 0x000, \r
- 0x145, 0x515, 0x1A6, 0x000, 0x141, 0x514, 0x1AA, 0x000, \r
- 0x13E, 0x514, 0x1AE, 0x000, 0x13A, 0x513, 0x1B2, 0x000, \r
- 0x137, 0x512, 0x1B7, 0x001, 0x133, 0x511, 0x1BB, 0x001, \r
- 0x130, 0x511, 0x1BF, 0x001, 0x12C, 0x510, 0x1C3, 0x001, \r
- 0x129, 0x50F, 0x1C8, 0x001, 0x125, 0x50E, 0x1CC, 0x001, \r
- 0x122, 0x50D, 0x1D0, 0x001, 0x11E, 0x50C, 0x1D5, 0x001, \r
- 0x11B, 0x50B, 0x1D9, 0x001, 0x118, 0x50A, 0x1DD, 0x001, \r
- 0x114, 0x508, 0x1E2, 0x001, 0x111, 0x507, 0x1E6, 0x002, \r
- 0x10E, 0x506, 0x1EB, 0x002, 0x10B, 0x504, 0x1EF, 0x002, \r
- 0x107, 0x503, 0x1F3, 0x002, 0x104, 0x502, 0x1F8, 0x002, \r
- 0x101, 0x500, 0x1FC, 0x002, 0x0FE, 0x4FF, 0x201, 0x002, \r
- 0x0FB, 0x4FD, 0x205, 0x003, 0x0F8, 0x4FB, 0x20A, 0x003, \r
- 0x0F5, 0x4FA, 0x20F, 0x003, 0x0F2, 0x4F8, 0x213, 0x003, \r
- 0x0EF, 0x4F6, 0x218, 0x003, 0x0EC, 0x4F5, 0x21C, 0x004, \r
- 0x0E9, 0x4F3, 0x221, 0x004, 0x0E6, 0x4F1, 0x226, 0x004, \r
- 0x0E3, 0x4EF, 0x22A, 0x004, 0x0E0, 0x4ED, 0x22F, 0x004, \r
- 0x0DD, 0x4EB, 0x233, 0x005, 0x0DA, 0x4E9, 0x238, 0x005, \r
- 0x0D7, 0x4E7, 0x23D, 0x005, 0x0D4, 0x4E5, 0x241, 0x005, \r
- 0x0D2, 0x4E3, 0x246, 0x006, 0x0CF, 0x4E0, 0x24B, 0x006, \r
- 0x0CC, 0x4DE, 0x250, 0x006, 0x0C9, 0x4DC, 0x254, 0x006, \r
- 0x0C7, 0x4D9, 0x259, 0x007, 0x0C4, 0x4D7, 0x25E, 0x007, \r
- 0x0C1, 0x4D5, 0x263, 0x007, 0x0BF, 0x4D2, 0x267, 0x008, \r
- 0x0BC, 0x4D0, 0x26C, 0x008, 0x0BA, 0x4CD, 0x271, 0x008, \r
- 0x0B7, 0x4CB, 0x276, 0x009, 0x0B4, 0x4C8, 0x27B, 0x009, \r
- 0x0B2, 0x4C5, 0x280, 0x009, 0x0AF, 0x4C3, 0x284, 0x00A, \r
- 0x0AD, 0x4C0, 0x289, 0x00A, 0x0AB, 0x4BD, 0x28E, 0x00A, \r
- 0x0A8, 0x4BA, 0x293, 0x00B, 0x0A6, 0x4B7, 0x298, 0x00B, \r
- 0x0A3, 0x4B5, 0x29D, 0x00B, 0x0A1, 0x4B2, 0x2A2, 0x00C, \r
- 0x09F, 0x4AF, 0x2A6, 0x00C, 0x09C, 0x4AC, 0x2AB, 0x00D, \r
- 0x09A, 0x4A9, 0x2B0, 0x00D, 0x098, 0x4A6, 0x2B5, 0x00E, \r
- 0x096, 0x4A2, 0x2BA, 0x00E, 0x093, 0x49F, 0x2BF, 0x00F, \r
- 0x091, 0x49C, 0x2C4, 0x00F, 0x08F, 0x499, 0x2C9, 0x00F, \r
- 0x08D, 0x496, 0x2CE, 0x010, 0x08B, 0x492, 0x2D3, 0x010, \r
- 0x089, 0x48F, 0x2D8, 0x011, 0x086, 0x48C, 0x2DC, 0x011, \r
- 0x084, 0x488, 0x2E1, 0x012, 0x082, 0x485, 0x2E6, 0x013, \r
- 0x080, 0x481, 0x2EB, 0x013, 0x07E, 0x47E, 0x2F0, 0x014, \r
- 0x07C, 0x47A, 0x2F5, 0x014, 0x07A, 0x477, 0x2FA, 0x015, \r
- 0x078, 0x473, 0x2FF, 0x015, 0x076, 0x470, 0x304, 0x016, \r
- 0x075, 0x46C, 0x309, 0x017, 0x073, 0x468, 0x30E, 0x017, \r
- 0x071, 0x465, 0x313, 0x018, 0x06F, 0x461, 0x318, 0x018, \r
- 0x06D, 0x45D, 0x31D, 0x019, 0x06B, 0x459, 0x322, 0x01A, \r
- 0x06A, 0x455, 0x326, 0x01B, 0x068, 0x452, 0x32B, 0x01B, \r
- 0x066, 0x44E, 0x330, 0x01C, 0x064, 0x44A, 0x335, 0x01D, \r
- 0x063, 0x446, 0x33A, 0x01D, 0x061, 0x442, 0x33F, 0x01E, \r
- 0x05F, 0x43E, 0x344, 0x01F, 0x05E, 0x43A, 0x349, 0x020, \r
