+++ /dev/null
-[submodule "libpicofe"]
- path = frontend/libpicofe
- url = git://notaz.gp2x.de/~notaz/libpicofe.git
-[submodule "warm"]
- path = frontend/warm
- url = git://notaz.gp2x.de/~notaz/warm.git
# default stuff goes here, so that config can override
TARGET ?= pcsx
-CFLAGS += -Wall -ggdb -Iinclude -ffast-math
-ifndef DEBUG
+CFLAGS += -Wall -Iinclude -ffast-math
+ifeq ($(DEBUG), 1)
+CFLAGS += -O0 -ggdb
+else
+ifeq ($(platform), vita)
+CFLAGS += -O3 -DNDEBUG
+else
CFLAGS += -O2 -DNDEBUG
endif
+endif
CXXFLAGS += $(CFLAGS)
#DRC_DBG = 1
#PCNT = 1
# dynarec
ifeq "$(USE_DYNAREC)" "1"
-OBJS += libpcsxcore/new_dynarec/new_dynarec.o libpcsxcore/new_dynarec/linkage_arm.o
-OBJS += libpcsxcore/new_dynarec/pcsxmem.o
+OBJS += libpcsxcore/new_dynarec/new_dynarec.o libpcsxcore/new_dynarec/arm/linkage_arm.o
+OBJS += libpcsxcore/new_dynarec/backends/psx/pcsxmem.o
else
-libpcsxcore/new_dynarec/emu_if.o: CFLAGS += -DDRC_DISABLE
+libpcsxcore/new_dynarec/backends/psx/emu_if.o: CFLAGS += -DDRC_DISABLE
frontend/libretro.o: CFLAGS += -DDRC_DISABLE
endif
-OBJS += libpcsxcore/new_dynarec/emu_if.o
-libpcsxcore/new_dynarec/new_dynarec.o: libpcsxcore/new_dynarec/assem_arm.c \
- libpcsxcore/new_dynarec/pcsxmem_inline.c
+OBJS += libpcsxcore/new_dynarec/backends/psx/emu_if.o
+libpcsxcore/new_dynarec/new_dynarec.o: libpcsxcore/new_dynarec/arm/assem_arm.c \
+ libpcsxcore/new_dynarec/backends/psx/pcsxmem_inline.c
ifdef DRC_DBG
-libpcsxcore/new_dynarec/emu_if.o: CFLAGS += -D_FILE_OFFSET_BITS=64
+libpcsxcore/new_dynarec/backends/psx/emu_if.o: CFLAGS += -D_FILE_OFFSET_BITS=64
CFLAGS += -DDRC_DBG
endif
ifeq "$(DRC_CACHE_BASE)" "1"
libpcsxcore/new_dynarec/%.o: CFLAGS += -DBASE_ADDR_FIXED=1
+libpcsxcore/new_dynarec/backends/psx/%.o: CFLAGS += -DBASE_ADDR_FIXED=1
+libpcsxcore/new_dynarec/arm/%.o: CFLAGS += -DBASE_ADDR_FIXED=1
endif
# spu
ifeq "$(PLATFORM)" "libretro"
OBJS += frontend/libretro.o
CFLAGS += -DFRONTEND_SUPPORTS_RGB565
+CFLAGS += -DHAVE_LIBRETRO
ifeq ($(MMAP_WIN32),1)
OBJS += libpcsxcore/memmap_win32.o
%.o: %.S
$(CC_AS) $(CFLAGS) -c $^ -o $@
+%.o: %.cpp
+ $(CXX) $(CXXFLAGS) -c -o $@ $<
+
+
target_: $(TARGET)
$(TARGET): $(OBJS)
+ifeq ($(STATIC_LINKING), 1)
+ $(AR) rcs $@ $(OBJS)
+else
$(CC_LINK) -o $@ $^ $(LDFLAGS) $(LDLIBS) $(EXTRA_LDFLAGS)
+endif
clean: $(PLAT_CLEAN) clean_plugins
$(RM) $(TARGET) $(OBJS) $(TARGET).map frontend/revision.h
# Makefile for PCSX ReARMed (libretro)
+DEBUG=0
+
ifeq ($(platform),)
platform = unix
ifeq ($(shell uname -a),)
CFLAGS ?=
TARGET_NAME := pcsx_rearmed
-
+GIT_VERSION := " $(shell git rev-parse --short HEAD || echo unknown)"
+ifneq ($(GIT_VERSION)," unknown")
+ CFLAGS += -DGIT_VERSION=\"$(GIT_VERSION)\"
+endif
+LIBZ := -lz
+LIBPTHREAD := -lpthread
+LIBDL := -ldl
MMAP_WIN32=0
+EXTRA_LDFLAGS =
# Unix
ifeq ($(platform), unix)
TARGET := $(TARGET_NAME)_libretro.so
fpic := -fPIC
- SHARED := -shared -Wl,--version-script=libretro/link.T
+
+else ifeq ($(platform), linux-portable)
+ TARGET := $(TARGET_NAME)_libretro.so
+ fpic := -fPIC -nostdlib
+ EXTRA_LDFLAGS += -fPIC -nostdlib
+ LIBZ :=
+ LIBPTHREAD :=
+ LIBDL :=
+ NO_UNDEF_CHECK = 1
# OS X
else ifeq ($(platform), osx)
TARGET := $(TARGET_NAME)_libretro.dylib
fpic := -fPIC
- SHARED := -dynamiclib
- OSXVER = `sw_vers -productVersion | cut -d. -f 2`
- OSX_LT_MAVERICKS = `(( $(OSXVER) <= 9)) && echo "YES"`
- ifeq ($(OSX_LT_MAVERICKS),"YES")
- fpic += -mmacosx-version-min=10.5
- endif
+ fpic += -mmacosx-version-min=10.1
# iOS
-else ifeq ($(platform), ios)
+else ifneq (,$(findstring ios,$(platform)))
ARCH := arm
+ USE_DYNAREC ?= 1
TARGET := $(TARGET_NAME)_libretro_ios.dylib
+ifeq ($(USE_DYNAREC),0)
+ # Override
+ TARGET := $(TARGET_NAME)_interpreter_libretro_ios.dylib
+endif
fpic := -fPIC
- SHARED := -dynamiclib
ifeq ($(IOSSDK),)
- IOSSDK := $(shell xcrun -sdk iphoneos -show-sdk-path)
+ IOSSDK := $(shell xcodebuild -version -sdk iphoneos Path)
endif
CC = clang -arch armv7 -isysroot $(IOSSDK)
ASFLAGS += -mcpu=cortex-a8 -mtune=cortex-a8 -mfpu=neon
HAVE_NEON = 1
BUILTIN_GPU = neon
- USE_DYNAREC = 1
CFLAGS += -DIOS
- OSXVER = `sw_vers -productVersion | cut -d. -f 2`
- OSX_LT_MAVERICKS = `(( $(OSXVER) <= 9)) && echo "YES"`
- ifeq ($(OSX_LT_MAVERICKS),"YES")
- CC += -miphoneos-version-min=5.0
- CXX += -miphoneos-version-min=5.0
- CC_AS += -miphoneos-version-min=5.0
- CFLAGS += -miphoneos-version-min=5.0
- endif
+ifeq ($(platform),ios9)
+ CC += -miphoneos-version-min=8.0
+ CXX += -miphoneos-version-min=8.0
+ CC_AS += -miphoneos-version-min=8.0
+ CFLAGS += -miphoneos-version-min=8.0
+else
+ CC += -miphoneos-version-min=5.0
+ CXX += -miphoneos-version-min=5.0
+ CC_AS += -miphoneos-version-min=5.0
+ CFLAGS += -miphoneos-version-min=5.0
+endif
# PS3
else ifeq ($(platform), ps3)
AR = psp-ar$(EXE_EXT)
CFLAGS += -DPSP -G0
+# Vita
+else ifeq ($(platform), vita)
+ TARGET := $(TARGET_NAME)_libretro_vita.a
+ CC = arm-vita-eabi-gcc$(EXE_EXT)
+ AR = arm-vita-eabi-ar$(EXE_EXT)
+ CFLAGS += -DVITA
+ CFLAGS += -mcpu=cortex-a8 -mtune=cortex-a8 -mfpu=neon -marm
+ CFLAGS += -fsingle-precision-constant -mword-relocations -fno-unwind-tables
+ CFLAGS += -fno-asynchronous-unwind-tables -ftree-vectorize -funroll-loops
+ CFLAGS += -fno-optimize-sibling-calls
+ CFLAGS += -I$(VITASDK)/include -Ifrontend/vita
+ CFLAGS += -DNO_SOCKET -DNO_OS -DNO_DYLIB
+ ASFLAGS += -mcpu=cortex-a8 -mtune=cortex-a8 -mfpu=neon
+
+# CFLAGS += -U__ARM_NEON__
+ HAVE_NEON = 1
+ BUILTIN_GPU = neon
+
+ USE_DYNAREC = 1
+ DRC_CACHE_BASE = 0
+
+ ARCH = arm
+ STATIC_LINKING = 1
+
+# CTR(3DS)
+else ifeq ($(platform), ctr)
+ TARGET := $(TARGET_NAME)_libretro_ctr.a
+ CC = $(DEVKITARM)/bin/arm-none-eabi-gcc$(EXE_EXT)
+ CXX = $(DEVKITARM)/bin/arm-none-eabi-g++$(EXE_EXT)
+ AR = $(DEVKITARM)/bin/arm-none-eabi-ar$(EXE_EXT)
+ CFLAGS += -DARM11 -D_3DS -DNO_OS -DNO_DYLIB -DNO_SOCKET
+ CFLAGS += -march=armv6k -mtune=mpcore -mfloat-abi=hard -marm -mfpu=vfp -mtp=soft
+ CFLAGS += -Wall -mword-relocations
+ CFLAGS += -fomit-frame-pointer -ffast-math
+ CFLAGS += -Ifrontend/3ds
+ CFLAGS += -Werror=implicit-function-declaration
+
+# CFLAGS += -DPCSX
+# BUILTIN_GPU = unai
+ USE_DYNAREC = 1
+ DRC_CACHE_BASE = 1
+ ARCH = arm
+ HAVE_NEON = 0
+
+ STATIC_LINKING = 1
+
# Xbox 360
else ifeq ($(platform), xenon)
TARGET := $(TARGET_NAME)_libretro_xenon360.a
# QNX
else ifeq ($(platform), qnx)
TARGET := $(TARGET_NAME)_libretro_qnx.so
+ fpic := -fPIC
CC = qcc -Vgcc_ntoarmv7le
CC_AS = $(CC)
HAVE_NEON = 1
ARCH = arm
CFLAGS += -D__BLACKBERRY_QNX__ -marm -mcpu=cortex-a9 -mtune=cortex-a9 -mfpu=neon -mfloat-abi=softfp
ASFLAGS += -mcpu=cortex-a9 -mfpu=neon -mfloat-abi=softfp
+ MAIN_LDLIBS += -lsocket
+ LIBPTHREAD :=
+ LIBDL :=
+
+#Raspberry Pi 2
+else ifeq ($(platform), rpi2)
+ TARGET := $(TARGET_NAME)_libretro.so
+ fpic := -fPIC
+ CFLAGS += -marm -mcpu=cortex-a7 -mfpu=neon-vfpv4 -mfloat-abi=hard
+ ASFLAGS += -mcpu=cortex-a7 -mfpu=neon-vfpv4 -mfloat-abi=hard
+ HAVE_NEON = 1
+ ARCH = arm
+ BUILTIN_GPU = neon
+ USE_DYNAREC = 1
+
+#Raspberry Pi 3
+else ifeq ($(platform), rpi3)
+ TARGET := $(TARGET_NAME)_libretro.so
+ fpic := -fPIC
+ CFLAGS += -marm -mcpu=cortex-a53 -mfpu=neon-fp-armv8 -mfloat-abi=hard
+ ASFLAGS += -mcpu=cortex-a53 -mfpu=neon-fp-armv8 -mfloat-abi=hard
+ HAVE_NEON = 1
+ ARCH = arm
+ BUILTIN_GPU = neon
+ USE_DYNAREC = 1
# ARM
else ifneq (,$(findstring armv,$(platform)))
TARGET := $(TARGET_NAME)_libretro.so
- SHARED := -shared -Wl,--no-undefined
+ fpic := -fPIC
DRC_CACHE_BASE = 0
ifneq (,$(findstring cortexa8,$(platform)))
CFLAGS += -marm -mcpu=cortex-a8
# Windows
else
TARGET := $(TARGET_NAME)_libretro.dll
- CC = gcc
- fpic := -fPIC
- LD_FLAGS := -fPIC
- SHARED := -shared -static-libgcc -static-libstdc++ -s -Wl,--version-script=libretro/link.T
- CFLAGS += -D__WIN32__ -D__WIN32_LIBRETRO__
+ MAIN_LDFLAGS += -static-libgcc -static-libstdc++ -s
+ CFLAGS += -D__WIN32__
MMAP_WIN32=1
-endif
-
-CFLAGS += -fPIC
-ifeq ($(platform),win)
MAIN_LDLIBS += -lws2_32
-else ifneq ($(platform),qnx)
- LDLIBS += -lpthread
- MAIN_LDLIBS += -ldl
+ LIBPTHREAD :=
+ LIBDL :=
endif
+
+CFLAGS += $(fpic)
MAIN_LDFLAGS += -shared
-MAIN_LDLIBS += -lm -lz
-EXTRA_LDFLAGS =
+MAIN_LDLIBS += $(LIBPTHREAD) $(LIBDL) $(LIBZ)
+
+# try to autodetect stuff for the lazy
+ifndef ARCH
+ARCH = $(shell $(CC) -dumpmachine | awk -F- '{print $$1}')
+endif
+ifndef HAVE_NEON
+HAVE_NEON = $(shell $(CC) -E -dD - < /dev/null 2> /dev/null | grep -q __ARM_NEON__ && echo 1 || echo 0)
+endif
+ifeq ($(NO_UNDEF_CHECK)$(shell ld -v 2> /dev/null | awk '{print $$1}'),GNU)
+MAIN_LDFLAGS += -Wl,--no-undefined
+endif
# try to autodetect stuff for the lazy
ifndef ARCH
PLUGINS =
NO_CONFIG_MAK = yes
+libretro_all: all
+ifeq ($(platform),ios)
+ifeq ($(USE_DYNAREC),1)
+ make -f Makefile.libretro USE_DYNAREC=0 platform=$(platform) clean
+ make -f Makefile.libretro USE_DYNAREC=0 platform=$(platform)
+endif
+endif
+
include Makefile
# no special AS needed for gpu_neon
+++ /dev/null
-<?xml version="1.0" encoding="UTF-8" standalone="no"?>
-<?fileVersion 4.0.0?>
-
-<cproject storage_type_id="org.eclipse.cdt.core.XmlProjectDescriptionStorage">
- <storageModule moduleId="org.eclipse.cdt.core.settings">
- <cconfiguration id="com.qnx.qcc.toolChain.1762498539">
- <storageModule buildSystemId="org.eclipse.cdt.managedbuilder.core.configurationDataProvider" id="com.qnx.qcc.toolChain.1762498539" moduleId="org.eclipse.cdt.core.settings" name="Device-Debug">
- <externalSettings/>
- <extensions>
- <extension id="com.qnx.tools.ide.qde.core.QDEBynaryParser" point="org.eclipse.cdt.core.BinaryParser"/>
- <extension id="org.eclipse.cdt.core.GmakeErrorParser" point="org.eclipse.cdt.core.ErrorParser"/>
- <extension id="org.eclipse.cdt.core.CWDLocator" point="org.eclipse.cdt.core.ErrorParser"/>
- <extension id="org.eclipse.cdt.core.GCCErrorParser" point="org.eclipse.cdt.core.ErrorParser"/>
- </extensions>
- </storageModule>
- <storageModule moduleId="cdtBuildSystem" version="4.0.0">
- <configuration artifactName="${ProjName}" buildProperties="" description="" id="com.qnx.qcc.toolChain.1762498539" name="Device-Debug" parent="org.eclipse.cdt.build.core.emptycfg">
- <folderInfo id="com.qnx.qcc.toolChain.1762498539.1561488424" name="/" resourcePath="">
- <toolChain id="com.qnx.qcc.toolChain.682312592" name="com.qnx.qcc.toolChain" superClass="com.qnx.qcc.toolChain">
- <option id="com.qnx.qcc.option.os.1720929524" name="Target OS:" superClass="com.qnx.qcc.option.os"/>
- <option id="com.qnx.qcc.option.cpu.2107899725" name="Target CPU:" superClass="com.qnx.qcc.option.cpu" value="com.qnx.qcc.option.gen.cpu.armle-v7" valueType="enumerated"/>
- <option id="com.qnx.qcc.option.compiler.596535986" name="Compiler:" superClass="com.qnx.qcc.option.compiler"/>
- <option id="com.qnx.qcc.option.runtime.742171011" name="Runtime:" superClass="com.qnx.qcc.option.runtime"/>
- <targetPlatform archList="all" binaryParser="com.qnx.tools.ide.qde.core.QDEBynaryParser" id="com.qnx.qcc.targetPlatform.982231418" osList="all" superClass="com.qnx.qcc.targetPlatform"/>
- <builder arguments="-C .. -f Makefile.libretro platform=qnx" command="make" id="com.qnx.qcc.toolChain.1762498539.480897078" keepEnvironmentInBuildfile="false" managedBuildOn="false" name="Gnu Make Builder" superClass="org.eclipse.cdt.build.core.settings.default.builder"/>
- <tool id="com.qnx.qcc.tool.compiler.267897021" name="QCC Compiler" superClass="com.qnx.qcc.tool.compiler">
- <option id="com.qnx.qcc.option.compiler.optlevel.1293751119" name="Optimization Level" superClass="com.qnx.qcc.option.compiler.optlevel" value="com.qnx.qcc.option.compiler.optlevel.0" valueType="enumerated"/>
- <option id="com.qnx.qcc.option.compiler.includePath.365274483" name="Include Directories (-I)" superClass="com.qnx.qcc.option.compiler.includePath" valueType="includePath">
- <listOptionValue builtIn="false" value="${QNX_TARGET}/usr/include/freetype2"/>
- <listOptionValue builtIn="false" value="${QNX_TARGET}/../target-override/usr/include"/>
- </option>
- <inputType id="com.qnx.qcc.inputType.compiler.116424583" superClass="com.qnx.qcc.inputType.compiler"/>
- </tool>
- <tool id="com.qnx.qcc.tool.assembler.1307903249" name="QCC Assembler" superClass="com.qnx.qcc.tool.assembler">
- <inputType id="com.qnx.qcc.inputType.assembler.1838739065" superClass="com.qnx.qcc.inputType.assembler"/>
- </tool>
- <tool id="com.qnx.qcc.tool.linker.1852803277" name="QCC Linker" superClass="com.qnx.qcc.tool.linker"/>
- <tool id="com.qnx.qcc.tool.archiver.1682937256" name="QCC Archiver" superClass="com.qnx.qcc.tool.archiver"/>
- </toolChain>
- </folderInfo>
- </configuration>
- </storageModule>
- <storageModule moduleId="org.eclipse.cdt.core.externalSettings"/>
- </cconfiguration>
- <cconfiguration id="com.qnx.qcc.toolChain.1815033502">
- <storageModule buildSystemId="org.eclipse.cdt.managedbuilder.core.configurationDataProvider" id="com.qnx.qcc.toolChain.1815033502" moduleId="org.eclipse.cdt.core.settings" name="Device-Release">
- <externalSettings/>
- <extensions>
- <extension id="com.qnx.tools.ide.qde.core.QDEBynaryParser" point="org.eclipse.cdt.core.BinaryParser"/>
- <extension id="org.eclipse.cdt.core.GmakeErrorParser" point="org.eclipse.cdt.core.ErrorParser"/>
- <extension id="org.eclipse.cdt.core.CWDLocator" point="org.eclipse.cdt.core.ErrorParser"/>
- <extension id="org.eclipse.cdt.core.GCCErrorParser" point="org.eclipse.cdt.core.ErrorParser"/>
- </extensions>
- </storageModule>
- <storageModule moduleId="cdtBuildSystem" version="4.0.0">
- <configuration artifactName="${ProjName}" buildProperties="" description="" id="com.qnx.qcc.toolChain.1815033502" name="Device-Release" parent="org.eclipse.cdt.build.core.emptycfg">
- <folderInfo id="com.qnx.qcc.toolChain.1815033502.1093640979" name="/" resourcePath="">
- <toolChain id="com.qnx.qcc.toolChain.1811843468" name="com.qnx.qcc.toolChain" superClass="com.qnx.qcc.toolChain">
- <option id="com.qnx.qcc.option.os.66936807" name="Target OS:" superClass="com.qnx.qcc.option.os"/>
- <option id="com.qnx.qcc.option.cpu.1884625209" name="Target CPU:" superClass="com.qnx.qcc.option.cpu" value="com.qnx.qcc.option.gen.cpu.armle-v7" valueType="enumerated"/>
- <option id="com.qnx.qcc.option.compiler.903071639" name="Compiler:" superClass="com.qnx.qcc.option.compiler"/>
- <option id="com.qnx.qcc.option.runtime.901433789" name="Runtime:" superClass="com.qnx.qcc.option.runtime"/>
- <targetPlatform archList="all" binaryParser="com.qnx.tools.ide.qde.core.QDEBynaryParser" id="com.qnx.qcc.targetPlatform.1169345860" osList="all" superClass="com.qnx.qcc.targetPlatform"/>
- <builder id="com.qnx.qcc.toolChain.1815033502.1831895405" keepEnvironmentInBuildfile="false" managedBuildOn="false" name="Gnu Make Builder" superClass="org.eclipse.cdt.build.core.settings.default.builder"/>
- <tool id="com.qnx.qcc.tool.compiler.401658009" name="QCC Compiler" superClass="com.qnx.qcc.tool.compiler">
- <option id="com.qnx.qcc.option.compiler.optlevel.20820451" name="Optimization Level" superClass="com.qnx.qcc.option.compiler.optlevel" value="com.qnx.qcc.option.compiler.optlevel.0" valueType="enumerated"/>
- <option id="com.qnx.qcc.option.compiler.includePath.2022402746" name="Include Directories (-I)" superClass="com.qnx.qcc.option.compiler.includePath" valueType="includePath">
- <listOptionValue builtIn="false" value="${QNX_TARGET}/usr/include/freetype2"/>
- <listOptionValue builtIn="false" value="${QNX_TARGET}/../target-override/usr/include"/>
- </option>
- <inputType id="com.qnx.qcc.inputType.compiler.1180700251" superClass="com.qnx.qcc.inputType.compiler"/>
- </tool>
- <tool id="com.qnx.qcc.tool.assembler.1403530230" name="QCC Assembler" superClass="com.qnx.qcc.tool.assembler">
- <inputType id="com.qnx.qcc.inputType.assembler.1360707586" superClass="com.qnx.qcc.inputType.assembler"/>
- </tool>
- <tool id="com.qnx.qcc.tool.linker.577346665" name="QCC Linker" superClass="com.qnx.qcc.tool.linker"/>
- <tool id="com.qnx.qcc.tool.archiver.637344581" name="QCC Archiver" superClass="com.qnx.qcc.tool.archiver"/>
- </toolChain>
- </folderInfo>
- </configuration>
- </storageModule>
- <storageModule moduleId="org.eclipse.cdt.core.externalSettings"/>
- </cconfiguration>
- <cconfiguration id="com.qnx.qcc.toolChain.1271074456">
- <storageModule buildSystemId="org.eclipse.cdt.managedbuilder.core.configurationDataProvider" id="com.qnx.qcc.toolChain.1271074456" moduleId="org.eclipse.cdt.core.settings" name="Simulator-Debug">
- <externalSettings/>
- <extensions>
- <extension id="com.qnx.tools.ide.qde.core.QDEBynaryParser" point="org.eclipse.cdt.core.BinaryParser"/>
- <extension id="org.eclipse.cdt.core.GmakeErrorParser" point="org.eclipse.cdt.core.ErrorParser"/>
- <extension id="org.eclipse.cdt.core.CWDLocator" point="org.eclipse.cdt.core.ErrorParser"/>
- <extension id="org.eclipse.cdt.core.GCCErrorParser" point="org.eclipse.cdt.core.ErrorParser"/>
- </extensions>
- </storageModule>
- <storageModule moduleId="cdtBuildSystem" version="4.0.0">
- <configuration artifactName="${ProjName}" buildProperties="" description="" id="com.qnx.qcc.toolChain.1271074456" name="Simulator-Debug" parent="org.eclipse.cdt.build.core.emptycfg">
- <folderInfo id="com.qnx.qcc.toolChain.1271074456.2095507025" name="/" resourcePath="">
- <toolChain id="com.qnx.qcc.toolChain.563285451" name="com.qnx.qcc.toolChain" superClass="com.qnx.qcc.toolChain">
- <option id="com.qnx.qcc.option.os.2028959839" name="Target OS:" superClass="com.qnx.qcc.option.os"/>
- <option id="com.qnx.qcc.option.cpu.460119393" name="Target CPU:" superClass="com.qnx.qcc.option.cpu"/>
- <option id="com.qnx.qcc.option.compiler.318948553" name="Compiler:" superClass="com.qnx.qcc.option.compiler"/>
- <option id="com.qnx.qcc.option.runtime.1244314155" name="Runtime:" superClass="com.qnx.qcc.option.runtime"/>
- <targetPlatform archList="all" binaryParser="com.qnx.tools.ide.qde.core.QDEBynaryParser" id="com.qnx.qcc.targetPlatform.2005367550" osList="all" superClass="com.qnx.qcc.targetPlatform"/>
- <builder id="com.qnx.qcc.toolChain.1271074456.325666051" keepEnvironmentInBuildfile="false" managedBuildOn="false" name="Gnu Make Builder" superClass="org.eclipse.cdt.build.core.settings.default.builder"/>
- <tool id="com.qnx.qcc.tool.compiler.821983732" name="QCC Compiler" superClass="com.qnx.qcc.tool.compiler">
- <option id="com.qnx.qcc.option.compiler.optlevel.1701209030" name="Optimization Level" superClass="com.qnx.qcc.option.compiler.optlevel" value="com.qnx.qcc.option.compiler.optlevel.0" valueType="enumerated"/>
- <option id="com.qnx.qcc.option.compiler.includePath.1616908655" name="Include Directories (-I)" superClass="com.qnx.qcc.option.compiler.includePath" valueType="includePath">
- <listOptionValue builtIn="false" value="${QNX_TARGET}/usr/include/freetype2"/>
- <listOptionValue builtIn="false" value="${QNX_TARGET}/../target-override/usr/include"/>
- </option>
- <inputType id="com.qnx.qcc.inputType.compiler.1059435667" superClass="com.qnx.qcc.inputType.compiler"/>
- </tool>
- <tool id="com.qnx.qcc.tool.assembler.1920350417" name="QCC Assembler" superClass="com.qnx.qcc.tool.assembler">
- <inputType id="com.qnx.qcc.inputType.assembler.618235584" superClass="com.qnx.qcc.inputType.assembler"/>
- </tool>
- <tool id="com.qnx.qcc.tool.linker.1321150712" name="QCC Linker" superClass="com.qnx.qcc.tool.linker"/>
- <tool id="com.qnx.qcc.tool.archiver.1860233844" name="QCC Archiver" superClass="com.qnx.qcc.tool.archiver"/>
- </toolChain>
- </folderInfo>
- </configuration>
- </storageModule>
- <storageModule moduleId="org.eclipse.cdt.core.externalSettings"/>
- </cconfiguration>
- </storageModule>
- <storageModule moduleId="cdtBuildSystem" version="4.0.0">
- <project id="pcsx_rearmed.null.446260429" name="pcsx_rearmed"/>
- </storageModule>
- <storageModule moduleId="scannerConfiguration">
- <autodiscovery enabled="true" problemReportingEnabled="true" selectedProfileId="com.qnx.tools.ide.qde.managedbuilder.core.qccScannerInfo"/>
- <scannerConfigBuildInfo instanceId="com.qnx.qcc.toolChain.1815033502">
- <autodiscovery enabled="true" problemReportingEnabled="true" selectedProfileId="com.qnx.tools.ide.qde.managedbuilder.core.qccScannerInfo"/>
- </scannerConfigBuildInfo>
- <scannerConfigBuildInfo instanceId="com.qnx.qcc.toolChain.1762498539">
- <autodiscovery enabled="true" problemReportingEnabled="true" selectedProfileId="com.qnx.tools.ide.qde.managedbuilder.core.qccScannerInfo"/>
- </scannerConfigBuildInfo>
- <scannerConfigBuildInfo instanceId="com.qnx.qcc.toolChain.1271074456">
- <autodiscovery enabled="true" problemReportingEnabled="true" selectedProfileId="com.qnx.tools.ide.qde.managedbuilder.core.qccScannerInfo"/>
- </scannerConfigBuildInfo>
- </storageModule>
- <storageModule moduleId="refreshScope" versionNumber="1">
- <resource resourceType="PROJECT" workspacePath="/pcsx_rearmed"/>
- </storageModule>
-</cproject>
+++ /dev/null
-<?xml version="1.0" encoding="UTF-8"?>
-<projectDescription>
- <name>pcsx_rearmed</name>
- <comment></comment>
- <projects>
- </projects>
- <buildSpec>
- <buildCommand>
- <name>org.eclipse.cdt.managedbuilder.core.genmakebuilder</name>
- <triggers>clean,full,incremental,</triggers>
- <arguments>
- <dictionary>
- <key>?name?</key>
- <value></value>
- </dictionary>
- <dictionary>
- <key>org.eclipse.cdt.make.core.append_environment</key>
- <value>true</value>
- </dictionary>
- <dictionary>
- <key>org.eclipse.cdt.make.core.autoBuildTarget</key>
- <value>all</value>
- </dictionary>
- <dictionary>
- <key>org.eclipse.cdt.make.core.buildArguments</key>
- <value>-C .. -f Makefile.libretro platform=qnx</value>
- </dictionary>
- <dictionary>
- <key>org.eclipse.cdt.make.core.buildCommand</key>
- <value>make</value>
- </dictionary>
- <dictionary>
- <key>org.eclipse.cdt.make.core.cleanBuildTarget</key>
- <value>clean</value>
- </dictionary>
- <dictionary>
- <key>org.eclipse.cdt.make.core.contents</key>
- <value>org.eclipse.cdt.make.core.activeConfigSettings</value>
- </dictionary>
- <dictionary>
- <key>org.eclipse.cdt.make.core.enableAutoBuild</key>
- <value>false</value>
- </dictionary>
- <dictionary>
- <key>org.eclipse.cdt.make.core.enableCleanBuild</key>
- <value>true</value>
- </dictionary>
- <dictionary>
- <key>org.eclipse.cdt.make.core.enableFullBuild</key>
- <value>true</value>
- </dictionary>
- <dictionary>
- <key>org.eclipse.cdt.make.core.fullBuildTarget</key>
- <value>all</value>
- </dictionary>
- <dictionary>
- <key>org.eclipse.cdt.make.core.stopOnError</key>
- <value>true</value>
- </dictionary>
- <dictionary>
- <key>org.eclipse.cdt.make.core.useDefaultBuildCmd</key>
- <value>false</value>
- </dictionary>
- </arguments>
- </buildCommand>
- <buildCommand>
- <name>org.eclipse.cdt.managedbuilder.core.ScannerConfigBuilder</name>
- <triggers>full,incremental,</triggers>
- <arguments>
- </arguments>
- </buildCommand>
- <buildCommand>
- <name>com.qnx.tools.bbt.xml.core.bbtXMLValidationBuilder</name>
- <arguments>
- </arguments>
- </buildCommand>
- </buildSpec>
- <natures>
- <nature>org.eclipse.cdt.core.cnature</nature>
- <nature>org.eclipse.cdt.managedbuilder.core.managedBuildNature</nature>
- <nature>org.eclipse.cdt.managedbuilder.core.ScannerConfigNature</nature>
- <nature>com.qnx.tools.ide.bbt.core.bbtnature</nature>
- </natures>
-</projectDescription>
+++ /dev/null
-#!/bin/bash -e
-
-NAME=`head debian/changelog -n1 | sed -n 's/^\(.*\) (\(.*\)) .*/\1-\2/p'`
-[[ -z $NAME ]] && { echo "Could not extract package name and version from debian/changelog" 2>&1; exit 1; }
-
-rm -rf ../$NAME
-cp -r ../`basename $PWD` ../$NAME
-cd ../$NAME
-rm -rf .git*
-find . -depth -name .svn -type d -exec rm -r {} \;
-find . -name '*~' -exec rm {} \;
-
-LD_LIBRARY_PATH=/usr/lib dpkg-buildpackage -rfakeroot $*
+++ /dev/null
-pcsxrearmed (0.4.0.14.13) unstable; urgency=low
-
- * Updated source to notaz git version
-
- -- sakya <sakya_tg@yahoo.it> Fri, 15 Feb 2013 12:50:28 +0200
-
-pcsxrearmed (0.4.0.14.12) unstable; urgency=low
-
- * Fixed a problem with controller and vibration (Gran Turismo 2, Wipeout 3)
- * Added dependency to libts
-
- -- sakya <sakya_tg@yahoo.it> Wed, 16 May 2012 17:09:33 +0200
-
-pcsxrearmed (0.4.0.14.11) unstable; urgency=low
-
- * Added option -guncon and -gunnotrigger to activate guncon controller type
-
- -- sakya <sakya_tg@yahoo.it> Wed, 16 May 2012 09:37:12 +0200
-
-pcsxrearmed (0.4.0.14.10) unstable; urgency=low
-
- * Added option -corners to set action to execute when clicking on display corners
- * Fixed problem with notification using gles plugin
- * Fixed controller problem with game "Heart Of Darkness" (maybe others?)