- 0x05C, 0x436, 0x34E, 0x020, 0x05A, 0x432, 0x353, 0x021, \r
- 0x059, 0x42E, 0x357, 0x022, 0x057, 0x42A, 0x35C, 0x023, \r
- 0x056, 0x425, 0x361, 0x024, 0x054, 0x421, 0x366, 0x024, \r
- 0x053, 0x41D, 0x36B, 0x025, 0x051, 0x419, 0x370, 0x026, \r
- 0x050, 0x415, 0x374, 0x027, 0x04E, 0x410, 0x379, 0x028, \r
- 0x04D, 0x40C, 0x37E, 0x029, 0x04C, 0x408, 0x383, 0x02A, \r
- 0x04A, 0x403, 0x388, 0x02B, 0x049, 0x3FF, 0x38C, 0x02C, \r
- 0x047, 0x3FB, 0x391, 0x02D, 0x046, 0x3F6, 0x396, 0x02E, \r
- 0x045, 0x3F2, 0x39B, 0x02F, 0x043, 0x3ED, 0x39F, 0x030, \r
- 0x042, 0x3E9, 0x3A4, 0x031, 0x041, 0x3E5, 0x3A9, 0x032, \r
- 0x040, 0x3E0, 0x3AD, 0x033, 0x03E, 0x3DC, 0x3B2, 0x034, \r
- 0x03D, 0x3D7, 0x3B7, 0x035, 0x03C, 0x3D2, 0x3BB, 0x036, \r
- 0x03B, 0x3CE, 0x3C0, 0x037, 0x03A, 0x3C9, 0x3C5, 0x038, \r
- 0x038, 0x3C5, 0x3C9, 0x03A, 0x037, 0x3C0, 0x3CE, 0x03B, \r
- 0x036, 0x3BB, 0x3D2, 0x03C, 0x035, 0x3B7, 0x3D7, 0x03D, \r
- 0x034, 0x3B2, 0x3DC, 0x03E, 0x033, 0x3AD, 0x3E0, 0x040, \r
- 0x032, 0x3A9, 0x3E5, 0x041, 0x031, 0x3A4, 0x3E9, 0x042, \r
- 0x030, 0x39F, 0x3ED, 0x043, 0x02F, 0x39B, 0x3F2, 0x045, \r
- 0x02E, 0x396, 0x3F6, 0x046, 0x02D, 0x391, 0x3FB, 0x047, \r
- 0x02C, 0x38C, 0x3FF, 0x049, 0x02B, 0x388, 0x403, 0x04A, \r
- 0x02A, 0x383, 0x408, 0x04C, 0x029, 0x37E, 0x40C, 0x04D, \r
- 0x028, 0x379, 0x410, 0x04E, 0x027, 0x374, 0x415, 0x050, \r
- 0x026, 0x370, 0x419, 0x051, 0x025, 0x36B, 0x41D, 0x053, \r
- 0x024, 0x366, 0x421, 0x054, 0x024, 0x361, 0x425, 0x056, \r
- 0x023, 0x35C, 0x42A, 0x057, 0x022, 0x357, 0x42E, 0x059, \r
- 0x021, 0x353, 0x432, 0x05A, 0x020, 0x34E, 0x436, 0x05C, \r
- 0x020, 0x349, 0x43A, 0x05E, 0x01F, 0x344, 0x43E, 0x05F, \r
- 0x01E, 0x33F, 0x442, 0x061, 0x01D, 0x33A, 0x446, 0x063, \r
- 0x01D, 0x335, 0x44A, 0x064, 0x01C, 0x330, 0x44E, 0x066, \r
- 0x01B, 0x32B, 0x452, 0x068, 0x01B, 0x326, 0x455, 0x06A, \r
- 0x01A, 0x322, 0x459, 0x06B, 0x019, 0x31D, 0x45D, 0x06D, \r
- 0x018, 0x318, 0x461, 0x06F, 0x018, 0x313, 0x465, 0x071, \r
- 0x017, 0x30E, 0x468, 0x073, 0x017, 0x309, 0x46C, 0x075, \r
- 0x016, 0x304, 0x470, 0x076, 0x015, 0x2FF, 0x473, 0x078, \r
- 0x015, 0x2FA, 0x477, 0x07A, 0x014, 0x2F5, 0x47A, 0x07C, \r
- 0x014, 0x2F0, 0x47E, 0x07E, 0x013, 0x2EB, 0x481, 0x080, \r
- 0x013, 0x2E6, 0x485, 0x082, 0x012, 0x2E1, 0x488, 0x084, \r
- 0x011, 0x2DC, 0x48C, 0x086, 0x011, 0x2D8, 0x48F, 0x089, \r
- 0x010, 0x2D3, 0x492, 0x08B, 0x010, 0x2CE, 0x496, 0x08D, \r
- 0x00F, 0x2C9, 0x499, 0x08F, 0x00F, 0x2C4, 0x49C, 0x091, \r
- 0x00F, 0x2BF, 0x49F, 0x093, 0x00E, 0x2BA, 0x4A2, 0x096, \r
- 0x00E, 0x2B5, 0x4A6, 0x098, 0x00D, 0x2B0, 0x4A9, 0x09A, \r
- 0x00D, 0x2AB, 0x4AC, 0x09C, 0x00C, 0x2A6, 0x4AF, 0x09F, \r
- 0x00C, 0x2A2, 0x4B2, 0x0A1, 0x00B, 0x29D, 0x4B5, 0x0A3, \r
- 0x00B, 0x298, 0x4B7, 0x0A6, 0x00B, 0x293, 0x4BA, 0x0A8, \r
- 0x00A, 0x28E, 0x4BD, 0x0AB, 0x00A, 0x289, 0x4C0, 0x0AD, \r