-
- -- sakya <sakya_tg@yahoo.it> Fri, 11 May 2012 16:38:29 +0200
-
-pcsxrearmed (0.4.0.14.9) unstable; urgency=low
-
- * Added support to .mdf extension
- * Added option -vibration to activate vibration
-
- -- sakya <sakya_tg@yahoo.it> Tue, 1 May 2012 12:19:49 +0200
-
-pcsxrearmed (0.4.0.14.8) unstable; urgency=low
-
- * Added option -disc to set the initial disc in multi discs images (used when loading a savestate with -load)
- * Added option -autosave
- * Fixed disc change for multi discs images (PBP)
- * Merged commits from Notaz git
- * drc: inv: fix ram ofset and mirror handling
- * support emulated RAM mapped at offset
-
- -- sakya <sakya_tg@yahoo.it> Fri, 20 Apr 2012 20:27:19 +0200
-
-pcsxrearmed (0.4.0.14.7) unstable; urgency=low
-
- * Fixed -displayon
-
- -- sakya <sakya_tg@yahoo.it> Sun, 15 Apr 2012 17:22:08 +0200
-
-pcsxrearmed (0.4.0.14.6) unstable; urgency=low
-
- * Added option -keys to set the keys config file
- * Fixed L1/L2/R1/R2
- * Added autopause on incoming call
-
- -- sakya <sakya_tg@yahoo.it> Wed, 13 Apr 2012 12:51:35 +0200
-
-pcsxrearmed (0.4.0.14.5) unstable; urgency=low
-
- * Fixed accelerometer using gles
- * Added -analog option to use the accelerometer as the analog pad
- * Added options to set accelerometer sens, max value, y_def
- * Added -displayon option to keep the display on (useful when playing using the accelerometer)
-
- -- sakya <sakya_tg@yahoo.it> Tue, 10 Apr 2012 15:34:11 +0200
-
-pcsxrearmed (0.4.0.14.4) unstable; urgency=low
-
- * Fixed -load option
- * Added disc change (configured a new key)
-
- -- sakya <sakya_tg@yahoo.it> Fri, 06 Apr 2012 13:54:56 +0200
-
-pcsxrearmed (0.4.0.14.3) unstable; urgency=low
-
- * Added options to set various gles settings
- * Fixed save state slot selection
- * Added notification on save state slot change
-
- -- sakya <sakya_tg@yahoo.it> Wed, 04 Apr 2012 10:20:18 +0200
-
-pcsxrearmed (0.4.0.14.2) unstable; urgency=low
-
- * Fixed fullscreen using gpu-gles
- * Fixed crash when saving savestate using gpu-gles
- * Added options to set spu reverb and interpolation (disabled by default)
-
- -- sakya <sakya_tg@yahoo.it> Sun, 01 Apr 2012 11:42:20 +0200
-
-pcsxrearmed (0.4.0.14.1) unstable; urgency=low
-
- * Added option to set psx region (NTSC/PAL/Auto)
- * Use PulseAudio (better audio)
-
- -- sakya <sakya_tg@yahoo.it> Wed, 30 Mar 2012 09:44:51 +0200
-
-pcsxrearmed (0.4.0.14) unstable; urgency=low
-
- * Updated to r14
- * Added --help
- * PCSX4All
-
- -- sakya <sakya_tg@yahoo.it> Sun, 27 Dec 2011 00:02:27 +0200
-
-pcsxrearmed (0.4.0.12.2) unstable; urgency=low
-
- * gpu-gles
-
-
- -- Bonapart <bonapart@programist.ru> Sun, 27 Dec 2011 00:02:27 +0200
+++ /dev/null
-Source: pcsxrearmed
-Section: user/games
-Priority: extra
-Maintainer: Bonapart <bonapart@programist.ru>
-Build-Depends: debhelper (>= 5), zlib1g-dev, libhildon1-dev, libpulse-dev, libasound2-dev, libbz2-dev, libgles1-sgx-img-dev, opengles-sgx-img-common-dev, libosso-dev, libdbus-1-dev, libhildonfm2-dev, libts-dev
-Standards-Version: 3.7.3
-
-Package: pcsxrearmed
-Architecture: armel
-Depends: ${shlibs:Depends}, libts-0.0-0
-Description: Sony PlayStation emulator
-XSBC-Homepage: http://notaz.gp2x.de/pcsx_rearmed.php
-XSBC-Bugtracker: http://notaz.gp2x.de/pcsx_rearmed.php
-XB-Maemo-Display-Name: PCSX-ReArmed
-XB-Maemo-Icon-26:
- iVBORw0KGgoAAAANSUhEUgAAADAAAAAwCAYAAABXAvmHAAAAAXNSR0IArs4c
- 6QAAEStJREFUaN7Fmn+wXVV1xz9r733uufe+e9+DJIRESEICEQghAUQBI8Uo
- ik7jrxm1o+3ooB2RkWrtONqZlhn7Y8bRUVudqVZsoTjFH2CrSKsVEFIQIr8C
- JARC0CDkBwkkIcl7L7n3nLP36h97n3Pvo07/7c2cOfeenB9rr/Vd3/Vd6zxh
- 7DM52b9isj+5YcGC+a9bunTpOVNTU91WK5Msy1ECIgYRMGKxzmGtQQBrHSZ9
- R8C5DOcc1hiMtTjrsM4hAtZYWq1W/H9nyZzDZVk6x9LKWmSteH2rlZNlLhw/
- fnzXszt3fmHjxo13bH74oReBwbbtO6r0ODht5UpnfXXdytOXX+mswVcl1hqc
- swjgQ0BV8T7gfSCEQFBQFFQJqqhquptpHCJiMGIQKxhjsdZircMai8kczibj
- XUaWZdi0d1lGlrVwmdN2nsvypUtZvmwpw7LY8dSTT37yX264/sGgOrNl67ZS
- AFavPudTF5y76u9fOniQZ3/7PLPHjuG9Z8wSJO7QeAABVIW0DFAFBEVANF0j
- AGh9XBWV9L3eRFAx6dr6XFDiMWMNy049VS9Yu4o/et+7xBj78u5duz78lS9/
- 8U6UoZx59lnZ2StXbMP7lT+7cyNFUWCsbQwmyLhTo1EiydvpSFogIpiIMQST
- zhOMMSAmnmcMIhYxgogFYxBjEYnnYOIWn2OjA4IiRjhj+TL98uc/K5X3W7Zs
- 2fKBf/72Pz5tZmdmz5jodJZtfeppyqqK+LQx3EYtpm0wRChYazBWMCYaasRg
- TFwAUu/TsgyIiecytkAxBjG1sTZuzfe4GIwDk4GxqMmQLAdx7PjNs/KNG75H
- 3srWLFmy5E3P79rj7Omnr7is08o+8Otnn6MYFtGIErQCyZXsqxW6B3S3gQqw
- /I6PNgEZwSPmQAMVYxERVCSSQTI8et4iYtF6MckhcXECJuWSGPbvf1EvumCN
- nDA1taIoypuNr6pFg6JgMEjGe2Ch0vpmSXdnQeuqQPeeivZtBbI6oIWiKJqS
- WLU2vM6POh2SIZjEXpIMtglGdSTib9IxEsSoFy9mBFtjmTleyJ33bMIYOevQ
- oUMnuLIs5w+LkuCr+HAP+dcqWu8PFD8SZAEwA9kGxawuOXZeBjMGXJ0BNMk4
- gpIZYbr2ZvJ6hJBrftcLEGPTfVJ+EBcfUo6pgohQhMCBgwdB4fDhw5MG6JdV
- RQgKQZAO2IuVMIDB+xzhcWF4lWP4FUPYZJATf1dCp0ROxps69LXR1mGsTZtD
- TNrbWE/i9/jbmFEiRx6oCSCRRHJZURTMzMx0nUK7LD2KIgZ0CPoM2KWQf8tj
- TlPkZGX4GRdNdiTvzzW+Nrg2voaIqb1uHUYsYm2KRNxURnBSTfdB4k5r6q0x
- qogIIShFWVKWZWa8962y8g0eRGH4GYd/Usg/GsjerHQ2VnRuK7GvC6iXhjpH
- xo+MyPOcdruNsTZyughiXFxI42mHuAyswzgLNrGRNWANYg1gUCOoMQ2DYUZ5
- JgKqahxI5n0Y4cJBeMxw7LwM+6ZA62880o454C4rmb1U4AkLrXHjY6UNqpx6
- ymKm+n2qEBgUFUemZzk8PYsPinMxIsa6xDAR71rXjFj/CJo8WdNDXeQTY4iA
- tZHVnKo61VBfCW3FXqzoUCl/bnB/ECj+0uGurGj/bcBdESifcBGLKQIN5oFu
- p8OCBfPpdDp0u13yvI1X5fnd+9jx210cOjJDnmUY4yLOE9xACEmamHoRQZtF
- aar0oBgxOJfFBYgxTjXxeGVgnqdzd4nuh9mLshizFkieHDKcyzam5nNjICjt
- djS81+sxMTHB5OQkvV6P89euoZXn3Pfgo9y16RGKMiDWRu8bQVTQEEAiPQsh
- KoAwqjApDBgjZM5F54mIa5IwA31OKL5kMYthYkeJe2ege39Bfm3Ab4fqJy7i
- PVjEW/AGCel3sHTb0fh+v8/k5CQ+KEemZ+h0u8yfN48PvvddXPvpq5ma6qMK
- 1goGk2qdIKYmZlMrLiBE+ISAAkaELMswxohx1mZSaxgBnFD8hePYBx3V92PW
- hEeFwecyjr+lA7stsgDMUkWWhLidGpBXBWRxQPvKZH+yWcA9v9rMN2+8mWd2
- Pk+/36fX6/G615zHtZ++GucsqpIkR6obgJFXVPfa+QliYgwuy7DW4sQYGdFg
- UsMC1fct1Q8c+ZdKqq9lhBds1D3WYt8zwP3JMNFc/RTBiPLcXdtZ9/LFdHtd
- +v0+/ck+Yi0vHXyZXq9Ht9ul3W5z2bqLeNsb13HrHffQytvUVdSIRPyPVfna
- +HpJxiSpL4LTEDAxHFFC12IssUz51y2oBNOSVPqF8MMu1X90QWykR7EY46iq
- ite89VImzp6Ixvf7tLIW1rbodDtMTEzQ6XTI85w8z7nowvP54U/vJs9Hyanq
- myKpKKIpAppEsWqCXhRlTlUxSbvXJTtSlYyS1tTcnKrt0CKFbSqqcZHnfeVY
- 0DupMb7X65HlOVhD3mo33s/znCzLWLl8Ka08IxBtUA1NUBVFJeoukdg0ee+Z
- mZllMBwgCM45cSGEEPHX0OzcRqaWv4y+R/GVqmqSCJJ6iM5Ep2GeXq9H1soR
- sWSt1hzjsyxj3oknMJG3KGqmqTsmiaCvo1BWnmJYUJRDKu9HjZIqzhijseSb
- RlXW+zoqkSJMoyZreWDHKms8Bt1urzG+1+vhsgwjllaWkef5qB+2lsoHfEj8
- PoZ3QQjeU5QFRVFSlRUh+Oa8qIK1gVAwxozEWLpN3Tr6oIhRjIJY0yhHsbEB
- qQWaMRapPN1uh36/z8TEBN1ul8xliAHrsjnGG2PY88I+Zo4dZ6I3EVnHB4qy
- ZDgYUpYVGkJqbUO0SAEJqAYq72MEAG+SFtc6DwREU6+bIhCA4AMWgzhpEnek
- c2KE6iJWV+I4jbA4Z2vubqK96aHHokQuo5eHRYEGT0hDBG0wLU0VltRi+qqK
- CxARX+uKV+J/1HhHcRXVo+C9EvB4FWwAYwLz5p+IwZC1crrdLp1Oh3a7jRhD
- 5QODwSAZBoPhkLvv/RXfuP4mPIbS+5iA49t4m9QcjwUt+EBRFrV0I4y8ImOV
- Q5qOKiZzrUINKlBVnrzlWLFsCWefdQbr113CLx94BCNCp9Oh0+nQarWoqujZ
- m370U3bs3MWik+Zx5OhRfnHPJnrdLsOyZPr4MarKY63BGtMYKnXhIsKmXogP
- nqIogajuGwjVTKQyd+yROnQCUJYVJ05NsWb1Kt74hks4c+XpnPKqxfT7fZ58
- 5lmyVqsxPsuilsqtsPrMM7jktWs5/bRl9HtdrvnYh7HWMhgMefHAQR7c/Dg/
- u3Mjj27djnEWI6aJQNJ0zcd7T1EMI4RUtaqTamxWMoJOUoo+KKcsWsglF13I
- 773hEk6av4B+vzcnYV8+fKQpUs45nHMcPTrNT757Heede04zwfhfcAXeuv5S
- Pvepj3PHXffw2c9/kWd378Vg0DAXRqrgK89gMCSEMJbEafxBrVoZNS55nnP5
- G9dx+frLmgJVU+TR6Vnu+O/7+Pdb/4vHt2zjfe/ZEKdsaTRTVSWLTl6Ic5ay
- qjg2e4ytTz3NDf96C4889jjHBkP+/E+v5sMfeC/tPOcdb38LU/0+7//jT3J0
- enpsXDDKCx88xTAtQKFsIKRjA6t6WqZw9qvP4PL1lzE5OcnExATtdocHHn6M
- +x/azP0PPkorb7P23HO4MG8nre6oqdmK4cCBg+zavYc77v4lP7/rHrZse4oz
- Vqxg7bnn8o4r1vPmy9Y1zATw4oGDBO/RkPJRx1pKjRAaDCMpOIGqSWIZTdqU
- URIfPjpNnrdHnncZe/e/xAknnMDVH/0Q6y+9hFVnvZp/+s73CaqM15V+v8s1
- n72W5/fsY3Z2lt9/y3o+9fErOX/NOSxfthTnRoOmF/bt58bv3sz1N93CzOzs
- qJGRxEAoSCB4z3A4yoFiVAdovB6naQYV4bnd+/jCV7/BuzdcwaVvuJjTly/i
- z675GO12m06n00gDl2WNWhyfXBw9Ms2nr7qSd2+4gkUnL6Tdzkd5oPCrBx/m
- m9d/h433PcjR6RmGRTXWTupcFKnifcWwzgERKWMEatYZCdjxAe2uF/bxtW/d
- yNe/fSNrV69i1dmvZvHCRbSyDLGW/fv38/O77uX1//CVOcl5+MhRbv/xTSw6
- eWGjX7z3TE9P88Nbf8oNN93MY1ufjHoqiUljYncW6sSlrgFRRnhfMSzqHFAt
- jJFGsMXRRuR+bSZjMULORSmxdfuveXzbMzFlxiYS5XDI3n37eenAQebPOzFC
- CeLMCXjpwEGe3P4Mt/zoNv7z9l/w/J59KYKt6NwxxlFlrIAx+h0ghEAxLOIC
- gmpRj/5C7XV5xfiiRkRiVWcdtOq5T2z9xBjaeYu/+uLf8YN/u5ULzlvNhisu
- ZzAcsOnBh9m9dy+3/+JeNm95giNHZ8haGZNT/cjxGtvGKB9CQkpACQRCwkBI
- 8jouoCxLvPfqNIRBnQOicY6TXBvlrMaGew60dCT8JIUcBWMNBw4d5t5ND3Pf
- A4/wvVt+wuzsMbZt/zXT09MMyxJjLZ1Op1GUUmuexsPjsoH4m7lsFEKgrLXQ
- KInndIdzJs9xRhPHHLFKayrtBiQZks4REWxm0QAHXz4MCoNiCBiyzKVnNJiI
- 9wmRYXTMeG2eERKca4qJLBRqNaqqRZ7nWOua1q2REPWKAs1UTALxfVkawMYb
- +9F8RxQNZvz9B6iMTbLjTUMIc7yu9Z4wFoUR89T72ODXL0oEZ4yUcQFWVcbZ
- TZtmRhtRFXm4rtIRXqnZVghGRzYzPmtPhKraDK8aVtG52J/LOjp6hUVI3lVE
- RK2NswsHlK34llCa7BeNuKd2uU0tTkA1hiJG1qNqmh6C1F01EJyzklFyJspJ
- JBNSDigStDlWGz96AZGco4qNr31qOS1F1spod9ujKXP9Uq5OgWa0B0ZHN2s8
- Qz3XTBBibpvYxLSBgI4aljpx0Yb3m1eHiaHGtZ8I5O0cUMqy9KaqyuPe+4OL
- Fy4kc07rmzH2kDjqCOnBPr4F0YCGufuAJwSPBo+G6hVbOlc9IV2j9bWEdN8k
- F9SPYEZgjH5oOdHFCxcwHBb7q6oqzNGj00cOHjz05No1q1lw4qSoD801UlfC
- Bn5a3yfOMTUWn7gF8CkR/4+NEFknfq/vXz9z9LwRtBI0gxK8Z+H8E2XtmtXs
- 3bv38enp6VlzbHb25W3bnnhANQzeseFtKBWVL0bYk9jU61jySTP1Do2XGsrT
- MOa5sU1HXZXq+LFRtyK11yXMmciB4qsCoeRd73w7RVEc37x586YjR44ctsba
- 7NChQ3m73T7ltRe+Zumac1ax9Yltenx6RsSmF26M6aRxlkpo1zQASEgevQTU
- MRgSKTJomHMMJb7pb/7RRDbWBk91/DiTUxN6zVUfkWVLlnDvvffed//99/8Y
- +I0VkWCtMc/s2DHw3i9at+71C996+Xrp9Sd01/O7ZHD8GASP+gpClfbxt097
- rY/7ilAlvPt4bHwLVUmo4n1COten65rzqmL0PXgmum3eueEK/ciH/lBOmJrU
- 2267bevtt9/+XeBRYJ8Att3OT6oqf6b3/pJ58+a96ROf+MRFZ5115sTk5JTp
- 93vSzttYF//OwaU/2siyLPatiSqNiXI8TjhoeoIRe0gjr4MGqjI6oKoqyqKk
- KAqGxRBf+TQIGFKWJbMzszozOxt27tw5e9111z1w4MCBO4H7gKeBlwWg3c5b
- 3of5VVWtUNVzgfMvvvji80477bQFS5Ys6VprTd301IaNG2iMaWBR9wKNwa/Y
- 69j8sqoqQhpeeR8Nr+V22sKePXuO7969+6WHHnroseT1x4GdwCGgbFzU7XSy
- wXDYDyGcDKwAlgOLgUmgzf/PZwgcAV4Ank2G7wemgRLgfwDIFWZCNtkwCgAA
- AABJRU5ErkJggg==
+++ /dev/null
-this package was maemonized by Roman Deninberg <bonapart@programist.ru>
-Mon, 10 Jan 2011 02:00:13 +0100
+++ /dev/null
-pcsxrearmed_0.4.0.14.13_armel.deb user/games extra
+++ /dev/null
-pcsx opt/maemo/usr/games/
-plugins/spunull/spunull.so opt/maemo/usr/games/plugins
-plugins/gpu_unai/gpu_unai.so opt/maemo/usr/games/plugins
-#plugins/gpu_unai/gpuPCSX4ALL.so opt/maemo/usr/games/plugins
-plugins/dfxvideo/gpu_peops.so opt/maemo/usr/games/plugins
-plugins/gpu-gles/gpu_gles.so opt/maemo/usr/games/plugins
+++ /dev/null
-#!/usr/bin/make -f
-# -*- makefile -*-
-
-#export DH_VERBOSE=1
-
-DEB_HOST_GNU_TYPE ?= $(shell dpkg-architecture -qDEB_HOST_GNU_TYPE)
-DEB_BUILD_GNU_TYPE ?= $(shell dpkg-architecture -qDEB_BUILD_GNU_TYPE)
-DEB_HOST_ARCH ?= $(shell dpkg-architecture -qDEB_HOST_ARCH)
-
-#GAME_VERSION := $(shell head debian/changelog -n1 | sed -n 's/.* (\(.*\)) .*/\1/p')
-CFLAGS = -Wall -g
-
-ifneq (,$(findstring noopt,$(DEB_BUILD_OPTIONS)))
- CFLAGS += -O0
-else
- CFLAGS += -O2
-endif
-
-build: build-stamp
-
-build-stamp:
- dh_testdir
- ./configure --platform=maemo --gpu=neon --sound-drivers=pulseaudio --enable-neon
- $(MAKE)
- strip pcsx
- strip plugins/gpu_unai/gpu_unai.so
- strip plugins/gpu-gles/gpu_gles.so
- strip plugins/spunull/spunull.so
- touch build-stamp
-
-clean:
- dh_testdir
- dh_testroot
- rm -f build-stamp
- dh_clean
- $(MAKE) clean clean_plugins
-
-install: build
- dh_testdir
- dh_testroot
- dh_installdirs
- mkdir -p "$(CURDIR)"/debian/pcsxrearmed/opt/maemo/usr/games/screenshots
- chmod 777 "$(CURDIR)"/debian/pcsxrearmed/opt/maemo/usr/games/screenshots
- chown user "$(CURDIR)"/debian/pcsxrearmed/opt/maemo/usr/games/screenshots
- dh_install
-
-binary-indep: build install
-
-binary-arch: build install
- dh_testdir
- dh_testroot
- dh_installchangelogs
- dh_installdocs
- #dh_installmenu
- dh_link
- dh_strip
- dh_compress
- dh_fixperms
- dh_installdeb
- dh_makeshlibs
- dh_shlibdeps
- dh_gencontrol
- #maemo-optify
- dh_md5sums
- dh_builddeb
-
-binary: binary-indep binary-arch
-.PHONY: build clean binary-indep binary-arch binary install
+++ /dev/null
-#!/bin/sh
-
-# Wiz's timings are already good, apply this for Caanoo
-if [ -e /dev/accel ]; then
- ./pollux_set "ram_timings=3,9,4,1,1,1,1"
-fi
-
-# the sync mount causes problems when writing saves,
-# probably due to many write calls, so have to get rid of it
-if grep mmcblk /proc/mounts | grep -q '\<sync\>'; then
- oldmount=`grep mmcblk /proc/mounts | grep '\<sync\>' | awk '{print $4}'`
- mount /dev/mmcblk0p1 /mnt/sd/ -o remount,dirsync,noatime
-fi
-
-./pcsx "$@"
-sync
-
-if [ -n "$oldmount" ]; then
- mount /dev/mmcblk0p1 /mnt/sd/ -o remount,$oldmount
-fi
-
-cd /usr/gp2x
-exec ./gp2xmenu
+++ /dev/null
-0 126
-100 -126
-115 0
+++ /dev/null
-0 54
-100 -126
-105 0
+++ /dev/null
-[info]
-name="PCSX ReARMed"
-icon="/pcsx_rearmed/pcsx26.png"
-path="/pcsx_rearmed/pcsx.gpe"
-title="/pcsx_rearmed/pcsxb.png"
-group="GAMES"
+++ /dev/null
-/*
- * quick tool to set various timings for Wiz
- *
- * Copyright (c) Gražvydas "notaz" Ignotas, 2009
- *
- * Redistribution and use in source and binary forms, with or without
- * modification, are permitted provided that the following conditions are met:
- * * Redistributions of source code must retain the above copyright
- * notice, this list of conditions and the following disclaimer.
- * * Redistributions in binary form must reproduce the above copyright
- * notice, this list of conditions and the following disclaimer in the
- * documentation and/or other materials provided with the distribution.
- * * Neither the name of the organization nor the
- * names of its contributors may be used to endorse or promote products
- * derived from this software without specific prior written permission.
- *
- * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS"
- * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE
- * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE
- * ARE DISCLAIMED. IN NO EVENT SHALL COPYRIGHT HOLDER OR CONTRIBUTORS BE LIABLE
- * FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL
- * DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR
- * SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER
- * CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY,
- * OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE
- * OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
- *
- * HTOTAL: X VTOTAL: 341
- * HSWIDTH: 1 VSWIDTH: 0
- * HASTART: 37 VASTART: 17
- * HAEND: 277 VAEND: 337
- *
- * 120Hz
- * pcd 8, 447: + 594us
- * pcd 9, 397: + 36us
- * pcd 10, 357: - 523us
- * pcd 11, 325: +1153us
- *
- * 'lcd_timings=397,1,37,277,341,0,17,337;dpc_clkdiv0=9'
- * 'ram_timings=2,9,4,1,1,1,1'
- */
-
-#include <stdio.h>
-#include <stdlib.h>
-#include <string.h>
-//#include "pollux_set.h"
-#define BINARY
-
-/* parse stuff */
-static int parse_lcd_timings(const char *str, void *data)
-{
- int *lcd_timings = data;
- const char *p = str;
- int ret, c;
- ret = sscanf(str, "%d,%d,%d,%d,%d,%d,%d,%d",
- &lcd_timings[0], &lcd_timings[1], &lcd_timings[2], &lcd_timings[3],
- &lcd_timings[4], &lcd_timings[5], &lcd_timings[6], &lcd_timings[7]);
- if (ret != 8)
- return -1;
- /* skip seven commas */
- for (c = 0; c < 7 && *p != 0; p++)
- if (*p == ',')
- c++;
- if (c != 7)
- return -1;
- /* skip last number */
- while ('0' <= *p && *p <= '9')
- p++;
-
- return p - str;
-}
-
-static int parse_ram_timings(const char *str, void *data)
-{
- int *ram_timings = data;
- const char *p = str;
- int ret, c;
- float cas;
-
- ret = sscanf(p, "%f,%d,%d,%d,%d,%d,%d",
- &cas, &ram_timings[1], &ram_timings[2], &ram_timings[3],
- &ram_timings[4], &ram_timings[5], &ram_timings[6]);
- if (ret != 7)
- return -1;
- if (cas == 2)
- ram_timings[0] = 1;
- else if (cas == 2.5)
- ram_timings[0] = 2;
- else if (cas == 3)
- ram_timings[0] = 3;
- else
- return -1;
- for (c = 0; c < 6 && *p != 0; p++)
- if (*p == ',')
- c++;
- if (c != 6)
- return -1;
- while ('0' <= *p && *p <= '9')
- p++;
-
- return p - str;
-}
-
-static int parse_decimal(const char *str, void *data)
-{
- char *ep;
-
- *(int *)data = strtoul(str, &ep, 10);
- if (ep == str)
- return -1;
-
- return ep - str;
-}
-
-/* validate and apply stuff */
-static int apply_lcd_timings(volatile unsigned short *memregs, void *data)
-{
- int *lcd_timings = data;
- int i;
-
- for (i = 0; i < 8; i++) {
- if (lcd_timings[i] & ~0xffff) {
- fprintf(stderr, "pollux_set: invalid lcd timing %d: %d\n", i, lcd_timings[i]);
- return -1;
- }
- }
-
- for (i = 0; i < 8; i++)
- memregs[(0x307c>>1) + i] = lcd_timings[i];
-
- return 0;
-}
-
-static const struct {
- signed char adj; /* how to adjust value passed by user */
- signed short min; /* range of */
- signed short max; /* allowed values (inclusive) */
-}
-ram_ranges[] = {
- { 0, 1, 3 }, /* cas (cl) */
- { -2, 0, 15 }, /* trc */
- { -2, 0, 15 }, /* tras */
- { 0, 0, 15 }, /* twr */
- { 0, 0, 15 }, /* tmrd */
- { 0, 0, 15 }, /* trp */
- { 0, 0, 15 }, /* trcd */
-};
-
-static int apply_ram_timings(volatile unsigned short *memregs, void *data)
-{
- int *ram_timings = data;
- int i, val;
-
- for (i = 0; i < 7; i++)
- {
- ram_timings[i] += ram_ranges[i].adj;
- if (ram_timings[i] < ram_ranges[i].min || ram_timings[i] > ram_ranges[i].max) {
- fprintf(stderr, "pollux_set: invalid RAM timing %d\n", i);
- return -1;
- }
- }
-
- val = memregs[0x14802>>1] & 0x0f00;
- val |= (ram_timings[4] << 12) | (ram_timings[5] << 4) | ram_timings[6];
- memregs[0x14802>>1] = val;
-
- val = memregs[0x14804>>1] & 0x4000;
- val |= (ram_timings[0] << 12) | (ram_timings[1] << 8) |
- (ram_timings[2] << 4) | ram_timings[3];
- val |= 0x8000;
- memregs[0x14804>>1] = val;
-
- for (i = 0; i < 0x100000 && (memregs[0x14804>>1] & 0x8000); i++)
- ;
-
- return 0;
-}
-
-static int apply_dpc_clkdiv0(volatile unsigned short *memregs, void *data)
-{
- int pcd = *(int *)data;
- int tmp;
-
- if ((pcd - 1) & ~0x3f) {
- fprintf(stderr, "pollux_set: invalid lcd clkdiv0: %d\n", pcd);
- return -1;
- }
-
- pcd = (pcd - 1) & 0x3f;
- tmp = memregs[0x31c4>>1];
- memregs[0x31c4>>1] = (tmp & ~0x3f0) | (pcd << 4);
-
- return 0;
-}
-
-static int apply_cpuclk(volatile unsigned short *memregs, void *data)
-{
- volatile unsigned int *memregl = (volatile void *)memregs;
- int mhz = *(int *)data;
- int adiv, mdiv, pdiv, sdiv = 0;
- int i, vf000, vf004;
-
- // m = MDIV, p = PDIV, s = SDIV
- #define SYS_CLK_FREQ 27
- pdiv = 9;
- mdiv = (mhz * pdiv) / SYS_CLK_FREQ;
- if (mdiv & ~0x3ff)
- return -1;
- vf004 = (pdiv<<18) | (mdiv<<8) | sdiv;
-
- // attempt to keep AHB the divider close to 250, but not higher
- for (adiv = 1; mhz / adiv > 250; adiv++)
- ;
-
- vf000 = memregl[0xf000>>2];
- vf000 = (vf000 & ~0x3c0) | ((adiv - 1) << 6);
- memregl[0xf000>>2] = vf000;
- memregl[0xf004>>2] = vf004;
- memregl[0xf07c>>2] |= 0x8000;
- for (i = 0; (memregl[0xf07c>>2] & 0x8000) && i < 0x100000; i++)
- ;
-
- printf("clock set to %dMHz, AHB set to %dMHz\n", mhz, mhz / adiv);
- return 0;
-}
-
-static int lcd_timings[8];
-static int ram_timings[7];
-static int dpc_clkdiv0;
-static int cpuclk;
-
-static const char lcd_t_help[] = "htotal,hswidth,hastart,haend,vtotal,vswidth,vastart,vaend";
-static const char ram_t_help[] = "CAS,tRC,tRAS,tWR,tMRD,tRP,tRCD";
-
-static const struct {
- const char *name;
- const char *help;
- int (*parse)(const char *str, void *data);
- int (*apply)(volatile unsigned short *memregs, void *data);
- void *data;
-}
-all_params[] = {
- { "lcd_timings", lcd_t_help, parse_lcd_timings, apply_lcd_timings, lcd_timings },
- { "ram_timings", ram_t_help, parse_ram_timings, apply_ram_timings, ram_timings },
- { "dpc_clkdiv0", "divider", parse_decimal, apply_dpc_clkdiv0, &dpc_clkdiv0 },
- { "clkdiv0", "divider", parse_decimal, apply_dpc_clkdiv0, &dpc_clkdiv0 }, /* alias */
- { "cpuclk", "MHZ", parse_decimal, apply_cpuclk, &cpuclk },
-};
-#define ALL_PARAM_COUNT (sizeof(all_params) / sizeof(all_params[0]))
-
-/*
- * set timings based on preformated string
- * returns 0 on success.
- */
-int pollux_set(volatile unsigned short *memregs, const char *str)
-{
- int parsed_params[ALL_PARAM_COUNT];
- int applied_params[ALL_PARAM_COUNT];
- int applied_something = 0;
- const char *p, *po;
- int i, ret;
-
- if (str == NULL)
- return -1;
-
- memset(parsed_params, 0, sizeof(parsed_params));
- memset(applied_params, 0, sizeof(applied_params));
-
- p = str;
- while (1)
- {
-again:
- while (*p == ';' || *p == ' ')
- p++;
- if (*p == 0)
- break;
-
- for (i = 0; i < ALL_PARAM_COUNT; i++)
- {
- int param_len = strlen(all_params[i].name);
- if (strncmp(p, all_params[i].name, param_len) == 0 && p[param_len] == '=')
- {
- p += param_len + 1;
- ret = all_params[i].parse(p, all_params[i].data);
- if (ret < 0) {
- fprintf(stderr, "pollux_set parser: error at %-10s\n", p);
- fprintf(stderr, " valid format is: <%s>\n", all_params[i].help);
- return -1;
- }
- parsed_params[i] = 1;
- p += ret;
- goto again;
- }
- }
-
- /* Unknown param. Attempt to be forward compatible and ignore it. */
- for (po = p; *p != 0 && *p != ';'; p++)
- ;
-
- fprintf(stderr, "unhandled param: ");
- fwrite(po, 1, p - po, stderr);
- fprintf(stderr, "\n");
- }
-
- /* validate and apply */
- for (i = 0; i < ALL_PARAM_COUNT; i++)
- {
- if (!parsed_params[i])
- continue;
-
- ret = all_params[i].apply(memregs, all_params[i].data);
- if (ret < 0) {
- fprintf(stderr, "pollux_set: failed to apply %s (bad value?)\n",
- all_params[i].name);
- continue;
- }
-
- applied_something = 1;
- applied_params[i] = 1;
- }
-
- if (applied_something)
- {
- int c;
- printf("applied: ");
- for (i = c = 0; i < ALL_PARAM_COUNT; i++)
- {
- if (!applied_params[i])
- continue;
- if (c != 0)
- printf(", ");
- printf("%s", all_params[i].name);
- c++;
- }
- printf("\n");
- }
-
- return 0;
-}
-
-#ifdef BINARY
-#include <sys/types.h>
-#include <sys/stat.h>
-#include <fcntl.h>
-#include <sys/mman.h>
-#include <unistd.h>
-
-static void usage(const char *binary)
-{
- int i;
- printf("usage:\n%s <set_str[;set_str[;...]]>\n"
- "set_str:\n", binary);
- for (i = 0; i < ALL_PARAM_COUNT; i++)
- printf(" %s=<%s>\n", all_params[i].name, all_params[i].help);
-}
-
-int main(int argc, char *argv[])
-{
- volatile unsigned short *memregs;
- int ret, memdev;
-
- if (argc != 2) {
- usage(argv[0]);
- return 1;
- }
-
- memdev = open("/dev/mem", O_RDWR);
- if (memdev == -1)
- {
- perror("open(/dev/mem) failed");
- return 1;
- }
-
- memregs = mmap(0, 0x20000, PROT_READ|PROT_WRITE, MAP_SHARED, memdev, 0xc0000000);
- if (memregs == MAP_FAILED)
- {
- perror("mmap(memregs) failed");
- close(memdev);
- return 1;
- }
-
- ret = pollux_set(memregs, argv[1]);
-
- munmap((void *)memregs, 0x20000);
- close(memdev);
-
- return ret;
-}
-#endif
+++ /dev/null
-The skin images can be customized, but there are several limitations:\r
-\r
-background.png - must be 320x240 image with 24bit RGB colors.\r
-font.png - must be 128x160 8bit grayscale image.\r
-selector.png - must be 8x10 8bit grayscale image.\r
-\r
-Font and selector colors can be changed by editing skin.txt.\r
-\r
+++ /dev/null
-// html-style hex color codes, ex. ff0000 is red, 0000ff is blue, etc.\r
-text_color=ffffc0\r
-selection_color=808010\r
-\r
+++ /dev/null
-#ifndef UI_FEATURES_H
-#define UI_FEATURES_H
-
-#define MENU_BIOS_PATH "pcsx_rearmed/bios/"
-#define MENU_SHOW_VARSCALER 0
-#define MENU_SHOW_VOUTMODE 0
-#define MENU_SHOW_SCALER2 1
-#define MENU_SHOW_NUBS_BTNS 0
-#define MENU_SHOW_VIBRATION 1
-#define MENU_SHOW_DEADZONE 1
-#define MENU_SHOW_MINIMIZE 0
-#define MENU_SHOW_FULLSCREEN 0
-#define MENU_SHOW_VOLUME 1
-
-#endif // UI_FEATURES_H
--- /dev/null
+#ifndef _3DS_UTILS_H
+#define _3DS_UTILS_H
+
+#include <stdio.h>
+
+#define MEMOP_PROT 6
+#define MEMOP_MAP 4
+#define MEMOP_UNMAP 5
+
+void* linearMemAlign(size_t size, size_t alignment);
+void linearFree(void* mem);
+
+int32_t svcDuplicateHandle(uint32_t* out, uint32_t original);
+int32_t svcCloseHandle(uint32_t handle);
+int32_t svcControlMemory(void* addr_out, void* addr0, void* addr1, uint32_t size, uint32_t op, uint32_t perm);
+int32_t svcControlProcessMemory(uint32_t process, void* addr0, void* addr1, uint32_t size, uint32_t op, uint32_t perm);
+
+int32_t svcCreateThread(int32_t* thread, void *(*entrypoint)(void*), void* arg, void* stack_top, int32_t thread_priority, int32_t processor_id);
+int32_t svcWaitSynchronization(int32_t handle, int64_t nanoseconds);
+void svcExitThread(void) __attribute__((noreturn));
+
+int32_t svcBackdoor(int32_t (*callback)(void));
+
+#define DEBUG_HOLD() do{printf("%s@%s:%d.\n",__FUNCTION__, __FILE__, __LINE__);fflush(stdout);wait_for_input();}while(0)
+
+void wait_for_input(void);
+
+extern __attribute__((weak)) int __ctr_svchax;
+
+typedef int32_t (*ctr_callback_type)(void);
+
+static inline void ctr_invalidate_ICache_kernel(void)
+{
+ __asm__ volatile(
+ "cpsid aif\n\t"
+ "mov r0, #0\n\t"
+ "mcr p15, 0, r0, c7, c5, 0\n\t");
+}
+
+static inline void ctr_flush_DCache_kernel(void)
+{
+ __asm__ volatile(
+ "cpsid aif\n\t"
+ "mov r0, #0\n\t"
+ "mcr p15, 0, r0, c7, c10, 0\n\t");
+}
+
+static inline void ctr_invalidate_ICache(void)
+{
+ svcBackdoor((ctr_callback_type)ctr_invalidate_ICache_kernel);
+}
+
+static inline void ctr_flush_DCache(void)
+{
+ svcBackdoor((ctr_callback_type)ctr_flush_DCache_kernel);
+}
+
+
+static inline void ctr_flush_invalidate_cache(void)
+{
+ ctr_flush_DCache();
+ ctr_invalidate_ICache();
+}
+
+
+#endif // _3DS_UTILS_H
--- /dev/null
+
+#ifndef _3DS_PTHREAD_WRAP__
+#define _3DS_PTHREAD_WRAP__
+
+#include <stdlib.h>
+#include <string.h>
+#include <stdio.h>
+
+#include "3ds_utils.h"
+
+#define CTR_PTHREAD_STACK_SIZE 0x10000
+
+typedef struct
+{
+ int32_t handle;
+ uint32_t* stack;
+}pthread_t;
+typedef int pthread_attr_t;
+
+static inline int pthread_create(pthread_t *thread,
+ const pthread_attr_t *attr, void *(*start_routine)(void*), void *arg)
+{
+
+ thread->stack = linearMemAlign(CTR_PTHREAD_STACK_SIZE, 8);
+
+ svcCreateThread(&thread->handle, start_routine, arg,
+ (uint32_t*)((uint32_t)thread->stack + CTR_PTHREAD_STACK_SIZE),
+ 0x25, 1);
+
+ return 1;
+}
+
+
+static inline int pthread_join(pthread_t thread, void **retval)
+{
+ (void)retval;
+
+ if(svcWaitSynchronization(thread.handle, INT64_MAX))
+ return -1;
+
+ linearFree(thread.stack);
+
+ return 0;
+}
+
+
+static inline void pthread_exit(void *retval)
+{
+ (void)retval;
+
+ svcExitThread();
+}
+
+
+#endif //_3DS_PTHREAD_WRAP__
+
--- /dev/null
+#ifndef MMAN_H
+#define MMAN_H
+
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+#include <stdlib.h>
+#include <stdio.h>
+#include <stdint.h>
+#include <malloc.h>
+
+#include "3ds_utils.h"
+
+#define PROT_READ 0b001
+#define PROT_WRITE 0b010
+#define PROT_EXEC 0b100
+#define MAP_PRIVATE 2
+#define MAP_FIXED 0x10
+#define MAP_ANONYMOUS 0x20
+
+#define MAP_FAILED ((void *)-1)
+
+static void* dynarec_cache = NULL;
+static void* dynarec_cache_mapping = NULL;
+
+static inline void* mmap(void *addr, size_t len, int prot, int flags, int fd, off_t offset)
+{
+ (void)fd;
+ (void)offset;
+
+ void* addr_out;
+
+ if((prot == (PROT_READ | PROT_WRITE | PROT_EXEC)) &&
+ (flags == (MAP_PRIVATE | MAP_ANONYMOUS)))
+ {
+ if(__ctr_svchax)
+ {
+ /* this hack works only for pcsx_rearmed */
+ uint32_t currentHandle;
+
+ if(!dynarec_cache)
+ dynarec_cache = memalign(0x1000, len);
+
+ svcDuplicateHandle(¤tHandle, 0xFFFF8001);
+ svcControlProcessMemory(currentHandle, addr, dynarec_cache,
+ len, MEMOP_MAP, prot);
+ svcCloseHandle(currentHandle);
+ dynarec_cache_mapping = addr;
+ return addr;
+ }
+ else
+ {
+ printf("tried to mmap RWX pages without svcControlProcessMemory access !\n");
+ return MAP_FAILED;
+ }
+
+ }
+
+ addr_out = malloc(len);
+ if(!addr_out)
+ return MAP_FAILED;
+
+ return addr_out;
+}
+
+static inline int mprotect(void *addr, size_t len, int prot)
+{
+ if(__ctr_svchax)
+ {
+ uint32_t currentHandle;
+ svcDuplicateHandle(¤tHandle, 0xFFFF8001);
+ svcControlProcessMemory(currentHandle, addr, NULL,
+ len, MEMOP_PROT, prot);
+ svcCloseHandle(currentHandle);
+ return 0;
+ }
+
+ printf("mprotect called without svcControlProcessMemory access !\n");
+ return -1;
+}
+
+static inline int munmap(void *addr, size_t len)
+{
+ if((addr == dynarec_cache_mapping) && __ctr_svchax)
+ {
+ uint32_t currentHandle;
+ svcDuplicateHandle(¤tHandle, 0xFFFF8001);
+ svcControlProcessMemory(currentHandle,
+ dynarec_cache, dynarec_cache_mapping,
+ len, MEMOP_UNMAP, 0b111);
+ svcCloseHandle(currentHandle);
+ dynarec_cache_mapping = NULL;
+
+ }
+ else
+ free(addr);
+
+ return 0;
+}
+
+#ifdef __cplusplus
+};
+#endif
+
+#endif // MMAN_H
+
--- /dev/null
+/* zconf.h -- configuration of the zlib compression library
+ * Copyright (C) 1995-2013 Jean-loup Gailly.
+ * For conditions of distribution and use, see copyright notice in zlib.h
+ */
+
+/* @(#) $Id$ */
+
+#ifndef ZCONF_H
+#define ZCONF_H
+
+/*
+ * If you *really* need a unique prefix for all types and library functions,
+ * compile with -DZ_PREFIX. The "standard" zlib should be compiled without it.
+ * Even better than compiling with -DZ_PREFIX would be to use configure to set
+ * this permanently in zconf.h using "./configure --zprefix".
+ */
+#ifdef Z_PREFIX /* may be set to #if 1 by ./configure */
+# define Z_PREFIX_SET
+
+/* all linked symbols */
+# define _dist_code z__dist_code
+# define _length_code z__length_code
+# define _tr_align z__tr_align
+# define _tr_flush_bits z__tr_flush_bits
+# define _tr_flush_block z__tr_flush_block
+# define _tr_init z__tr_init
+# define _tr_stored_block z__tr_stored_block
+# define _tr_tally z__tr_tally
+# define adler32 z_adler32
+# define adler32_combine z_adler32_combine
+# define adler32_combine64 z_adler32_combine64
+# ifndef Z_SOLO
+# define compress z_compress
+# define compress2 z_compress2
+# define compressBound z_compressBound
+# endif
+# define crc32 z_crc32
+# define crc32_combine z_crc32_combine
+# define crc32_combine64 z_crc32_combine64
+# define deflate z_deflate
+# define deflateBound z_deflateBound
+# define deflateCopy z_deflateCopy
+# define deflateEnd z_deflateEnd
+# define deflateInit2_ z_deflateInit2_
+# define deflateInit_ z_deflateInit_
+# define deflateParams z_deflateParams
+# define deflatePending z_deflatePending
+# define deflatePrime z_deflatePrime
+# define deflateReset z_deflateReset
+# define deflateResetKeep z_deflateResetKeep
+# define deflateSetDictionary z_deflateSetDictionary
+# define deflateSetHeader z_deflateSetHeader
+# define deflateTune z_deflateTune
+# define deflate_copyright z_deflate_copyright
+# define get_crc_table z_get_crc_table
+# ifndef Z_SOLO
+# define gz_error z_gz_error
+# define gz_intmax z_gz_intmax
+# define gz_strwinerror z_gz_strwinerror
+# define gzbuffer z_gzbuffer
+# define gzclearerr z_gzclearerr
+# define gzclose z_gzclose
+# define gzclose_r z_gzclose_r
+# define gzclose_w z_gzclose_w
+# define gzdirect z_gzdirect
+# define gzdopen z_gzdopen
+# define gzeof z_gzeof
+# define gzerror z_gzerror
+# define gzflush z_gzflush
+# define gzgetc z_gzgetc
+# define gzgetc_ z_gzgetc_
+# define gzgets z_gzgets
+# define gzoffset z_gzoffset
+# define gzoffset64 z_gzoffset64
+# define gzopen z_gzopen
+# define gzopen64 z_gzopen64
+# ifdef _WIN32
+# define gzopen_w z_gzopen_w
+# endif
+# define gzprintf z_gzprintf
+# define gzvprintf z_gzvprintf
+# define gzputc z_gzputc
+# define gzputs z_gzputs
+# define gzread z_gzread
+# define gzrewind z_gzrewind
+# define gzseek z_gzseek
+# define gzseek64 z_gzseek64
+# define gzsetparams z_gzsetparams
+# define gztell z_gztell
+# define gztell64 z_gztell64
+# define gzungetc z_gzungetc
+# define gzwrite z_gzwrite
+# endif
+# define inflate z_inflate
+# define inflateBack z_inflateBack
+# define inflateBackEnd z_inflateBackEnd
+# define inflateBackInit_ z_inflateBackInit_
+# define inflateCopy z_inflateCopy
+# define inflateEnd z_inflateEnd
+# define inflateGetHeader z_inflateGetHeader
+# define inflateInit2_ z_inflateInit2_
+# define inflateInit_ z_inflateInit_
+# define inflateMark z_inflateMark
+# define inflatePrime z_inflatePrime
+# define inflateReset z_inflateReset
+# define inflateReset2 z_inflateReset2
+# define inflateSetDictionary z_inflateSetDictionary
+# define inflateGetDictionary z_inflateGetDictionary
+# define inflateSync z_inflateSync
+# define inflateSyncPoint z_inflateSyncPoint
+# define inflateUndermine z_inflateUndermine
+# define inflateResetKeep z_inflateResetKeep
+# define inflate_copyright z_inflate_copyright
+# define inflate_fast z_inflate_fast
+# define inflate_table z_inflate_table
+# ifndef Z_SOLO
+# define uncompress z_uncompress
+# endif
+# define zError z_zError
+# ifndef Z_SOLO
+# define zcalloc z_zcalloc
+# define zcfree z_zcfree
+# endif
+# define zlibCompileFlags z_zlibCompileFlags
+# define zlibVersion z_zlibVersion
+
+/* all zlib typedefs in zlib.h and zconf.h */
+# define Byte z_Byte
+# define Bytef z_Bytef
+# define alloc_func z_alloc_func
+# define charf z_charf
+# define free_func z_free_func
+# ifndef Z_SOLO
+# define gzFile z_gzFile
+# endif
+# define gz_header z_gz_header
+# define gz_headerp z_gz_headerp
+# define in_func z_in_func
+# define intf z_intf
+# define out_func z_out_func
+# define uInt z_uInt
+# define uIntf z_uIntf
+# define uLong z_uLong
+# define uLongf z_uLongf
+# define voidp z_voidp
+# define voidpc z_voidpc
+# define voidpf z_voidpf
+
+/* all zlib structs in zlib.h and zconf.h */
+# define gz_header_s z_gz_header_s
+# define internal_state z_internal_state
+
+#endif
+
+#if defined(__MSDOS__) && !defined(MSDOS)
+# define MSDOS
+#endif
+#if (defined(OS_2) || defined(__OS2__)) && !defined(OS2)
+# define OS2
+#endif
+#if defined(_WINDOWS) && !defined(WINDOWS)
+# define WINDOWS
+#endif
+#if defined(_WIN32) || defined(_WIN32_WCE) || defined(__WIN32__)
+# ifndef WIN32
+# define WIN32
+# endif
+#endif
+#if (defined(MSDOS) || defined(OS2) || defined(WINDOWS)) && !defined(WIN32)
+# if !defined(__GNUC__) && !defined(__FLAT__) && !defined(__386__)
+# ifndef SYS16BIT
+# define SYS16BIT
+# endif
+# endif
+#endif
+
+/*
+ * Compile with -DMAXSEG_64K if the alloc function cannot allocate more
+ * than 64k bytes at a time (needed on systems with 16-bit int).
+ */
+#ifdef SYS16BIT
+# define MAXSEG_64K
+#endif
+#ifdef MSDOS
+# define UNALIGNED_OK
+#endif
+
+#ifdef __STDC_VERSION__
+# ifndef STDC
+# define STDC
+# endif
+# if __STDC_VERSION__ >= 199901L
+# ifndef STDC99
+# define STDC99
+# endif
+# endif
+#endif
+#if !defined(STDC) && (defined(__STDC__) || defined(__cplusplus))
+# define STDC
+#endif
+#if !defined(STDC) && (defined(__GNUC__) || defined(__BORLANDC__))
+# define STDC
+#endif
+#if !defined(STDC) && (defined(MSDOS) || defined(WINDOWS) || defined(WIN32))
+# define STDC
+#endif
+#if !defined(STDC) && (defined(OS2) || defined(__HOS_AIX__))
+# define STDC
+#endif
+
+#if defined(__OS400__) && !defined(STDC) /* iSeries (formerly AS/400). */
+# define STDC
+#endif
+
+#ifndef STDC
+# ifndef const /* cannot use !defined(STDC) && !defined(const) on Mac */
+# define const /* note: need a more gentle solution here */
+# endif
+#endif
+
+#if defined(ZLIB_CONST) && !defined(z_const)
+# define z_const const
+#else
+# define z_const
+#endif
+
+/* Some Mac compilers merge all .h files incorrectly: */
+#if defined(__MWERKS__)||defined(applec)||defined(THINK_C)||defined(__SC__)
+# define NO_DUMMY_DECL
+#endif
+
+/* Maximum value for memLevel in deflateInit2 */
+#ifndef MAX_MEM_LEVEL
+# ifdef MAXSEG_64K
+# define MAX_MEM_LEVEL 8
+# else
+# define MAX_MEM_LEVEL 9
+# endif
+#endif
+
+/* Maximum value for windowBits in deflateInit2 and inflateInit2.
+ * WARNING: reducing MAX_WBITS makes minigzip unable to extract .gz files
+ * created by gzip. (Files created by minigzip can still be extracted by
+ * gzip.)
+ */
+#ifndef MAX_WBITS
+# define MAX_WBITS 15 /* 32K LZ77 window */
+#endif
+
+/* The memory requirements for deflate are (in bytes):
+ (1 << (windowBits+2)) + (1 << (memLevel+9))
+ that is: 128K for windowBits=15 + 128K for memLevel = 8 (default values)
+ plus a few kilobytes for small objects. For example, if you want to reduce
+ the default memory requirements from 256K to 128K, compile with
+ make CFLAGS="-O -DMAX_WBITS=14 -DMAX_MEM_LEVEL=7"
+ Of course this will generally degrade compression (there's no free lunch).
+
+ The memory requirements for inflate are (in bytes) 1 << windowBits
+ that is, 32K for windowBits=15 (default value) plus a few kilobytes
+ for small objects.
+*/
+
+ /* Type declarations */
+
+#ifndef OF /* function prototypes */
+# ifdef STDC
+# define OF(args) args
+# else
+# define OF(args) ()
+# endif
+#endif
+
+#ifndef Z_ARG /* function prototypes for stdarg */
+# if defined(STDC) || defined(Z_HAVE_STDARG_H)
+# define Z_ARG(args) args
+# else
+# define Z_ARG(args) ()
+# endif
+#endif
+
+/* The following definitions for FAR are needed only for MSDOS mixed
+ * model programming (small or medium model with some far allocations).
+ * This was tested only with MSC; for other MSDOS compilers you may have
+ * to define NO_MEMCPY in zutil.h. If you don't need the mixed model,
+ * just define FAR to be empty.
+ */
+#ifdef SYS16BIT
+# if defined(M_I86SM) || defined(M_I86MM)
+ /* MSC small or medium model */
+# define SMALL_MEDIUM
+# ifdef _MSC_VER
+# define FAR _far
+# else
+# define FAR far
+# endif
+# endif
+# if (defined(__SMALL__) || defined(__MEDIUM__))
+ /* Turbo C small or medium model */
+# define SMALL_MEDIUM
+# ifdef __BORLANDC__
+# define FAR _far
+# else
+# define FAR far
+# endif
+# endif
+#endif
+
+#if defined(WINDOWS) || defined(WIN32)
+ /* If building or using zlib as a DLL, define ZLIB_DLL.
+ * This is not mandatory, but it offers a little performance increase.
+ */
+# ifdef ZLIB_DLL
+# if defined(WIN32) && (!defined(__BORLANDC__) || (__BORLANDC__ >= 0x500))
+# ifdef ZLIB_INTERNAL
+# define ZEXTERN extern __declspec(dllexport)
+# else
+# define ZEXTERN extern __declspec(dllimport)
+# endif
+# endif
+# endif /* ZLIB_DLL */
+ /* If building or using zlib with the WINAPI/WINAPIV calling convention,
+ * define ZLIB_WINAPI.
+ * Caution: the standard ZLIB1.DLL is NOT compiled using ZLIB_WINAPI.
+ */
+# ifdef ZLIB_WINAPI
+# ifdef FAR
+# undef FAR
+# endif
+# include <windows.h>
+ /* No need for _export, use ZLIB.DEF instead. */
+ /* For complete Windows compatibility, use WINAPI, not __stdcall. */
+# define ZEXPORT WINAPI
+# ifdef WIN32
+# define ZEXPORTVA WINAPIV
+# else
+# define ZEXPORTVA FAR CDECL
+# endif
+# endif
+#endif
+
+#if defined (__BEOS__)
+# ifdef ZLIB_DLL
+# ifdef ZLIB_INTERNAL
+# define ZEXPORT __declspec(dllexport)
+# define ZEXPORTVA __declspec(dllexport)
+# else
+# define ZEXPORT __declspec(dllimport)
+# define ZEXPORTVA __declspec(dllimport)
+# endif
+# endif
+#endif
+
+#ifndef ZEXTERN
+# define ZEXTERN extern
+#endif
+#ifndef ZEXPORT
+# define ZEXPORT
+#endif
+#ifndef ZEXPORTVA
+# define ZEXPORTVA
+#endif
+
+#ifndef FAR
+# define FAR
+#endif
+
+#if !defined(__MACTYPES__)
+typedef unsigned char Byte; /* 8 bits */
+#endif
+typedef unsigned int uInt; /* 16 bits or more */
+typedef unsigned long uLong; /* 32 bits or more */
+
+#ifdef SMALL_MEDIUM
+ /* Borland C/C++ and some old MSC versions ignore FAR inside typedef */
+# define Bytef Byte FAR
+#else
+ typedef Byte FAR Bytef;
+#endif
+typedef char FAR charf;
+typedef int FAR intf;
+typedef uInt FAR uIntf;
+typedef uLong FAR uLongf;
+
+#ifdef STDC
+ typedef void const *voidpc;
+ typedef void FAR *voidpf;
+ typedef void *voidp;
+#else
+ typedef Byte const *voidpc;
+ typedef Byte FAR *voidpf;
+ typedef Byte *voidp;
+#endif
+
+#if !defined(Z_U4) && !defined(Z_SOLO) && defined(STDC)
+# include <limits.h>
+# if (UINT_MAX == 0xffffffffUL)
+# define Z_U4 unsigned
+# elif (ULONG_MAX == 0xffffffffUL)
+# define Z_U4 unsigned long
+# elif (USHRT_MAX == 0xffffffffUL)
+# define Z_U4 unsigned short
+# endif
+#endif
+
+#ifdef Z_U4
+ typedef Z_U4 z_crc_t;
+#else
+ typedef unsigned long z_crc_t;
+#endif
+
+#if 1 /* was set to #if 1 by ./configure */
+# define Z_HAVE_UNISTD_H
+#endif
+
+#if 1 /* was set to #if 1 by ./configure */
+# define Z_HAVE_STDARG_H
+#endif
+
+#ifdef STDC
+# ifndef Z_SOLO
+# include <sys/types.h> /* for off_t */
+# endif
+#endif
+
+#if defined(STDC) || defined(Z_HAVE_STDARG_H)
+# ifndef Z_SOLO
+# include <stdarg.h> /* for va_list */
+# endif
+#endif
+
+#ifdef _WIN32
+# ifndef Z_SOLO
+# include <stddef.h> /* for wchar_t */
+# endif
+#endif
+
+/* a little trick to accommodate both "#define _LARGEFILE64_SOURCE" and
+ * "#define _LARGEFILE64_SOURCE 1" as requesting 64-bit operations, (even
+ * though the former does not conform to the LFS document), but considering
+ * both "#undef _LARGEFILE64_SOURCE" and "#define _LARGEFILE64_SOURCE 0" as
+ * equivalently requesting no 64-bit operations
+ */
+#if defined(_LARGEFILE64_SOURCE) && -_LARGEFILE64_SOURCE - -1 == 1
+# undef _LARGEFILE64_SOURCE
+#endif
+
+#if defined(__WATCOMC__) && !defined(Z_HAVE_UNISTD_H)
+# define Z_HAVE_UNISTD_H
+#endif
+#ifndef Z_SOLO
+# if defined(Z_HAVE_UNISTD_H) || defined(_LARGEFILE64_SOURCE)
+# include <unistd.h> /* for SEEK_*, off_t, and _LFS64_LARGEFILE */
+# ifdef VMS
+# include <unixio.h> /* for off_t */
+# endif
+# ifndef z_off_t
+# define z_off_t off_t
+# endif
+# endif
+#endif
+
+#if defined(_LFS64_LARGEFILE) && _LFS64_LARGEFILE-0
+# define Z_LFS64
+#endif
+
+#if defined(_LARGEFILE64_SOURCE) && defined(Z_LFS64)
+# define Z_LARGE64
+#endif
+
+#if defined(_FILE_OFFSET_BITS) && _FILE_OFFSET_BITS-0 == 64 && defined(Z_LFS64)
+# define Z_WANT64
+#endif
+
+#if !defined(SEEK_SET) && !defined(Z_SOLO)
+# define SEEK_SET 0 /* Seek from beginning of file. */
+# define SEEK_CUR 1 /* Seek from current position. */
+# define SEEK_END 2 /* Set file pointer to EOF plus "offset" */
+#endif
+
+#ifndef z_off_t
+# define z_off_t long
+#endif
+
+#if !defined(_WIN32) && defined(Z_LARGE64)
+# define z_off64_t off64_t
+#else
+# if defined(_WIN32) && !defined(__GNUC__) && !defined(Z_SOLO)
+# define z_off64_t __int64
+# else
+# define z_off64_t z_off_t
+# endif
+#endif
+
+/* MVS linker does not support external names larger than 8 bytes */
+#if defined(__MVS__)
+ #pragma map(deflateInit_,"DEIN")
+ #pragma map(deflateInit2_,"DEIN2")
+ #pragma map(deflateEnd,"DEEND")
+ #pragma map(deflateBound,"DEBND")
+ #pragma map(inflateInit_,"ININ")
+ #pragma map(inflateInit2_,"ININ2")
+ #pragma map(inflateEnd,"INEND")
+ #pragma map(inflateSync,"INSY")
+ #pragma map(inflateSetDictionary,"INSEDI")
+ #pragma map(compressBound,"CMBND")
+ #pragma map(inflate_table,"INTABL")
+ #pragma map(inflate_fast,"INFA")
+ #pragma map(inflate_copyright,"INCOPY")
+#endif
+
+#endif /* ZCONF_H */
--- /dev/null
+/* zlib.h -- interface of the 'zlib' general purpose compression library
+ version 1.2.8, April 28th, 2013
+
+ Copyright (C) 1995-2013 Jean-loup Gailly and Mark Adler
+
+ This software is provided 'as-is', without any express or implied
+ warranty. In no event will the authors be held liable for any damages
+ arising from the use of this software.
+
+ Permission is granted to anyone to use this software for any purpose,
+ including commercial applications, and to alter it and redistribute it
+ freely, subject to the following restrictions:
+
+ 1. The origin of this software must not be misrepresented; you must not
+ claim that you wrote the original software. If you use this software
+ in a product, an acknowledgment in the product documentation would be
+ appreciated but is not required.
+ 2. Altered source versions must be plainly marked as such, and must not be
+ misrepresented as being the original software.
+ 3. This notice may not be removed or altered from any source distribution.
+
+ Jean-loup Gailly Mark Adler
+ jloup@gzip.org madler@alumni.caltech.edu
+
+
+ The data format used by the zlib library is described by RFCs (Request for
+ Comments) 1950 to 1952 in the files http://tools.ietf.org/html/rfc1950
+ (zlib format), rfc1951 (deflate format) and rfc1952 (gzip format).
+*/
+
+#ifndef ZLIB_H
+#define ZLIB_H
+
+#include "zconf.h"
+
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+#define ZLIB_VERSION "1.2.8"
+#define ZLIB_VERNUM 0x1280
+#define ZLIB_VER_MAJOR 1
+#define ZLIB_VER_MINOR 2
+#define ZLIB_VER_REVISION 8
+#define ZLIB_VER_SUBREVISION 0
+
+/*
+ The 'zlib' compression library provides in-memory compression and
+ decompression functions, including integrity checks of the uncompressed data.
+ This version of the library supports only one compression method (deflation)
+ but other algorithms will be added later and will have the same stream
+ interface.
+
+ Compression can be done in a single step if the buffers are large enough,
+ or can be done by repeated calls of the compression function. In the latter
+ case, the application must provide more input and/or consume the output
+ (providing more output space) before each call.
+
+ The compressed data format used by default by the in-memory functions is
+ the zlib format, which is a zlib wrapper documented in RFC 1950, wrapped
+ around a deflate stream, which is itself documented in RFC 1951.
+
+ The library also supports reading and writing files in gzip (.gz) format
+ with an interface similar to that of stdio using the functions that start
+ with "gz". The gzip format is different from the zlib format. gzip is a
+ gzip wrapper, documented in RFC 1952, wrapped around a deflate stream.
+
+ This library can optionally read and write gzip streams in memory as well.
+
+ The zlib format was designed to be compact and fast for use in memory
+ and on communications channels. The gzip format was designed for single-
+ file compression on file systems, has a larger header than zlib to maintain
+ directory information, and uses a different, slower check method than zlib.
+
+ The library does not install any signal handler. The decoder checks
+ the consistency of the compressed data, so the library should never crash
+ even in case of corrupted input.
+*/
+
+typedef voidpf (*alloc_func) OF((voidpf opaque, uInt items, uInt size));
+typedef void (*free_func) OF((voidpf opaque, voidpf address));
+
+struct internal_state;
+
+typedef struct z_stream_s {
+ z_const Bytef *next_in; /* next input byte */
+ uInt avail_in; /* number of bytes available at next_in */
+ uLong total_in; /* total number of input bytes read so far */
+
+ Bytef *next_out; /* next output byte should be put there */
+ uInt avail_out; /* remaining free space at next_out */
+ uLong total_out; /* total number of bytes output so far */
+
+ z_const char *msg; /* last error message, NULL if no error */
+ struct internal_state FAR *state; /* not visible by applications */
+
+ alloc_func zalloc; /* used to allocate the internal state */
+ free_func zfree; /* used to free the internal state */
+ voidpf opaque; /* private data object passed to zalloc and zfree */
+
+ int data_type; /* best guess about the data type: binary or text */
+ uLong adler; /* adler32 value of the uncompressed data */
+ uLong reserved; /* reserved for future use */
+} z_stream;
+
+typedef z_stream FAR *z_streamp;
+
+/*
+ gzip header information passed to and from zlib routines. See RFC 1952
+ for more details on the meanings of these fields.
+*/
+typedef struct gz_header_s {
+ int text; /* true if compressed data believed to be text */
+ uLong time; /* modification time */
+ int xflags; /* extra flags (not used when writing a gzip file) */
+ int os; /* operating system */
+ Bytef *extra; /* pointer to extra field or Z_NULL if none */
+ uInt extra_len; /* extra field length (valid if extra != Z_NULL) */
+ uInt extra_max; /* space at extra (only when reading header) */
+ Bytef *name; /* pointer to zero-terminated file name or Z_NULL */
+ uInt name_max; /* space at name (only when reading header) */
+ Bytef *comment; /* pointer to zero-terminated comment or Z_NULL */
+ uInt comm_max; /* space at comment (only when reading header) */
+ int hcrc; /* true if there was or will be a header crc */
+ int done; /* true when done reading gzip header (not used
+ when writing a gzip file) */
+} gz_header;
+
+typedef gz_header FAR *gz_headerp;
+
+/*
+ The application must update next_in and avail_in when avail_in has dropped
+ to zero. It must update next_out and avail_out when avail_out has dropped
+ to zero. The application must initialize zalloc, zfree and opaque before
+ calling the init function. All other fields are set by the compression
+ library and must not be updated by the application.
+
+ The opaque value provided by the application will be passed as the first
+ parameter for calls of zalloc and zfree. This can be useful for custom
+ memory management. The compression library attaches no meaning to the
+ opaque value.
+
+ zalloc must return Z_NULL if there is not enough memory for the object.
+ If zlib is used in a multi-threaded application, zalloc and zfree must be
+ thread safe.
+
+ On 16-bit systems, the functions zalloc and zfree must be able to allocate
+ exactly 65536 bytes, but will not be required to allocate more than this if
+ the symbol MAXSEG_64K is defined (see zconf.h). WARNING: On MSDOS, pointers
+ returned by zalloc for objects of exactly 65536 bytes *must* have their
+ offset normalized to zero. The default allocation function provided by this
+ library ensures this (see zutil.c). To reduce memory requirements and avoid
+ any allocation of 64K objects, at the expense of compression ratio, compile
+ the library with -DMAX_WBITS=14 (see zconf.h).
+
+ The fields total_in and total_out can be used for statistics or progress
+ reports. After compression, total_in holds the total size of the
+ uncompressed data and may be saved for use in the decompressor (particularly
+ if the decompressor wants to decompress everything in a single step).
+*/
+
+ /* constants */
+
+#define Z_NO_FLUSH 0
+#define Z_PARTIAL_FLUSH 1
+#define Z_SYNC_FLUSH 2
+#define Z_FULL_FLUSH 3
+#define Z_FINISH 4
+#define Z_BLOCK 5
+#define Z_TREES 6
+/* Allowed flush values; see deflate() and inflate() below for details */
+
+#define Z_OK 0
+#define Z_STREAM_END 1
+#define Z_NEED_DICT 2
+#define Z_ERRNO (-1)
+#define Z_STREAM_ERROR (-2)
+#define Z_DATA_ERROR (-3)
+#define Z_MEM_ERROR (-4)
+#define Z_BUF_ERROR (-5)
+#define Z_VERSION_ERROR (-6)
+/* Return codes for the compression/decompression functions. Negative values
+ * are errors, positive values are used for special but normal events.
+ */
+
+#define Z_NO_COMPRESSION 0
+#define Z_BEST_SPEED 1
+#define Z_BEST_COMPRESSION 9
+#define Z_DEFAULT_COMPRESSION (-1)
+/* compression levels */
+
+#define Z_FILTERED 1
+#define Z_HUFFMAN_ONLY 2
+#define Z_RLE 3
+#define Z_FIXED 4
+#define Z_DEFAULT_STRATEGY 0
+/* compression strategy; see deflateInit2() below for details */
+
+#define Z_BINARY 0
+#define Z_TEXT 1
+#define Z_ASCII Z_TEXT /* for compatibility with 1.2.2 and earlier */
+#define Z_UNKNOWN 2
+/* Possible values of the data_type field (though see inflate()) */
+
+#define Z_DEFLATED 8
+/* The deflate compression method (the only one supported in this version) */
+
+#define Z_NULL 0 /* for initializing zalloc, zfree, opaque */
+
+#define zlib_version zlibVersion()
+/* for compatibility with versions < 1.0.2 */
+
+
+ /* basic functions */
+
+ZEXTERN const char * ZEXPORT zlibVersion OF((void));
+/* The application can compare zlibVersion and ZLIB_VERSION for consistency.
+ If the first character differs, the library code actually used is not
+ compatible with the zlib.h header file used by the application. This check
+ is automatically made by deflateInit and inflateInit.
+ */
+
+/*
+ZEXTERN int ZEXPORT deflateInit OF((z_streamp strm, int level));
+
+ Initializes the internal stream state for compression. The fields
+ zalloc, zfree and opaque must be initialized before by the caller. If
+ zalloc and zfree are set to Z_NULL, deflateInit updates them to use default
+ allocation functions.
+
+ The compression level must be Z_DEFAULT_COMPRESSION, or between 0 and 9:
+ 1 gives best speed, 9 gives best compression, 0 gives no compression at all
+ (the input data is simply copied a block at a time). Z_DEFAULT_COMPRESSION
+ requests a default compromise between speed and compression (currently
+ equivalent to level 6).
+
+ deflateInit returns Z_OK if success, Z_MEM_ERROR if there was not enough
+ memory, Z_STREAM_ERROR if level is not a valid compression level, or
+ Z_VERSION_ERROR if the zlib library version (zlib_version) is incompatible
+ with the version assumed by the caller (ZLIB_VERSION). msg is set to null
+ if there is no error message. deflateInit does not perform any compression:
+ this will be done by deflate().
+*/
+
+
+ZEXTERN int ZEXPORT deflate OF((z_streamp strm, int flush));
+/*
+ deflate compresses as much data as possible, and stops when the input
+ buffer becomes empty or the output buffer becomes full. It may introduce
+ some output latency (reading input without producing any output) except when
+ forced to flush.
+
+ The detailed semantics are as follows. deflate performs one or both of the
+ following actions:
+
+ - Compress more input starting at next_in and update next_in and avail_in
+ accordingly. If not all input can be processed (because there is not
+ enough room in the output buffer), next_in and avail_in are updated and
+ processing will resume at this point for the next call of deflate().
+
+ - Provide more output starting at next_out and update next_out and avail_out
+ accordingly. This action is forced if the parameter flush is non zero.
+ Forcing flush frequently degrades the compression ratio, so this parameter
+ should be set only when necessary (in interactive applications). Some
+ output may be provided even if flush is not set.
+
+ Before the call of deflate(), the application should ensure that at least
+ one of the actions is possible, by providing more input and/or consuming more
+ output, and updating avail_in or avail_out accordingly; avail_out should
+ never be zero before the call. The application can consume the compressed
+ output when it wants, for example when the output buffer is full (avail_out
+ == 0), or after each call of deflate(). If deflate returns Z_OK and with
+ zero avail_out, it must be called again after making room in the output
+ buffer because there might be more output pending.
+
+ Normally the parameter flush is set to Z_NO_FLUSH, which allows deflate to
+ decide how much data to accumulate before producing output, in order to
+ maximize compression.
+
+ If the parameter flush is set to Z_SYNC_FLUSH, all pending output is
+ flushed to the output buffer and the output is aligned on a byte boundary, so
+ that the decompressor can get all input data available so far. (In
+ particular avail_in is zero after the call if enough output space has been
+ provided before the call.) Flushing may degrade compression for some
+ compression algorithms and so it should be used only when necessary. This
+ completes the current deflate block and follows it with an empty stored block
+ that is three bits plus filler bits to the next byte, followed by four bytes
+ (00 00 ff ff).
+
+ If flush is set to Z_PARTIAL_FLUSH, all pending output is flushed to the
+ output buffer, but the output is not aligned to a byte boundary. All of the
+ input data so far will be available to the decompressor, as for Z_SYNC_FLUSH.
+ This completes the current deflate block and follows it with an empty fixed
+ codes block that is 10 bits long. This assures that enough bytes are output
+ in order for the decompressor to finish the block before the empty fixed code
+ block.
+
+ If flush is set to Z_BLOCK, a deflate block is completed and emitted, as
+ for Z_SYNC_FLUSH, but the output is not aligned on a byte boundary, and up to
+ seven bits of the current block are held to be written as the next byte after
+ the next deflate block is completed. In this case, the decompressor may not
+ be provided enough bits at this point in order to complete decompression of
+ the data provided so far to the compressor. It may need to wait for the next
+ block to be emitted. This is for advanced applications that need to control
+ the emission of deflate blocks.
+
+ If flush is set to Z_FULL_FLUSH, all output is flushed as with
+ Z_SYNC_FLUSH, and the compression state is reset so that decompression can
+ restart from this point if previous compressed data has been damaged or if
+ random access is desired. Using Z_FULL_FLUSH too often can seriously degrade
+ compression.
+
+ If deflate returns with avail_out == 0, this function must be called again
+ with the same value of the flush parameter and more output space (updated
+ avail_out), until the flush is complete (deflate returns with non-zero
+ avail_out). In the case of a Z_FULL_FLUSH or Z_SYNC_FLUSH, make sure that
+ avail_out is greater than six to avoid repeated flush markers due to
+ avail_out == 0 on return.
+
+ If the parameter flush is set to Z_FINISH, pending input is processed,
+ pending output is flushed and deflate returns with Z_STREAM_END if there was
+ enough output space; if deflate returns with Z_OK, this function must be
+ called again with Z_FINISH and more output space (updated avail_out) but no
+ more input data, until it returns with Z_STREAM_END or an error. After
+ deflate has returned Z_STREAM_END, the only possible operations on the stream
+ are deflateReset or deflateEnd.
+
+ Z_FINISH can be used immediately after deflateInit if all the compression
+ is to be done in a single step. In this case, avail_out must be at least the
+ value returned by deflateBound (see below). Then deflate is guaranteed to
+ return Z_STREAM_END. If not enough output space is provided, deflate will
+ not return Z_STREAM_END, and it must be called again as described above.
+
+ deflate() sets strm->adler to the adler32 checksum of all input read
+ so far (that is, total_in bytes).
+
+ deflate() may update strm->data_type if it can make a good guess about
+ the input data type (Z_BINARY or Z_TEXT). In doubt, the data is considered
+ binary. This field is only for information purposes and does not affect the
+ compression algorithm in any manner.
+
+ deflate() returns Z_OK if some progress has been made (more input
+ processed or more output produced), Z_STREAM_END if all input has been
+ consumed and all output has been produced (only when flush is set to
+ Z_FINISH), Z_STREAM_ERROR if the stream state was inconsistent (for example
+ if next_in or next_out was Z_NULL), Z_BUF_ERROR if no progress is possible
+ (for example avail_in or avail_out was zero). Note that Z_BUF_ERROR is not
+ fatal, and deflate() can be called again with more input and more output
+ space to continue compressing.
+*/
+
+
+ZEXTERN int ZEXPORT deflateEnd OF((z_streamp strm));
+/*
+ All dynamically allocated data structures for this stream are freed.
+ This function discards any unprocessed input and does not flush any pending
+ output.
+
+ deflateEnd returns Z_OK if success, Z_STREAM_ERROR if the
+ stream state was inconsistent, Z_DATA_ERROR if the stream was freed
+ prematurely (some input or output was discarded). In the error case, msg
+ may be set but then points to a static string (which must not be
+ deallocated).
+*/
+
+
+/*
+ZEXTERN int ZEXPORT inflateInit OF((z_streamp strm));
+
+ Initializes the internal stream state for decompression. The fields
+ next_in, avail_in, zalloc, zfree and opaque must be initialized before by
+ the caller. If next_in is not Z_NULL and avail_in is large enough (the
+ exact value depends on the compression method), inflateInit determines the
+ compression method from the zlib header and allocates all data structures
+ accordingly; otherwise the allocation will be deferred to the first call of
+ inflate. If zalloc and zfree are set to Z_NULL, inflateInit updates them to
+ use default allocation functions.
+
+ inflateInit returns Z_OK if success, Z_MEM_ERROR if there was not enough
+ memory, Z_VERSION_ERROR if the zlib library version is incompatible with the
+ version assumed by the caller, or Z_STREAM_ERROR if the parameters are
+ invalid, such as a null pointer to the structure. msg is set to null if
+ there is no error message. inflateInit does not perform any decompression
+ apart from possibly reading the zlib header if present: actual decompression
+ will be done by inflate(). (So next_in and avail_in may be modified, but
+ next_out and avail_out are unused and unchanged.) The current implementation
+ of inflateInit() does not process any header information -- that is deferred
+ until inflate() is called.
+*/
+
+
+ZEXTERN int ZEXPORT inflate OF((z_streamp strm, int flush));
+/*
+ inflate decompresses as much data as possible, and stops when the input
+ buffer becomes empty or the output buffer becomes full. It may introduce
+ some output latency (reading input without producing any output) except when
+ forced to flush.
+
+ The detailed semantics are as follows. inflate performs one or both of the
+ following actions:
+
+ - Decompress more input starting at next_in and update next_in and avail_in
+ accordingly. If not all input can be processed (because there is not
+ enough room in the output buffer), next_in is updated and processing will
+ resume at this point for the next call of inflate().
+
+ - Provide more output starting at next_out and update next_out and avail_out
+ accordingly. inflate() provides as much output as possible, until there is
+ no more input data or no more space in the output buffer (see below about
+ the flush parameter).
+
+ Before the call of inflate(), the application should ensure that at least
+ one of the actions is possible, by providing more input and/or consuming more
+ output, and updating the next_* and avail_* values accordingly. The
+ application can consume the uncompressed output when it wants, for example
+ when the output buffer is full (avail_out == 0), or after each call of
+ inflate(). If inflate returns Z_OK and with zero avail_out, it must be
+ called again after making room in the output buffer because there might be
+ more output pending.
+
+ The flush parameter of inflate() can be Z_NO_FLUSH, Z_SYNC_FLUSH, Z_FINISH,
+ Z_BLOCK, or Z_TREES. Z_SYNC_FLUSH requests that inflate() flush as much
+ output as possible to the output buffer. Z_BLOCK requests that inflate()
+ stop if and when it gets to the next deflate block boundary. When decoding
+ the zlib or gzip format, this will cause inflate() to return immediately
+ after the header and before the first block. When doing a raw inflate,
+ inflate() will go ahead and process the first block, and will return when it
+ gets to the end of that block, or when it runs out of data.
+
+ The Z_BLOCK option assists in appending to or combining deflate streams.
+ Also to assist in this, on return inflate() will set strm->data_type to the
+ number of unused bits in the last byte taken from strm->next_in, plus 64 if
+ inflate() is currently decoding the last block in the deflate stream, plus
+ 128 if inflate() returned immediately after decoding an end-of-block code or
+ decoding the complete header up to just before the first byte of the deflate
+ stream. The end-of-block will not be indicated until all of the uncompressed
+ data from that block has been written to strm->next_out. The number of
+ unused bits may in general be greater than seven, except when bit 7 of
+ data_type is set, in which case the number of unused bits will be less than
+ eight. data_type is set as noted here every time inflate() returns for all
+ flush options, and so can be used to determine the amount of currently
+ consumed input in bits.
+
+ The Z_TREES option behaves as Z_BLOCK does, but it also returns when the
+ end of each deflate block header is reached, before any actual data in that
+ block is decoded. This allows the caller to determine the length of the
+ deflate block header for later use in random access within a deflate block.
+ 256 is added to the value of strm->data_type when inflate() returns
+ immediately after reaching the end of the deflate block header.
+
+ inflate() should normally be called until it returns Z_STREAM_END or an
+ error. However if all decompression is to be performed in a single step (a
+ single call of inflate), the parameter flush should be set to Z_FINISH. In
+ this case all pending input is processed and all pending output is flushed;
+ avail_out must be large enough to hold all of the uncompressed data for the
+ operation to complete. (The size of the uncompressed data may have been
+ saved by the compressor for this purpose.) The use of Z_FINISH is not
+ required to perform an inflation in one step. However it may be used to
+ inform inflate that a faster approach can be used for the single inflate()
+ call. Z_FINISH also informs inflate to not maintain a sliding window if the
+ stream completes, which reduces inflate's memory footprint. If the stream
+ does not complete, either because not all of the stream is provided or not
+ enough output space is provided, then a sliding window will be allocated and
+ inflate() can be called again to continue the operation as if Z_NO_FLUSH had
+ been used.
+
+ In this implementation, inflate() always flushes as much output as
+ possible to the output buffer, and always uses the faster approach on the
+ first call. So the effects of the flush parameter in this implementation are
+ on the return value of inflate() as noted below, when inflate() returns early
+ when Z_BLOCK or Z_TREES is used, and when inflate() avoids the allocation of
+ memory for a sliding window when Z_FINISH is used.
+
+ If a preset dictionary is needed after this call (see inflateSetDictionary
+ below), inflate sets strm->adler to the Adler-32 checksum of the dictionary
+ chosen by the compressor and returns Z_NEED_DICT; otherwise it sets
+ strm->adler to the Adler-32 checksum of all output produced so far (that is,
+ total_out bytes) and returns Z_OK, Z_STREAM_END or an error code as described
+ below. At the end of the stream, inflate() checks that its computed adler32
+ checksum is equal to that saved by the compressor and returns Z_STREAM_END
+ only if the checksum is correct.
+
+ inflate() can decompress and check either zlib-wrapped or gzip-wrapped
+ deflate data. The header type is detected automatically, if requested when
+ initializing with inflateInit2(). Any information contained in the gzip
+ header is not retained, so applications that need that information should
+ instead use raw inflate, see inflateInit2() below, or inflateBack() and
+ perform their own processing of the gzip header and trailer. When processing
+ gzip-wrapped deflate data, strm->adler32 is set to the CRC-32 of the output
+ producted so far. The CRC-32 is checked against the gzip trailer.
+
+ inflate() returns Z_OK if some progress has been made (more input processed
+ or more output produced), Z_STREAM_END if the end of the compressed data has
+ been reached and all uncompressed output has been produced, Z_NEED_DICT if a
+ preset dictionary is needed at this point, Z_DATA_ERROR if the input data was
+ corrupted (input stream not conforming to the zlib format or incorrect check
+ value), Z_STREAM_ERROR if the stream structure was inconsistent (for example
+ next_in or next_out was Z_NULL), Z_MEM_ERROR if there was not enough memory,
+ Z_BUF_ERROR if no progress is possible or if there was not enough room in the
+ output buffer when Z_FINISH is used. Note that Z_BUF_ERROR is not fatal, and
+ inflate() can be called again with more input and more output space to
+ continue decompressing. If Z_DATA_ERROR is returned, the application may
+ then call inflateSync() to look for a good compression block if a partial
+ recovery of the data is desired.
+*/
+
+
+ZEXTERN int ZEXPORT inflateEnd OF((z_streamp strm));
+/*
+ All dynamically allocated data structures for this stream are freed.
+ This function discards any unprocessed input and does not flush any pending
+ output.
+
+ inflateEnd returns Z_OK if success, Z_STREAM_ERROR if the stream state
+ was inconsistent. In the error case, msg may be set but then points to a
+ static string (which must not be deallocated).
+*/
+
+
+ /* Advanced functions */
+
+/*
+ The following functions are needed only in some special applications.
+*/
+
+/*
+ZEXTERN int ZEXPORT deflateInit2 OF((z_streamp strm,
+ int level,
+ int method,
+ int windowBits,
+ int memLevel,
+ int strategy));
+
+ This is another version of deflateInit with more compression options. The
+ fields next_in, zalloc, zfree and opaque must be initialized before by the
+ caller.
+
+ The method parameter is the compression method. It must be Z_DEFLATED in
+ this version of the library.
+
+ The windowBits parameter is the base two logarithm of the window size
+ (the size of the history buffer). It should be in the range 8..15 for this
+ version of the library. Larger values of this parameter result in better
+ compression at the expense of memory usage. The default value is 15 if
+ deflateInit is used instead.
+
+ windowBits can also be -8..-15 for raw deflate. In this case, -windowBits
+ determines the window size. deflate() will then generate raw deflate data
+ with no zlib header or trailer, and will not compute an adler32 check value.
+
+ windowBits can also be greater than 15 for optional gzip encoding. Add
+ 16 to windowBits to write a simple gzip header and trailer around the
+ compressed data instead of a zlib wrapper. The gzip header will have no
+ file name, no extra data, no comment, no modification time (set to zero), no
+ header crc, and the operating system will be set to 255 (unknown). If a
+ gzip stream is being written, strm->adler is a crc32 instead of an adler32.
+
+ The memLevel parameter specifies how much memory should be allocated
+ for the internal compression state. memLevel=1 uses minimum memory but is
+ slow and reduces compression ratio; memLevel=9 uses maximum memory for
+ optimal speed. The default value is 8. See zconf.h for total memory usage
+ as a function of windowBits and memLevel.