- 0x00A, 0x284, 0x4C3, 0x0AF, 0x009, 0x280, 0x4C5, 0x0B2, \r
- 0x009, 0x27B, 0x4C8, 0x0B4, 0x009, 0x276, 0x4CB, 0x0B7, \r
- 0x008, 0x271, 0x4CD, 0x0BA, 0x008, 0x26C, 0x4D0, 0x0BC, \r
- 0x008, 0x267, 0x4D2, 0x0BF, 0x007, 0x263, 0x4D5, 0x0C1, \r
- 0x007, 0x25E, 0x4D7, 0x0C4, 0x007, 0x259, 0x4D9, 0x0C7, \r
- 0x006, 0x254, 0x4DC, 0x0C9, 0x006, 0x250, 0x4DE, 0x0CC, \r
- 0x006, 0x24B, 0x4E0, 0x0CF, 0x006, 0x246, 0x4E3, 0x0D2, \r
- 0x005, 0x241, 0x4E5, 0x0D4, 0x005, 0x23D, 0x4E7, 0x0D7, \r
- 0x005, 0x238, 0x4E9, 0x0DA, 0x005, 0x233, 0x4EB, 0x0DD, \r
- 0x004, 0x22F, 0x4ED, 0x0E0, 0x004, 0x22A, 0x4EF, 0x0E3, \r
- 0x004, 0x226, 0x4F1, 0x0E6, 0x004, 0x221, 0x4F3, 0x0E9, \r
- 0x004, 0x21C, 0x4F5, 0x0EC, 0x003, 0x218, 0x4F6, 0x0EF, \r
- 0x003, 0x213, 0x4F8, 0x0F2, 0x003, 0x20F, 0x4FA, 0x0F5, \r
- 0x003, 0x20A, 0x4FB, 0x0F8, 0x003, 0x205, 0x4FD, 0x0FB, \r
- 0x002, 0x201, 0x4FF, 0x0FE, 0x002, 0x1FC, 0x500, 0x101, \r
- 0x002, 0x1F8, 0x502, 0x104, 0x002, 0x1F3, 0x503, 0x107, \r
- 0x002, 0x1EF, 0x504, 0x10B, 0x002, 0x1EB, 0x506, 0x10E, \r
- 0x002, 0x1E6, 0x507, 0x111, 0x001, 0x1E2, 0x508, 0x114, \r
- 0x001, 0x1DD, 0x50A, 0x118, 0x001, 0x1D9, 0x50B, 0x11B, \r
- 0x001, 0x1D5, 0x50C, 0x11E, 0x001, 0x1D0, 0x50D, 0x122, \r
- 0x001, 0x1CC, 0x50E, 0x125, 0x001, 0x1C8, 0x50F, 0x129, \r
- 0x001, 0x1C3, 0x510, 0x12C, 0x001, 0x1BF, 0x511, 0x130, \r
- 0x001, 0x1BB, 0x511, 0x133, 0x001, 0x1B7, 0x512, 0x137, \r
- 0x000, 0x1B2, 0x513, 0x13A, 0x000, 0x1AE, 0x514, 0x13E, \r
- 0x000, 0x1AA, 0x514, 0x141, 0x000, 0x1A6, 0x515, 0x145, \r
- 0x000, 0x1A2, 0x516, 0x148, 0x000, 0x19E, 0x516, 0x14C, \r
- 0x000, 0x19A, 0x517, 0x150, 0x000, 0x195, 0x517, 0x153, \r
- 0x000, 0x191, 0x517, 0x157, 0x000, 0x18D, 0x518, 0x15B, \r
- 0x000, 0x189, 0x518, 0x15F, 0x000, 0x185, 0x518, 0x162, \r
- 0x000, 0x181, 0x518, 0x166, 0x000, 0x17D, 0x518, 0x16A, \r
- 0x000, 0x17A, 0x519, 0x16E, 0x000, 0x176, 0x519, 0x172};\r
-#endif\r
+\r
+/*\r
+128 * 4 table\r
+- 0 = past #3\r
+- 1 = past #2\r
+- 2 = past #1\r
+- 3 = past #0\r
+\r
+\r
+offset 0\r
+for(0) + for(256) + rev(256) + rev(0)\r
+*/\r
+\r
+\r
+// NOTE: Dr. Hell\r
+// - Excel NORMDIST($A6,2,0.567,FALSE) [0-4] = 98%\r
+\r
+\r
+// Mednafen's table (PSX) 99-100%\r
+const int gauss[]={\r
+ 0x12c7, 0x59b3, 0x1307, 0xffffffff, \r
+ 0x1288, 0x59b2, 0x1347, 0xffffffff, \r
+ 0x1249, 0x59b0, 0x1388, 0xffffffff, \r
+ 0x120b, 0x59ad, 0x13c9, 0xffffffff, \r
+ 0x11cd, 0x59a9, 0x140b, 0xffffffff, \r
+ 0x118f, 0x59a4, 0x144d, 0xffffffff, \r
+ 0x1153, 0x599e, 0x1490, 0xffffffff, \r
+ 0x1116, 0x5997, 0x14d4, 0xffffffff, \r
+ 0x10db, 0x598f, 0x1517, 0xffffffff, \r
+ 0x109f, 0x5986, 0x155c, 0xffffffff, \r
+ 0x1065, 0x597c, 0x15a0, 0xffffffff, \r
+ 0x102a, 0x5971, 0x15e6, 0xffffffff, \r
+ 0x0ff1, 0x5965, 0x162c, 0xffffffff, \r
+ 0x0fb7, 0x5958, 0x1672, 0xffffffff, \r
+ 0x0f7f, 0x5949, 0x16b9, 0xffffffff, \r
+ 0x0f46, 0x593a, 0x1700, 0xffffffff, \r
+ 0x0f0f, 0x592a, 0x1747, 0x0000, \r
+ 0x0ed7, 0x5919, 0x1790, 0x0000, \r
+ 0x0ea1, 0x5907, 0x17d8, 0x0000, \r
+ 0x0e6b, 0x58f4, 0x1821, 0x0000, \r
+ 0x0e35, 0x58e0, 0x186b, 0x0000, \r
+ 0x0e00, 0x58cb, 0x18b5, 0x0000, \r
+ 0x0dcb, 0x58b5, 0x1900, 0x0000, \r
+ 0x0d97, 0x589e, 0x194b, 0x0001, \r
+ 0x0d63, 0x5886, 0x1996, 0x0001, \r
+ 0x0d30, 0x586d, 0x19e2, 0x0001, \r
+ 0x0cfd, 0x5853, 0x1a2e, 0x0001, \r
+ 0x0ccb, 0x5838, 0x1a7b, 0x0002, \r
+ 0x0c99, 0x581c, 0x1ac8, 0x0002, \r
+ 0x0c68, 0x57ff, 0x1b16, 0x0002, \r
+ 0x0c38, 0x57e2, 0x1b64, 0x0003, \r
+ 0x0c07, 0x57c3, 0x1bb3, 0x0003, \r
+ 0x0bd8, 0x57a3, 0x1c02, 0x0003, \r
+ 0x0ba9, 0x5782, 0x1c51, 0x0004, \r
+ 0x0b7a, 0x5761, 0x1ca1, 0x0004, \r
+ 0x0b4c, 0x573e, 0x1cf1, 0x0005, \r
+ 0x0b1e, 0x571b, 0x1d42, 0x0005, \r
+ 0x0af1, 0x56f6, 0x1d93, 0x0006, \r
+ 0x0ac4, 0x56d1, 0x1de5, 0x0007, \r
+ 0x0a98, 0x56ab, 0x1e37, 0x0007, \r
+ 0x0a6c, 0x5684, 0x1e89, 0x0008, \r
+ 0x0a40, 0x565b, 0x1edc, 0x0009, \r
+ 0x0a16, 0x5632, 0x1f2f, 0x0009, \r
+ 0x09eb, 0x5609, 0x1f82, 0x000a, \r
+ 0x09c1, 0x55de, 0x1fd6, 0x000b, \r
+ 0x0998, 0x55b2, 0x202a, 0x000c, \r
+ 0x096f, 0x5585, 0x207f, 0x000d, \r
+ 0x0946, 0x5558, 0x20d4, 0x000e, \r
+ 0x091e, 0x5529, 0x2129, 0x000f, \r
+ 0x08f7, 0x54fa, 0x217f, 0x0010, \r
+ 0x08d0, 0x54ca, 0x21d5, 0x0011, \r
+ 0x08a9, 0x5499, 0x222c, 0x0012, \r
+ 0x0883, 0x5467, 0x2282, 0x0013, \r
+ 0x085d, 0x5434, 0x22da, 0x0015, \r
+ 0x0838, 0x5401, 0x2331, 0x0016, \r
+ 0x0813, 0x53cc, 0x2389, 0x0018, \r
+ 0x07ef, 0x5397, 0x23e1, 0x0019, \r
+ 0x07cb, 0x5361, 0x2439, 0x001b, \r
+ 0x07a7, 0x532a, 0x2492, 0x001c, \r
+ 0x0784, 0x52f3, 0x24eb, 0x001e, \r
+ 0x0762, 0x52ba, 0x2545, 0x0020, \r
+ 0x0740, 0x5281, 0x259e, 0x0021, \r
+ 0x071e, 0x5247, 0x25f8, 0x0023, \r
+ 0x06fd, 0x520c, 0x2653, 0x0025, \r
+ 0x06dc, 0x51d0, 0x26ad, 0x0027, \r
+ 0x06bb, 0x5194, 0x2708, 0x0029, \r
+ 0x069b, 0x5156, 0x2763, 0x002c, \r
+ 0x067c, 0x5118, 0x27be, 0x002e, \r
+ 0x065c, 0x50da, 0x281a, 0x0030, \r
+ 0x063e, 0x509a, 0x2876, 0x0033, \r
+ 0x061f, 0x505a, 0x28d2, 0x0035, \r
+ 0x0601, 0x5019, 0x292e, 0x0038, \r
+ 0x05e4, 0x4fd7, 0x298b, 0x003a, \r
+ 0x05c7, 0x4f95, 0x29e7, 0x003d, \r
+ 0x05aa, 0x4f52, 0x2a44, 0x0040, \r
+ 0x058e, 0x4f0e, 0x2aa1, 0x0043, \r
+ 0x0572, 0x4ec9, 0x2aff, 0x0046, \r
+ 0x0556, 0x4e84, 0x2b5c, 0x0049, \r
+ 0x053b, 0x4e3e, 0x2bba, 0x004d, \r
+ 0x0520, 0x4df7, 0x2c18, 0x0050, \r
+ 0x0506, 0x4db0, 0x2c76, 0x0054, \r
+ 0x04ec, 0x4d68, 0x2cd4, 0x0057, \r
+ 0x04d2, 0x4d20, 0x2d33, 0x005b, \r
+ 0x04b9, 0x4cd7, 0x2d91, 0x005f, \r
+ 0x04a0, 0x4c8d, 0x2df0, 0x0063, \r
+ 0x0488, 0x4c42, 0x2e4f, 0x0067, \r
+ 0x0470, 0x4bf7, 0x2eae, 0x006b, \r
+ 0x0458, 0x4bac, 0x2f0d, 0x006f, \r
+ 0x0441, 0x4b5f, 0x2f6c, 0x0074, \r