+
+ The strategy parameter is used to tune the compression algorithm. Use the
+ value Z_DEFAULT_STRATEGY for normal data, Z_FILTERED for data produced by a
+ filter (or predictor), Z_HUFFMAN_ONLY to force Huffman encoding only (no
+ string match), or Z_RLE to limit match distances to one (run-length
+ encoding). Filtered data consists mostly of small values with a somewhat
+ random distribution. In this case, the compression algorithm is tuned to
+ compress them better. The effect of Z_FILTERED is to force more Huffman
+ coding and less string matching; it is somewhat intermediate between
+ Z_DEFAULT_STRATEGY and Z_HUFFMAN_ONLY. Z_RLE is designed to be almost as
+ fast as Z_HUFFMAN_ONLY, but give better compression for PNG image data. The
+ strategy parameter only affects the compression ratio but not the
+ correctness of the compressed output even if it is not set appropriately.
+ Z_FIXED prevents the use of dynamic Huffman codes, allowing for a simpler
+ decoder for special applications.
+
+ deflateInit2 returns Z_OK if success, Z_MEM_ERROR if there was not enough
+ memory, Z_STREAM_ERROR if any parameter is invalid (such as an invalid
+ method), or Z_VERSION_ERROR if the zlib library version (zlib_version) is
+ incompatible with the version assumed by the caller (ZLIB_VERSION). msg is
+ set to null if there is no error message. deflateInit2 does not perform any
+ compression: this will be done by deflate().
+*/
+
+ZEXTERN int ZEXPORT deflateSetDictionary OF((z_streamp strm,
+ const Bytef *dictionary,
+ uInt dictLength));
+/*
+ Initializes the compression dictionary from the given byte sequence
+ without producing any compressed output. When using the zlib format, this
+ function must be called immediately after deflateInit, deflateInit2 or
+ deflateReset, and before any call of deflate. When doing raw deflate, this
+ function must be called either before any call of deflate, or immediately
+ after the completion of a deflate block, i.e. after all input has been
+ consumed and all output has been delivered when using any of the flush
+ options Z_BLOCK, Z_PARTIAL_FLUSH, Z_SYNC_FLUSH, or Z_FULL_FLUSH. The
+ compressor and decompressor must use exactly the same dictionary (see
+ inflateSetDictionary).
+
+ The dictionary should consist of strings (byte sequences) that are likely
+ to be encountered later in the data to be compressed, with the most commonly
+ used strings preferably put towards the end of the dictionary. Using a
+ dictionary is most useful when the data to be compressed is short and can be
+ predicted with good accuracy; the data can then be compressed better than
+ with the default empty dictionary.
+
+ Depending on the size of the compression data structures selected by
+ deflateInit or deflateInit2, a part of the dictionary may in effect be
+ discarded, for example if the dictionary is larger than the window size
+ provided in deflateInit or deflateInit2. Thus the strings most likely to be
+ useful should be put at the end of the dictionary, not at the front. In
+ addition, the current implementation of deflate will use at most the window
+ size minus 262 bytes of the provided dictionary.
+
+ Upon return of this function, strm->adler is set to the adler32 value
+ of the dictionary; the decompressor may later use this value to determine
+ which dictionary has been used by the compressor. (The adler32 value
+ applies to the whole dictionary even if only a subset of the dictionary is
+ actually used by the compressor.) If a raw deflate was requested, then the
+ adler32 value is not computed and strm->adler is not set.
+
+ deflateSetDictionary returns Z_OK if success, or Z_STREAM_ERROR if a
+ parameter is invalid (e.g. dictionary being Z_NULL) or the stream state is
+ inconsistent (for example if deflate has already been called for this stream
+ or if not at a block boundary for raw deflate). deflateSetDictionary does
+ not perform any compression: this will be done by deflate().
+*/
+
+ZEXTERN int ZEXPORT deflateCopy OF((z_streamp dest,
+ z_streamp source));
+/*
+ Sets the destination stream as a complete copy of the source stream.
+
+ This function can be useful when several compression strategies will be
+ tried, for example when there are several ways of pre-processing the input
+ data with a filter. The streams that will be discarded should then be freed
+ by calling deflateEnd. Note that deflateCopy duplicates the internal
+ compression state which can be quite large, so this strategy is slow and can
+ consume lots of memory.
+
+ deflateCopy returns Z_OK if success, Z_MEM_ERROR if there was not
+ enough memory, Z_STREAM_ERROR if the source stream state was inconsistent
+ (such as zalloc being Z_NULL). msg is left unchanged in both source and
+ destination.
+*/
+
+ZEXTERN int ZEXPORT deflateReset OF((z_streamp strm));
+/*
+ This function is equivalent to deflateEnd followed by deflateInit,
+ but does not free and reallocate all the internal compression state. The
+ stream will keep the same compression level and any other attributes that
+ may have been set by deflateInit2.
+
+ deflateReset returns Z_OK if success, or Z_STREAM_ERROR if the source
+ stream state was inconsistent (such as zalloc or state being Z_NULL).
+*/
+
+ZEXTERN int ZEXPORT deflateParams OF((z_streamp strm,
+ int level,
+ int strategy));
+/*
+ Dynamically update the compression level and compression strategy. The
+ interpretation of level and strategy is as in deflateInit2. This can be
+ used to switch between compression and straight copy of the input data, or
+ to switch to a different kind of input data requiring a different strategy.
+ If the compression level is changed, the input available so far is
+ compressed with the old level (and may be flushed); the new level will take
+ effect only at the next call of deflate().
+
+ Before the call of deflateParams, the stream state must be set as for
+ a call of deflate(), since the currently available input may have to be
+ compressed and flushed. In particular, strm->avail_out must be non-zero.
+
+ deflateParams returns Z_OK if success, Z_STREAM_ERROR if the source
+ stream state was inconsistent or if a parameter was invalid, Z_BUF_ERROR if
+ strm->avail_out was zero.
+*/
+
+ZEXTERN int ZEXPORT deflateTune OF((z_streamp strm,
+ int good_length,
+ int max_lazy,
+ int nice_length,
+ int max_chain));
+/*
+ Fine tune deflate's internal compression parameters. This should only be
+ used by someone who understands the algorithm used by zlib's deflate for
+ searching for the best matching string, and even then only by the most
+ fanatic optimizer trying to squeeze out the last compressed bit for their
+ specific input data. Read the deflate.c source code for the meaning of the
+ max_lazy, good_length, nice_length, and max_chain parameters.
+
+ deflateTune() can be called after deflateInit() or deflateInit2(), and
+ returns Z_OK on success, or Z_STREAM_ERROR for an invalid deflate stream.
+ */
+
+ZEXTERN uLong ZEXPORT deflateBound OF((z_streamp strm,
+ uLong sourceLen));
+/*
+ deflateBound() returns an upper bound on the compressed size after
+ deflation of sourceLen bytes. It must be called after deflateInit() or
+ deflateInit2(), and after deflateSetHeader(), if used. This would be used
+ to allocate an output buffer for deflation in a single pass, and so would be
+ called before deflate(). If that first deflate() call is provided the
+ sourceLen input bytes, an output buffer allocated to the size returned by
+ deflateBound(), and the flush value Z_FINISH, then deflate() is guaranteed
+ to return Z_STREAM_END. Note that it is possible for the compressed size to
+ be larger than the value returned by deflateBound() if flush options other
+ than Z_FINISH or Z_NO_FLUSH are used.
+*/
+
+ZEXTERN int ZEXPORT deflatePending OF((z_streamp strm,
+ unsigned *pending,
+ int *bits));
+/*
+ deflatePending() returns the number of bytes and bits of output that have
+ been generated, but not yet provided in the available output. The bytes not
+ provided would be due to the available output space having being consumed.
+ The number of bits of output not provided are between 0 and 7, where they
+ await more bits to join them in order to fill out a full byte. If pending
+ or bits are Z_NULL, then those values are not set.
+
+ deflatePending returns Z_OK if success, or Z_STREAM_ERROR if the source
+ stream state was inconsistent.
+ */
+
+ZEXTERN int ZEXPORT deflatePrime OF((z_streamp strm,
+ int bits,
+ int value));
+/*
+ deflatePrime() inserts bits in the deflate output stream. The intent
+ is that this function is used to start off the deflate output with the bits
+ leftover from a previous deflate stream when appending to it. As such, this
+ function can only be used for raw deflate, and must be used before the first
+ deflate() call after a deflateInit2() or deflateReset(). bits must be less
+ than or equal to 16, and that many of the least significant bits of value
+ will be inserted in the output.
+
+ deflatePrime returns Z_OK if success, Z_BUF_ERROR if there was not enough
+ room in the internal buffer to insert the bits, or Z_STREAM_ERROR if the
+ source stream state was inconsistent.
+*/
+
+ZEXTERN int ZEXPORT deflateSetHeader OF((z_streamp strm,
+ gz_headerp head));
+/*
+ deflateSetHeader() provides gzip header information for when a gzip
+ stream is requested by deflateInit2(). deflateSetHeader() may be called
+ after deflateInit2() or deflateReset() and before the first call of
+ deflate(). The text, time, os, extra field, name, and comment information
+ in the provided gz_header structure are written to the gzip header (xflag is
+ ignored -- the extra flags are set according to the compression level). The
+ caller must assure that, if not Z_NULL, name and comment are terminated with
+ a zero byte, and that if extra is not Z_NULL, that extra_len bytes are
+ available there. If hcrc is true, a gzip header crc is included. Note that
+ the current versions of the command-line version of gzip (up through version
+ 1.3.x) do not support header crc's, and will report that it is a "multi-part
+ gzip file" and give up.
+
+ If deflateSetHeader is not used, the default gzip header has text false,
+ the time set to zero, and os set to 255, with no extra, name, or comment
+ fields. The gzip header is returned to the default state by deflateReset().
+
+ deflateSetHeader returns Z_OK if success, or Z_STREAM_ERROR if the source
+ stream state was inconsistent.
+*/
+
+/*
+ZEXTERN int ZEXPORT inflateInit2 OF((z_streamp strm,
+ int windowBits));
+
+ This is another version of inflateInit with an extra parameter. The
+ fields next_in, avail_in, zalloc, zfree and opaque must be initialized
+ before by the caller.
+
+ The windowBits parameter is the base two logarithm of the maximum window
+ size (the size of the history buffer). It should be in the range 8..15 for
+ this version of the library. The default value is 15 if inflateInit is used
+ instead. windowBits must be greater than or equal to the windowBits value
+ provided to deflateInit2() while compressing, or it must be equal to 15 if
+ deflateInit2() was not used. If a compressed stream with a larger window
+ size is given as input, inflate() will return with the error code
+ Z_DATA_ERROR instead of trying to allocate a larger window.
+
+ windowBits can also be zero to request that inflate use the window size in
+ the zlib header of the compressed stream.
+
+ windowBits can also be -8..-15 for raw inflate. In this case, -windowBits
+ determines the window size. inflate() will then process raw deflate data,
+ not looking for a zlib or gzip header, not generating a check value, and not
+ looking for any check values for comparison at the end of the stream. This
+ is for use with other formats that use the deflate compressed data format
+ such as zip. Those formats provide their own check values. If a custom
+ format is developed using the raw deflate format for compressed data, it is
+ recommended that a check value such as an adler32 or a crc32 be applied to
+ the uncompressed data as is done in the zlib, gzip, and zip formats. For
+ most applications, the zlib format should be used as is. Note that comments
+ above on the use in deflateInit2() applies to the magnitude of windowBits.
+
+ windowBits can also be greater than 15 for optional gzip decoding. Add
+ 32 to windowBits to enable zlib and gzip decoding with automatic header
+ detection, or add 16 to decode only the gzip format (the zlib format will
+ return a Z_DATA_ERROR). If a gzip stream is being decoded, strm->adler is a
+ crc32 instead of an adler32.
+
+ inflateInit2 returns Z_OK if success, Z_MEM_ERROR if there was not enough
+ memory, Z_VERSION_ERROR if the zlib library version is incompatible with the
+ version assumed by the caller, or Z_STREAM_ERROR if the parameters are
+ invalid, such as a null pointer to the structure. msg is set to null if
+ there is no error message. inflateInit2 does not perform any decompression
+ apart from possibly reading the zlib header if present: actual decompression
+ will be done by inflate(). (So next_in and avail_in may be modified, but
+ next_out and avail_out are unused and unchanged.) The current implementation
+ of inflateInit2() does not process any header information -- that is
+ deferred until inflate() is called.
+*/
+
+ZEXTERN int ZEXPORT inflateSetDictionary OF((z_streamp strm,
+ const Bytef *dictionary,
+ uInt dictLength));
+/*
+ Initializes the decompression dictionary from the given uncompressed byte
+ sequence. This function must be called immediately after a call of inflate,
+ if that call returned Z_NEED_DICT. The dictionary chosen by the compressor
+ can be determined from the adler32 value returned by that call of inflate.
+ The compressor and decompressor must use exactly the same dictionary (see
+ deflateSetDictionary). For raw inflate, this function can be called at any
+ time to set the dictionary. If the provided dictionary is smaller than the
+ window and there is already data in the window, then the provided dictionary
+ will amend what's there. The application must insure that the dictionary
+ that was used for compression is provided.
+
+ inflateSetDictionary returns Z_OK if success, Z_STREAM_ERROR if a
+ parameter is invalid (e.g. dictionary being Z_NULL) or the stream state is
+ inconsistent, Z_DATA_ERROR if the given dictionary doesn't match the
+ expected one (incorrect adler32 value). inflateSetDictionary does not
+ perform any decompression: this will be done by subsequent calls of
+ inflate().
+*/
+
+ZEXTERN int ZEXPORT inflateGetDictionary OF((z_streamp strm,
+ Bytef *dictionary,
+ uInt *dictLength));
+/*
+ Returns the sliding dictionary being maintained by inflate. dictLength is
+ set to the number of bytes in the dictionary, and that many bytes are copied
+ to dictionary. dictionary must have enough space, where 32768 bytes is
+ always enough. If inflateGetDictionary() is called with dictionary equal to
+ Z_NULL, then only the dictionary length is returned, and nothing is copied.
+ Similary, if dictLength is Z_NULL, then it is not set.
+
+ inflateGetDictionary returns Z_OK on success, or Z_STREAM_ERROR if the
+ stream state is inconsistent.
+*/
+
+ZEXTERN int ZEXPORT inflateSync OF((z_streamp strm));
+/*
+ Skips invalid compressed data until a possible full flush point (see above
+ for the description of deflate with Z_FULL_FLUSH) can be found, or until all
+ available input is skipped. No output is provided.
+
+ inflateSync searches for a 00 00 FF FF pattern in the compressed data.
+ All full flush points have this pattern, but not all occurrences of this
+ pattern are full flush points.
+
+ inflateSync returns Z_OK if a possible full flush point has been found,
+ Z_BUF_ERROR if no more input was provided, Z_DATA_ERROR if no flush point
+ has been found, or Z_STREAM_ERROR if the stream structure was inconsistent.
+ In the success case, the application may save the current current value of
+ total_in which indicates where valid compressed data was found. In the
+ error case, the application may repeatedly call inflateSync, providing more
+ input each time, until success or end of the input data.
+*/
+
+ZEXTERN int ZEXPORT inflateCopy OF((z_streamp dest,
+ z_streamp source));
+/*
+ Sets the destination stream as a complete copy of the source stream.
+
+ This function can be useful when randomly accessing a large stream. The
+ first pass through the stream can periodically record the inflate state,
+ allowing restarting inflate at those points when randomly accessing the
+ stream.
+
+ inflateCopy returns Z_OK if success, Z_MEM_ERROR if there was not
+ enough memory, Z_STREAM_ERROR if the source stream state was inconsistent
+ (such as zalloc being Z_NULL). msg is left unchanged in both source and
+ destination.
+*/
+
+ZEXTERN int ZEXPORT inflateReset OF((z_streamp strm));
+/*
+ This function is equivalent to inflateEnd followed by inflateInit,
+ but does not free and reallocate all the internal decompression state. The
+ stream will keep attributes that may have been set by inflateInit2.
+
+ inflateReset returns Z_OK if success, or Z_STREAM_ERROR if the source
+ stream state was inconsistent (such as zalloc or state being Z_NULL).
+*/
+
+ZEXTERN int ZEXPORT inflateReset2 OF((z_streamp strm,
+ int windowBits));
+/*
+ This function is the same as inflateReset, but it also permits changing
+ the wrap and window size requests. The windowBits parameter is interpreted
+ the same as it is for inflateInit2.
+
+ inflateReset2 returns Z_OK if success, or Z_STREAM_ERROR if the source
+ stream state was inconsistent (such as zalloc or state being Z_NULL), or if
+ the windowBits parameter is invalid.
+*/
+
+ZEXTERN int ZEXPORT inflatePrime OF((z_streamp strm,
+ int bits,
+ int value));
+/*
+ This function inserts bits in the inflate input stream. The intent is
+ that this function is used to start inflating at a bit position in the
+ middle of a byte. The provided bits will be used before any bytes are used
+ from next_in. This function should only be used with raw inflate, and
+ should be used before the first inflate() call after inflateInit2() or
+ inflateReset(). bits must be less than or equal to 16, and that many of the
+ least significant bits of value will be inserted in the input.
+
+ If bits is negative, then the input stream bit buffer is emptied. Then
+ inflatePrime() can be called again to put bits in the buffer. This is used
+ to clear out bits leftover after feeding inflate a block description prior
+ to feeding inflate codes.
+
+ inflatePrime returns Z_OK if success, or Z_STREAM_ERROR if the source
+ stream state was inconsistent.
+*/
+
+ZEXTERN long ZEXPORT inflateMark OF((z_streamp strm));
+/*
+ This function returns two values, one in the lower 16 bits of the return
+ value, and the other in the remaining upper bits, obtained by shifting the
+ return value down 16 bits. If the upper value is -1 and the lower value is
+ zero, then inflate() is currently decoding information outside of a block.
+ If the upper value is -1 and the lower value is non-zero, then inflate is in
+ the middle of a stored block, with the lower value equaling the number of
+ bytes from the input remaining to copy. If the upper value is not -1, then
+ it is the number of bits back from the current bit position in the input of
+ the code (literal or length/distance pair) currently being processed. In
+ that case the lower value is the number of bytes already emitted for that
+ code.
+
+ A code is being processed if inflate is waiting for more input to complete
+ decoding of the code, or if it has completed decoding but is waiting for
+ more output space to write the literal or match data.
+
+ inflateMark() is used to mark locations in the input data for random
+ access, which may be at bit positions, and to note those cases where the
+ output of a code may span boundaries of random access blocks. The current
+ location in the input stream can be determined from avail_in and data_type
+ as noted in the description for the Z_BLOCK flush parameter for inflate.
+
+ inflateMark returns the value noted above or -1 << 16 if the provided
+ source stream state was inconsistent.
+*/
+
+ZEXTERN int ZEXPORT inflateGetHeader OF((z_streamp strm,
+ gz_headerp head));
+/*
+ inflateGetHeader() requests that gzip header information be stored in the
+ provided gz_header structure. inflateGetHeader() may be called after
+ inflateInit2() or inflateReset(), and before the first call of inflate().
+ As inflate() processes the gzip stream, head->done is zero until the header
+ is completed, at which time head->done is set to one. If a zlib stream is
+ being decoded, then head->done is set to -1 to indicate that there will be
+ no gzip header information forthcoming. Note that Z_BLOCK or Z_TREES can be
+ used to force inflate() to return immediately after header processing is
+ complete and before any actual data is decompressed.
+
+ The text, time, xflags, and os fields are filled in with the gzip header
+ contents. hcrc is set to true if there is a header CRC. (The header CRC
+ was valid if done is set to one.) If extra is not Z_NULL, then extra_max
+ contains the maximum number of bytes to write to extra. Once done is true,
+ extra_len contains the actual extra field length, and extra contains the
+ extra field, or that field truncated if extra_max is less than extra_len.
+ If name is not Z_NULL, then up to name_max characters are written there,
+ terminated with a zero unless the length is greater than name_max. If
+ comment is not Z_NULL, then up to comm_max characters are written there,
+ terminated with a zero unless the length is greater than comm_max. When any
+ of extra, name, or comment are not Z_NULL and the respective field is not
+ present in the header, then that field is set to Z_NULL to signal its
+ absence. This allows the use of deflateSetHeader() with the returned
+ structure to duplicate the header. However if those fields are set to
+ allocated memory, then the application will need to save those pointers
+ elsewhere so that they can be eventually freed.
+
+ If inflateGetHeader is not used, then the header information is simply
+ discarded. The header is always checked for validity, including the header
+ CRC if present. inflateReset() will reset the process to discard the header
+ information. The application would need to call inflateGetHeader() again to
+ retrieve the header from the next gzip stream.
+
+ inflateGetHeader returns Z_OK if success, or Z_STREAM_ERROR if the source
+ stream state was inconsistent.
+*/
+
+/*
+ZEXTERN int ZEXPORT inflateBackInit OF((z_streamp strm, int windowBits,
+ unsigned char FAR *window));
+
+ Initialize the internal stream state for decompression using inflateBack()
+ calls. The fields zalloc, zfree and opaque in strm must be initialized
+ before the call. If zalloc and zfree are Z_NULL, then the default library-
+ derived memory allocation routines are used. windowBits is the base two
+ logarithm of the window size, in the range 8..15. window is a caller
+ supplied buffer of that size. Except for special applications where it is
+ assured that deflate was used with small window sizes, windowBits must be 15
+ and a 32K byte window must be supplied to be able to decompress general
+ deflate streams.
+
+ See inflateBack() for the usage of these routines.
+
+ inflateBackInit will return Z_OK on success, Z_STREAM_ERROR if any of
+ the parameters are invalid, Z_MEM_ERROR if the internal state could not be
+ allocated, or Z_VERSION_ERROR if the version of the library does not match
+ the version of the header file.
+*/
+
+typedef unsigned (*in_func) OF((void FAR *,
+ z_const unsigned char FAR * FAR *));
+typedef int (*out_func) OF((void FAR *, unsigned char FAR *, unsigned));
+
+ZEXTERN int ZEXPORT inflateBack OF((z_streamp strm,
+ in_func in, void FAR *in_desc,
+ out_func out, void FAR *out_desc));
+/*
+ inflateBack() does a raw inflate with a single call using a call-back
+ interface for input and output. This is potentially more efficient than
+ inflate() for file i/o applications, in that it avoids copying between the
+ output and the sliding window by simply making the window itself the output
+ buffer. inflate() can be faster on modern CPUs when used with large
+ buffers. inflateBack() trusts the application to not change the output
+ buffer passed by the output function, at least until inflateBack() returns.
+
+ inflateBackInit() must be called first to allocate the internal state
+ and to initialize the state with the user-provided window buffer.
+ inflateBack() may then be used multiple times to inflate a complete, raw
+ deflate stream with each call. inflateBackEnd() is then called to free the
+ allocated state.
+
+ A raw deflate stream is one with no zlib or gzip header or trailer.
+ This routine would normally be used in a utility that reads zip or gzip
+ files and writes out uncompressed files. The utility would decode the
+ header and process the trailer on its own, hence this routine expects only
+ the raw deflate stream to decompress. This is different from the normal
+ behavior of inflate(), which expects either a zlib or gzip header and
+ trailer around the deflate stream.
+
+ inflateBack() uses two subroutines supplied by the caller that are then
+ called by inflateBack() for input and output. inflateBack() calls those
+ routines until it reads a complete deflate stream and writes out all of the
+ uncompressed data, or until it encounters an error. The function's
+ parameters and return types are defined above in the in_func and out_func
+ typedefs. inflateBack() will call in(in_desc, &buf) which should return the
+ number of bytes of provided input, and a pointer to that input in buf. If
+ there is no input available, in() must return zero--buf is ignored in that
+ case--and inflateBack() will return a buffer error. inflateBack() will call
+ out(out_desc, buf, len) to write the uncompressed data buf[0..len-1]. out()
+ should return zero on success, or non-zero on failure. If out() returns
+ non-zero, inflateBack() will return with an error. Neither in() nor out()
+ are permitted to change the contents of the window provided to
+ inflateBackInit(), which is also the buffer that out() uses to write from.
+ The length written by out() will be at most the window size. Any non-zero
+ amount of input may be provided by in().
+
+ For convenience, inflateBack() can be provided input on the first call by
+ setting strm->next_in and strm->avail_in. If that input is exhausted, then
+ in() will be called. Therefore strm->next_in must be initialized before
+ calling inflateBack(). If strm->next_in is Z_NULL, then in() will be called
+ immediately for input. If strm->next_in is not Z_NULL, then strm->avail_in
+ must also be initialized, and then if strm->avail_in is not zero, input will
+ initially be taken from strm->next_in[0 .. strm->avail_in - 1].
+
+ The in_desc and out_desc parameters of inflateBack() is passed as the
+ first parameter of in() and out() respectively when they are called. These
+ descriptors can be optionally used to pass any information that the caller-
+ supplied in() and out() functions need to do their job.
+
+ On return, inflateBack() will set strm->next_in and strm->avail_in to
+ pass back any unused input that was provided by the last in() call. The
+ return values of inflateBack() can be Z_STREAM_END on success, Z_BUF_ERROR
+ if in() or out() returned an error, Z_DATA_ERROR if there was a format error
+ in the deflate stream (in which case strm->msg is set to indicate the nature
+ of the error), or Z_STREAM_ERROR if the stream was not properly initialized.
+ In the case of Z_BUF_ERROR, an input or output error can be distinguished
+ using strm->next_in which will be Z_NULL only if in() returned an error. If
+ strm->next_in is not Z_NULL, then the Z_BUF_ERROR was due to out() returning
+ non-zero. (in() will always be called before out(), so strm->next_in is
+ assured to be defined if out() returns non-zero.) Note that inflateBack()
+ cannot return Z_OK.
+*/
+
+ZEXTERN int ZEXPORT inflateBackEnd OF((z_streamp strm));
+/*
+ All memory allocated by inflateBackInit() is freed.
+
+ inflateBackEnd() returns Z_OK on success, or Z_STREAM_ERROR if the stream
+ state was inconsistent.
+*/
+
+ZEXTERN uLong ZEXPORT zlibCompileFlags OF((void));
+/* Return flags indicating compile-time options.
+
+ Type sizes, two bits each, 00 = 16 bits, 01 = 32, 10 = 64, 11 = other:
+ 1.0: size of uInt
+ 3.2: size of uLong
+ 5.4: size of voidpf (pointer)
+ 7.6: size of z_off_t
+
+ Compiler, assembler, and debug options:
+ 8: DEBUG
+ 9: ASMV or ASMINF -- use ASM code
+ 10: ZLIB_WINAPI -- exported functions use the WINAPI calling convention
+ 11: 0 (reserved)
+
+ One-time table building (smaller code, but not thread-safe if true):
+ 12: BUILDFIXED -- build static block decoding tables when needed
+ 13: DYNAMIC_CRC_TABLE -- build CRC calculation tables when needed
+ 14,15: 0 (reserved)
+
+ Library content (indicates missing functionality):
+ 16: NO_GZCOMPRESS -- gz* functions cannot compress (to avoid linking
+ deflate code when not needed)
+ 17: NO_GZIP -- deflate can't write gzip streams, and inflate can't detect
+ and decode gzip streams (to avoid linking crc code)
+ 18-19: 0 (reserved)
+
+ Operation variations (changes in library functionality):
+ 20: PKZIP_BUG_WORKAROUND -- slightly more permissive inflate
+ 21: FASTEST -- deflate algorithm with only one, lowest compression level
+ 22,23: 0 (reserved)
+
+ The sprintf variant used by gzprintf (zero is best):
+ 24: 0 = vs*, 1 = s* -- 1 means limited to 20 arguments after the format
+ 25: 0 = *nprintf, 1 = *printf -- 1 means gzprintf() not secure!
+ 26: 0 = returns value, 1 = void -- 1 means inferred string length returned
+
+ Remainder:
+ 27-31: 0 (reserved)
+ */
+
+#ifndef Z_SOLO
+
+ /* utility functions */
+
+/*
+ The following utility functions are implemented on top of the basic
+ stream-oriented functions. To simplify the interface, some default options
+ are assumed (compression level and memory usage, standard memory allocation
+ functions). The source code of these utility functions can be modified if
+ you need special options.
+*/
+
+ZEXTERN int ZEXPORT compress OF((Bytef *dest, uLongf *destLen,
+ const Bytef *source, uLong sourceLen));
+/*
+ Compresses the source buffer into the destination buffer. sourceLen is
+ the byte length of the source buffer. Upon entry, destLen is the total size
+ of the destination buffer, which must be at least the value returned by
+ compressBound(sourceLen). Upon exit, destLen is the actual size of the
+ compressed buffer.
+
+ compress returns Z_OK if success, Z_MEM_ERROR if there was not
+ enough memory, Z_BUF_ERROR if there was not enough room in the output
+ buffer.
+*/
+
+ZEXTERN int ZEXPORT compress2 OF((Bytef *dest, uLongf *destLen,
+ const Bytef *source, uLong sourceLen,
+ int level));
+/*
+ Compresses the source buffer into the destination buffer. The level
+ parameter has the same meaning as in deflateInit. sourceLen is the byte
+ length of the source buffer. Upon entry, destLen is the total size of the
+ destination buffer, which must be at least the value returned by
+ compressBound(sourceLen). Upon exit, destLen is the actual size of the
+ compressed buffer.
+
+ compress2 returns Z_OK if success, Z_MEM_ERROR if there was not enough
+ memory, Z_BUF_ERROR if there was not enough room in the output buffer,
+ Z_STREAM_ERROR if the level parameter is invalid.
+*/
+
+ZEXTERN uLong ZEXPORT compressBound OF((uLong sourceLen));
+/*
+ compressBound() returns an upper bound on the compressed size after
+ compress() or compress2() on sourceLen bytes. It would be used before a
+ compress() or compress2() call to allocate the destination buffer.
+*/
+
+ZEXTERN int ZEXPORT uncompress OF((Bytef *dest, uLongf *destLen,
+ const Bytef *source, uLong sourceLen));
+/*
+ Decompresses the source buffer into the destination buffer. sourceLen is
+ the byte length of the source buffer. Upon entry, destLen is the total size
+ of the destination buffer, which must be large enough to hold the entire
+ uncompressed data. (The size of the uncompressed data must have been saved
+ previously by the compressor and transmitted to the decompressor by some
+ mechanism outside the scope of this compression library.) Upon exit, destLen
+ is the actual size of the uncompressed buffer.
+
+ uncompress returns Z_OK if success, Z_MEM_ERROR if there was not
+ enough memory, Z_BUF_ERROR if there was not enough room in the output
+ buffer, or Z_DATA_ERROR if the input data was corrupted or incomplete. In
+ the case where there is not enough room, uncompress() will fill the output
+ buffer with the uncompressed data up to that point.
+*/
+
+ /* gzip file access functions */
+
+/*
+ This library supports reading and writing files in gzip (.gz) format with
+ an interface similar to that of stdio, using the functions that start with
+ "gz". The gzip format is different from the zlib format. gzip is a gzip
+ wrapper, documented in RFC 1952, wrapped around a deflate stream.
+*/
+
+typedef struct gzFile_s *gzFile; /* semi-opaque gzip file descriptor */
+
+/*
+ZEXTERN gzFile ZEXPORT gzopen OF((const char *path, const char *mode));
+
+ Opens a gzip (.gz) file for reading or writing. The mode parameter is as
+ in fopen ("rb" or "wb") but can also include a compression level ("wb9") or
+ a strategy: 'f' for filtered data as in "wb6f", 'h' for Huffman-only
+ compression as in "wb1h", 'R' for run-length encoding as in "wb1R", or 'F'
+ for fixed code compression as in "wb9F". (See the description of
+ deflateInit2 for more information about the strategy parameter.) 'T' will
+ request transparent writing or appending with no compression and not using
+ the gzip format.
+
+ "a" can be used instead of "w" to request that the gzip stream that will
+ be written be appended to the file. "+" will result in an error, since
+ reading and writing to the same gzip file is not supported. The addition of
+ "x" when writing will create the file exclusively, which fails if the file
+ already exists. On systems that support it, the addition of "e" when
+ reading or writing will set the flag to close the file on an execve() call.
+
+ These functions, as well as gzip, will read and decode a sequence of gzip
+ streams in a file. The append function of gzopen() can be used to create
+ such a file. (Also see gzflush() for another way to do this.) When
+ appending, gzopen does not test whether the file begins with a gzip stream,
+ nor does it look for the end of the gzip streams to begin appending. gzopen
+ will simply append a gzip stream to the existing file.
+
+ gzopen can be used to read a file which is not in gzip format; in this
+ case gzread will directly read from the file without decompression. When
+ reading, this will be detected automatically by looking for the magic two-
+ byte gzip header.
+
+ gzopen returns NULL if the file could not be opened, if there was
+ insufficient memory to allocate the gzFile state, or if an invalid mode was
+ specified (an 'r', 'w', or 'a' was not provided, or '+' was provided).
+ errno can be checked to determine if the reason gzopen failed was that the
+ file could not be opened.
+*/
+
+ZEXTERN gzFile ZEXPORT gzdopen OF((int fd, const char *mode));
+/*
+ gzdopen associates a gzFile with the file descriptor fd. File descriptors
+ are obtained from calls like open, dup, creat, pipe or fileno (if the file
+ has been previously opened with fopen). The mode parameter is as in gzopen.
+
+ The next call of gzclose on the returned gzFile will also close the file
+ descriptor fd, just like fclose(fdopen(fd, mode)) closes the file descriptor
+ fd. If you want to keep fd open, use fd = dup(fd_keep); gz = gzdopen(fd,
+ mode);. The duplicated descriptor should be saved to avoid a leak, since
+ gzdopen does not close fd if it fails. If you are using fileno() to get the
+ file descriptor from a FILE *, then you will have to use dup() to avoid
+ double-close()ing the file descriptor. Both gzclose() and fclose() will
+ close the associated file descriptor, so they need to have different file
+ descriptors.
+
+ gzdopen returns NULL if there was insufficient memory to allocate the
+ gzFile state, if an invalid mode was specified (an 'r', 'w', or 'a' was not
+ provided, or '+' was provided), or if fd is -1. The file descriptor is not
+ used until the next gz* read, write, seek, or close operation, so gzdopen
+ will not detect if fd is invalid (unless fd is -1).
+*/
+
+ZEXTERN int ZEXPORT gzbuffer OF((gzFile file, unsigned size));
+/*
+ Set the internal buffer size used by this library's functions. The
+ default buffer size is 8192 bytes. This function must be called after
+ gzopen() or gzdopen(), and before any other calls that read or write the
+ file. The buffer memory allocation is always deferred to the first read or
+ write. Two buffers are allocated, either both of the specified size when
+ writing, or one of the specified size and the other twice that size when
+ reading. A larger buffer size of, for example, 64K or 128K bytes will
+ noticeably increase the speed of decompression (reading).
+
+ The new buffer size also affects the maximum length for gzprintf().
+
+ gzbuffer() returns 0 on success, or -1 on failure, such as being called
+ too late.
+*/
+
+ZEXTERN int ZEXPORT gzsetparams OF((gzFile file, int level, int strategy));
+/*
+ Dynamically update the compression level or strategy. See the description
+ of deflateInit2 for the meaning of these parameters.
+
+ gzsetparams returns Z_OK if success, or Z_STREAM_ERROR if the file was not
+ opened for writing.
+*/
+
+ZEXTERN int ZEXPORT gzread OF((gzFile file, voidp buf, unsigned len));
+/*
+ Reads the given number of uncompressed bytes from the compressed file. If
+ the input file is not in gzip format, gzread copies the given number of
+ bytes into the buffer directly from the file.
+
+ After reaching the end of a gzip stream in the input, gzread will continue
+ to read, looking for another gzip stream. Any number of gzip streams may be
+ concatenated in the input file, and will all be decompressed by gzread().
+ If something other than a gzip stream is encountered after a gzip stream,
+ that remaining trailing garbage is ignored (and no error is returned).
+
+ gzread can be used to read a gzip file that is being concurrently written.
+ Upon reaching the end of the input, gzread will return with the available
+ data. If the error code returned by gzerror is Z_OK or Z_BUF_ERROR, then
+ gzclearerr can be used to clear the end of file indicator in order to permit
+ gzread to be tried again. Z_OK indicates that a gzip stream was completed
+ on the last gzread. Z_BUF_ERROR indicates that the input file ended in the
+ middle of a gzip stream. Note that gzread does not return -1 in the event
+ of an incomplete gzip stream. This error is deferred until gzclose(), which
+ will return Z_BUF_ERROR if the last gzread ended in the middle of a gzip
+ stream. Alternatively, gzerror can be used before gzclose to detect this
+ case.
+
+ gzread returns the number of uncompressed bytes actually read, less than
+ len for end of file, or -1 for error.
+*/
+
+ZEXTERN int ZEXPORT gzwrite OF((gzFile file,
+ voidpc buf, unsigned len));
+/*
+ Writes the given number of uncompressed bytes into the compressed file.
+ gzwrite returns the number of uncompressed bytes written or 0 in case of
+ error.
+*/
+
+ZEXTERN int ZEXPORTVA gzprintf Z_ARG((gzFile file, const char *format, ...));
+/*
+ Converts, formats, and writes the arguments to the compressed file under
+ control of the format string, as in fprintf. gzprintf returns the number of
+ uncompressed bytes actually written, or 0 in case of error. The number of
+ uncompressed bytes written is limited to 8191, or one less than the buffer
+ size given to gzbuffer(). The caller should assure that this limit is not
+ exceeded. If it is exceeded, then gzprintf() will return an error (0) with
+ nothing written. In this case, there may also be a buffer overflow with
+ unpredictable consequences, which is possible only if zlib was compiled with
+ the insecure functions sprintf() or vsprintf() because the secure snprintf()
+ or vsnprintf() functions were not available. This can be determined using
+ zlibCompileFlags().
+*/
+
+ZEXTERN int ZEXPORT gzputs OF((gzFile file, const char *s));
+/*
+ Writes the given null-terminated string to the compressed file, excluding
+ the terminating null character.
+
+ gzputs returns the number of characters written, or -1 in case of error.
+*/
+
+ZEXTERN char * ZEXPORT gzgets OF((gzFile file, char *buf, int len));
+/*
+ Reads bytes from the compressed file until len-1 characters are read, or a
+ newline character is read and transferred to buf, or an end-of-file
+ condition is encountered. If any characters are read or if len == 1, the
+ string is terminated with a null character. If no characters are read due
+ to an end-of-file or len < 1, then the buffer is left untouched.
+
+ gzgets returns buf which is a null-terminated string, or it returns NULL
+ for end-of-file or in case of error. If there was an error, the contents at
+ buf are indeterminate.
+*/
+
+ZEXTERN int ZEXPORT gzputc OF((gzFile file, int c));
+/*
+ Writes c, converted to an unsigned char, into the compressed file. gzputc
+ returns the value that was written, or -1 in case of error.
+*/
+
+ZEXTERN int ZEXPORT gzgetc OF((gzFile file));
+/*
+ Reads one byte from the compressed file. gzgetc returns this byte or -1
+ in case of end of file or error. This is implemented as a macro for speed.
+ As such, it does not do all of the checking the other functions do. I.e.
+ it does not check to see if file is NULL, nor whether the structure file
+ points to has been clobbered or not.
+*/
+
+ZEXTERN int ZEXPORT gzungetc OF((int c, gzFile file));
+/*
+ Push one character back onto the stream to be read as the first character
+ on the next read. At least one character of push-back is allowed.
+ gzungetc() returns the character pushed, or -1 on failure. gzungetc() will
+ fail if c is -1, and may fail if a character has been pushed but not read
+ yet. If gzungetc is used immediately after gzopen or gzdopen, at least the
+ output buffer size of pushed characters is allowed. (See gzbuffer above.)
+ The pushed character will be discarded if the stream is repositioned with
+ gzseek() or gzrewind().
+*/
+
+ZEXTERN int ZEXPORT gzflush OF((gzFile file, int flush));
+/*
+ Flushes all pending output into the compressed file. The parameter flush
+ is as in the deflate() function. The return value is the zlib error number
+ (see function gzerror below). gzflush is only permitted when writing.
+
+ If the flush parameter is Z_FINISH, the remaining data is written and the
+ gzip stream is completed in the output. If gzwrite() is called again, a new
+ gzip stream will be started in the output. gzread() is able to read such
+ concatented gzip streams.
+
+ gzflush should be called only when strictly necessary because it will
+ degrade compression if called too often.
+*/
+
+/*
+ZEXTERN z_off_t ZEXPORT gzseek OF((gzFile file,
+ z_off_t offset, int whence));
+
+ Sets the starting position for the next gzread or gzwrite on the given
+ compressed file. The offset represents a number of bytes in the
+ uncompressed data stream. The whence parameter is defined as in lseek(2);
+ the value SEEK_END is not supported.
+
+ If the file is opened for reading, this function is emulated but can be
+ extremely slow. If the file is opened for writing, only forward seeks are
+ supported; gzseek then compresses a sequence of zeroes up to the new
+ starting position.
+
+ gzseek returns the resulting offset location as measured in bytes from
+ the beginning of the uncompressed stream, or -1 in case of error, in
+ particular if the file is opened for writing and the new starting position
+ would be before the current position.
+*/
+
+ZEXTERN int ZEXPORT gzrewind OF((gzFile file));
+/*
+ Rewinds the given file. This function is supported only for reading.
+
+ gzrewind(file) is equivalent to (int)gzseek(file, 0L, SEEK_SET)
+*/
+
+/*
+ZEXTERN z_off_t ZEXPORT gztell OF((gzFile file));
+
+ Returns the starting position for the next gzread or gzwrite on the given
+ compressed file. This position represents a number of bytes in the
+ uncompressed data stream, and is zero when starting, even if appending or
+ reading a gzip stream from the middle of a file using gzdopen().
+
+ gztell(file) is equivalent to gzseek(file, 0L, SEEK_CUR)
+*/
+
+/*
+ZEXTERN z_off_t ZEXPORT gzoffset OF((gzFile file));
+
+ Returns the current offset in the file being read or written. This offset
+ includes the count of bytes that precede the gzip stream, for example when
+ appending or when using gzdopen() for reading. When reading, the offset
+ does not include as yet unused buffered input. This information can be used
+ for a progress indicator. On error, gzoffset() returns -1.
+*/
+
+ZEXTERN int ZEXPORT gzeof OF((gzFile file));
+/*
+ Returns true (1) if the end-of-file indicator has been set while reading,
+ false (0) otherwise. Note that the end-of-file indicator is set only if the
+ read tried to go past the end of the input, but came up short. Therefore,
+ just like feof(), gzeof() may return false even if there is no more data to
+ read, in the event that the last read request was for the exact number of
+ bytes remaining in the input file. This will happen if the input file size
+ is an exact multiple of the buffer size.
+
+ If gzeof() returns true, then the read functions will return no more data,
+ unless the end-of-file indicator is reset by gzclearerr() and the input file
+ has grown since the previous end of file was detected.
+*/
+
+ZEXTERN int ZEXPORT gzdirect OF((gzFile file));
+/*
+ Returns true (1) if file is being copied directly while reading, or false
+ (0) if file is a gzip stream being decompressed.
+
+ If the input file is empty, gzdirect() will return true, since the input
+ does not contain a gzip stream.
+
+ If gzdirect() is used immediately after gzopen() or gzdopen() it will
+ cause buffers to be allocated to allow reading the file to determine if it
+ is a gzip file. Therefore if gzbuffer() is used, it should be called before
+ gzdirect().
+
+ When writing, gzdirect() returns true (1) if transparent writing was
+ requested ("wT" for the gzopen() mode), or false (0) otherwise. (Note:
+ gzdirect() is not needed when writing. Transparent writing must be
+ explicitly requested, so the application already knows the answer. When
+ linking statically, using gzdirect() will include all of the zlib code for
+ gzip file reading and decompression, which may not be desired.)
+*/
+
+ZEXTERN int ZEXPORT gzclose OF((gzFile file));
+/*
+ Flushes all pending output if necessary, closes the compressed file and
+ deallocates the (de)compression state. Note that once file is closed, you
+ cannot call gzerror with file, since its structures have been deallocated.
+ gzclose must not be called more than once on the same file, just as free
+ must not be called more than once on the same allocation.
+
+ gzclose will return Z_STREAM_ERROR if file is not valid, Z_ERRNO on a
+ file operation error, Z_MEM_ERROR if out of memory, Z_BUF_ERROR if the
+ last read ended in the middle of a gzip stream, or Z_OK on success.
+*/
+
+ZEXTERN int ZEXPORT gzclose_r OF((gzFile file));
+ZEXTERN int ZEXPORT gzclose_w OF((gzFile file));
+/*
+ Same as gzclose(), but gzclose_r() is only for use when reading, and
+ gzclose_w() is only for use when writing or appending. The advantage to
+ using these instead of gzclose() is that they avoid linking in zlib
+ compression or decompression code that is not used when only reading or only
+ writing respectively. If gzclose() is used, then both compression and
+ decompression code will be included the application when linking to a static
+ zlib library.
+*/
+
+ZEXTERN const char * ZEXPORT gzerror OF((gzFile file, int *errnum));
+/*
+ Returns the error message for the last error which occurred on the given
+ compressed file. errnum is set to zlib error number. If an error occurred
+ in the file system and not in the compression library, errnum is set to
+ Z_ERRNO and the application may consult errno to get the exact error code.
+
+ The application must not modify the returned string. Future calls to
+ this function may invalidate the previously returned string. If file is
+ closed, then the string previously returned by gzerror will no longer be
+ available.
+
+ gzerror() should be used to distinguish errors from end-of-file for those
+ functions above that do not distinguish those cases in their return values.
+*/
+
+ZEXTERN void ZEXPORT gzclearerr OF((gzFile file));
+/*
+ Clears the error and end-of-file flags for file. This is analogous to the
+ clearerr() function in stdio. This is useful for continuing to read a gzip
+ file that is being written concurrently.
+*/
+
+#endif /* !Z_SOLO */
+
+ /* checksum functions */
+
+/*
+ These functions are not related to compression but are exported
+ anyway because they might be useful in applications using the compression
+ library.
+*/
+
+ZEXTERN uLong ZEXPORT adler32 OF((uLong adler, const Bytef *buf, uInt len));
+/*
+ Update a running Adler-32 checksum with the bytes buf[0..len-1] and
+ return the updated checksum. If buf is Z_NULL, this function returns the
+ required initial value for the checksum.
+
+ An Adler-32 checksum is almost as reliable as a CRC32 but can be computed
+ much faster.
+
+ Usage example:
+
+ uLong adler = adler32(0L, Z_NULL, 0);
+
+ while (read_buffer(buffer, length) != EOF) {
+ adler = adler32(adler, buffer, length);
+ }
+ if (adler != original_adler) error();
+*/
+
+/*
+ZEXTERN uLong ZEXPORT adler32_combine OF((uLong adler1, uLong adler2,
+ z_off_t len2));
+
+ Combine two Adler-32 checksums into one. For two sequences of bytes, seq1
+ and seq2 with lengths len1 and len2, Adler-32 checksums were calculated for
+ each, adler1 and adler2. adler32_combine() returns the Adler-32 checksum of
+ seq1 and seq2 concatenated, requiring only adler1, adler2, and len2. Note
+ that the z_off_t type (like off_t) is a signed integer. If len2 is
+ negative, the result has no meaning or utility.
+*/
+
+ZEXTERN uLong ZEXPORT crc32 OF((uLong crc, const Bytef *buf, uInt len));
+/*
+ Update a running CRC-32 with the bytes buf[0..len-1] and return the
+ updated CRC-32. If buf is Z_NULL, this function returns the required
+ initial value for the crc. Pre- and post-conditioning (one's complement) is
+ performed within this function so it shouldn't be done by the application.
+
+ Usage example:
+
+ uLong crc = crc32(0L, Z_NULL, 0);
+
+ while (read_buffer(buffer, length) != EOF) {
+ crc = crc32(crc, buffer, length);
+ }
+ if (crc != original_crc) error();
+*/
+
+/*
+ZEXTERN uLong ZEXPORT crc32_combine OF((uLong crc1, uLong crc2, z_off_t len2));
+
+ Combine two CRC-32 check values into one. For two sequences of bytes,
+ seq1 and seq2 with lengths len1 and len2, CRC-32 check values were
+ calculated for each, crc1 and crc2. crc32_combine() returns the CRC-32
+ check value of seq1 and seq2 concatenated, requiring only crc1, crc2, and
+ len2.
+*/
+
+
+ /* various hacks, don't look :) */
+
+/* deflateInit and inflateInit are macros to allow checking the zlib version
+ * and the compiler's view of z_stream:
+ */
+ZEXTERN int ZEXPORT deflateInit_ OF((z_streamp strm, int level,
+ const char *version, int stream_size));
+ZEXTERN int ZEXPORT inflateInit_ OF((z_streamp strm,
+ const char *version, int stream_size));
+ZEXTERN int ZEXPORT deflateInit2_ OF((z_streamp strm, int level, int method,
+ int windowBits, int memLevel,
+ int strategy, const char *version,
+ int stream_size));
+ZEXTERN int ZEXPORT inflateInit2_ OF((z_streamp strm, int windowBits,
+ const char *version, int stream_size));
+ZEXTERN int ZEXPORT inflateBackInit_ OF((z_streamp strm, int windowBits,
+ unsigned char FAR *window,
+ const char *version,
+ int stream_size));
+#define deflateInit(strm, level) \
+ deflateInit_((strm), (level), ZLIB_VERSION, (int)sizeof(z_stream))
+#define inflateInit(strm) \
+ inflateInit_((strm), ZLIB_VERSION, (int)sizeof(z_stream))
+#define deflateInit2(strm, level, method, windowBits, memLevel, strategy) \
+ deflateInit2_((strm),(level),(method),(windowBits),(memLevel),\
+ (strategy), ZLIB_VERSION, (int)sizeof(z_stream))
+#define inflateInit2(strm, windowBits) \
+ inflateInit2_((strm), (windowBits), ZLIB_VERSION, \
+ (int)sizeof(z_stream))
+#define inflateBackInit(strm, windowBits, window) \
+ inflateBackInit_((strm), (windowBits), (window), \
+ ZLIB_VERSION, (int)sizeof(z_stream))
+
+#ifndef Z_SOLO
+
+/* gzgetc() macro and its supporting function and exposed data structure. Note
+ * that the real internal state is much larger than the exposed structure.
+ * This abbreviated structure exposes just enough for the gzgetc() macro. The
+ * user should not mess with these exposed elements, since their names or
+ * behavior could change in the future, perhaps even capriciously. They can
+ * only be used by the gzgetc() macro. You have been warned.
+ */
+struct gzFile_s {
+ unsigned have;
+ unsigned char *next;
+ z_off64_t pos;
+};
+ZEXTERN int ZEXPORT gzgetc_ OF((gzFile file)); /* backward compatibility */
+#ifdef Z_PREFIX_SET
+# undef z_gzgetc
+# define z_gzgetc(g) \
+ ((g)->have ? ((g)->have--, (g)->pos++, *((g)->next)++) : gzgetc(g))
+#else
+# define gzgetc(g) \
+ ((g)->have ? ((g)->have--, (g)->pos++, *((g)->next)++) : gzgetc(g))
+#endif
+
+/* provide 64-bit offset functions if _LARGEFILE64_SOURCE defined, and/or
+ * change the regular functions to 64 bits if _FILE_OFFSET_BITS is 64 (if
+ * both are true, the application gets the *64 functions, and the regular
+ * functions are changed to 64 bits) -- in case these are set on systems
+ * without large file support, _LFS64_LARGEFILE must also be true
+ */
+#ifdef Z_LARGE64
+ ZEXTERN gzFile ZEXPORT gzopen64 OF((const char *, const char *));
+ ZEXTERN z_off64_t ZEXPORT gzseek64 OF((gzFile, z_off64_t, int));
+ ZEXTERN z_off64_t ZEXPORT gztell64 OF((gzFile));
+ ZEXTERN z_off64_t ZEXPORT gzoffset64 OF((gzFile));
+ ZEXTERN uLong ZEXPORT adler32_combine64 OF((uLong, uLong, z_off64_t));
+ ZEXTERN uLong ZEXPORT crc32_combine64 OF((uLong, uLong, z_off64_t));
+#endif
+
+#if !defined(ZLIB_INTERNAL) && defined(Z_WANT64)
+# ifdef Z_PREFIX_SET
+# define z_gzopen z_gzopen64
+# define z_gzseek z_gzseek64
+# define z_gztell z_gztell64
+# define z_gzoffset z_gzoffset64
+# define z_adler32_combine z_adler32_combine64
+# define z_crc32_combine z_crc32_combine64
+# else
+# define gzopen gzopen64
+# define gzseek gzseek64
+# define gztell gztell64
+# define gzoffset gzoffset64
+# define adler32_combine adler32_combine64
+# define crc32_combine crc32_combine64
+# endif
+# ifndef Z_LARGE64
+ ZEXTERN gzFile ZEXPORT gzopen64 OF((const char *, const char *));
+ ZEXTERN z_off_t ZEXPORT gzseek64 OF((gzFile, z_off_t, int));
+ ZEXTERN z_off_t ZEXPORT gztell64 OF((gzFile));
+ ZEXTERN z_off_t ZEXPORT gzoffset64 OF((gzFile));
+ ZEXTERN uLong ZEXPORT adler32_combine64 OF((uLong, uLong, z_off_t));
+ ZEXTERN uLong ZEXPORT crc32_combine64 OF((uLong, uLong, z_off_t));
+# endif
+#else
+ ZEXTERN gzFile ZEXPORT gzopen OF((const char *, const char *));
+ ZEXTERN z_off_t ZEXPORT gzseek OF((gzFile, z_off_t, int));
+ ZEXTERN z_off_t ZEXPORT gztell OF((gzFile));
+ ZEXTERN z_off_t ZEXPORT gzoffset OF((gzFile));
+ ZEXTERN uLong ZEXPORT adler32_combine OF((uLong, uLong, z_off_t));
+ ZEXTERN uLong ZEXPORT crc32_combine OF((uLong, uLong, z_off_t));
+#endif
+
+#else /* Z_SOLO */
+
+ ZEXTERN uLong ZEXPORT adler32_combine OF((uLong, uLong, z_off_t));
+ ZEXTERN uLong ZEXPORT crc32_combine OF((uLong, uLong, z_off_t));
+
+#endif /* !Z_SOLO */
+
+/* hack for buggy compilers */
+#if !defined(ZUTIL_H) && !defined(NO_DUMMY_DECL)
+ struct internal_state {int dummy;};
+#endif
+
+/* undocumented functions */
+ZEXTERN const char * ZEXPORT zError OF((int));
+ZEXTERN int ZEXPORT inflateSyncPoint OF((z_streamp));
+ZEXTERN const z_crc_t FAR * ZEXPORT get_crc_table OF((void));
+ZEXTERN int ZEXPORT inflateUndermine OF((z_streamp, int));
+ZEXTERN int ZEXPORT inflateResetKeep OF((z_streamp));
+ZEXTERN int ZEXPORT deflateResetKeep OF((z_streamp));
+#if defined(_WIN32) && !defined(Z_SOLO)
+ZEXTERN gzFile ZEXPORT gzopen_w OF((const wchar_t *path,
+ const char *mode));
+#endif
+#if defined(STDC) || defined(Z_HAVE_STDARG_H)
+# ifndef Z_SOLO
+ZEXTERN int ZEXPORTVA gzvprintf Z_ARG((gzFile file,
+ const char *format,
+ va_list va));
+# endif
+#endif
+
+#ifdef __cplusplus
+}
+#endif
+
+#endif /* ZLIB_H */
+++ /dev/null
-Subproject commit 21604a047941b8fe81d381ede0371c75da964afd
#include "revision.h"
#include "libretro.h"
+#ifdef _3DS
+#include "3ds/3ds_utils.h"
+#endif
+
+#define PORTS_NUMBER 8
+
+#ifndef MIN
+#define MIN(a, b) ((a) < (b) ? (a) : (b))
+#endif
+
+#define ISHEXDEC ((buf[cursor]>='0') && (buf[cursor]<='9')) || ((buf[cursor]>='a') && (buf[cursor]<='f')) || ((buf[cursor]>='A') && (buf[cursor]<='F'))
+
+//hack to prevent retroarch freezing when reseting in the menu but not while running with the hot key
+static int rebootemu = 0;
+
static retro_video_refresh_t video_cb;
static retro_input_poll_t input_poll_cb;
static retro_input_state_t input_state_cb;
static struct retro_rumble_interface rumble;
static void *vout_buf;
+static void * vout_buf_ptr;
static int vout_width, vout_height;
static int vout_doffs_old, vout_fb_dirty;
static bool vout_can_dupe;
static bool duping_enable;
+static bool found_bios;
static int plugins_opened;
static int is_pal_mode;
/* memory card data */
extern char Mcd1Data[MCD_SIZE];
+extern char Mcd2Data[MCD_SIZE];
extern char McdDisable[2];
/* PCSX ReARMed core calls and stuff */
-int in_type1, in_type2;
-int in_a1[2] = { 127, 127 }, in_a2[2] = { 127, 127 };
-int in_keystate;
+int in_type[8] = { PSE_PAD_TYPE_NONE, PSE_PAD_TYPE_NONE,
+ PSE_PAD_TYPE_NONE, PSE_PAD_TYPE_NONE,
+ PSE_PAD_TYPE_NONE, PSE_PAD_TYPE_NONE,
+ PSE_PAD_TYPE_NONE, PSE_PAD_TYPE_NONE };
+int in_analog_left[8][2] = {{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 }};
+int in_analog_right[8][2] = {{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 }};
+unsigned short in_keystate[PORTS_NUMBER];
+int multitap1 = 0;
+int multitap2 = 0;
int in_enable_vibration = 1;
/* PSX max resolution is 640x512, but with enhancement it's 1024x512 */
#define VOUT_MAX_WIDTH 1024
#define VOUT_MAX_HEIGHT 512
+//Dummy functions
+bool retro_load_game_special(unsigned game_type, const struct retro_game_info *info, size_t num_info){return false;}
+void retro_unload_game(void){}
+static int vout_open(void){return 0;}
+static void vout_close(void){}
+static int snd_init(void){return 0;}
+static void snd_finish(void){}
+static int snd_busy(void){return 0;}
+
static void init_memcard(char *mcd_data)
{
unsigned off = 0;
}
}
-static int vout_open(void)
-{
- return 0;
-}
-
static void vout_set_mode(int w, int h, int raw_w, int raw_h, int bpp)
{
vout_width = w;
vout_height = h;
+
+ struct retro_framebuffer fb = {0};
+
+ fb.width = vout_width;
+ fb.height = vout_height;
+ fb.access_flags = RETRO_MEMORY_ACCESS_WRITE;
+
+ vout_buf_ptr = vout_buf;
+
+ if (environ_cb(RETRO_ENVIRONMENT_GET_CURRENT_SOFTWARE_FRAMEBUFFER, &fb) && fb.format == RETRO_PIXEL_FORMAT_RGB565)
+ {
+ vout_buf_ptr = (uint16_t*)fb.data;
+ }
+
}
#ifndef FRONTEND_SUPPORTS_RGB565
static void vout_flip(const void *vram, int stride, int bgr24, int w, int h)
{
- unsigned short *dest = vout_buf;
+ unsigned short *dest = vout_buf_ptr;
const unsigned short *src = vram;
int dstride = vout_width, h1 = h;
int doffs;
if (vram == NULL) {
// blanking
- memset(vout_buf, 0, dstride * h * 2);
+ memset(vout_buf_ptr, 0, dstride * h * 2);
goto out;
}
doffs += (dstride - w) / 2 & ~1;
if (doffs != vout_doffs_old) {
// clear borders
- memset(vout_buf, 0, dstride * h * 2);
+ memset(vout_buf_ptr, 0, dstride * h * 2);
vout_doffs_old = doffs;
}
dest += doffs;
out:
#ifndef FRONTEND_SUPPORTS_RGB565
- convert(vout_buf, vout_width * vout_height * 2);
+ convert(vout_buf_ptr, vout_width * vout_height * 2);
#endif
vout_fb_dirty = 1;
pl_rearmed_cbs.flip_cnt++;
}
-static void vout_close(void)
+#ifdef _3DS
+typedef struct
+{
+ void* buffer;
+ uint32_t target_map;
+ size_t size;
+ enum psxMapTag tag;
+}psx_map_t;
+
+psx_map_t custom_psx_maps[] = {
+ {NULL, 0x13000000, 0x210000, MAP_TAG_RAM}, // 0x80000000
+ {NULL, 0x12800000, 0x010000, MAP_TAG_OTHER}, // 0x1f800000
+ {NULL, 0x12c00000, 0x080000, MAP_TAG_OTHER}, // 0x1fc00000
+ {NULL, 0x11000000, 0x800000, MAP_TAG_LUTS}, // 0x08000000
+ {NULL, 0x12000000, 0x200000, MAP_TAG_VRAM}, // 0x00000000
+};
+
+void* pl_3ds_mmap(unsigned long addr, size_t size, int is_fixed,
+ enum psxMapTag tag)
+{
+ (void)is_fixed;
+ (void)addr;
+
+ if (__ctr_svchax)
+ {
+ psx_map_t* custom_map = custom_psx_maps;
+
+ for (; custom_map->size; custom_map++)
+ {
+ if ((custom_map->size == size) && (custom_map->tag == tag))
+ {
+ uint32_t ptr_aligned, tmp;
+
+ custom_map->buffer = malloc(size + 0x1000);
+ ptr_aligned = (((u32)custom_map->buffer) + 0xFFF) & ~0xFFF;
+
+ if(svcControlMemory(&tmp, (void*)custom_map->target_map, (void*)ptr_aligned, size, MEMOP_MAP, 0x3) < 0)
+ {
+ SysPrintf("could not map memory @0x%08X\n", custom_map->target_map);
+ exit(1);
+ }
+
+ return (void*)custom_map->target_map;
+ }
+ }
+ }
+
+ return malloc(size);
+}
+
+void pl_3ds_munmap(void *ptr, size_t size, enum psxMapTag tag)
+{
+ (void)tag;
+
+ if (__ctr_svchax)
+ {
+ psx_map_t* custom_map = custom_psx_maps;
+
+ for (; custom_map->size; custom_map++)
+ {
+ if ((custom_map->target_map == (uint32_t)ptr))
+ {
+ uint32_t ptr_aligned, tmp;
+
+ ptr_aligned = (((u32)custom_map->buffer) + 0xFFF) & ~0xFFF;
+
+ svcControlMemory(&tmp, (void*)custom_map->target_map, (void*)ptr_aligned, size, MEMOP_UNMAP, 0x3);
+
+ free(custom_map->buffer);
+ custom_map->buffer = NULL;
+ return;
+ }
+ }
+ }
+
+ free(ptr);
+}
+#endif
+
+#ifdef VITA
+typedef struct
+{
+ void* buffer;
+ uint32_t target_map;
+ size_t size;
+ enum psxMapTag tag;
+}psx_map_t;
+
+void* addr = NULL;
+
+psx_map_t custom_psx_maps[] = {
+ {NULL, NULL, 0x210000, MAP_TAG_RAM}, // 0x80000000
+ {NULL, NULL, 0x010000, MAP_TAG_OTHER}, // 0x1f800000
+ {NULL, NULL, 0x080000, MAP_TAG_OTHER}, // 0x1fc00000
+ {NULL, NULL, 0x800000, MAP_TAG_LUTS}, // 0x08000000
+ {NULL, NULL, 0x200000, MAP_TAG_VRAM}, // 0x00000000
+};
+
+int init_vita_mmap(){
+ int n;
+ void * tmpaddr;
+ addr = malloc(64*1024*1024);
+ if(addr==NULL)
+ return -1;
+ tmpaddr = ((u32)(addr+0xFFFFFF))&~0xFFFFFF;
+ custom_psx_maps[0].buffer=tmpaddr+0x2000000;
+ custom_psx_maps[1].buffer=tmpaddr+0x1800000;
+ custom_psx_maps[2].buffer=tmpaddr+0x1c00000;
+ custom_psx_maps[3].buffer=tmpaddr+0x0000000;
+ custom_psx_maps[4].buffer=tmpaddr+0x1000000;
+#if 0
+ for(n = 0; n < 5; n++){
+ sceClibPrintf("addr reserved %x\n",custom_psx_maps[n].buffer);
+ }
+#endif
+ return 0;
+}
+
+void deinit_vita_mmap(){
+ free(addr);
+}
+
+void* pl_vita_mmap(unsigned long addr, size_t size, int is_fixed,
+ enum psxMapTag tag)
+{
+ (void)is_fixed;
+ (void)addr;
+
+
+ psx_map_t* custom_map = custom_psx_maps;
+
+ for (; custom_map->size; custom_map++)
+ {
+ if ((custom_map->size == size) && (custom_map->tag == tag))
+ {
+ return custom_map->buffer;
+ }
+ }
+
+
+ return malloc(size);
+}
+
+void pl_vita_munmap(void *ptr, size_t size, enum psxMapTag tag)
{
+ (void)tag;
+
+ psx_map_t* custom_map = custom_psx_maps;
+
+ for (; custom_map->size; custom_map++)
+ {
+ if ((custom_map->buffer == ptr))
+ {
+ return;
+ }
+ }
+
+ free(ptr);
}
+#endif
static void *pl_mmap(unsigned int size)
{
void plat_trigger_vibrate(int pad, int low, int high)
{
- rumble.set_rumble_state(pad, RETRO_RUMBLE_STRONG, high << 8);
- rumble.set_rumble_state(pad, RETRO_RUMBLE_WEAK, low ? 0xffff : 0x0);
+ if(in_enable_vibration)
+ {
+ rumble.set_rumble_state(pad, RETRO_RUMBLE_STRONG, high << 8);
+ rumble.set_rumble_state(pad, RETRO_RUMBLE_WEAK, low ? 0xffff : 0x0);
+ }
}
void pl_update_gun(int *xn, int *yn, int *xres, int *yres, int *in)
}
/* sound calls */
-static int snd_init(void)
-{
- return 0;
-}
-
-static void snd_finish(void)
-{
-}
-
-static int snd_busy(void)
-{
- return 0;
-}
-
static void snd_feed(void *buf, int bytes)
{
if (audio_batch_cb != NULL)
static const struct retro_variable vars[] = {
{ "pcsx_rearmed_frameskip", "Frameskip; 0|1|2|3" },
{ "pcsx_rearmed_region", "Region; Auto|NTSC|PAL" },
- { "pcsx_rearmed_pad1type", "Pad 1 Type; standard|analog" },
- { "pcsx_rearmed_pad2type", "Pad 2 Type; standard|analog" },
+ { "pcsx_rearmed_pad1type", "Pad 1 Type; default|none|standard|analog|negcon" },
+ { "pcsx_rearmed_pad2type", "Pad 2 Type; default|none|standard|analog|negcon" },
+ { "pcsx_rearmed_pad3type", "Pad 3 Type; default|none|standard|analog|negcon" },
+ { "pcsx_rearmed_pad4type", "Pad 4 Type; default|none|standard|analog|negcon" },
+ { "pcsx_rearmed_pad5type", "Pad 5 Type; default|none|standard|analog|negcon" },
+ { "pcsx_rearmed_pad6type", "Pad 6 Type; default|none|standard|analog|negcon" },
+ { "pcsx_rearmed_pad7type", "Pad 7 Type; default|none|standard|analog|negcon" },
+ { "pcsx_rearmed_pad8type", "Pad 8 Type; default|none|standard|analog|negcon" },
+ { "pcsx_rearmed_multitap1", "Multitap 1; auto|disabled|enabled" },
+ { "pcsx_rearmed_multitap2", "Multitap 2; auto|disabled|enabled" },
+ { "pcsx_rearmed_vibration", "Enable Vibration; enabled|disabled" },
#ifndef DRC_DISABLE
{ "pcsx_rearmed_drc", "Dynamic recompiler; enabled|disabled" },
#endif
{ "pcsx_rearmed_neon_enhancement_enable", "Enhanced resolution (slow); disabled|enabled" },
{ "pcsx_rearmed_neon_enhancement_no_main", "Enhanced resolution speed hack; disabled|enabled" },
#endif
- { "pcsx_rearmed_duping_enable", "Frame duping; on|off" },
- { "pcsx_rearmed_spu_reverb", "Sound: Reverb; on|off" },
+ { "pcsx_rearmed_duping_enable", "Frame duping; enabled|disabled" },
+ { "pcsx_rearmed_show_bios_bootlogo", "Show Bios Bootlogo(Breaks some games); disabled|enabled" },
+ { "pcsx_rearmed_spu_reverb", "Sound: Reverb; enabled|disabled" },
{ "pcsx_rearmed_spu_interpolation", "Sound: Interpolation; simple|gaussian|cubic|off" },
+ { "pcsx_rearmed_pe2_fix", "Parasite Eve 2/Vandal Hearts 1/2 Fix; disabled|enabled" },
+ { "pcsx_rearmed_inuyasha_fix", "InuYasha Sengoku Battle Fix; disabled|enabled" },
{ NULL, NULL },
};
return RETRO_API_VERSION;
}
+static int controller_port_variable(unsigned port, struct retro_variable *var)
+{
+ if (port >= PORTS_NUMBER)
+ return 0;
+
+ if (!environ_cb)
+ return 0;
+
+ var->value = NULL;
+ switch (port) {
+ case 0:
+ var->key = "pcsx_rearmed_pad1type";
+ break;
+ case 1:
+ var->key = "pcsx_rearmed_pad2type";
+ break;
+ case 2:
+ var->key = "pcsx_rearmed_pad3type";
+ break;
+ case 3:
+ var->key = "pcsx_rearmed_pad4type";
+ break;
+ case 4:
+ var->key = "pcsx_rearmed_pad5type";
+ break;
+ case 5:
+ var->key = "pcsx_rearmed_pad6type";
+ break;
+ case 6:
+ var->key = "pcsx_rearmed_pad7type";
+ break;
+ case 7:
+ var->key = "pcsx_rearmed_pad8type";
+ break;
+ }
+
+ return environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, var) || var->value;
+}
+
+static void update_controller_port_variable(unsigned port)
+{
+ if (port >= PORTS_NUMBER)
+ return;
+
+ struct retro_variable var;
+
+ if (controller_port_variable(port, &var))
+ {
+ if (strcmp(var.value, "standard") == 0)
+ in_type[port] = PSE_PAD_TYPE_STANDARD;
+ else if (strcmp(var.value, "analog") == 0)
+ in_type[port] = PSE_PAD_TYPE_ANALOGPAD;
+ else if (strcmp(var.value, "negcon") == 0)
+ in_type[port] = PSE_PAD_TYPE_NEGCON;
+ else if (strcmp(var.value, "none") == 0)
+ in_type[port] = PSE_PAD_TYPE_NONE;
+ // else 'default' case, do nothing
+ }
+}
+
+static void update_controller_port_device(unsigned port, unsigned device)
+{
+ if (port >= PORTS_NUMBER)
+ return;
+
+ struct retro_variable var;
+
+ if (!controller_port_variable(port, &var))
+ return;
+
+ if (strcmp(var.value, "default") != 0)
+ return;
+
+ switch (device)
+ {
+ case RETRO_DEVICE_JOYPAD:
+ in_type[port] = PSE_PAD_TYPE_STANDARD;
+ break;
+ case RETRO_DEVICE_ANALOG:
+ in_type[port] = PSE_PAD_TYPE_ANALOGPAD;
+ break;
+ case RETRO_DEVICE_MOUSE:
+ in_type[port] = PSE_PAD_TYPE_MOUSE;
+ break;
+ case RETRO_DEVICE_LIGHTGUN:
+ in_type[port] = PSE_PAD_TYPE_GUN;
+ break;
+ case RETRO_DEVICE_NONE:
+ default:
+ in_type[port] = PSE_PAD_TYPE_NONE;
+ }
+}
+
+static void update_multitap()
+{
+ struct retro_variable var;
+ int auto_case, port;
+
+ var.value = NULL;
+ var.key = "pcsx_rearmed_multitap1";
+ auto_case = 0;
+ if (environ_cb && (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value))
+ {
+ if (strcmp(var.value, "enabled") == 0)
+ multitap1 = 1;
+ else if (strcmp(var.value, "disabled") == 0)
+ multitap1 = 0;
+ else // 'auto' case
+ auto_case = 1;
+ }
+ else
+ auto_case = 1;
+
+ if (auto_case)
+ {
+ // If a gamepad is plugged after port 2, we need a first multitap.
+ multitap1 = 0;
+ for (port = 2; port < PORTS_NUMBER; port++)
+ multitap1 |= in_type[port] != PSE_PAD_TYPE_NONE;
+ }
+
+ var.value = NULL;
+ var.key = "pcsx_rearmed_multitap2";
+ auto_case = 0;
+ if (environ_cb && (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value))
+ {
+ if (strcmp(var.value, "enabled") == 0)
+ multitap2 = 1;
+ else if (strcmp(var.value, "disabled") == 0)
+ multitap2 = 0;
+ else // 'auto' case
+ auto_case = 1;
+ }
+ else
+ auto_case = 1;
+
+ if (auto_case)
+ {
+ // If a gamepad is plugged after port 4, we need a second multitap.
+ multitap2 = 0;
+ for (port = 4; port < PORTS_NUMBER; port++)
+ multitap2 |= in_type[port] != PSE_PAD_TYPE_NONE;
+ }
+}
+
void retro_set_controller_port_device(unsigned port, unsigned device)
{
+ SysPrintf("port %u device %u",port,device);
+
+ if (port >= PORTS_NUMBER)
+ return;
+
+ update_controller_port_device(port, device);
+ update_multitap();
}
void retro_get_system_info(struct retro_system_info *info)
{
memset(info, 0, sizeof(*info));
info->library_name = "PCSX-ReARMed";
- info->library_version = "r22";
+#ifndef GIT_VERSION
+#define GIT_VERSION ""
+#endif
+ info->library_version = "r22" GIT_VERSION;
info->valid_extensions = "bin|cue|img|mdf|pbp|toc|cbn|m3u";
info->need_fullpath = true;
}
}
/* savestates */
-size_t retro_serialize_size(void)
-{
+size_t retro_serialize_size(void)
+{
// it's currently 4380651-4397047 bytes,
// but have some reserved for future
return 0x440000;
}
bool retro_serialize(void *data, size_t size)
-{
+{
int ret = SaveState(data);
return ret == 0 ? true : false;
}
// cheat funcs are destructive, need a copy..
strncpy(buf, code, sizeof(buf));
buf[sizeof(buf) - 1] = 0;
+
+ //Prepare buffered cheat for PCSX's AddCheat fucntion.