+ 0x042a, 0x4b13, 0x2fcc, 0x0078, \r
+ 0x0413, 0x4ac5, 0x302b, 0x007d, \r
+ 0x03fc, 0x4a77, 0x308b, 0x0082, \r
+ 0x03e7, 0x4a29, 0x30ea, 0x0087, \r
+ 0x03d1, 0x49d9, 0x314a, 0x008c, \r
+ 0x03bc, 0x498a, 0x31aa, 0x0091, \r
+ 0x03a7, 0x493a, 0x3209, 0x0096, \r
+ 0x0392, 0x48e9, 0x3269, 0x009c, \r
+ 0x037e, 0x4898, 0x32c9, 0x00a1, \r
+ 0x036a, 0x4846, 0x3329, 0x00a7, \r
+ 0x0356, 0x47f4, 0x3389, 0x00ad, \r
+ 0x0343, 0x47a1, 0x33e9, 0x00b3, \r
+ 0x0330, 0x474e, 0x3449, 0x00ba, \r
+ 0x031d, 0x46fa, 0x34a9, 0x00c0, \r
+ 0x030b, 0x46a6, 0x3509, 0x00c7, \r
+ 0x02f9, 0x4651, 0x3569, 0x00cd, \r
+ 0x02e7, 0x45fc, 0x35c9, 0x00d4, \r
+ 0x02d6, 0x45a6, 0x3629, 0x00db, \r
+ 0x02c4, 0x4550, 0x3689, 0x00e3, \r
+ 0x02b4, 0x44fa, 0x36e8, 0x00ea, \r
+ 0x02a3, 0x44a3, 0x3748, 0x00f2, \r
+ 0x0293, 0x444c, 0x37a8, 0x00fa, \r
+ 0x0283, 0x43f4, 0x3807, 0x0101, \r
+ 0x0273, 0x439c, 0x3867, 0x010a, \r
+ 0x0264, 0x4344, 0x38c6, 0x0112, \r
+ 0x0255, 0x42eb, 0x3926, 0x011b, \r
+ 0x0246, 0x4292, 0x3985, 0x0123, \r
+ 0x0237, 0x4239, 0x39e4, 0x012c, \r
+ 0x0229, 0x41df, 0x3a43, 0x0135, \r
+ 0x021b, 0x4185, 0x3aa2, 0x013f, \r
+ 0x020d, 0x412a, 0x3b00, 0x0148, \r
+ 0x0200, 0x40d0, 0x3b5f, 0x0152, \r
+ 0x01f2, 0x4074, 0x3bbd, 0x015c, \r
+ 0x01e5, 0x4019, 0x3c1b, 0x0166, \r
+ 0x01d9, 0x3fbd, 0x3c79, 0x0171, \r
+ 0x01cc, 0x3f62, 0x3cd7, 0x017b, \r
+ 0x01c0, 0x3f05, 0x3d35, 0x0186, \r
+ 0x01b4, 0x3ea9, 0x3d92, 0x0191, \r
+ 0x01a8, 0x3e4c, 0x3def, 0x019c, \r
+ 0x019c, 0x3def, 0x3e4c, 0x01a8, \r
+ 0x0191, 0x3d92, 0x3ea9, 0x01b4, \r
+ 0x0186, 0x3d35, 0x3f05, 0x01c0, \r
+ 0x017b, 0x3cd7, 0x3f62, 0x01cc, \r
+ 0x0171, 0x3c79, 0x3fbd, 0x01d9, \r
+ 0x0166, 0x3c1b, 0x4019, 0x01e5, \r
+ 0x015c, 0x3bbd, 0x4074, 0x01f2, \r
+ 0x0152, 0x3b5f, 0x40d0, 0x0200, \r
+ 0x0148, 0x3b00, 0x412a, 0x020d, \r
+ 0x013f, 0x3aa2, 0x4185, 0x021b, \r
+ 0x0135, 0x3a43, 0x41df, 0x0229, \r
+ 0x012c, 0x39e4, 0x4239, 0x0237, \r
+ 0x0123, 0x3985, 0x4292, 0x0246, \r
+ 0x011b, 0x3926, 0x42eb, 0x0255, \r
+ 0x0112, 0x38c6, 0x4344, 0x0264, \r
+ 0x010a, 0x3867, 0x439c, 0x0273, \r
+ 0x0101, 0x3807, 0x43f4, 0x0283, \r
+ 0x00fa, 0x37a8, 0x444c, 0x0293, \r
+ 0x00f2, 0x3748, 0x44a3, 0x02a3, \r
+ 0x00ea, 0x36e8, 0x44fa, 0x02b4, \r
+ 0x00e3, 0x3689, 0x4550, 0x02c4, \r
+ 0x00db, 0x3629, 0x45a6, 0x02d6, \r
+ 0x00d4, 0x35c9, 0x45fc, 0x02e7, \r
+ 0x00cd, 0x3569, 0x4651, 0x02f9, \r
+ 0x00c7, 0x3509, 0x46a6, 0x030b, \r
+ 0x00c0, 0x34a9, 0x46fa, 0x031d, \r
+ 0x00ba, 0x3449, 0x474e, 0x0330, \r
+ 0x00b3, 0x33e9, 0x47a1, 0x0343, \r
+ 0x00ad, 0x3389, 0x47f4, 0x0356, \r
+ 0x00a7, 0x3329, 0x4846, 0x036a, \r
+ 0x00a1, 0x32c9, 0x4898, 0x037e, \r
+ 0x009c, 0x3269, 0x48e9, 0x0392, \r
+ 0x0096, 0x3209, 0x493a, 0x03a7, \r
+ 0x0091, 0x31aa, 0x498a, 0x03bc, \r
+ 0x008c, 0x314a, 0x49d9, 0x03d1, \r
+ 0x0087, 0x30ea, 0x4a29, 0x03e7, \r
+ 0x0082, 0x308b, 0x4a77, 0x03fc, \r
+ 0x007d, 0x302b, 0x4ac5, 0x0413, \r
+ 0x0078, 0x2fcc, 0x4b13, 0x042a, \r
+ 0x0074, 0x2f6c, 0x4b5f, 0x0441, \r
+ 0x006f, 0x2f0d, 0x4bac, 0x0458, \r
+ 0x006b, 0x2eae, 0x4bf7, 0x0470, \r
+ 0x0067, 0x2e4f, 0x4c42, 0x0488, \r
+ 0x0063, 0x2df0, 0x4c8d, 0x04a0, \r
+ 0x005f, 0x2d91, 0x4cd7, 0x04b9, \r
+ 0x005b, 0x2d33, 0x4d20, 0x04d2, \r
+ 0x0057, 0x2cd4, 0x4d68, 0x04ec, \r
+ 0x0054, 0x2c76, 0x4db0, 0x0506, \r
+ 0x0050, 0x2c18, 0x4df7, 0x0520, \r
+ 0x004d, 0x2bba, 0x4e3e, 0x053b, \r
+ 0x0049, 0x2b5c, 0x4e84, 0x0556, \r
+ 0x0046, 0x2aff, 0x4ec9, 0x0572, \r
+ 0x0043, 0x2aa1, 0x4f0e, 0x058e, \r
+ 0x0040, 0x2a44, 0x4f52, 0x05aa, \r
+ 0x003d, 0x29e7, 0x4f95, 0x05c7, \r
+ 0x003a, 0x298b, 0x4fd7, 0x05e4, \r
+ 0x0038, 0x292e, 0x5019, 0x0601, \r
+ 0x0035, 0x28d2, 0x505a, 0x061f, \r
+ 0x0033, 0x2876, 0x509a, 0x063e, \r
+ 0x0030, 0x281a, 0x50da, 0x065c, \r
+ 0x002e, 0x27be, 0x5118, 0x067c, \r
+ 0x002c, 0x2763, 0x5156, 0x069b, \r
+ 0x0029, 0x2708, 0x5194, 0x06bb, \r
+ 0x0027, 0x26ad, 0x51d0, 0x06dc, \r
+ 0x0025, 0x2653, 0x520c, 0x06fd, \r
+ 0x0023, 0x25f8, 0x5247, 0x071e, \r
+ 0x0021, 0x259e, 0x5281, 0x0740, \r
+ 0x0020, 0x2545, 0x52ba, 0x0762, \r
+ 0x001e, 0x24eb, 0x52f3, 0x0784, \r
+ 0x001c, 0x2492, 0x532a, 0x07a7, \r
+ 0x001b, 0x2439, 0x5361, 0x07cb, \r
+ 0x0019, 0x23e1, 0x5397, 0x07ef, \r
+ 0x0018, 0x2389, 0x53cc, 0x0813, \r
+ 0x0016, 0x2331, 0x5401, 0x0838, \r
+ 0x0015, 0x22da, 0x5434, 0x085d, \r
+ 0x0013, 0x2282, 0x5467, 0x0883, \r
+ 0x0012, 0x222c, 0x5499, 0x08a9, \r
+ 0x0011, 0x21d5, 0x54ca, 0x08d0, \r
+ 0x0010, 0x217f, 0x54fa, 0x08f7, \r
+ 0x000f, 0x2129, 0x5529, 0x091e, \r
+ 0x000e, 0x20d4, 0x5558, 0x0946, \r
+ 0x000d, 0x207f, 0x5585, 0x096f, \r
+ 0x000c, 0x202a, 0x55b2, 0x0998, \r
+ 0x000b, 0x1fd6, 0x55de, 0x09c1, \r
+ 0x000a, 0x1f82, 0x5609, 0x09eb, \r
+ 0x0009, 0x1f2f, 0x5632, 0x0a16, \r
+ 0x0009, 0x1edc, 0x565b, 0x0a40, \r
+ 0x0008, 0x1e89, 0x5684, 0x0a6c, \r
+ 0x0007, 0x1e37, 0x56ab, 0x0a98, \r
+ 0x0007, 0x1de5, 0x56d1, 0x0ac4, \r
+ 0x0006, 0x1d93, 0x56f6, 0x0af1, \r
+ 0x0005, 0x1d42, 0x571b, 0x0b1e, \r
+ 0x0005, 0x1cf1, 0x573e, 0x0b4c, \r
+ 0x0004, 0x1ca1, 0x5761, 0x0b7a, \r
+ 0x0004, 0x1c51, 0x5782, 0x0ba9, \r
+ 0x0003, 0x1c02, 0x57a3, 0x0bd8, \r
+ 0x0003, 0x1bb3, 0x57c3, 0x0c07, \r
+ 0x0003, 0x1b64, 0x57e2, 0x0c38, \r
+ 0x0002, 0x1b16, 0x57ff, 0x0c68, \r
+ 0x0002, 0x1ac8, 0x581c, 0x0c99, \r
+ 0x0002, 0x1a7b, 0x5838, 0x0ccb, \r
+ 0x0001, 0x1a2e, 0x5853, 0x0cfd, \r
+ 0x0001, 0x19e2, 0x586d, 0x0d30, \r
+ 0x0001, 0x1996, 0x5886, 0x0d63, \r
+ 0x0001, 0x194b, 0x589e, 0x0d97, \r
+ 0x0000, 0x1900, 0x58b5, 0x0dcb, \r
+ 0x0000, 0x18b5, 0x58cb, 0x0e00, \r
+ 0x0000, 0x186b, 0x58e0, 0x0e35, \r
+ 0x0000, 0x1821, 0x58f4, 0x0e6b, \r
+ 0x0000, 0x17d8, 0x5907, 0x0ea1, \r
+ 0x0000, 0x1790, 0x5919, 0x0ed7, \r