+ int cursor=0;
+ int nonhexdec=0;
+ while (buf[cursor]){
+ if (!(ISHEXDEC)){
+ if (++nonhexdec%2){
+ buf[cursor]=' ';
+ } else {
+ buf[cursor]='\n';
+ }
+ }
+ cursor++;
+ }
+
if (index < NumCheats)
ret = EditCheat(index, "", buf);
#define SLASH '/'
#endif
+#ifndef PATH_MAX
+#define PATH_MAX 4096
+#endif
+
static char base_dir[PATH_MAX];
static bool read_m3u(const char *file)
{ 5, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_R2, "R2" },
{ 5, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_R3, "R3" },
{ 5, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_SELECT, "Select" },
- { 5, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_START, "Start" },
+ { 5, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_START, "Start" },
{ 5, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_LEFT, RETRO_DEVICE_ID_ANALOG_X, "Left Analog X" },
{ 5, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_LEFT, RETRO_DEVICE_ID_ANALOG_Y, "Left Analog Y" },
{ 5, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_RIGHT, RETRO_DEVICE_ID_ANALOG_X, "Right Analog X" },
{ 6, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_R2, "R2" },
{ 6, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_R3, "R3" },
{ 6, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_SELECT, "Select" },
- { 6, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_START, "Start" },
+ { 6, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_START, "Start" },
{ 6, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_LEFT, RETRO_DEVICE_ID_ANALOG_X, "Left Analog X" },
{ 6, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_LEFT, RETRO_DEVICE_ID_ANALOG_Y, "Left Analog Y" },
{ 6, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_RIGHT, RETRO_DEVICE_ID_ANALOG_X, "Right Analog X" },
{ 7, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_R2, "R2" },
{ 7, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_R3, "R3" },
{ 7, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_SELECT, "Select" },
- { 7, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_START, "Start" },
+ { 7, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_START, "Start" },
{ 7, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_LEFT, RETRO_DEVICE_ID_ANALOG_X, "Left Analog X" },
{ 7, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_LEFT, RETRO_DEVICE_ID_ANALOG_Y, "Left Analog Y" },
{ 7, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_RIGHT, RETRO_DEVICE_ID_ANALOG_X, "Right Analog X" },
return true;
}
-bool retro_load_game_special(unsigned game_type, const struct retro_game_info *info, size_t num_info)
-{
- return false;
-}
-
-void retro_unload_game(void)
-{
-}
-
unsigned retro_get_region(void)
{
return is_pal_mode ? RETRO_REGION_PAL : RETRO_REGION_NTSC;
void retro_reset(void)
{
- SysReset();
+ //hack to prevent retroarch freezing when reseting in the menu but not while running with the hot key
+ rebootemu = 1;
+ //SysReset();
}
static const unsigned short retro_psx_map[] = {
static void update_variables(bool in_flight)
{
struct retro_variable var;
-
+ int i;
+
var.value = NULL;
var.key = "pcsx_rearmed_frameskip";
-
if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value)
pl_rearmed_cbs.frameskip = atoi(var.value);
var.value = NULL;
var.key = "pcsx_rearmed_region";
-
if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value)
{
Config.PsxAuto = 0;
Config.PsxType = 1;
}
- var.value = NULL;
- var.key = "pcsx_rearmed_pad1type";
+ for (i = 0; i < PORTS_NUMBER; i++)
+ update_controller_port_variable(i);
- if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value)
- {
- in_type1 = PSE_PAD_TYPE_STANDARD;
- if (strcmp(var.value, "analog") == 0)
- in_type1 = PSE_PAD_TYPE_ANALOGPAD;
- }
+ update_multitap();
var.value = NULL;
- var.key = "pcsx_rearmed_pad2type";
+ var.key = "pcsx_rearmed_vibration";
if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value)
{
- in_type2 = PSE_PAD_TYPE_STANDARD;
- if (strcmp(var.value, "analog") == 0)
- in_type2 = PSE_PAD_TYPE_ANALOGPAD;
+ if (strcmp(var.value, "disabled") == 0)
+ in_enable_vibration = 0;
+ else if (strcmp(var.value, "enabled") == 0)
+ in_enable_vibration = 1;
}
#ifdef __ARM_NEON__
if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value)
{
- if (strcmp(var.value, "off") == 0)
+ if (strcmp(var.value, "disabled") == 0)
duping_enable = false;
- else if (strcmp(var.value, "on") == 0)
+ else if (strcmp(var.value, "enabled") == 0)
duping_enable = true;
}
{
R3000Acpu *prev_cpu = psxCpu;
+#ifdef _3DS
+ if(!__ctr_svchax)
+ Config.Cpu = CPU_INTERPRETER;
+ else
+#endif
if (strcmp(var.value, "disabled") == 0)
Config.Cpu = CPU_INTERPRETER;
else if (strcmp(var.value, "enabled") == 0)
if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value)
{
- if (strcmp(var.value, "off") == 0)
+ if (strcmp(var.value, "disabled") == 0)
spu_config.iUseReverb = false;
- else if (strcmp(var.value, "on") == 0)
+ else if (strcmp(var.value, "enabled") == 0)
spu_config.iUseReverb = true;
}
spu_config.iUseInterpolation = 0;
}
+ var.value = "NULL";
+ var.key = "pcsx_rearmed_pe2_fix";
+
+ if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value)
+ {
+ if (strcmp(var.value, "disabled") == 0)
+ Config.RCntFix = 0;
+ else if (strcmp(var.value, "enabled") == 0)
+ Config.RCntFix = 1;
+ }
+
+ var.value = "NULL";
+ var.key = "pcsx_rearmed_inuyasha_fix";
+
+ if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value)
+ {
+ if (strcmp(var.value, "disabled") == 0)
+ Config.VSyncWA = 0;
+ else if (strcmp(var.value, "enabled") == 0)
+ Config.VSyncWA = 1;
+ }
+
if (in_flight) {
// inform core things about possible config changes
plugin_call_rearmed_cbs();
dfinput_activate();
}
+ else{
+ //not yet running
+
+ //bootlogo display hack
+ if (found_bios) {
+ var.value = "NULL";
+ var.key = "pcsx_rearmed_show_bios_bootlogo";
+ if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value)
+ {
+ if (strcmp(var.value, "enabled") == 0)
+ rebootemu = 1;
+ }
+ }
+ }
}
-void retro_run(void)
+void retro_run(void)
{
- int i;
+ int i;
+ //SysReset must be run while core is running,Not in menu (Locks up Retroarch)
+ if(rebootemu != 0){
+ rebootemu = 0;
+ SysReset();
+ }
input_poll_cb();
if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE_UPDATE, &updated) && updated)
update_variables(true);
- in_keystate = 0;
- for (i = 0; i < RETRO_PSX_MAP_LEN; i++)
- if (input_state_cb(1, RETRO_DEVICE_JOYPAD, 0, i))
- in_keystate |= retro_psx_map[i];
- in_keystate <<= 16;
- for (i = 0; i < RETRO_PSX_MAP_LEN; i++)
- if (input_state_cb(0, RETRO_DEVICE_JOYPAD, 0, i))
- in_keystate |= retro_psx_map[i];
+ // reset all keystate, query libretro for keystate
+ int j;
+ for(i = 0; i < PORTS_NUMBER; i++) {
+ in_keystate[i] = 0;
- if (in_type1 == PSE_PAD_TYPE_ANALOGPAD)
- {
- in_a1[0] = (input_state_cb(0, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_LEFT, RETRO_DEVICE_ID_ANALOG_X) / 256) + 128;
- in_a1[1] = (input_state_cb(0, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_LEFT, RETRO_DEVICE_ID_ANALOG_Y) / 256) + 128;
- in_a2[0] = (input_state_cb(0, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_RIGHT, RETRO_DEVICE_ID_ANALOG_X) / 256) + 128;
- in_a2[1] = (input_state_cb(0, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_RIGHT, RETRO_DEVICE_ID_ANALOG_Y) / 256) + 128;
+ if (in_type[i] == PSE_PAD_TYPE_NONE)
+ continue;
+
+ // query libretro for keystate
+ for (j = 0; j < RETRO_PSX_MAP_LEN; j++)
+ if (input_state_cb(i, RETRO_DEVICE_JOYPAD, 0, j))
+ in_keystate[i] |= retro_psx_map[j];
+
+ if (in_type[i] == PSE_PAD_TYPE_ANALOGPAD)
+ {
+ in_analog_left[i][0] = MIN((input_state_cb(i, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_LEFT, RETRO_DEVICE_ID_ANALOG_X) / 255) + 128, 255);
+ in_analog_left[i][1] = MIN((input_state_cb(i, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_LEFT, RETRO_DEVICE_ID_ANALOG_Y) / 255) + 128, 255);
+ in_analog_right[i][0] = MIN((input_state_cb(i, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_RIGHT, RETRO_DEVICE_ID_ANALOG_X) / 255) + 128, 255);
+ in_analog_right[i][1] = MIN((input_state_cb(i, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_RIGHT, RETRO_DEVICE_ID_ANALOG_Y) / 255) + 128, 255);
+ }
}
stop = 0;
psxCpu->Execute();
- video_cb((vout_fb_dirty || !vout_can_dupe || !duping_enable) ? vout_buf : NULL,
+ video_cb((vout_fb_dirty || !vout_can_dupe || !duping_enable) ? vout_buf_ptr : NULL,
vout_width, vout_height, vout_width * 2);
vout_fb_dirty = 0;
}
return true;
}
-#if 1
+#ifndef VITA
#include <sys/types.h>
#include <dirent.h>
void retro_init(void)
{
- const char *bios[] = { "scph1001", "scph5501", "scph7001" };
+ const char *bios[] = { "SCPH101", "SCPH7001", "SCPH5501", "SCPH1001" };
const char *dir;
char path[256];
int i, ret;
- bool found_bios = false;
+
+ found_bios = false;
#ifdef __MACH__
// magic sauce to make the dynarec work on iOS
syscall(SYS_ptrace, 0 /*PTRACE_TRACEME*/, 0, 0, 0);
#endif
+#ifdef _3DS
+ psxMapHook = pl_3ds_mmap;
+ psxUnmapHook = pl_3ds_munmap;
+#endif
+#ifdef VITA
+ if(init_vita_mmap()<0)
+ abort();
+ psxMapHook = pl_vita_mmap;
+ psxUnmapHook = pl_vita_munmap;
+#endif
ret = emu_core_preinit();
+#ifdef _3DS
+ /* emu_core_preinit sets the cpu to dynarec */
+ if(!__ctr_svchax)
+ Config.Cpu = CPU_INTERPRETER;
+#endif
+
ret |= emu_core_init();
if (ret != 0) {
SysPrintf("PCSX init failed.\n");
exit(1);
}
-#if defined(_POSIX_C_SOURCE) && (_POSIX_C_SOURCE >= 200112L)
+#ifdef _3DS
+ vout_buf = linearMemAlign(VOUT_MAX_WIDTH * VOUT_MAX_HEIGHT * 2, 0x80);
+#elif defined(_POSIX_C_SOURCE) && (_POSIX_C_SOURCE >= 200112L) && !defined(VITA)
posix_memalign(&vout_buf, 16, VOUT_MAX_WIDTH * VOUT_MAX_HEIGHT * 2);
#else
vout_buf = malloc(VOUT_MAX_WIDTH * VOUT_MAX_HEIGHT * 2);
#endif
-
+
+ vout_buf_ptr = vout_buf;
+
if (environ_cb(RETRO_ENVIRONMENT_GET_SYSTEM_DIRECTORY, &dir) && dir)
{
- snprintf(Config.BiosDir, sizeof(Config.BiosDir), "%s/", dir);
+ snprintf(Config.BiosDir, sizeof(Config.BiosDir), "%s", dir);
for (i = 0; i < sizeof(bios) / sizeof(bios[0]); i++) {
snprintf(path, sizeof(path), "%s/%s.bin", dir, bios[i]);
else
{
SysPrintf("no BIOS files found.\n");
- struct retro_message msg =
+ struct retro_message msg =
{
- "no BIOS found, expect bugs!",
+ "No BIOS file found - add for better compatibility",
180
};
environ_cb(RETRO_ENVIRONMENT_SET_MESSAGE, (void*)&msg);
McdDisable[0] = 0;
McdDisable[1] = 1;
init_memcard(Mcd1Data);
+ init_memcard(Mcd2Data);
SaveFuncs.open = save_open;
SaveFuncs.read = save_read;
void retro_deinit(void)
{
SysClose();
+#ifdef _3DS
+ linearFree(vout_buf);
+#else
free(vout_buf);
+#endif
vout_buf = NULL;
+
+#ifdef VITA
+ deinit_vita_mmap();
+#endif
+}
+
+#ifdef VITA
+#include <psp2/kernel/threadmgr.h>
+int usleep (unsigned long us)
+{
+ sceKernelDelayThread(us);
}
+#endif
-/* Copyright (C) 2010-2014 The RetroArch team
+/* Copyright (C) 2010-2016 The RetroArch team
*
* ---------------------------------------------------------------------------------------
* The following license statement only applies to this libretro API header (libretro.h).
#endif
#endif
+#ifndef RETRO_CALLCONV
+# if defined(__GNUC__) && defined(__i386__) && !defined(__x86_64__)
+# define RETRO_CALLCONV __attribute__((cdecl))
+# elif defined(_MSC_VER) && defined(_M_X86) && !defined(_M_X64)
+# define RETRO_CALLCONV __cdecl
+# else
+# define RETRO_CALLCONV /* all other platforms only have one calling convention each */
+# endif
+#endif
+
+#ifndef RETRO_API
+# if defined(_WIN32) || defined(__CYGWIN__) || defined(__MINGW32__)
+# ifdef RETRO_IMPORT_SYMBOLS
+# ifdef __GNUC__
+# define RETRO_API RETRO_CALLCONV __attribute__((__dllimport__))
+# else
+# define RETRO_API RETRO_CALLCONV __declspec(dllimport)
+# endif
+# else
+# ifdef __GNUC__
+# define RETRO_API RETRO_CALLCONV __attribute__((__dllexport__))
+# else
+# define RETRO_API RETRO_CALLCONV __declspec(dllexport)
+# endif
+# endif
+# else
+# if defined(__GNUC__) && __GNUC__ >= 4 && !defined(__CELLOS_LV2__)
+# define RETRO_API RETRO_CALLCONV __attribute__((__visibility__("default")))
+# else
+# define RETRO_API RETRO_CALLCONV
+# endif
+# endif
+#endif
+
/* Used for checking API/ABI mismatches that can break libretro
* implementations.
* It is not incremented for compatible changes to the API.
#define RETRO_DEVICE_ID_ANALOG_Y 1
/* Id values for MOUSE. */
-#define RETRO_DEVICE_ID_MOUSE_X 0
-#define RETRO_DEVICE_ID_MOUSE_Y 1
-#define RETRO_DEVICE_ID_MOUSE_LEFT 2
-#define RETRO_DEVICE_ID_MOUSE_RIGHT 3
-#define RETRO_DEVICE_ID_MOUSE_WHEELUP 4
-#define RETRO_DEVICE_ID_MOUSE_WHEELDOWN 5
-#define RETRO_DEVICE_ID_MOUSE_MIDDLE 6
+#define RETRO_DEVICE_ID_MOUSE_X 0
+#define RETRO_DEVICE_ID_MOUSE_Y 1
+#define RETRO_DEVICE_ID_MOUSE_LEFT 2
+#define RETRO_DEVICE_ID_MOUSE_RIGHT 3
+#define RETRO_DEVICE_ID_MOUSE_WHEELUP 4
+#define RETRO_DEVICE_ID_MOUSE_WHEELDOWN 5
+#define RETRO_DEVICE_ID_MOUSE_MIDDLE 6
+#define RETRO_DEVICE_ID_MOUSE_HORIZ_WHEELUP 7
+#define RETRO_DEVICE_ID_MOUSE_HORIZ_WHEELDOWN 8
/* Id values for LIGHTGUN types. */
#define RETRO_DEVICE_ID_LIGHTGUN_X 0
RETRO_LANGUAGE_KOREAN = 9,
RETRO_LANGUAGE_CHINESE_TRADITIONAL = 10,
RETRO_LANGUAGE_CHINESE_SIMPLIFIED = 11,
+ RETRO_LANGUAGE_ESPERANTO = 12,
+ RETRO_LANGUAGE_POLISH = 13,
RETRO_LANGUAGE_LAST,
/* Ensure sizeof(enum) == sizeof(int) */
* location-based information from the host device,
* such as current latitude / longitude.
*/
-#define RETRO_ENVIRONMENT_GET_CONTENT_DIRECTORY 30
+#define RETRO_ENVIRONMENT_GET_CONTENT_DIRECTORY 30 /* Old name, kept for compatibility. */
+#define RETRO_ENVIRONMENT_GET_CORE_ASSETS_DIRECTORY 30
/* const char ** --
- * Returns the "content" directory of the frontend.
+ * Returns the "core assets" directory of the frontend.
* This directory can be used to store specific assets that the
* core relies upon, such as art assets,
* input data, etc etc.
* Returns the specified language of the frontend, if specified by the user.
* It can be used by the core for localization purposes.
*/
+#define RETRO_ENVIRONMENT_GET_CURRENT_SOFTWARE_FRAMEBUFFER (40 | RETRO_ENVIRONMENT_EXPERIMENTAL)
+ /* struct retro_framebuffer * --
+ * Returns a preallocated framebuffer which the core can use for rendering
+ * the frame into when not using SET_HW_RENDER.
+ * The framebuffer returned from this call must not be used
+ * after the current call to retro_run() returns.
+ *
+ * The goal of this call is to allow zero-copy behavior where a core
+ * can render directly into video memory, avoiding extra bandwidth cost by copying
+ * memory from core to video memory.
+ *
+ * If this call succeeds and the core renders into it,
+ * the framebuffer pointer and pitch can be passed to retro_video_refresh_t.
+ * If the buffer from GET_CURRENT_SOFTWARE_FRAMEBUFFER is to be used,
+ * the core must pass the exact
+ * same pointer as returned by GET_CURRENT_SOFTWARE_FRAMEBUFFER;
+ * i.e. passing a pointer which is offset from the
+ * buffer is undefined. The width, height and pitch parameters
+ * must also match exactly to the values obtained from GET_CURRENT_SOFTWARE_FRAMEBUFFER.
+ *
+ * It is possible for a frontend to return a different pixel format
+ * than the one used in SET_PIXEL_FORMAT. This can happen if the frontend
+ * needs to perform conversion.
+ *
+ * It is still valid for a core to render to a different buffer
+ * even if GET_CURRENT_SOFTWARE_FRAMEBUFFER succeeds.
+ *
+ * A frontend must make sure that the pointer obtained from this function is
+ * writeable (and readable).
+ */
+
+enum retro_hw_render_interface_type
+{
+ RETRO_HW_RENDER_INTERFACE_VULKAN = 0,
+ RETRO_HW_RENDER_INTERFACE_DUMMY = INT_MAX
+};
+
+/* Base struct. All retro_hw_render_interface_* types
+ * contain at least these fields. */
+struct retro_hw_render_interface
+{
+ enum retro_hw_render_interface_type interface_type;
+ unsigned interface_version;
+};
+#define RETRO_ENVIRONMENT_GET_HW_RENDER_INTERFACE (41 | RETRO_ENVIRONMENT_EXPERIMENTAL)
+ /* const struct retro_hw_render_interface ** --
+ * Returns an API specific rendering interface for accessing API specific data.
+ * Not all HW rendering APIs support or need this.
+ * The contents of the returned pointer is specific to the rendering API
+ * being used. See the various headers like libretro_vulkan.h, etc.
+ *
+ * GET_HW_RENDER_INTERFACE cannot be called before context_reset has been called.
+ * Similarly, after context_destroyed callback returns,
+ * the contents of the HW_RENDER_INTERFACE are invalidated.
+ */
#define RETRO_MEMDESC_CONST (1 << 0) /* The frontend will never change this memory area once retro_load_game has returned. */
#define RETRO_MEMDESC_BIGENDIAN (1 << 1) /* The memory area contains big endian data. Default is little endian. */
#define RETRO_SIMD_VFPU (1 << 13)
#define RETRO_SIMD_PS (1 << 14)
#define RETRO_SIMD_AES (1 << 15)
+#define RETRO_SIMD_VFPV3 (1 << 16)
+#define RETRO_SIMD_VFPV4 (1 << 17)
+#define RETRO_SIMD_POPCNT (1 << 18)
+#define RETRO_SIMD_MOVBE (1 << 19)
typedef uint64_t retro_perf_tick_t;
typedef int64_t retro_time_t;
* use the corresponding enums directly. */
RETRO_HW_CONTEXT_OPENGLES_VERSION = 5,
+ /* Vulkan, see RETRO_ENVIRONMENT_GET_HW_RENDER_INTERFACE. */
+ RETRO_HW_CONTEXT_VULKAN = 6,
+
RETRO_HW_CONTEXT_DUMMY = INT_MAX
};
*/
retro_hw_context_reset_t context_reset;
- /* Set by frontend. */
+ /* Set by frontend.
+ * TODO: This is rather obsolete. The frontend should not
+ * be providing preallocated framebuffers. */
retro_hw_get_current_framebuffer_t get_current_framebuffer;
/* Set by frontend. */
retro_hw_get_proc_address_t get_proc_address;
- /* Set if render buffers should have depth component attached. */
+ /* Set if render buffers should have depth component attached.
+ * TODO: Obsolete. */
bool depth;
- /* Set if stencil buffers should be attached. */
+ /* Set if stencil buffers should be attached.
+ * TODO: Obsolete. */
bool stencil;
/* If depth and stencil are true, a packed 24/8 buffer will be added.
* Only attaching stencil is invalid and will be ignored. */
/* Use conventional bottom-left origin convention. If false,
- * standard libretro top-left origin semantics are used. */
+ * standard libretro top-left origin semantics are used.
+ * TODO: Move to GL specific interface. */
bool bottom_left_origin;
/* Major version number for core GL context or GLES 3.1+. */
/* If this is true, the frontend will go very far to avoid
* resetting context in scenarios like toggling fullscreen, etc.
+ * TODO: Obsolete? Maybe frontend should just always assume this ...
*/
bool cache_context;
const char *meta; /* String of implementation specific meta-data. */
};
+#define RETRO_MEMORY_ACCESS_WRITE (1 << 0)
+ /* The core will write to the buffer provided by retro_framebuffer::data. */
+#define RETRO_MEMORY_ACCESS_READ (1 << 1)
+ /* The core will read from retro_framebuffer::data. */
+#define RETRO_MEMORY_TYPE_CACHED (1 << 0)
+ /* The memory in data is cached.
+ * If not cached, random writes and/or reading from the buffer is expected to be very slow. */
+struct retro_framebuffer
+{
+ void *data; /* The framebuffer which the core can render into.
+ Set by frontend in GET_CURRENT_SOFTWARE_FRAMEBUFFER.
+ The initial contents of data are unspecified. */
+ unsigned width; /* The framebuffer width used by the core. Set by core. */
+ unsigned height; /* The framebuffer height used by the core. Set by core. */
+ size_t pitch; /* The number of bytes between the beginning of a scanline,
+ and beginning of the next scanline.
+ Set by frontend in GET_CURRENT_SOFTWARE_FRAMEBUFFER. */
+ enum retro_pixel_format format; /* The pixel format the core must use to render into data.
+ This format could differ from the format used in
+ SET_PIXEL_FORMAT.
+ Set by frontend in GET_CURRENT_SOFTWARE_FRAMEBUFFER. */
+
+ unsigned access_flags; /* How the core will access the memory in the framebuffer.
+ RETRO_MEMORY_ACCESS_* flags.
+ Set by core. */
+ unsigned memory_flags; /* Flags telling core how the memory has been mapped.
+ RETRO_MEMORY_TYPE_* flags.
+ Set by frontend in GET_CURRENT_SOFTWARE_FRAMEBUFFER. */
+};
+
/* Callbacks */
/* Environment callback. Gives implementations a way of performing
*
* The rest of the set_* functions are guaranteed to have been called
* before the first call to retro_run() is made. */
-void retro_set_environment(retro_environment_t);
-void retro_set_video_refresh(retro_video_refresh_t);
-void retro_set_audio_sample(retro_audio_sample_t);
-void retro_set_audio_sample_batch(retro_audio_sample_batch_t);
-void retro_set_input_poll(retro_input_poll_t);
-void retro_set_input_state(retro_input_state_t);
+RETRO_API void retro_set_environment(retro_environment_t);
+RETRO_API void retro_set_video_refresh(retro_video_refresh_t);
+RETRO_API void retro_set_audio_sample(retro_audio_sample_t);
+RETRO_API void retro_set_audio_sample_batch(retro_audio_sample_batch_t);
+RETRO_API void retro_set_input_poll(retro_input_poll_t);
+RETRO_API void retro_set_input_state(retro_input_state_t);
/* Library global initialization/deinitialization. */
-void retro_init(void);
-void retro_deinit(void);
+RETRO_API void retro_init(void);
+RETRO_API void retro_deinit(void);
/* Must return RETRO_API_VERSION. Used to validate ABI compatibility
* when the API is revised. */
-unsigned retro_api_version(void);
+RETRO_API unsigned retro_api_version(void);
/* Gets statically known system info. Pointers provided in *info
* must be statically allocated.
* Can be called at any time, even before retro_init(). */
-void retro_get_system_info(struct retro_system_info *info);
+RETRO_API void retro_get_system_info(struct retro_system_info *info);
/* Gets information about system audio/video timings and geometry.
* Can be called only after retro_load_game() has successfully completed.
* variable if needed.
* E.g. geom.aspect_ratio might not be initialized if core doesn't
* desire a particular aspect ratio. */
-void retro_get_system_av_info(struct retro_system_av_info *info);
+RETRO_API void retro_get_system_av_info(struct retro_system_av_info *info);
/* Sets device to be used for player 'port'.
* By default, RETRO_DEVICE_JOYPAD is assumed to be plugged into all
* hint to the libretro core when a core cannot automatically detect the
* appropriate input device type on its own. It is also relevant when a
* core can change its behavior depending on device type. */
-void retro_set_controller_port_device(unsigned port, unsigned device);
+RETRO_API void retro_set_controller_port_device(unsigned port, unsigned device);
/* Resets the current game. */
-void retro_reset(void);
+RETRO_API void retro_reset(void);
/* Runs the game for one video frame.
* During retro_run(), input_poll callback must be called at least once.
* a frame if GET_CAN_DUPE returns true.
* In this case, the video callback can take a NULL argument for data.
*/
-void retro_run(void);
+RETRO_API void retro_run(void);
/* Returns the amount of data the implementation requires to serialize
* internal state (save states).
* returned size is never allowed to be larger than a previous returned
* value, to ensure that the frontend can allocate a save state buffer once.
*/
-size_t retro_serialize_size(void);
+RETRO_API size_t retro_serialize_size(void);
/* Serializes internal state. If failed, or size is lower than
* retro_serialize_size(), it should return false, true otherwise. */
-bool retro_serialize(void *data, size_t size);
-bool retro_unserialize(const void *data, size_t size);
+RETRO_API bool retro_serialize(void *data, size_t size);
+RETRO_API bool retro_unserialize(const void *data, size_t size);
-void retro_cheat_reset(void);
-void retro_cheat_set(unsigned index, bool enabled, const char *code);
+RETRO_API void retro_cheat_reset(void);
+RETRO_API void retro_cheat_set(unsigned index, bool enabled, const char *code);
/* Loads a game. */
-bool retro_load_game(const struct retro_game_info *game);
+RETRO_API bool retro_load_game(const struct retro_game_info *game);
/* Loads a "special" kind of game. Should not be used,
* except in extreme cases. */
-bool retro_load_game_special(
+RETRO_API bool retro_load_game_special(
unsigned game_type,
const struct retro_game_info *info, size_t num_info
);
/* Unloads a currently loaded game. */
-void retro_unload_game(void);
+RETRO_API void retro_unload_game(void);
/* Gets region of game. */
-unsigned retro_get_region(void);
+RETRO_API unsigned retro_get_region(void);
/* Gets region of memory. */
-void *retro_get_memory_data(unsigned id);
-size_t retro_get_memory_size(unsigned id);
+RETRO_API void *retro_get_memory_data(unsigned id);
+RETRO_API size_t retro_get_memory_size(unsigned id);
#ifdef __cplusplus
}
#include <unistd.h>
#include <signal.h>
#include <time.h>
-#ifndef _WIN32
+#if !defined(_WIN32) && !defined(NO_DYLIB)
#include <dlfcn.h>
#endif
new_dynarec_hacks = 0;
cycle_multiplier = 200;
- in_type1 = PSE_PAD_TYPE_STANDARD;
- in_type2 = PSE_PAD_TYPE_STANDARD;
+ in_type[0] = PSE_PAD_TYPE_STANDARD;
+ in_type[1] = PSE_PAD_TYPE_STANDARD;
}
void do_emu_action(void)
// reset can run code, timing must be set
pl_timing_prepare(Config.PsxType);
- EmuReset();
-
- // hmh core forgets this
+ // hmh core forgets this
CDR_stop();
+
+ EmuReset();
GPU_updateLace = real_lace;
g_emu_resetting = 0;
return ret;
ret = SaveState(fname);
-#ifdef HAVE_PRE_ARMV7 /* XXX GPH hack */
+#if defined(HAVE_PRE_ARMV7) && !defined(_3DS) /* XXX GPH hack */
sync();
#endif
SysPrintf("* %s \"%s\" [%d]\n",
return (void *)(long)(PLUGIN_DL_BASE + builtin_plugin_ids[i]);
}
-#ifndef _WIN32
+#if !defined(_WIN32) && !defined(NO_DYLIB)
ret = dlopen(lib, RTLD_NOW);
if (ret == NULL)
SysMessage("dlopen: %s", dlerror());
if (PLUGIN_DL_BASE <= plugid && plugid < PLUGIN_DL_BASE + ARRAY_SIZE(builtin_plugins))
return plugin_link(plugid - PLUGIN_DL_BASE, sym);
-#ifndef _WIN32
+#if !defined(_WIN32) && !defined(NO_DYLIB)
return dlsym(lib, sym);
#else
return NULL;
}
const char *SysLibError() {
-#ifndef _WIN32
+#if defined(NO_DYLIB)
+ return NULL;
+#elif !defined(_WIN32)
return dlerror();
#else
return "not supported";
if (PLUGIN_DL_BASE <= plugid && plugid < PLUGIN_DL_BASE + ARRAY_SIZE(builtin_plugins))
return;
-#ifndef _WIN32
+#if !defined(_WIN32) && !defined(NO_DYLIB)
dlclose(lib);
#endif
}
-
switch (in_type_sel1) {
case 1: in_type1 = PSE_PAD_TYPE_ANALOGPAD; break;
- case 2: in_type1 = PSE_PAD_TYPE_GUNCON; break;
+ case 2: in_type1 = PSE_PAD_TYPE_NEGCON; break;
default: in_type1 = PSE_PAD_TYPE_STANDARD;
}
switch (in_type_sel2) {
case 1: in_type2 = PSE_PAD_TYPE_ANALOGPAD; break;
- case 2: in_type2 = PSE_PAD_TYPE_GUNCON; break;
+ case 2: in_type2 = PSE_PAD_TYPE_NEGCON; break;
default: in_type2 = PSE_PAD_TYPE_STANDARD;
}
if (in_evdev_allow_abs_only != allow_abs_only_old) {
+++ /dev/null
-<?xml version="1.0" encoding="UTF-8"?>
-<PXML xmlns="http://openpandora.org/namespaces/PXML" xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" xsi:noNamespaceSchemaLocation="PXML_schema.xsd">
-<package id="package.pcsx_rearmed.notaz">
- <titles>
- <title lang="en_US">PCSX ReARMed</title>
- </titles>
- <version major="1" minor="9" release="93" build="%PR%"/>
- <author name="PCSX team/notaz" website="http://notaz.gp2x.de/"/>
-</package>
-<application id="pcsx_rearmed.notaz.%PR%" appdata="pcsx_rearmed">
- <titles>
- <title lang="en_US">PCSX ReARMed %PR%</title>
- </titles>
- <title lang="en_US">PCSX ReARMed %PR%</title>
-
- <descriptions>
- <description lang="en_US">PCSX ReARMed is heavily optimized PlayStation Emulator. It's a PCSX fork based on the PCSX-Reloaded project, which itself contains code from PCSX, PCSX-df and PCSX-Revolution.
-
-The emulator features MIPS->ARM recompiler by Ari64 and ARM NEON GPU by Exophase, that in many cases produces pixel perfect graphics at very high performance. There is also NEON-optimized GTE code, optimized P.E.Op.S. (Pete's) SPU; PCSX4ALL and traditional P.E.Op.S. GPUs are also available.</description>
- </descriptions>
-
- <exec command="pcsx.sh"/>
-
- <icon src="pcsx.png"/>
-
- <author name="PCSX team/notaz" website="http://notaz.gp2x.de/"/>
-
- <version major="1" minor="9" release="93" build="%PR%"/>
-
- <licenses>
- <license name="GPLv2+" url="http://www.gnu.org/licenses/gpl-2.0.html" sourcecodeurl="http://notaz.gp2x.de/cgi-bin/gitweb.cgi?p=pcsx_rearmed.git"/>
- </licenses>
-
- <info name="PCSX ReARMed %PR% readme" type="text/plain" src="readme.txt"/>
-
- <categories>
- <category name="Game">
- <subcategory name="Emulator"/>
- </category>
- </categories>
-</application>
-</PXML>
+++ /dev/null
-#!/bin/sh
-
-# stupid nub mode thing
-nub0mode=`cat /proc/pandora/nub0/mode`
-nub1mode=`cat /proc/pandora/nub1/mode`
-/usr/pandora/scripts/op_nubchange.sh absolute absolute
-
-# 4MB for RAM (2+align) + 2MB for vram (1+overdraw)
-# + 10MB for gpu_neon (8+overdraw) + 8MB LUTs
-# no big deal if this fails, only performance loss
-sudo -n /usr/pandora/scripts/op_hugetlb.sh 24
-
-# C64x DSP for SPU
-sudo -n /usr/pandora/scripts/op_dsp_c64.sh
-
-./pcsx "$@"
-
-# restore stuff if pcsx crashes
-./picorestore
-sudo -n /usr/pandora/scripts/op_lcdrate.sh 60
-sudo -n /usr/pandora/scripts/op_gamma.sh 0
-sudo -n /usr/pandora/scripts/op_hugetlb.sh 0
-
-/usr/pandora/scripts/op_nubchange.sh $nub0mode $nub1mode
+++ /dev/null
-/*
- * picorestore - clean up after an omapfb program crash
- *
- * Copyright (c) Gražvydas "notaz" Ignotas, 2010
- *
- * Redistribution and use in source and binary forms, with or without
- * modification, are permitted provided that the following conditions are met:
- * * Redistributions of source code must retain the above copyright
- * notice, this list of conditions and the following disclaimer.
- * * Redistributions in binary form must reproduce the above copyright
- * notice, this list of conditions and the following disclaimer in the
- * documentation and/or other materials provided with the distribution.
- * * Neither the name of the organization nor the
- * names of its contributors may be used to endorse or promote products
- * derived from this software without specific prior written permission.
- *
- * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS"
- * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE
- * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE
- * ARE DISCLAIMED. IN NO EVENT SHALL COPYRIGHT HOLDER OR CONTRIBUTORS BE LIABLE
- * FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL
- * DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR
- * SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER
- * CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY,
- * OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE
- * OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
- */
-
-#include <stdio.h>
-#include <sys/types.h>
-#include <sys/stat.h>
-#include <fcntl.h>
-#include <unistd.h>
-#include <sys/ioctl.h>
-#include <linux/fb.h>
-#include <linux/omapfb.h>
-#include <linux/kd.h>
-
-int main()
-{
- struct fb_var_screeninfo fbvar;
- struct omapfb_plane_info pi;
- struct omapfb_mem_info mi;
- int ret, fbdev, kbdfd;
-
- fbdev = open("/dev/fb0", O_RDWR);
- if (fbdev == -1) {
- perror("open fb0");
- goto end_fb0;
- }
-
- ret = ioctl(fbdev, FBIOGET_VSCREENINFO, &fbvar);
- if (ret == -1) {
- perror("FBIOGET_VSCREENINFO ioctl");
- goto end_fb0;
- }
-
- if (fbvar.yoffset != 0) {
- printf("fixing yoffset.. ");
- fbvar.yoffset = 0;
- ret = ioctl(fbdev, FBIOPAN_DISPLAY, &fbvar);
- if (ret < 0)
- perror("ioctl FBIOPAN_DISPLAY");
- else
- printf("ok\n");
- }
-
-end_fb0:
- if (fbdev >= 0)
- close(fbdev);
-
- fbdev = open("/dev/fb1", O_RDWR);
- if (fbdev == -1) {
- perror("open fb1");
- goto end_fb1;
- }
-
- ret = ioctl(fbdev, OMAPFB_QUERY_PLANE, &pi);
- ret |= ioctl(fbdev, OMAPFB_QUERY_MEM, &mi);
- if (ret != 0)
- perror("QUERY_*");
-
- pi.enabled = 0;
- ret = ioctl(fbdev, OMAPFB_SETUP_PLANE, &pi);
- if (ret != 0)
- perror("SETUP_PLANE");
-
- mi.size = 0;
- ret = ioctl(fbdev, OMAPFB_SETUP_MEM, &mi);
- if (ret != 0)
- perror("SETUP_MEM");
-
-end_fb1:
- if (fbdev >= 0)
- close(fbdev);
-
- kbdfd = open("/dev/tty", O_RDWR);
- if (kbdfd == -1) {
- perror("open /dev/tty");
- return 1;
- }
-
- if (ioctl(kbdfd, KDSETMODE, KD_TEXT) == -1)
- perror("KDSETMODE KD_TEXT");
-
- close(kbdfd);
-
- return 0;
-}
+++ /dev/null
-The skin images can be customized, but there are several limitations:\r
-\r
-background.png - must be 320x240 image with 24bit RGB colors.\r
-font.png - must be 128x160 8bit grayscale image.\r
-selector.png - must be 8x10 8bit grayscale image.\r
-\r
-Font and selector colors can be changed by editing skin.txt.\r
-\r
+++ /dev/null
-// html-style hex color codes, ex. ff0000 is red, 0000ff is blue, etc.\r
-text_color=ffffc0\r
-selection_color=808010\r
-\r
+++ /dev/null
-#ifndef UI_FEATURES_H
-#define UI_FEATURES_H
-
-#define MENU_BIOS_PATH "<SD card>/pandora/appdata/pcsx_rearmed/bios/"
-#define BOOT_MSG "Booting up... (press SPACE for menu)"
-#define MENU_SHOW_VARSCALER 1
-#define MENU_SHOW_VOUTMODE 0
-#define MENU_SHOW_SCALER2 0
-#define MENU_SHOW_NUBS_BTNS 1
-#define MENU_SHOW_VIBRATION 0
-#define MENU_SHOW_DEADZONE 0
-#define MENU_SHOW_MINIMIZE 1
-#define MENU_SHOW_FULLSCREEN 0
-#define MENU_SHOW_VOLUME 0
-
-#endif // UI_FEATURES_H
extern int CALLBACK SPUplayCDDAchannel(short *, int);
/* PAD */
-static long PADreadPort1(PadDataS *pad)
-{
- pad->controllerType = in_type1;
- pad->buttonStatus = ~in_keystate;
- if (in_type1 == PSE_PAD_TYPE_ANALOGPAD) {
- pad->leftJoyX = in_a1[0];
- pad->leftJoyY = in_a1[1];
- pad->rightJoyX = in_a2[0];
- pad->rightJoyY = in_a2[1];
- }
- return 0;
+static long PADreadPort1(PadDataS *pad) {
+ int pad_index = pad->requestPadIndex;
+ pad->controllerType = in_type[pad_index];
+ pad->buttonStatus = ~in_keystate[pad_index];
+ if (multitap1 == 1)
+ pad->portMultitap = 1;
+ else
+ pad->portMultitap = 0;
+
+ if (in_type[pad_index] == PSE_PAD_TYPE_ANALOGPAD || in_type[pad_index] == PSE_PAD_TYPE_NEGCON)
+ {
+ pad->leftJoyX = in_analog_left[pad_index][0];
+ pad->leftJoyY = in_analog_left[pad_index][1];
+ pad->rightJoyX = in_analog_right[pad_index][0];
+ pad->rightJoyY = in_analog_right[pad_index][1];
+ }
+ return 0;
}
-static long PADreadPort2(PadDataS *pad)
-{
- pad->controllerType = in_type2;
- pad->buttonStatus = ~in_keystate >> 16;
- return 0;
+static long PADreadPort2(PadDataS *pad) {
+ int pad_index = pad->requestPadIndex;
+
+ pad->controllerType = in_type[pad_index];
+ pad->buttonStatus = ~in_keystate[pad_index];
+ if (multitap2 == 1)
+ pad->portMultitap = 2;
+ else
+ pad->portMultitap = 0;
+
+ if (in_type[pad_index] == PSE_PAD_TYPE_ANALOGPAD || in_type[pad_index] == PSE_PAD_TYPE_NEGCON)
+ {
+ pad->leftJoyX = in_analog_left[pad_index][0];
+ pad->leftJoyY = in_analog_left[pad_index][1];
+ pad->rightJoyX = in_analog_right[pad_index][0];
+ pad->rightJoyY = in_analog_right[pad_index][1];
+ }
+ return 0;
}
/* GPU */
#define HUD_HEIGHT 10
-int in_type1, in_type2;
-int in_a1[2] = { 127, 127 }, in_a2[2] = { 127, 127 };
+int in_type[8];
+int multitap1;
+int multitap2;
+int in_analog_left[8][2] = {{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 }};
+int in_analog_right[8][2] = {{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 }};
int in_adev[2] = { -1, -1 }, in_adev_axis[2][2] = {{ 0, 1 }, { 0, 1 }};
int in_adev_is_nublike[2];
-int in_keystate, in_state_gun;
+unsigned short in_keystate[8];
+int in_state_gun;
int in_enable_vibration;
void *tsdev;
void *pl_vout_buf;
static void update_analogs(void)
{
- int *nubp[2] = { in_a1, in_a2 };
+ int *nubp[2] = { in_analog_left[0], in_analog_right[0] };
int vals[2];
int i, a, v, ret;
unsigned int emu_act;
in_update(actions);
- if (in_type1 == PSE_PAD_TYPE_ANALOGPAD)
+ if (in_type[0] == PSE_PAD_TYPE_ANALOGPAD)
update_analogs();
emu_act = actions[IN_BINDTYPE_EMU];
in_state_gun = (emu_act & SACTION_GUN_MASK) >> SACTION_GUN_TRIGGER;
}
emu_set_action(emu_act);
- in_keystate = actions[IN_BINDTYPE_PLAYER12];
+ in_keystate[0] = actions[IN_BINDTYPE_PLAYER12];
}
#else /* MAEMO */
extern void update_input(void);
DKEY_CROSS,
DKEY_SQUARE,
};
-extern int in_type1, in_type2;
-extern int in_keystate, in_state_gun, in_a1[2], in_a2[2];
+extern int in_state_gun;
+extern int in_type[8];
+extern int multitap1;
+extern int multitap2;
+extern int in_analog_left[8][2];
+extern int in_analog_right[8][2];
+extern unsigned short in_keystate[8];
+
extern int in_adev[2], in_adev_axis[2][2];
extern int in_adev_is_nublike[2];
extern int in_enable_vibration;
--- /dev/null
+/* Copyright (C) 2010-2015 The RetroArch team
+ *
+ * ---------------------------------------------------------------------------------------
+ * The following license statement only applies to this file (retro_inline.h).