+ 0x0000, 0x1747, 0x592a, 0x0f0f, \r
+ 0xffffffff, 0x1700, 0x593a, 0x0f46, \r
+ 0xffffffff, 0x16b9, 0x5949, 0x0f7f, \r
+ 0xffffffff, 0x1672, 0x5958, 0x0fb7, \r
+ 0xffffffff, 0x162c, 0x5965, 0x0ff1, \r
+ 0xffffffff, 0x15e6, 0x5971, 0x102a, \r
+ 0xffffffff, 0x15a0, 0x597c, 0x1065, \r
+ 0xffffffff, 0x155c, 0x5986, 0x109f, \r
+ 0xffffffff, 0x1517, 0x598f, 0x10db, \r
+ 0xffffffff, 0x14d4, 0x5997, 0x1116, \r
+ 0xffffffff, 0x1490, 0x599e, 0x1153, \r
+ 0xffffffff, 0x144d, 0x59a4, 0x118f, \r
+ 0xffffffff, 0x140b, 0x59a9, 0x11cd, \r
+ 0xffffffff, 0x13c9, 0x59ad, 0x120b, \r
+ 0xffffffff, 0x1388, 0x59b0, 0x1249, \r
+ 0xffffffff, 0x1347, 0x59b2, 0x1288, \r
+ 0xffffffff, 0x1307, 0x59b3, 0x12c7, \r
+};\r
+\r
+#endif
\ No newline at end of file
int vl, vr;int gpos;
vl = (spos >> 6) & ~3;
gpos = SB[28];
- vr=(gauss[vl]*(int)gval0)&~2047;
- vr+=(gauss[vl+1]*gval(1))&~2047;
- vr+=(gauss[vl+2]*gval(2))&~2047;
- vr+=(gauss[vl+3]*gval(3))&~2047;
- fa = vr>>11;
+ vr=(gauss[vl]*(int)gval0) >> 15;
+ vr+=(gauss[vl+1]*gval(1)) >> 15;
+ vr+=(gauss[vl+2]*gval(2)) >> 15;
+ vr+=(gauss[vl+3]*gval(3)) >> 15;
+ fa = vr;
} break;
//--------------------------------------------------//
case 1: // simple interpolation
spos -= 0x10000L;
}
vl = (spos >> 6) & ~3;
- vr=(gauss[vl]*gvall0)&~2047;
- vr+=(gauss[vl+1]*gvall(1))&~2047;
- vr+=(gauss[vl+2]*gvall(2))&~2047;
- vr+=(gauss[vl+3]*gvall(3))&~2047;
- l= (vr >> 11) & 0xffff;
- vr=(gauss[vl]*gvalr0)&~2047;
- vr+=(gauss[vl+1]*gvalr(1))&~2047;
- vr+=(gauss[vl+2]*gvalr(2))&~2047;
- vr+=(gauss[vl+3]*gvalr(3))&~2047;
- l |= vr << 5;
+ vr=(gauss[vl]*gvall0) >> 15;
+ vr+=(gauss[vl+1]*gvall(1)) >> 15;
+ vr+=(gauss[vl+2]*gvall(2)) >> 15;
+ vr+=(gauss[vl+3]*gvall(3)) >> 15;
+ l= vr & 0xffff;
+ vr=(gauss[vl]*gvalr0) >> 15;
+ vr+=(gauss[vl+1]*gvalr(1)) >> 15;
+ vr+=(gauss[vl+2]*gvalr(2)) >> 15;
+ vr+=(gauss[vl+3]*gvalr(3)) >> 15;
+ l |= vr << 16;
}
else
{
spos -= 0x10000L;
}
vl = (spos >> 6) & ~3;
- vr=(gauss[vl]*gvall0)&~2047;
- vr+=(gauss[vl+1]*gvall(1))&~2047;
- vr+=(gauss[vl+2]*gvall(2))&~2047;
- vr+=(gauss[vl+3]*gvall(3))&~2047;
- l= (vr >> 11) & 0xffff;
- vr=(gauss[vl]*gvalr0)&~2047;
- vr+=(gauss[vl+1]*gvalr(1))&~2047;
- vr+=(gauss[vl+2]*gvalr(2))&~2047;
- vr+=(gauss[vl+3]*gvalr(3))&~2047;
- l |= vr << 5;
+ vr=(gauss[vl]*gvall0) >> 15;
+ vr+=(gauss[vl+1]*gvall(1)) >> 15;
+ vr+=(gauss[vl+2]*gvall(2)) >> 15;
+ vr+=(gauss[vl+3]*gvall(3)) >> 15;
+ l= vr & 0xffff;
+ vr=(gauss[vl]*gvalr0) >> 15;
+ vr+=(gauss[vl+1]*gvalr(1)) >> 15;
+ vr+=(gauss[vl+2]*gvalr(2)) >> 15;
+ vr+=(gauss[vl+3]*gvalr(3)) >> 15;
+ l |= vr << 16;
}
else
{
spos -= 0x10000L;
}
vl = (spos >> 6) & ~3;
- vr=(gauss[vl]*gvall0)&~2047;
- vr+=(gauss[vl+1]*gvall(1))&~2047;
- vr+=(gauss[vl+2]*gvall(2))&~2047;
- vr+=(gauss[vl+3]*gvall(3))&~2047;
- l1=s= vr >> 11;
+ vr=(gauss[vl]*gvall0) >> 15;
+ vr+=(gauss[vl+1]*gvall(1)) >> 15;
+ vr+=(gauss[vl+2]*gvall(2)) >> 15;
+ vr+=(gauss[vl+3]*gvall(3)) >> 15;
+ l1=s= vr;
l1 &= 0xffff;
}
else
spos -= 0x10000L;
}
vl = (spos >> 6) & ~3;
- vr=(gauss[vl]*gvall0)&~2047;
- vr+=(gauss[vl+1]*gvall(1))&~2047;
- vr+=(gauss[vl+2]*gvall(2))&~2047;
- vr+=(gauss[vl+3]*gvall(3))&~2047;
- l=s= vr >> 11;
+ vr=(gauss[vl]*gvall0) >> 15;
+ vr+=(gauss[vl+1]*gvall(1)) >> 15;
+ vr+=(gauss[vl+2]*gvall(2)) >> 15;
+ vr+=(gauss[vl+3]*gvall(3)) >> 15;
+ l=s= vr;
}
else
{
extern const unsigned char cmd_lengths[256];
-int do_cmd_list(unsigned int *list, int list_len, int *last_cmd)
+int do_cmd_list(uint32_t *list, int list_len, int *last_cmd)
{
unsigned int cmd = 0, len;
- unsigned int *list_start = list;
- unsigned int *list_end = list + list_len;
+ uint32_t *list_start = list;
+ uint32_t *list_end = list + list_len;
for (; list < list_end; list += 1 + len)
{
u8 texture_4bpp_cache[32][256 * 256];
u8 texture_8bpp_even_cache[16][256 * 256];
u8 texture_8bpp_odd_cache[16][256 * 256];
+ int use_dithering;
} psx_gpu_struct;
typedef struct __attribute__((aligned(16)))
map_enhancement_buffer();
if (cbs->pl_set_gpu_caps)
cbs->pl_set_gpu_caps(GPU_CAP_SUPPORTS_2X);
+
+ egpu.use_dithering = cbs->gpu_neon.allow_dithering;
+ if(!egpu.use_dithering) {
+ egpu.dither_table[0] = dither_table_row(0, 0, 0, 0);
+ egpu.dither_table[1] = dither_table_row(0, 0, 0, 0);
+ egpu.dither_table[2] = dither_table_row(0, 0, 0, 0);
+ egpu.dither_table[3] = dither_table_row(0, 0, 0, 0);
+ } else {
+ egpu.dither_table[0] = dither_table_row(-4, 0, -3, 1);
+ egpu.dither_table[1] = dither_table_row(2, -2, 3, -1);
+ egpu.dither_table[2] = dither_table_row(-3, 1, -4, 0);
+ egpu.dither_table[3] = dither_table_row(3, -1, 2, -2);
+ }
+
}
* See the COPYING file in the top-level directory.
*/
+#include "arm_features.h"
.text
.align 2
extern const unsigned char cmd_lengths[256];
-int do_cmd_list(unsigned int *list, int list_len, int *last_cmd)
+int do_cmd_list(u32 *list, int list_len, int *last_cmd)
{
- unsigned int cmd = 0, len, i;
- unsigned int *list_start = list;
- unsigned int *list_end = list + list_len;
+ u32 cmd = 0, len, i;
+ u32 *list_start = list;
+ u32 *list_end = list + list_len;
linesInterlace = force_interlace;
#ifdef HAVE_PRE_ARMV7 /* XXX */
gpu.state.allow_interlace = cbs->gpu_neon.allow_interlace;
gpu.state.enhancement_enable = cbs->gpu_neon.enhancement_enable;
+ gpu.useDithering = cbs->gpu_neon.allow_dithering;
gpu.mmap = cbs->mmap;
gpu.munmap = cbs->munmap;
uint32_t last_flip_frame;
uint32_t pending_fill[3];
} frameskip;
+ int useDithering:1; /* 0 - off , 1 - on */
uint16_t *(*get_enhancement_bufer)
(int *x, int *y, int *w, int *h, int *vram_h);
void *(*mmap)(unsigned int size);
notaz.gp2x.de / pcsx_rearmed.git / commitdiff