+ * ---------------------------------------------------------------------------------------
+ *
+ * Permission is hereby granted, free of charge,
+ * to any person obtaining a copy of this software and associated documentation files (the "Software"),
+ * to deal in the Software without restriction, including without limitation the rights to
+ * use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software,
+ * and to permit persons to whom the Software is furnished to do so, subject to the following conditions:
+ *
+ * The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED,
+ * INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+ * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+ * IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY,
+ * WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+ * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+ */
+
+#ifndef __LIBRETRO_SDK_INLINE_H
+#define __LIBRETRO_SDK_INLINE_H
+
+#ifndef INLINE
+
+#if !defined(__cplusplus) && defined(_WIN32)
+#define INLINE _inline
+#elif defined(__STDC_VERSION__) && __STDC_VERSION__>=199901L
+#define INLINE inline
+#elif defined(__GNUC__)
+#define INLINE __inline__
+#else
+#define INLINE
+#endif
+
+#endif
+#endif
--- /dev/null
+#ifndef MMAN_H
+#define MMAN_H
+
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+#include "stdlib.h"
+#include "stdio.h"
+
+#define PROT_READ 0b001
+#define PROT_WRITE 0b010
+#define PROT_EXEC 0b100
+#define MAP_PRIVATE 2
+#define MAP_ANONYMOUS 0x20
+
+#define MAP_FAILED ((void *)-1)
+
+static inline void* mmap(void *addr, size_t len, int prot, int flags, int fd, off_t offset)
+{
+ (void)prot;
+ (void)flags;
+ (void)fd;
+ (void)offset;
+
+ int block, ret;
+
+ block = sceKernelAllocMemBlockForVM("code", len);
+ if(block<=0){
+ sceClibPrintf("could not alloc mem block @0x%08X 0x%08X \n", block, len);
+ exit(1);
+ }
+
+ // get base address
+ ret = sceKernelGetMemBlockBase(block, &addr);
+ if (ret < 0)
+ {
+ sceClibPrintf("could get address @0x%08X 0x%08X \n", block, addr);
+ exit(1);
+ }
+
+
+ if(!addr)
+ return MAP_FAILED;
+
+ return addr;
+}
+
+static inline int mprotect(void *addr, size_t len, int prot)
+{
+ (void)addr;
+ (void)len;
+ (void)prot;
+ return 0;
+}
+
+static inline int munmap(void *addr, size_t len)
+{
+ int uid = sceKernelFindMemBlockByAddr(addr, len);
+
+ return sceKernelFreeMemBlock(uid);
+
+}
+
+#ifdef __cplusplus
+};
+#endif
+
+#endif // MMAN_H
+++ /dev/null
-Subproject commit a6f015da3b10b82a476250793645c071340decbc
+// No controller
+#define PSE_PAD_TYPE_NONE 0
// MOUSE SCPH-1030
#define PSE_PAD_TYPE_MOUSE 1
// NEGCON - 16 button analog controller SLPH-00001
typedef struct
{
- // controler type - fill it withe predefined values above
+ // controller type - fill it withe predefined values above
unsigned char controllerType;
+ //0 : no multitap between psx and pad
+ //1 : multitap between psx and pad on port 1
+ //2 : multitap between psx and pad on port 2
+ int portMultitap;
+ int requestPadIndex;
+
// status of buttons - every controller fills this field
unsigned short buttonStatus;
unsigned char Vib[2];
unsigned char VibF[2];
-
+
+ //configuration mode Request 0x43
+ int configMode;
unsigned char reserved[87];
} PadDataS;
include $(CLEAR_VARS)
+GIT_VERSION := " $(shell git rev-parse --short HEAD || echo unknown)"
+ifneq ($(GIT_VERSION)," unknown")
+ LOCAL_CFLAGS += -DGIT_VERSION=\"$(GIT_VERSION)\"
+endif
+
APP_DIR := ../../src
+#fix stupid change in ndk r11 that breaks compiling even when the exe would run fine
+LOCAL_DISABLE_FATAL_LINKER_WARNINGS := true
+
ifneq ($(TARGET_ARCH_ABI),armeabi-v7a)
NO_NEON_BUILD := 1
else
LOCAL_SRC_FILES += ../libpcsxcore/gte_arm.S
# dynarec
- LOCAL_SRC_FILES += ../libpcsxcore/new_dynarec/new_dynarec.c ../libpcsxcore/new_dynarec/linkage_arm.S ../libpcsxcore/new_dynarec/emu_if.c ../libpcsxcore/new_dynarec/pcsxmem.c
+ LOCAL_SRC_FILES += ../libpcsxcore/new_dynarec/new_dynarec.c ../libpcsxcore/new_dynarec/arm/linkage_arm.S ../libpcsxcore/new_dynarec/backends/psx/emu_if.c ../libpcsxcore/new_dynarec/backends/psx/pcsxmem.c
# spu
LOCAL_SRC_FILES += ../plugins/dfsound/arm_utils.S
# libretro
LOCAL_SRC_FILES += ../frontend/libretro.c
-LOCAL_CFLAGS += -O3 -ffast-math -funroll-loops -DNDEBUG -D_FILE_OFFSET_BITS=64 -DHAVE_LIBRETRO -DNO_FRONTEND -DFRONTEND_SUPPORTS_RGB565
+LOCAL_CFLAGS += -O3 -ffast-math -funroll-loops -DNDEBUG -D_FILE_OFFSET_BITS=64 -DHAVE_LIBRETRO -DNO_FRONTEND -DFRONTEND_SUPPORTS_RGB565 -DANDROID
LOCAL_C_INCLUDES += $(LOCAL_PATH)/../include
LOCAL_LDLIBS := -lz -llog
APP_ABI := armeabi armeabi-v7a
+APP_PLATFORM := android-9
#include "cdriso.h"
#include "ppf.h"
+#include <errno.h>
+#include <zlib.h>
+
#ifdef _WIN32
#define WIN32_LEAN_AND_MEAN
#include <process.h>
#include <windows.h>
#define strcasecmp _stricmp
-#define usleep(x) Sleep((x) / 1000)
+#define usleep(x) (Sleep((x) / 1000))
#else
#include <pthread.h>
#include <sys/time.h>
#include <unistd.h>
#endif
-#include <errno.h>
-#include <zlib.h>
#define OFF_T_MSB ((off_t)1 << (sizeof(off_t) * 8 - 1))
do {
ret = SPU_playCDDAchannel((short *)sndbuffer, s);
if (ret == 0x7761)
+ {
usleep(6 * 1000);
+ }
} while (ret == 0x7761 && playing); // rearmed_wait
}
// HACK: stop feeding data while emu is paused
extern int stop;
while (stop && playing)
+ {
usleep(10000);
+ }
now = GetTickCount();
osleep = t - now;
return ret;
}
-static int uncompress2(void *out, unsigned long *out_size, void *in, unsigned long in_size)
+static int uncomp2(void *out, unsigned long *out_size, void *in, unsigned long in_size)
{
static z_stream z;
int ret = 0;
if (is_compressed) {
cdbuffer_size_expect = sizeof(compr_img->buff_raw[0]) << compr_img->block_shift;
cdbuffer_size = cdbuffer_size_expect;
- ret = uncompress2(compr_img->buff_raw[0], &cdbuffer_size, compr_img->buff_compressed, size);
+ ret = uncomp2(compr_img->buff_raw[0], &cdbuffer_size, compr_img->buff_compressed, size);
if (ret != 0) {
SysPrintf("uncompress failed with %d for block %d, sector %d\n",
ret, block, sector);
*/
#include "arm_features.h"
-#include "new_dynarec/linkage_offsets.h"
+#include "new_dynarec/arm/linkage_offsets.h"
.syntax unified
.text
* 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. *
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * */
-#include "../gte.h"
+#include "../../gte.h"
#define FLAGLESS
-#include "../gte.h"
+#include "../../gte.h"
#undef FLAGLESS
-#include "../gte_arm.h"
-#include "../gte_neon.h"
+#include "../../gte_arm.h"
+#include "../../gte_neon.h"
#include "pcnt.h"
#include "arm_features.h"
}
}
-#include "pcsxmem.h"
-#include "pcsxmem_inline.c"
+#include "../backends/psx/pcsxmem.h"
+#include "../backends/psx/pcsxmem_inline.c"
static void do_readstub(int n)
{
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * */
#include "arm_features.h"
-#include "new_dynarec_config.h"
+#include "../new_dynarec_config.h"
#include "linkage_offsets.h"
#include "emu_if.h"
#include "pcsxmem.h"
-#include "../psxhle.h"
-#include "../r3000a.h"
-#include "../cdrom.h"
-#include "../psxdma.h"
-#include "../mdec.h"
-#include "../gte_arm.h"
-#include "../gte_neon.h"
+#include "../../../psxhle.h"
+#include "../../../r3000a.h"
+#include "../../../cdrom.h"
+#include "../../../psxdma.h"
+#include "../../../mdec.h"
+#include "../../../gte_arm.h"
+#include "../../../gte_neon.h"
#define FLAGLESS
-#include "../gte.h"
+#include "../../../gte.h"
#define ARRAY_SIZE(x) (sizeof(x) / sizeof(x[0]))
#ifdef DRC_DISABLE
unsigned int address;
int pending_exception, stop;
-unsigned int next_interupt;
+u32 next_interupt;
int new_dynarec_did_compile;
int cycle_multiplier;
int new_dynarec_hacks;
-#include "new_dynarec.h"
-#include "../r3000a.h"
+#include "../../new_dynarec.h"
+#include "../../../r3000a.h"
extern char invalid_code[0x100000];
extern u32 inv_code_start, inv_code_end;
/* cycles/irqs */
-extern unsigned int next_interupt;
+extern u32 next_interupt;
extern int pending_exception;
/* called by drc */
*/
#include <stdio.h>
-#include "../psxhw.h"
-#include "../cdrom.h"
-#include "../mdec.h"
-#include "../gpu.h"
-#include "../psxmem_map.h"
+#include "../../../psxhw.h"
+#include "../../../cdrom.h"
+#include "../../../mdec.h"
+#include "../../../gpu.h"
+#include "../../../psxmem_map.h"
#include "emu_if.h"
#include "pcsxmem.h"
#ifdef VITA
#include <psp2/kernel/sysmem.h>
static int sceBlock;
+int getVMBlock();
#endif
#include "new_dynarec_config.h"
-#include "emu_if.h" //emulator interface
+#include "backends/psx/emu_if.h" //emulator interface
//#define DISASM
//#define assem_debug printf
#define inv_debug(...)
#ifdef __i386__
-#include "assem_x86.h"
+#include "x86/assem_x86.h"
#endif
#ifdef __x86_64__
-#include "assem_x64.h"
+#include "x64/assem_x64.h"
#endif
#ifdef __arm__
-#include "assem_arm.h"
+#include "arm/assem_arm.h"
+#endif
+
+#ifdef VITA
+int _newlib_vm_size_user = 1 << TARGET_SIZE_2;
#endif
#define MAXBLOCK 4096
// This is called from the recompiled JR/JALR instructions
void *get_addr(u_int vaddr)
{
- u_int page=get_page(vaddr);
- u_int vpage=get_vpage(vaddr);
- struct ll_entry *head;
+ struct ll_entry *head = NULL;
+ u_int page = get_page(vaddr);
+ u_int vpage = get_vpage(vaddr);
//printf("TRACE: count=%d next=%d (get_addr %x,page %d)\n",Count,next_interupt,vaddr,page);
head=jump_in[page];
- while(head!=NULL) {
- if(head->vaddr==vaddr) {
- //printf("TRACE: count=%d next=%d (get_addr match %x: %x)\n",Count,next_interupt,vaddr,(int)head->addr);
+ while(head!=NULL)
+ {
+ if(head->vaddr==vaddr)
+ {
+ //printf("TRACE: count=%d next=%d (get_addr match %x: %x)\n",Count,next_interupt,vaddr,(int)head->addr);
u_int *ht_bin=hash_table[((vaddr>>16)^vaddr)&0xFFFF];
ht_bin[3]=ht_bin[1];
ht_bin[2]=ht_bin[0];
head=head->next;
}
head=jump_dirty[vpage];
- while(head!=NULL) {
- if(head->vaddr==vaddr) {
+ while(head!=NULL)
+ {
+ if(head->vaddr==vaddr)
+ {
//printf("TRACE: count=%d next=%d (get_addr match dirty %x: %x)\n",Count,next_interupt,vaddr,(int)head->addr);
// Don't restore blocks which are about to expire from the cache
if((((u_int)head->addr-(u_int)out)<<(32-TARGET_SIZE_2))>0x60000000+(MAX_OUTPUT_BLOCK_SIZE<<(32-TARGET_SIZE_2)))
- if(verify_dirty(head->addr)) {
- //printf("restore candidate: %x (%d) d=%d\n",vaddr,page,invalid_code[vaddr>>12]);
- invalid_code[vaddr>>12]=0;
- inv_code_start=inv_code_end=~0;
- if(vpage<2048) {
- restore_candidate[vpage>>3]|=1<<(vpage&7);
- }
- else restore_candidate[page>>3]|=1<<(page&7);
- u_int *ht_bin=hash_table[((vaddr>>16)^vaddr)&0xFFFF];
- if(ht_bin[0]==vaddr) {
- ht_bin[1]=(u_int)head->addr; // Replace existing entry
- }
- else
+ if(verify_dirty(head->addr))
{
- ht_bin[3]=ht_bin[1];
- ht_bin[2]=ht_bin[0];
- ht_bin[1]=(int)head->addr;
- ht_bin[0]=vaddr;
+ //printf("restore candidate: %x (%d) d=%d\n",vaddr,page,invalid_code[vaddr>>12]);
+ invalid_code[vaddr>>12]=0;
+ inv_code_start=inv_code_end=~0;
+ if(vpage<2048)
+ {
+ restore_candidate[vpage>>3]|=1<<(vpage&7);
+ }
+ else
+ {
+ restore_candidate[page>>3]|=1<<(page&7);
+ }
+ u_int *ht_bin=hash_table[((vaddr>>16)^vaddr)&0xFFFF];
+
+ if(ht_bin[0]==vaddr)
+ ht_bin[1]=(u_int)head->addr; // Replace existing entry
+ else
+ {
+ ht_bin[3]=ht_bin[1];
+ ht_bin[2]=ht_bin[0];
+ ht_bin[1]=(int)head->addr;
+ ht_bin[0]=vaddr;
+ }
+ return head->addr;
}
- return head->addr;
- }
}
head=head->next;
}
//printf("TRACE: count=%d next=%d (get_addr no-match %x)\n",Count,next_interupt,vaddr);
int r=new_recompile_block(vaddr);
- if(r==0) return get_addr(vaddr);
- // Execute in unmapped page, generate pagefault execption
+ if(r==0)
+ return get_addr(vaddr);
+ // Execute in unmapped page, generate pagefault exception
Status|=2;
Cause=(vaddr<<31)|0x8;
EPC=(vaddr&1)?vaddr-5:vaddr;
EntryHi=BadVAddr&0xFFFFE000;
return get_addr_ht(0x80000000);
}
+
// Look up address in hash table first
void *get_addr_ht(u_int vaddr)
{
}
#ifdef __i386__
-#include "assem_x86.c"
+#include "x86/assem_x86.c"
#endif
#ifdef __x86_64__
-#include "assem_x64.c"
+#include "x64/assem_x64.c"
#endif
#ifdef __arm__
-#include "assem_arm.c"
+#include "arm/assem_arm.c"
#endif
// Add virtual address mapping to linked list
assert(first+5>page); // NB: this assumes MAXBLOCK<=4096 (4 pages)
assert(last<page+5);
// Invalidate the adjacent pages if a block crosses a 4K boundary
- while(first<page) {
+ while(first<page)
+ {
invalidate_page(first);
first++;
}
- for(first=page+1;first<last;first++) {
+ for(first=page+1;first<last;first++)
+ {
invalidate_page(first);
}
- #ifdef __arm__
- do_clear_cache();
- #endif
+
+#ifdef __arm__
+ do_clear_cache();
+#endif
// Don't trap writes
invalid_code[block]=1;
- #ifdef USE_MINI_HT
+#ifdef USE_MINI_HT
memset(mini_ht,-1,sizeof(mini_ht));
- #endif
+#endif
}
void invalidate_block(u_int block)
u_int page=get_page(block<<12);
u_int vpage=get_vpage(block<<12);
inv_debug("INVALIDATE: %x (%d)\n",block<<12,page);
- //inv_debug("invalid_code[block]=%d\n",invalid_code[block]);
u_int first,last;
first=last=page;
struct ll_entry *head;
head=jump_dirty[vpage];
//printf("page=%d vpage=%d\n",page,vpage);
- while(head!=NULL) {
+ while(head!=NULL)
+ {
u_int start,end;
- if(vpage>2047||(head->vaddr>>12)==block) { // Ignore vaddr hash collision
+ if(vpage>2047||(head->vaddr>>12)==block)
+ { // Ignore vaddr hash collision
get_bounds((int)head->addr,&start,&end);
//printf("start: %x end: %x\n",start,end);
- if(page<2048&&start>=(u_int)rdram&&end<(u_int)rdram+RAM_SIZE) {
- if(((start-(u_int)rdram)>>12)<=page&&((end-1-(u_int)rdram)>>12)>=page) {
+ if(page<2048&&start>=(u_int)rdram&&end<(u_int)rdram+RAM_SIZE)
+ {
+ if(((start-(u_int)rdram)>>12)<=page&&((end-1-(u_int)rdram)>>12)>=page)
+ {
if((((start-(u_int)rdram)>>12)&2047)<first) first=((start-(u_int)rdram)>>12)&2047;
if((((end-1-(u_int)rdram)>>12)&2047)>last) last=((end-1-(u_int)rdram)>>12)&2047;
}
// This is called when loading a save state.
// Anything could have changed, so invalidate everything.
-void invalidate_all_pages()
+void invalidate_all_pages(void)
{
u_int page;
for(page=0;page<4096;page++)
invalidate_page(page);
for(page=0;page<1048576;page++)
- if(!invalid_code[page]) {
+ {
+ if(!invalid_code[page])
+ {
restore_candidate[(page&2047)>>3]|=1<<(page&7);
restore_candidate[((page&2047)>>3)+256]|=1<<(page&7);
}
- #ifdef USE_MINI_HT
+ }
+
+#ifdef USE_MINI_HT
memset(mini_ht,-1,sizeof(mini_ht));
- #endif
+#endif
}
// Add an entry to jump_out after making a link
struct ll_entry *head;
inv_debug("INV: clean_blocks page=%d\n",page);
head=jump_dirty[page];
- while(head!=NULL) {
- if(!invalid_code[head->vaddr>>12]) {
+ while(head!=NULL)
+ {
+ if(!invalid_code[head->vaddr>>12])
+ {
// Don't restore blocks which are about to expire from the cache
- if((((u_int)head->addr-(u_int)out)<<(32-TARGET_SIZE_2))>0x60000000+(MAX_OUTPUT_BLOCK_SIZE<<(32-TARGET_SIZE_2))) {
+ if((((u_int)head->addr-(u_int)out)<<(32-TARGET_SIZE_2))>0x60000000+(MAX_OUTPUT_BLOCK_SIZE<<(32-TARGET_SIZE_2)))
+ {
u_int start,end;
- if(verify_dirty(head->addr)) {
+ if(verify_dirty(head->addr))
+ {
//printf("Possibly Restore %x (%x)\n",head->vaddr, (int)head->addr);
u_int i;
u_int inv=0;
get_bounds((int)head->addr,&start,&end);
- if(start-(u_int)rdram<RAM_SIZE) {
- for(i=(start-(u_int)rdram+0x80000000)>>12;i<=(end-1-(u_int)rdram+0x80000000)>>12;i++) {
+ if(start-(u_int)rdram<RAM_SIZE)
+ {
+ for(i=(start-(u_int)rdram+0x80000000)>>12;i<=(end-1-(u_int)rdram+0x80000000)>>12;i++)
+ {
inv|=invalid_code[i];
}
}
- else if((signed int)head->vaddr>=(signed int)0x80000000+RAM_SIZE) {
+ else if((signed int)head->vaddr>=(signed int)0x80000000+RAM_SIZE)
+ {
inv=1;
}
- if(!inv) {
+ if(!inv)
+ {
void * clean_addr=(void *)get_clean_addr((int)head->addr);
- if((((u_int)clean_addr-(u_int)out)<<(32-TARGET_SIZE_2))>0x60000000+(MAX_OUTPUT_BLOCK_SIZE<<(32-TARGET_SIZE_2))) {
+ if((((u_int)clean_addr-(u_int)out)<<(32-TARGET_SIZE_2))>0x60000000+(MAX_OUTPUT_BLOCK_SIZE<<(32-TARGET_SIZE_2)))
+ {
u_int ppage=page;
inv_debug("INV: Restored %x (%x/%x)\n",head->vaddr, (int)head->addr, (int)clean_addr);
//printf("page=%x, addr=%x\n",page,head->vaddr);
//assert(head->vaddr>>12==(page|0x80000));
ll_add_flags(jump_in+ppage,head->vaddr,head->reg_sv_flags,clean_addr);
u_int *ht_bin=hash_table[((head->vaddr>>16)^head->vaddr)&0xFFFF];
- if(ht_bin[0]==head->vaddr) {
+ if(ht_bin[0]==head->vaddr)
+ {
ht_bin[1]=(u_int)clean_addr; // Replace existing entry
}
- if(ht_bin[2]==head->vaddr) {
+ if(ht_bin[2]==head->vaddr)
+ {
ht_bin[3]=(u_int)clean_addr; // Replace existing entry
}
}
}
}
-
-void mov_alloc(struct regstat *current,int i)
+static void mov_alloc(struct regstat *current,int i)
{
// Note: Don't need to actually alloc the source registers
- if((~current->is32>>rs1[i])&1) {
+ if((~current->is32>>rs1[i])&1)
+ {
//alloc_reg64(current,i,rs1[i]);
alloc_reg64(current,i,rt1[i]);
current->is32&=~(1LL<<rt1[i]);
- } else {
+ }
+ else
+ {
//alloc_reg(current,i,rs1[i]);
alloc_reg(current,i,rt1[i]);
current->is32|=(1LL<<rt1[i]);
void delayslot_alloc(struct regstat *current,int i)
{
- switch(itype[i]) {
+ switch(itype[i])
+ {
case UJUMP:
case CJUMP:
case SJUMP:
}
}
-int mchecksum()
+#if 0
+static int mchecksum(void)
{
//if(!tracedebug) return 0;
int i;
}
return sum;
}
-int rchecksum()
+
+static int rchecksum(void)
{
int i;
int sum=0;
sum^=((u_int *)reg)[i];
return sum;
}
-void rlist()
+
+static void rlist(void)
{
int i;
printf("TRACE: ");
printf("\n");
}
-void enabletrace()
+static void enabletrace(void)
{
tracedebug=1;
}
-void memdebug(int i)
+static void memdebug(int i)
{
//printf("TRACE: count=%d next=%d (checksum %x) lo=%8x%8x\n",Count,next_interupt,mchecksum(),(int)(reg[LOREG]>>32),(int)reg[LOREG]);
//printf("TRACE: count=%d next=%d (rchecksum %x)\n",Count,next_interupt,rchecksum());
}
//printf("TRACE: %x\n",(&i)[-1]);
}
+#endif
void alu_assemble(int i,struct regstat *i_regs)
{
// clear the state completely, instead of just marking
// things invalid like invalidate_all_pages() does
-void new_dynarec_clear_full()
+void new_dynarec_clear_full(void)
{
int n;
out=(u_char *)BASE_ADDR;
for(n=0;n<4096;n++) ll_clear(jump_dirty+n);
}
-void new_dynarec_init()
+void new_dynarec_init(void)
{
SysPrintf("Init new dynarec\n");
// see assem_arm.h for some explanation
#if defined(BASE_ADDR_FIXED)
if (mmap (translation_cache, 1 << TARGET_SIZE_2,
- PROT_READ | PROT_WRITE | PROT_EXEC,
- MAP_PRIVATE | MAP_ANONYMOUS,
- -1, 0) != translation_cache) {
+ PROT_READ | PROT_WRITE | PROT_EXEC,
+ MAP_PRIVATE | MAP_ANONYMOUS,
+ -1, 0) != translation_cache)
+ {
SysPrintf("mmap() failed: %s\n", strerror(errno));
SysPrintf("disable BASE_ADDR_FIXED and recompile\n");
abort();
}
#elif defined(BASE_ADDR_DYNAMIC)
- #ifdef VITA
- sceBlock = sceKernelAllocMemBlockForVM("code", 1 << TARGET_SIZE_2);
+#ifdef VITA
+ sceBlock = getVMBlock();//sceKernelAllocMemBlockForVM("code", 1 << TARGET_SIZE_2);
if (sceBlock < 0)
SysPrintf("sceKernelAllocMemBlockForVM failed\n");
int ret = sceKernelGetMemBlockBase(sceBlock, (void **)&translation_cache);
if (ret < 0)
SysPrintf("sceKernelGetMemBlockBase failed\n");
- #else
+
+ sceKernelOpenVMDomain();
+ sceClibPrintf("translation_cache = 0x%08X \n ", translation_cache);
+#elif defined(_MSC_VER)
+ base_addr = VirtualAlloc(NULL, 1<<TARGET_SIZE_2, MEM_COMMIT | MEM_RESERVE,
+ PAGE_EXECUTE_READWRITE);
+#else
translation_cache = mmap (NULL, 1 << TARGET_SIZE_2,
- PROT_READ | PROT_WRITE | PROT_EXEC,
- MAP_PRIVATE | MAP_ANONYMOUS, -1, 0);
+ PROT_READ | PROT_WRITE | PROT_EXEC,
+ MAP_PRIVATE | MAP_ANONYMOUS, -1, 0);
if (translation_cache == MAP_FAILED) {
SysPrintf("mmap() failed: %s\n", strerror(errno));
abort();
}
- #endif
+#endif
#else
- #ifndef NO_WRITE_EXEC
+#ifndef NO_WRITE_EXEC
// not all systems allow execute in data segment by default
if (mprotect((void *)BASE_ADDR, 1<<TARGET_SIZE_2, PROT_READ | PROT_WRITE | PROT_EXEC) != 0)
SysPrintf("mprotect() failed: %s\n", strerror(errno));
- #endif
#endif
+#endif
+
out=(u_char *)BASE_ADDR;
cycle_multiplier=200;
new_dynarec_clear_full();
SysPrintf("warning: RAM is not directly mapped, performance will suffer\n");
}
-void new_dynarec_cleanup()
+void new_dynarec_cleanup(void)
{
int n;
#if defined(BASE_ADDR_FIXED) || defined(BASE_ADDR_DYNAMIC)
- #ifdef VITA
- sceKernelFreeMemBlock(sceBlock);
- sceBlock = -1;
- #else
+#ifndef VITA
+#if defined(_MSC_VER)
+ VirtualFree(base_addr, 0, MEM_RELEASE);
+#else
if (munmap ((void *)BASE_ADDR, 1<<TARGET_SIZE_2) < 0)
SysPrintf("munmap() failed\n");
- #endif
#endif
- for(n=0;n<4096;n++) ll_clear(jump_in+n);
- for(n=0;n<4096;n++) ll_clear(jump_out+n);
- for(n=0;n<4096;n++) ll_clear(jump_dirty+n);
- #ifdef ROM_COPY
+#endif
+#endif
+ for(n=0;n<4096;n++)
+ ll_clear(jump_in+n);
+ for(n=0;n<4096;n++)
+ ll_clear(jump_out+n);
+ for(n=0;n<4096;n++)
+ ll_clear(jump_dirty+n);
+#ifdef ROM_COPY
if (munmap (ROM_COPY, 67108864) < 0) {SysPrintf("munmap() failed\n");}
- #endif
+#endif
}
static u_int *get_source_start(u_int addr, u_int *limit)
#define NDHACK_GTE_NO_FLAGS (1<<2)
extern int new_dynarec_hacks;
-void new_dynarec_init();
-void new_dynarec_cleanup();
-void new_dynarec_clear_full();
-void new_dyna_start();
+void new_dynarec_init(void);
+void new_dynarec_cleanup(void);
+void new_dynarec_clear_full(void);
+void new_dyna_start(void);
int new_dynarec_save_blocks(void *save, int size);
void new_dynarec_load_blocks(const void *save, int size);
-void invalidate_all_pages();
+void invalidate_all_pages(void);
void invalidate_block(unsigned int block);
#define USE_MINI_HT 1
//#define REG_PREFETCH 1
-#if defined(__MACH__) || defined(VITA)
+#if defined(__MACH__)
#define NO_WRITE_EXEC 1
#endif
#ifdef VITA
-/***************************************************************************\r
- * Copyright (C) 2007 Ryan Schultz, PCSX-df Team, PCSX team *\r
- * *\r
- * This program is free software; you can redistribute it and/or modify *\r
- * it under the terms of the GNU General Public License as published by *\r
- * the Free Software Foundation; either version 2 of the License, or *\r
- * (at your option) any later version. *\r
- * *\r
- * This program is distributed in the hope that it will be useful, *\r
- * but WITHOUT ANY WARRANTY; without even the implied warranty of *\r
- * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the *\r
- * GNU General Public License for more details. *\r
- * *\r
- * You should have received a copy of the GNU General Public License *\r
- * along with this program; if not, write to the *\r
- * Free Software Foundation, Inc., *\r
- * 51 Franklin Street, Fifth Floor, Boston, MA 02111-1307 USA. *\r
- ***************************************************************************/\r
-\r
-/*\r
-* Plugin library callback/access functions.\r
-*/\r
-\r
-#include "plugins.h"\r
-#include "cdriso.h"\r
-\r
-static char IsoFile[MAXPATHLEN] = "";\r
-static s64 cdOpenCaseTime = 0;\r
-\r
-GPUupdateLace GPU_updateLace;\r
-GPUinit GPU_init;\r
-GPUshutdown GPU_shutdown; \r
-GPUconfigure GPU_configure;\r
-GPUtest GPU_test;\r
-GPUabout GPU_about;\r
-GPUopen GPU_open;\r
-GPUclose GPU_close;\r
-GPUreadStatus GPU_readStatus;\r
-GPUreadData GPU_readData;\r
-GPUreadDataMem GPU_readDataMem;\r
-GPUwriteStatus GPU_writeStatus; \r
-GPUwriteData GPU_writeData;\r
-GPUwriteDataMem GPU_writeDataMem;\r
-GPUdmaChain GPU_dmaChain;\r
-GPUkeypressed GPU_keypressed;\r
-GPUdisplayText GPU_displayText;\r
-GPUmakeSnapshot GPU_makeSnapshot;\r
-GPUfreeze GPU_freeze;\r
-GPUgetScreenPic GPU_getScreenPic;\r
-GPUshowScreenPic GPU_showScreenPic;\r
-GPUclearDynarec GPU_clearDynarec;\r
-GPUvBlank GPU_vBlank;\r
-\r
-CDRinit CDR_init;\r
-CDRshutdown CDR_shutdown;\r
-CDRopen CDR_open;\r
-CDRclose CDR_close; \r
-CDRtest CDR_test;\r
-CDRgetTN CDR_getTN;\r
-CDRgetTD CDR_getTD;\r
-CDRreadTrack CDR_readTrack;\r
-CDRgetBuffer CDR_getBuffer;\r
-CDRplay CDR_play;\r
-CDRstop CDR_stop;\r
-CDRgetStatus CDR_getStatus;\r
-CDRgetDriveLetter CDR_getDriveLetter;\r
-CDRgetBufferSub CDR_getBufferSub;\r
-CDRconfigure CDR_configure;\r
-CDRabout CDR_about;\r
-CDRsetfilename CDR_setfilename;\r
-CDRreadCDDA CDR_readCDDA;\r
-CDRgetTE CDR_getTE;\r
-\r
-SPUconfigure SPU_configure;\r
-SPUabout SPU_about;\r
-SPUinit SPU_init;\r
-SPUshutdown SPU_shutdown;\r
-SPUtest SPU_test;\r
-SPUopen SPU_open;\r
-SPUclose SPU_close;\r
-SPUplaySample SPU_playSample;\r
-SPUwriteRegister SPU_writeRegister;\r
-SPUreadRegister SPU_readRegister;\r
-SPUwriteDMA SPU_writeDMA;\r
-SPUreadDMA SPU_readDMA;\r
-SPUwriteDMAMem SPU_writeDMAMem;\r
-SPUreadDMAMem SPU_readDMAMem;\r
-SPUplayADPCMchannel SPU_playADPCMchannel;\r
-SPUfreeze SPU_freeze;\r
-SPUregisterCallback SPU_registerCallback;\r
-SPUregisterScheduleCb SPU_registerScheduleCb;\r
-SPUasync SPU_async;\r
-SPUplayCDDAchannel SPU_playCDDAchannel;\r
-\r
-PADconfigure PAD1_configure;\r
-PADabout PAD1_about;\r
-PADinit PAD1_init;\r
-PADshutdown PAD1_shutdown;\r
-PADtest PAD1_test;\r
-PADopen PAD1_open;\r
-PADclose PAD1_close;\r
-PADquery PAD1_query;\r
-PADreadPort1 PAD1_readPort1;\r
-PADkeypressed PAD1_keypressed;\r
-PADstartPoll PAD1_startPoll;\r
-PADpoll PAD1_poll;\r
-PADsetSensitive PAD1_setSensitive;\r
-\r
-PADconfigure PAD2_configure;\r
-PADabout PAD2_about;\r
-PADinit PAD2_init;\r
-PADshutdown PAD2_shutdown;\r
-PADtest PAD2_test;\r
-PADopen PAD2_open;\r
-PADclose PAD2_close;\r
-PADquery PAD2_query;\r
-PADreadPort2 PAD2_readPort2;\r
-PADkeypressed PAD2_keypressed;\r
-PADstartPoll PAD2_startPoll;\r
-PADpoll PAD2_poll;\r
-PADsetSensitive PAD2_setSensitive;\r
-\r
-NETinit NET_init;\r
-NETshutdown NET_shutdown;\r
-NETopen NET_open;\r
-NETclose NET_close; \r
-NETtest NET_test;\r
-NETconfigure NET_configure;\r
-NETabout NET_about;\r
-NETpause NET_pause;\r
-NETresume NET_resume;\r
-NETqueryPlayer NET_queryPlayer;\r
-NETsendData NET_sendData;\r
-NETrecvData NET_recvData;\r
-NETsendPadData NET_sendPadData;\r
-NETrecvPadData NET_recvPadData;\r
-NETsetInfo NET_setInfo;\r
-NETkeypressed NET_keypressed;\r
-\r
-#ifdef ENABLE_SIO1API\r
-\r
-SIO1init SIO1_init;\r
-SIO1shutdown SIO1_shutdown;\r
-SIO1open SIO1_open;\r
-SIO1close SIO1_close; \r
-SIO1test SIO1_test;\r
-SIO1configure SIO1_configure;\r
-SIO1about SIO1_about;\r
-SIO1pause SIO1_pause;\r
-SIO1resume SIO1_resume;\r
-SIO1keypressed SIO1_keypressed;\r
-SIO1writeData8 SIO1_writeData8;\r
-SIO1writeData16 SIO1_writeData16;\r
-SIO1writeData32 SIO1_writeData32;\r
-SIO1writeStat16 SIO1_writeStat16;\r
-SIO1writeStat32 SIO1_writeStat32;\r
-SIO1writeMode16 SIO1_writeMode16;\r
-SIO1writeMode32 SIO1_writeMode32;\r
-SIO1writeCtrl16 SIO1_writeCtrl16;\r
-SIO1writeCtrl32 SIO1_writeCtrl32;\r
-SIO1writeBaud16 SIO1_writeBaud16;\r
-SIO1writeBaud32 SIO1_writeBaud32;\r
-SIO1readData8 SIO1_readData8;\r
-SIO1readData16 SIO1_readData16;\r
-SIO1readData32 SIO1_readData32;\r
-SIO1readStat16 SIO1_readStat16;\r
-SIO1readStat32 SIO1_readStat32;\r
-SIO1readMode16 SIO1_readMode16;\r
-SIO1readMode32 SIO1_readMode32;\r
-SIO1readCtrl16 SIO1_readCtrl16;\r
-SIO1readCtrl32 SIO1_readCtrl32;\r
-SIO1readBaud16 SIO1_readBaud16;\r
-SIO1readBaud32 SIO1_readBaud32;\r
-SIO1registerCallback SIO1_registerCallback;\r
-\r
-#endif\r
-\r
-static const char *err;\r
-\r
-#define CheckErr(func) { \\r
- err = SysLibError(); \\r
- if (err != NULL) { SysMessage(_("Error loading %s: %s"), func, err); return -1; } \\r
-}\r
-\r
-#define LoadSym(dest, src, name, checkerr) { \\r
- dest = (src)SysLoadSym(drv, name); \\r
- if (checkerr) { CheckErr(name); } else SysLibError(); \\r
-}\r
-\r
-void *hGPUDriver = NULL;\r
-\r
-void CALLBACK GPU__displayText(char *pText) {\r
- SysPrintf("%s\n", pText);\r
-}\r
-\r
-long CALLBACK GPU__configure(void) { return 0; }\r
-long CALLBACK GPU__test(void) { return 0; }\r
-void CALLBACK GPU__about(void) {}\r
-void CALLBACK GPU__makeSnapshot(void) {}\r
-void CALLBACK GPU__keypressed(int key) {}\r
-long CALLBACK GPU__getScreenPic(unsigned char *pMem) { return -1; }\r
-long CALLBACK GPU__showScreenPic(unsigned char *pMem) { return -1; }\r
-void CALLBACK GPU__clearDynarec(void (CALLBACK *callback)(void)) {}\r
-void CALLBACK GPU__vBlank(int val) {}\r
-\r
-#define LoadGpuSym1(dest, name) \\r
- LoadSym(GPU_##dest, GPU##dest, name, TRUE);\r
-\r
-#define LoadGpuSym0(dest, name) \\r
- LoadSym(GPU_##dest, GPU##dest, name, FALSE); \\r
- if (GPU_##dest == NULL) GPU_##dest = (GPU##dest) GPU__##dest;\r
-\r
-#define LoadGpuSymN(dest, name) \\r
- LoadSym(GPU_##dest, GPU##dest, name, FALSE);\r
-\r
-static int LoadGPUplugin(const char *GPUdll) {\r
- void *drv;\r
-\r
- hGPUDriver = SysLoadLibrary(GPUdll);\r
- if (hGPUDriver == NULL) { \r
- GPU_configure = NULL;\r
- SysMessage (_("Could not load GPU plugin %s!"), GPUdll); return -1; \r
- }\r
- drv = hGPUDriver;\r
- LoadGpuSym1(init, "GPUinit");\r
- LoadGpuSym1(shutdown, "GPUshutdown");\r
- LoadGpuSym1(open, "GPUopen");\r
- LoadGpuSym1(close, "GPUclose");\r
- LoadGpuSym1(readData, "GPUreadData");\r
- LoadGpuSym1(readDataMem, "GPUreadDataMem");\r
- LoadGpuSym1(readStatus, "GPUreadStatus");\r
- LoadGpuSym1(writeData, "GPUwriteData");\r
- LoadGpuSym1(writeDataMem, "GPUwriteDataMem");\r
- LoadGpuSym1(writeStatus, "GPUwriteStatus");\r
- LoadGpuSym1(dmaChain, "GPUdmaChain");\r
- LoadGpuSym1(updateLace, "GPUupdateLace");\r
- LoadGpuSym0(keypressed, "GPUkeypressed");\r
- LoadGpuSym0(displayText, "GPUdisplayText");\r
- LoadGpuSym0(makeSnapshot, "GPUmakeSnapshot");\r
- LoadGpuSym1(freeze, "GPUfreeze");\r
- LoadGpuSym0(getScreenPic, "GPUgetScreenPic");\r
- LoadGpuSym0(showScreenPic, "GPUshowScreenPic");\r
- LoadGpuSym0(clearDynarec, "GPUclearDynarec");\r
- LoadGpuSym0(vBlank, "GPUvBlank");\r
- LoadGpuSym0(configure, "GPUconfigure");\r
- LoadGpuSym0(test, "GPUtest");\r
- LoadGpuSym0(about, "GPUabout");\r
-\r
- return 0;\r
-}\r
-\r
-void *hCDRDriver = NULL;\r
-\r
-long CALLBACK CDR__play(unsigned char *sector) { return 0; }\r
-long CALLBACK CDR__stop(void) { return 0; }\r
-\r
-long CALLBACK CDR__getStatus(struct CdrStat *stat) {\r
- if (cdOpenCaseTime < 0 || cdOpenCaseTime > (s64)time(NULL))\r
- stat->Status = 0x10;\r
- else\r
- stat->Status = 0;\r
-\r
- return 0;\r
-}\r
-\r
-char* CALLBACK CDR__getDriveLetter(void) { return NULL; }\r
-long CALLBACK CDR__configure(void) { return 0; }\r
-long CALLBACK CDR__test(void) { return 0; }\r
-void CALLBACK CDR__about(void) {}\r
-long CALLBACK CDR__setfilename(char*filename) { return 0; }\r
-\r
-#define LoadCdrSym1(dest, name) \\r
- LoadSym(CDR_##dest, CDR##dest, name, TRUE);\r
-\r
-#define LoadCdrSym0(dest, name) \\r
- LoadSym(CDR_##dest, CDR##dest, name, FALSE); \\r
- if (CDR_##dest == NULL) CDR_##dest = (CDR##dest) CDR__##dest;\r
-\r
-#define LoadCdrSymN(dest, name) \\r
- LoadSym(CDR_##dest, CDR##dest, name, FALSE);\r
-\r
-static int LoadCDRplugin(const char *CDRdll) {\r
- void *drv;\r
-\r
- if (CDRdll == NULL) {\r
- cdrIsoInit();\r
- return 0;\r
- }\r
-\r
- hCDRDriver = SysLoadLibrary(CDRdll);\r
- if (hCDRDriver == NULL) {\r
- CDR_configure = NULL;\r
- SysMessage (_("Could not load CD-ROM plugin %s!"), CDRdll); return -1;\r
- }\r
- drv = hCDRDriver;\r
- LoadCdrSym1(init, "CDRinit");\r
- LoadCdrSym1(shutdown, "CDRshutdown");\r
- LoadCdrSym1(open, "CDRopen");\r
- LoadCdrSym1(close, "CDRclose");\r
- LoadCdrSym1(getTN, "CDRgetTN");\r
- LoadCdrSym1(getTD, "CDRgetTD");\r
- LoadCdrSym1(readTrack, "CDRreadTrack");\r
- LoadCdrSym1(getBuffer, "CDRgetBuffer");\r
- LoadCdrSym1(getBufferSub, "CDRgetBufferSub");\r
- LoadCdrSym0(play, "CDRplay");\r
- LoadCdrSym0(stop, "CDRstop");\r
- LoadCdrSym0(getStatus, "CDRgetStatus");\r
- LoadCdrSym0(getDriveLetter, "CDRgetDriveLetter");\r
- LoadCdrSym0(configure, "CDRconfigure");\r
- LoadCdrSym0(test, "CDRtest");\r
- LoadCdrSym0(about, "CDRabout");\r
- LoadCdrSym0(setfilename, "CDRsetfilename");\r
- LoadCdrSymN(readCDDA, "CDRreadCDDA");\r
- LoadCdrSymN(getTE, "CDRgetTE");\r
-\r
- return 0;\r
-}\r
-\r
-void *hSPUDriver = NULL;\r
-\r
-long CALLBACK SPU__configure(void) { return 0; }\r
-void CALLBACK SPU__about(void) {}\r
-long CALLBACK SPU__test(void) { return 0; }\r
-void CALLBACK SPU__registerScheduleCb(void (CALLBACK *cb)(unsigned int)) {}\r
-\r
-#define LoadSpuSym1(dest, name) \\r
- LoadSym(SPU_##dest, SPU##dest, name, TRUE);\r
-\r
-#define LoadSpuSym0(dest, name) \\r
- LoadSym(SPU_##dest, SPU##dest, name, FALSE); \\r
- if (SPU_##dest == NULL) SPU_##dest = (SPU##dest) SPU__##dest;\r
-\r
-#define LoadSpuSymN(dest, name) \\r
- LoadSym(SPU_##dest, SPU##dest, name, FALSE);\r
-\r
-static int LoadSPUplugin(const char *SPUdll) {\r
- void *drv;\r
-\r
- hSPUDriver = SysLoadLibrary(SPUdll);\r
- if (hSPUDriver == NULL) {\r
- SPU_configure = NULL;\r
- SysMessage (_("Could not load SPU plugin %s!"), SPUdll); return -1;\r
- }\r
- drv = hSPUDriver;\r
- LoadSpuSym1(init, "SPUinit");\r
- LoadSpuSym1(shutdown, "SPUshutdown");\r
- LoadSpuSym1(open, "SPUopen");\r
- LoadSpuSym1(close, "SPUclose");\r
- LoadSpuSym0(configure, "SPUconfigure");\r
- LoadSpuSym0(about, "SPUabout");\r
- LoadSpuSym0(test, "SPUtest");\r
- LoadSpuSym1(writeRegister, "SPUwriteRegister");\r
- LoadSpuSym1(readRegister, "SPUreadRegister"); \r
- LoadSpuSym1(writeDMA, "SPUwriteDMA");\r
- LoadSpuSym1(readDMA, "SPUreadDMA");\r
- LoadSpuSym1(writeDMAMem, "SPUwriteDMAMem");\r
- LoadSpuSym1(readDMAMem, "SPUreadDMAMem");\r
- LoadSpuSym1(playADPCMchannel, "SPUplayADPCMchannel");\r
- LoadSpuSym1(freeze, "SPUfreeze");\r
- LoadSpuSym1(registerCallback, "SPUregisterCallback");\r
- LoadSpuSym0(registerScheduleCb, "SPUregisterScheduleCb");\r
- LoadSpuSymN(async, "SPUasync");\r
- LoadSpuSymN(playCDDAchannel, "SPUplayCDDAchannel");\r
-\r
- return 0;\r
-}\r
-\r
-void *hPAD1Driver = NULL;\r
-void *hPAD2Driver = NULL;\r
-\r
-static unsigned char buf[256];\r
-unsigned char stdpar[10] = { 0x00, 0x41, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff };\r
-unsigned char mousepar[8] = { 0x00, 0x12, 0x5a, 0xff, 0xff, 0xff, 0xff };\r
-unsigned char analogpar[9] = { 0x00, 0xff, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff };\r
-\r
-static int bufcount, bufc;\r
-\r
-PadDataS padd1, padd2;\r
-\r
-unsigned char _PADstartPoll(PadDataS *pad) {\r
- bufc = 0;\r
-\r
- switch (pad->controllerType) {\r
- case PSE_PAD_TYPE_MOUSE:\r
- mousepar[3] = pad->buttonStatus & 0xff;\r
- mousepar[4] = pad->buttonStatus >> 8;\r
- mousepar[5] = pad->moveX;\r
- mousepar[6] = pad->moveY;\r
-\r
- memcpy(buf, mousepar, 7);\r
- bufcount = 6;\r
- break;\r
- case PSE_PAD_TYPE_NEGCON: // npc101/npc104(slph00001/slph00069)\r
- analogpar[1] = 0x23;\r
- analogpar[3] = pad->buttonStatus & 0xff;\r
- analogpar[4] = pad->buttonStatus >> 8;\r
- analogpar[5] = pad->rightJoyX;\r
- analogpar[6] = pad->rightJoyY;\r
- analogpar[7] = pad->leftJoyX;\r
- analogpar[8] = pad->leftJoyY;\r
-\r
- memcpy(buf, analogpar, 9);\r
- bufcount = 8;\r
- break;\r
- case PSE_PAD_TYPE_ANALOGPAD: // scph1150\r
- analogpar[1] = 0x73;\r
- analogpar[3] = pad->buttonStatus & 0xff;\r
- analogpar[4] = pad->buttonStatus >> 8;\r
- analogpar[5] = pad->rightJoyX;\r
- analogpar[6] = pad->rightJoyY;\r
- analogpar[7] = pad->leftJoyX;\r
- analogpar[8] = pad->leftJoyY;\r
-\r
- memcpy(buf, analogpar, 9);\r
- bufcount = 8;\r
- break;\r
- case PSE_PAD_TYPE_ANALOGJOY: // scph1110\r
- analogpar[1] = 0x53;\r
- analogpar[3] = pad->buttonStatus & 0xff;\r
- analogpar[4] = pad->buttonStatus >> 8;\r
- analogpar[5] = pad->rightJoyX;\r
- analogpar[6] = pad->rightJoyY;\r
- analogpar[7] = pad->leftJoyX;\r
- analogpar[8] = pad->leftJoyY;\r
-\r
- memcpy(buf, analogpar, 9);\r
- bufcount = 8;\r
- break;\r
- case PSE_PAD_TYPE_STANDARD:\r
- default:\r
- stdpar[3] = pad->buttonStatus & 0xff;\r
- stdpar[4] = pad->buttonStatus >> 8;\r
-\r
- memcpy(buf, stdpar, 5);\r
- bufcount = 4;\r
- }\r
-\r
- return buf[bufc++];\r
-}\r
-\r
-unsigned char _PADpoll(unsigned char value) {\r
- if (bufc > bufcount) return 0;\r
- return buf[bufc++];\r
-}\r
-\r
-unsigned char CALLBACK PAD1__startPoll(int pad) {\r
- PadDataS padd;\r
-\r
- PAD1_readPort1(&padd);\r
-\r
- return _PADstartPoll(&padd);\r
-}\r
-\r
-unsigned char CALLBACK PAD1__poll(unsigned char value) {\r
- return _PADpoll(value);\r
-}\r
-\r
-long CALLBACK PAD1__configure(void) { return 0; }\r
-void CALLBACK PAD1__about(void) {}\r
-long CALLBACK PAD1__test(void) { return 0; }\r
-long CALLBACK PAD1__query(void) { return 3; }\r
-long CALLBACK PAD1__keypressed() { return 0; }\r
-\r
-#define LoadPad1Sym1(dest, name) \\r
- LoadSym(PAD1_##dest, PAD##dest, name, TRUE);\r
-\r
-#define LoadPad1SymN(dest, name) \\r
- LoadSym(PAD1_##dest, PAD##dest, name, FALSE);\r
-\r
-#define LoadPad1Sym0(dest, name) \\r
- LoadSym(PAD1_##dest, PAD##dest, name, FALSE); \\r
- if (PAD1_##dest == NULL) PAD1_##dest = (PAD##dest) PAD1__##dest;\r
-\r
-static int LoadPAD1plugin(const char *PAD1dll) {\r
- void *drv;\r
-\r
- hPAD1Driver = SysLoadLibrary(PAD1dll);\r
- if (hPAD1Driver == NULL) {\r
- PAD1_configure = NULL;\r
- SysMessage (_("Could not load Controller 1 plugin %s!"), PAD1dll); return -1;\r
- }\r
- drv = hPAD1Driver;\r
- LoadPad1Sym1(init, "PADinit");\r
- LoadPad1Sym1(shutdown, "PADshutdown");\r
- LoadPad1Sym1(open, "PADopen");\r
- LoadPad1Sym1(close, "PADclose");\r
- LoadPad1Sym0(query, "PADquery");\r
- LoadPad1Sym1(readPort1, "PADreadPort1");\r
- LoadPad1Sym0(configure, "PADconfigure");\r
- LoadPad1Sym0(test, "PADtest");\r
- LoadPad1Sym0(about, "PADabout");\r
- LoadPad1Sym0(keypressed, "PADkeypressed");\r
- LoadPad1Sym0(startPoll, "PADstartPoll");\r
- LoadPad1Sym0(poll, "PADpoll");\r
- LoadPad1SymN(setSensitive, "PADsetSensitive");\r
-\r
- return 0;\r
-}\r
-\r
-unsigned char CALLBACK PAD2__startPoll(int pad) {\r
- PadDataS padd;\r
-\r
- PAD2_readPort2(&padd);\r
- \r
- return _PADstartPoll(&padd);\r
-}\r
-\r
-unsigned char CALLBACK PAD2__poll(unsigned char value) {\r
- return _PADpoll(value);\r
-}\r
-\r
-long CALLBACK PAD2__configure(void) { return 0; }\r
-void CALLBACK PAD2__about(void) {}\r
-long CALLBACK PAD2__test(void) { return 0; }\r
-long CALLBACK PAD2__query(void) { return PSE_PAD_USE_PORT1 | PSE_PAD_USE_PORT2; }\r
-long CALLBACK PAD2__keypressed() { return 0; }\r
-\r
-#define LoadPad2Sym1(dest, name) \\r
- LoadSym(PAD2_##dest, PAD##dest, name, TRUE);\r
-\r
-#define LoadPad2Sym0(dest, name) \\r
- LoadSym(PAD2_##dest, PAD##dest, name, FALSE); \\r
- if (PAD2_##dest == NULL) PAD2_##dest = (PAD##dest) PAD2__##dest;\r
-\r
-#define LoadPad2SymN(dest, name) \\r
- LoadSym(PAD2_##dest, PAD##dest, name, FALSE);\r
-\r
-static int LoadPAD2plugin(const char *PAD2dll) {\r
- void *drv;\r
-\r
- hPAD2Driver = SysLoadLibrary(PAD2dll);\r
- if (hPAD2Driver == NULL) {\r
- PAD2_configure = NULL;\r
- SysMessage (_("Could not load Controller 2 plugin %s!"), PAD2dll); return -1;\r
- }\r
- drv = hPAD2Driver;\r
- LoadPad2Sym1(init, "PADinit");\r
- LoadPad2Sym1(shutdown, "PADshutdown");\r
- LoadPad2Sym1(open, "PADopen");\r
- LoadPad2Sym1(close, "PADclose");\r
- LoadPad2Sym0(query, "PADquery");\r
- LoadPad2Sym1(readPort2, "PADreadPort2");\r
- LoadPad2Sym0(configure, "PADconfigure");\r
- LoadPad2Sym0(test, "PADtest");\r
- LoadPad2Sym0(about, "PADabout");\r
- LoadPad2Sym0(keypressed, "PADkeypressed");\r
- LoadPad2Sym0(startPoll, "PADstartPoll");\r
- LoadPad2Sym0(poll, "PADpoll");\r
- LoadPad2SymN(setSensitive, "PADsetSensitive");\r
-\r
- return 0;\r
-}\r
-\r
-void *hNETDriver = NULL;\r
-\r
-void CALLBACK NET__setInfo(netInfo *info) {}\r
-void CALLBACK NET__keypressed(int key) {}\r
-long CALLBACK NET__configure(void) { return 0; }\r
-long CALLBACK NET__test(void) { return 0; }\r
-void CALLBACK NET__about(void) {}\r
-\r
-#define LoadNetSym1(dest, name) \\r
- LoadSym(NET_##dest, NET##dest, name, TRUE);\r
-\r
-#define LoadNetSymN(dest, name) \\r
- LoadSym(NET_##dest, NET##dest, name, FALSE);\r
-\r
-#define LoadNetSym0(dest, name) \\r
- LoadSym(NET_##dest, NET##dest, name, FALSE); \\r
- if (NET_##dest == NULL) NET_##dest = (NET##dest) NET__##dest;\r
-\r
-static int LoadNETplugin(const char *NETdll) {\r
- void *drv;\r
-\r
- hNETDriver = SysLoadLibrary(NETdll);\r
- if (hNETDriver == NULL) {\r
- SysMessage (_("Could not load NetPlay plugin %s!"), NETdll); return -1;\r
- }\r
- drv = hNETDriver;\r
- LoadNetSym1(init, "NETinit");\r
- LoadNetSym1(shutdown, "NETshutdown");\r
- LoadNetSym1(open, "NETopen");\r
- LoadNetSym1(close, "NETclose");\r
- LoadNetSymN(sendData, "NETsendData");\r
- LoadNetSymN(recvData, "NETrecvData");\r
- LoadNetSym1(sendPadData, "NETsendPadData");\r
- LoadNetSym1(recvPadData, "NETrecvPadData");\r
- LoadNetSym1(queryPlayer, "NETqueryPlayer");\r
- LoadNetSym1(pause, "NETpause");\r
- LoadNetSym1(resume, "NETresume");\r
- LoadNetSym0(setInfo, "NETsetInfo");\r
- LoadNetSym0(keypressed, "NETkeypressed");\r
- LoadNetSym0(configure, "NETconfigure");\r
- LoadNetSym0(test, "NETtest");\r
- LoadNetSym0(about, "NETabout");\r
-\r
- return 0;\r
-}\r
-\r
-#ifdef ENABLE_SIO1API\r
-\r
-void *hSIO1Driver = NULL;\r
-\r
-long CALLBACK SIO1__init(void) { return 0; }\r
-long CALLBACK SIO1__shutdown(void) { return 0; }\r
-long CALLBACK SIO1__open(void) { return 0; }\r
-long CALLBACK SIO1__close(void) { return 0; }\r
-long CALLBACK SIO1__configure(void) { return 0; }\r
-long CALLBACK SIO1__test(void) { return 0; }\r
-void CALLBACK SIO1__about(void) {}\r
-void CALLBACK SIO1__pause(void) {}\r
-void CALLBACK SIO1__resume(void) {}\r
-long CALLBACK SIO1__keypressed(int key) { return 0; }\r
-void CALLBACK SIO1__writeData8(unsigned char val) {}\r
-void CALLBACK SIO1__writeData16(unsigned short val) {}\r
-void CALLBACK SIO1__writeData32(unsigned long val) {}\r
-void CALLBACK SIO1__writeStat16(unsigned short val) {}\r
-void CALLBACK SIO1__writeStat32(unsigned long val) {}\r
-void CALLBACK SIO1__writeMode16(unsigned short val) {}\r
-void CALLBACK SIO1__writeMode32(unsigned long val) {}\r
-void CALLBACK SIO1__writeCtrl16(unsigned short val) {}\r
-void CALLBACK SIO1__writeCtrl32(unsigned long val) {}\r
-void CALLBACK SIO1__writeBaud16(unsigned short val) {}\r
-void CALLBACK SIO1__writeBaud32(unsigned long val) {}\r
-unsigned char CALLBACK SIO1__readData8(void) { return 0; }\r
-unsigned short CALLBACK SIO1__readData16(void) { return 0; }\r
-unsigned long CALLBACK SIO1__readData32(void) { return 0; }\r
-unsigned short CALLBACK SIO1__readStat16(void) { return 0; }\r
-unsigned long CALLBACK SIO1__readStat32(void) { return 0; }\r
-unsigned short CALLBACK SIO1__readMode16(void) { return 0; }\r
-unsigned long CALLBACK SIO1__readMode32(void) { return 0; }\r
-unsigned short CALLBACK SIO1__readCtrl16(void) { return 0; }\r
-unsigned long CALLBACK SIO1__readCtrl32(void) { return 0; }\r
-unsigned short CALLBACK SIO1__readBaud16(void) { return 0; }\r
-unsigned long CALLBACK SIO1__readBaud32(void) { return 0; }\r
-void CALLBACK SIO1__registerCallback(void (CALLBACK *callback)(void)) {};\r
-\r
-void CALLBACK SIO1irq(void) {\r
- psxHu32ref(0x1070) |= SWAPu32(0x100);\r
-}\r
-\r
-#define LoadSio1Sym1(dest, name) \\r
- LoadSym(SIO1_##dest, SIO1##dest, name, TRUE);\r
-\r
-#define LoadSio1SymN(dest, name) \\r
- LoadSym(SIO1_##dest, SIO1##dest, name, FALSE);\r
-\r
-#define LoadSio1Sym0(dest, name) \\r
- LoadSym(SIO1_##dest, SIO1##dest, name, FALSE); \\r
- if (SIO1_##dest == NULL) SIO1_##dest = (SIO1##dest) SIO1__##dest;\r
-\r
-static int LoadSIO1plugin(const char *SIO1dll) {\r
- void *drv;\r
-\r
- hSIO1Driver = SysLoadLibrary(SIO1dll);\r
- if (hSIO1Driver == NULL) {\r
- SysMessage (_("Could not load SIO1 plugin %s!"), SIO1dll); return -1;\r
- }\r
- drv = hSIO1Driver;\r
-\r
- LoadSio1Sym0(init, "SIO1init");\r
- LoadSio1Sym0(shutdown, "SIO1shutdown");\r
- LoadSio1Sym0(open, "SIO1open");\r
- LoadSio1Sym0(close, "SIO1close");\r
- LoadSio1Sym0(pause, "SIO1pause");\r
- LoadSio1Sym0(resume, "SIO1resume");\r
- LoadSio1Sym0(keypressed, "SIO1keypressed");\r
- LoadSio1Sym0(configure, "SIO1configure");\r
- LoadSio1Sym0(test, "SIO1test");\r
- LoadSio1Sym0(about, "SIO1about");\r
- LoadSio1Sym0(writeData8, "SIO1writeData8");\r
- LoadSio1Sym0(writeData16, "SIO1writeData16");\r
- LoadSio1Sym0(writeData32, "SIO1writeData32");\r
- LoadSio1Sym0(writeStat16, "SIO1writeStat16");\r
- LoadSio1Sym0(writeStat32, "SIO1writeStat32");\r
- LoadSio1Sym0(writeMode16, "SIO1writeMode16");\r
- LoadSio1Sym0(writeMode32, "SIO1writeMode32");\r
- LoadSio1Sym0(writeCtrl16, "SIO1writeCtrl16");\r
- LoadSio1Sym0(writeCtrl32, "SIO1writeCtrl32");\r
- LoadSio1Sym0(writeBaud16, "SIO1writeBaud16");\r
- LoadSio1Sym0(writeBaud32, "SIO1writeBaud32");\r
- LoadSio1Sym0(readData16, "SIO1readData16");\r
- LoadSio1Sym0(readData32, "SIO1readData32");\r
- LoadSio1Sym0(readStat16, "SIO1readStat16");\r
- LoadSio1Sym0(readStat32, "SIO1readStat32");\r
- LoadSio1Sym0(readMode16, "SIO1readMode16");\r
- LoadSio1Sym0(readMode32, "SIO1readMode32");\r
- LoadSio1Sym0(readCtrl16, "SIO1readCtrl16");\r
- LoadSio1Sym0(readCtrl32, "SIO1readCtrl32");\r
- LoadSio1Sym0(readBaud16, "SIO1readBaud16");\r
- LoadSio1Sym0(readBaud32, "SIO1readBaud32");\r
- LoadSio1Sym0(registerCallback, "SIO1registerCallback");\r
-\r
- return 0;\r
-}\r
-\r
-#endif\r
-\r
-void CALLBACK clearDynarec(void) {\r
- psxCpu->Reset();\r
-}\r
-\r
-int LoadPlugins() {\r
- int ret;\r
- char Plugin[MAXPATHLEN];\r
-\r
- ReleasePlugins();\r
- SysLibError();\r
-\r
- if (UsingIso()) {\r
- LoadCDRplugin(NULL);\r
- } else {\r
- sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Cdr);\r
- if (LoadCDRplugin(Plugin) == -1) return -1;\r
- }\r
-\r
- sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Gpu);\r
- if (LoadGPUplugin(Plugin) == -1) return -1;\r
-\r
- sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Spu);\r
- if (LoadSPUplugin(Plugin) == -1) return -1;\r
-\r
- sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Pad1);\r
- if (LoadPAD1plugin(Plugin) == -1) return -1;\r
-\r
- sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Pad2);\r
- if (LoadPAD2plugin(Plugin) == -1) return -1;\r
-\r
- if (strcmp("Disabled", Config.Net) == 0 || strcmp("", Config.Net) == 0)\r
- Config.UseNet = FALSE;\r
- else {\r
- Config.UseNet = TRUE;\r
- sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Net);\r
- if (LoadNETplugin(Plugin) == -1) Config.UseNet = FALSE;\r
- }\r
-\r
-#ifdef ENABLE_SIO1API\r
- sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Sio1);\r
- if (LoadSIO1plugin(Plugin) == -1) return -1;\r
-#endif\r
-\r
- ret = CDR_init();\r
- if (ret < 0) { SysMessage (_("Error initializing CD-ROM plugin: %d"), ret); return -1; }\r
- ret = GPU_init();\r
- if (ret < 0) { SysMessage (_("Error initializing GPU plugin: %d"), ret); return -1; }\r
- ret = SPU_init();\r
- if (ret < 0) { SysMessage (_("Error initializing SPU plugin: %d"), ret); return -1; }\r
- ret = PAD1_init(1);\r
- if (ret < 0) { SysMessage (_("Error initializing Controller 1 plugin: %d"), ret); return -1; }\r
- ret = PAD2_init(2);\r
- if (ret < 0) { SysMessage (_("Error initializing Controller 2 plugin: %d"), ret); return -1; }\r
-\r
- if (Config.UseNet) {\r
- ret = NET_init();\r
- if (ret < 0) { SysMessage (_("Error initializing NetPlay plugin: %d"), ret); return -1; }\r
- }\r
-\r
-#ifdef ENABLE_SIO1API\r
- ret = SIO1_init();\r
- if (ret < 0) { SysMessage (_("Error initializing SIO1 plugin: %d"), ret); return -1; }\r
-#endif\r
-\r
- SysPrintf(_("Plugins loaded.\n"));\r
- return 0;\r
-}\r
-\r
-void ReleasePlugins() {\r
- if (Config.UseNet) {\r
- int ret = NET_close();\r
- if (ret < 0) Config.UseNet = FALSE;\r
- }\r
- NetOpened = FALSE;\r
-\r
- if (hCDRDriver != NULL || cdrIsoActive()) CDR_shutdown();\r
- if (hGPUDriver != NULL) GPU_shutdown();\r
- if (hSPUDriver != NULL) SPU_shutdown();\r
- if (hPAD1Driver != NULL) PAD1_shutdown();\r
- if (hPAD2Driver != NULL) PAD2_shutdown();\r
-\r
- if (Config.UseNet && hNETDriver != NULL) NET_shutdown(); \r
-\r
- if (hCDRDriver != NULL) SysCloseLibrary(hCDRDriver); hCDRDriver = NULL;\r
- if (hGPUDriver != NULL) SysCloseLibrary(hGPUDriver); hGPUDriver = NULL;\r
- if (hSPUDriver != NULL) SysCloseLibrary(hSPUDriver); hSPUDriver = NULL;\r
- if (hPAD1Driver != NULL) SysCloseLibrary(hPAD1Driver); hPAD1Driver = NULL;\r
- if (hPAD2Driver != NULL) SysCloseLibrary(hPAD2Driver); hPAD2Driver = NULL;\r
-\r
- if (Config.UseNet && hNETDriver != NULL) {\r
- SysCloseLibrary(hNETDriver); hNETDriver = NULL;\r
- }\r
-\r
-#ifdef ENABLE_SIO1API\r
- if (hSIO1Driver != NULL) {\r
- SIO1_shutdown();\r
- SysCloseLibrary(hSIO1Driver);\r
- hSIO1Driver = NULL;\r
- }\r
-#endif\r
-}\r
-\r
-// for CD swap\r
-int ReloadCdromPlugin()\r
-{\r
- if (hCDRDriver != NULL || cdrIsoActive()) CDR_shutdown();\r
- if (hCDRDriver != NULL) SysCloseLibrary(hCDRDriver); hCDRDriver = NULL;\r
-\r
- if (UsingIso()) {\r
- LoadCDRplugin(NULL);\r
- } else {\r
- char Plugin[MAXPATHLEN];\r
- sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Cdr);\r
- if (LoadCDRplugin(Plugin) == -1) return -1;\r
- }\r
-\r
- return CDR_init();\r
-}\r
-\r
-void SetIsoFile(const char *filename) {\r
- if (filename == NULL) {\r
- IsoFile[0] = '\0';\r
- return;\r
- }\r
- strncpy(IsoFile, filename, MAXPATHLEN);\r
-}\r
-\r
-const char *GetIsoFile(void) {\r
- return IsoFile;\r
-}\r
-\r
-boolean UsingIso(void) {\r
- return (IsoFile[0] != '\0');\r
-}\r
-\r
-void SetCdOpenCaseTime(s64 time) {\r
- cdOpenCaseTime = time;\r
-}\r
+/***************************************************************************
+ * Copyright (C) 2007 Ryan Schultz, PCSX-df Team, PCSX team *
+ * *
+ * This program is free software; you can redistribute it and/or modify *
+ * it under the terms of the GNU General Public License as published by *
+ * the Free Software Foundation; either version 2 of the License, or *
+ * (at your option) any later version. *
+ * *
+ * This program is distributed in the hope that it will be useful, *
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of *
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the *
+ * GNU General Public License for more details. *
+ * *
+ * You should have received a copy of the GNU General Public License *
+ * along with this program; if not, write to the *
+ * Free Software Foundation, Inc., *
+ * 51 Franklin Street, Fifth Floor, Boston, MA 02111-1307 USA. *
+ ***************************************************************************/
+
+/*
+* Plugin library callback/access functions.
+*/
+
+#include "plugins.h"
+#include "cdriso.h"
+#include "../plugins/dfinput/externals.h"
+
+static char IsoFile[MAXPATHLEN] = "";
+static s64 cdOpenCaseTime = 0;
+
+GPUupdateLace GPU_updateLace;
+GPUinit GPU_init;
+GPUshutdown GPU_shutdown;
+GPUconfigure GPU_configure;
+GPUtest GPU_test;
+GPUabout GPU_about;
+GPUopen GPU_open;
+GPUclose GPU_close;
+GPUreadStatus GPU_readStatus;
+GPUreadData GPU_readData;
+GPUreadDataMem GPU_readDataMem;
+GPUwriteStatus GPU_writeStatus;
+GPUwriteData GPU_writeData;
+GPUwriteDataMem GPU_writeDataMem;
+GPUdmaChain GPU_dmaChain;
+GPUkeypressed GPU_keypressed;
+GPUdisplayText GPU_displayText;
+GPUmakeSnapshot GPU_makeSnapshot;
+GPUfreeze GPU_freeze;
+GPUgetScreenPic GPU_getScreenPic;
+GPUshowScreenPic GPU_showScreenPic;
+GPUclearDynarec GPU_clearDynarec;
+GPUvBlank GPU_vBlank;
+
+CDRinit CDR_init;
+CDRshutdown CDR_shutdown;
+CDRopen CDR_open;
+CDRclose CDR_close;
+CDRtest CDR_test;
+CDRgetTN CDR_getTN;
+CDRgetTD CDR_getTD;
+CDRreadTrack CDR_readTrack;
+CDRgetBuffer CDR_getBuffer;
+CDRplay CDR_play;
+CDRstop CDR_stop;
+CDRgetStatus CDR_getStatus;
+CDRgetDriveLetter CDR_getDriveLetter;
+CDRgetBufferSub CDR_getBufferSub;
+CDRconfigure CDR_configure;
+CDRabout CDR_about;
+CDRsetfilename CDR_setfilename;
+CDRreadCDDA CDR_readCDDA;
+CDRgetTE CDR_getTE;
+
+SPUconfigure SPU_configure;
+SPUabout SPU_about;
+SPUinit SPU_init;
+SPUshutdown SPU_shutdown;
+SPUtest SPU_test;
+SPUopen SPU_open;
+SPUclose SPU_close;
+SPUplaySample SPU_playSample;
+SPUwriteRegister SPU_writeRegister;
+SPUreadRegister SPU_readRegister;
+SPUwriteDMA SPU_writeDMA;
+SPUreadDMA SPU_readDMA;
+SPUwriteDMAMem SPU_writeDMAMem;
+SPUreadDMAMem SPU_readDMAMem;
+SPUplayADPCMchannel SPU_playADPCMchannel;
+SPUfreeze SPU_freeze;
+SPUregisterCallback SPU_registerCallback;
+SPUregisterScheduleCb SPU_registerScheduleCb;
+SPUasync SPU_async;
+SPUplayCDDAchannel SPU_playCDDAchannel;
+
+PADconfigure PAD1_configure;
+PADabout PAD1_about;
+PADinit PAD1_init;
+PADshutdown PAD1_shutdown;
+PADtest PAD1_test;
+PADopen PAD1_open;
+PADclose PAD1_close;
+PADquery PAD1_query;
+PADreadPort1 PAD1_readPort1;
+PADkeypressed PAD1_keypressed;
+PADstartPoll PAD1_startPoll;
+PADpoll PAD1_poll;
+PADsetSensitive PAD1_setSensitive;
+
+PADconfigure PAD2_configure;
+PADabout PAD2_about;
+PADinit PAD2_init;
+PADshutdown PAD2_shutdown;
+PADtest PAD2_test;
+PADopen PAD2_open;
+PADclose PAD2_close;
+PADquery PAD2_query;
+PADreadPort2 PAD2_readPort2;
+PADkeypressed PAD2_keypressed;
+PADstartPoll PAD2_startPoll;
+PADpoll PAD2_poll;
+PADsetSensitive PAD2_setSensitive;
+
+NETinit NET_init;
+NETshutdown NET_shutdown;
+NETopen NET_open;
+NETclose NET_close;
+NETtest NET_test;
+NETconfigure NET_configure;
+NETabout NET_about;
+NETpause NET_pause;
+NETresume NET_resume;
+NETqueryPlayer NET_queryPlayer;
+NETsendData NET_sendData;
+NETrecvData NET_recvData;
+NETsendPadData NET_sendPadData;
+NETrecvPadData NET_recvPadData;
+NETsetInfo NET_setInfo;
+NETkeypressed NET_keypressed;
+
+#ifdef ENABLE_SIO1API
+
+SIO1init SIO1_init;
+SIO1shutdown SIO1_shutdown;
+SIO1open SIO1_open;
+SIO1close SIO1_close;
+SIO1test SIO1_test;
+SIO1configure SIO1_configure;
+SIO1about SIO1_about;
+SIO1pause SIO1_pause;
+SIO1resume SIO1_resume;
+SIO1keypressed SIO1_keypressed;
+SIO1writeData8 SIO1_writeData8;
+SIO1writeData16 SIO1_writeData16;
+SIO1writeData32 SIO1_writeData32;
+SIO1writeStat16 SIO1_writeStat16;
+SIO1writeStat32 SIO1_writeStat32;
+SIO1writeMode16 SIO1_writeMode16;
+SIO1writeMode32 SIO1_writeMode32;
+SIO1writeCtrl16 SIO1_writeCtrl16;
+SIO1writeCtrl32 SIO1_writeCtrl32;
+SIO1writeBaud16 SIO1_writeBaud16;
+SIO1writeBaud32 SIO1_writeBaud32;
+SIO1readData8 SIO1_readData8;
+SIO1readData16 SIO1_readData16;
+SIO1readData32 SIO1_readData32;
+SIO1readStat16 SIO1_readStat16;
+SIO1readStat32 SIO1_readStat32;
+SIO1readMode16 SIO1_readMode16;
+SIO1readMode32 SIO1_readMode32;
+SIO1readCtrl16 SIO1_readCtrl16;
+SIO1readCtrl32 SIO1_readCtrl32;
+SIO1readBaud16 SIO1_readBaud16;
+SIO1readBaud32 SIO1_readBaud32;
+SIO1registerCallback SIO1_registerCallback;
+
+#endif
+
+static const char *err;
+
+#define CheckErr(func) { \
+ err = SysLibError(); \
+ if (err != NULL) { SysMessage(_("Error loading %s: %s"), func, err); return -1; } \
+}
+
+#define LoadSym(dest, src, name, checkerr) { \
+ dest = (src)SysLoadSym(drv, name); \
+ if (checkerr) { CheckErr(name); } else SysLibError(); \
+}
+
+void *hGPUDriver = NULL;
+
+void CALLBACK GPU__displayText(char *pText) {
+ SysPrintf("%s\n", pText);
+}
+
+long CALLBACK GPU__configure(void) { return 0; }
+long CALLBACK GPU__test(void) { return 0; }
+void CALLBACK GPU__about(void) {}
+void CALLBACK GPU__makeSnapshot(void) {}
+void CALLBACK GPU__keypressed(int key) {}
+long CALLBACK GPU__getScreenPic(unsigned char *pMem) { return -1; }
+long CALLBACK GPU__showScreenPic(unsigned char *pMem) { return -1; }
+void CALLBACK GPU__clearDynarec(void (CALLBACK *callback)(void)) {}
+void CALLBACK GPU__vBlank(int val) {}
+
+#define LoadGpuSym1(dest, name) \
+ LoadSym(GPU_##dest, GPU##dest, name, TRUE);
+
+#define LoadGpuSym0(dest, name) \
+ LoadSym(GPU_##dest, GPU##dest, name, FALSE); \
+ if (GPU_##dest == NULL) GPU_##dest = (GPU##dest) GPU__##dest;
+
+#define LoadGpuSymN(dest, name) \
+ LoadSym(GPU_##dest, GPU##dest, name, FALSE);
+
+static int LoadGPUplugin(const char *GPUdll) {
+ void *drv;
+
+ hGPUDriver = SysLoadLibrary(GPUdll);
+ if (hGPUDriver == NULL) {
+ GPU_configure = NULL;
+ SysMessage (_("Could not load GPU plugin %s!"), GPUdll); return -1;
+ }
+ drv = hGPUDriver;
+ LoadGpuSym1(init, "GPUinit");
+ LoadGpuSym1(shutdown, "GPUshutdown");
+ LoadGpuSym1(open, "GPUopen");
+ LoadGpuSym1(close, "GPUclose");
+ LoadGpuSym1(readData, "GPUreadData");
+ LoadGpuSym1(readDataMem, "GPUreadDataMem");
+ LoadGpuSym1(readStatus, "GPUreadStatus");
+ LoadGpuSym1(writeData, "GPUwriteData");
+ LoadGpuSym1(writeDataMem, "GPUwriteDataMem");
+ LoadGpuSym1(writeStatus, "GPUwriteStatus");
+ LoadGpuSym1(dmaChain, "GPUdmaChain");
+ LoadGpuSym1(updateLace, "GPUupdateLace");
+ LoadGpuSym0(keypressed, "GPUkeypressed");
+ LoadGpuSym0(displayText, "GPUdisplayText");
+ LoadGpuSym0(makeSnapshot, "GPUmakeSnapshot");
+ LoadGpuSym1(freeze, "GPUfreeze");
+ LoadGpuSym0(getScreenPic, "GPUgetScreenPic");
+ LoadGpuSym0(showScreenPic, "GPUshowScreenPic");
+ LoadGpuSym0(clearDynarec, "GPUclearDynarec");
+ LoadGpuSym0(vBlank, "GPUvBlank");
+ LoadGpuSym0(configure, "GPUconfigure");
+ LoadGpuSym0(test, "GPUtest");
+ LoadGpuSym0(about, "GPUabout");
+
+ return 0;
+}
+
+void *hCDRDriver = NULL;
+
+long CALLBACK CDR__play(unsigned char *sector) { return 0; }
+long CALLBACK CDR__stop(void) { return 0; }
+
+long CALLBACK CDR__getStatus(struct CdrStat *stat) {
+ if (cdOpenCaseTime < 0 || cdOpenCaseTime > (s64)time(NULL))
+ stat->Status = 0x10;
+ else
+ stat->Status = 0;
+
+ return 0;
+}
+
+char* CALLBACK CDR__getDriveLetter(void) { return NULL; }
+long CALLBACK CDR__configure(void) { return 0; }
+long CALLBACK CDR__test(void) { return 0; }
+void CALLBACK CDR__about(void) {}
+long CALLBACK CDR__setfilename(char*filename) { return 0; }
+
+#define LoadCdrSym1(dest, name) \
+ LoadSym(CDR_##dest, CDR##dest, name, TRUE);
+
+#define LoadCdrSym0(dest, name) \
+ LoadSym(CDR_##dest, CDR##dest, name, FALSE); \
+ if (CDR_##dest == NULL) CDR_##dest = (CDR##dest) CDR__##dest;
+
+#define LoadCdrSymN(dest, name) \
+ LoadSym(CDR_##dest, CDR##dest, name, FALSE);
+
+static int LoadCDRplugin(const char *CDRdll) {
+ void *drv;
+
+ if (CDRdll == NULL) {
+ cdrIsoInit();
+ return 0;
+ }
+
+ hCDRDriver = SysLoadLibrary(CDRdll);
+ if (hCDRDriver == NULL) {
+ CDR_configure = NULL;
+ SysMessage (_("Could not load CD-ROM plugin %s!"), CDRdll); return -1;
+ }
+ drv = hCDRDriver;
+ LoadCdrSym1(init, "CDRinit");
+ LoadCdrSym1(shutdown, "CDRshutdown");
+ LoadCdrSym1(open, "CDRopen");
+ LoadCdrSym1(close, "CDRclose");
+ LoadCdrSym1(getTN, "CDRgetTN");
+ LoadCdrSym1(getTD, "CDRgetTD");
+ LoadCdrSym1(readTrack, "CDRreadTrack");
+ LoadCdrSym1(getBuffer, "CDRgetBuffer");
+ LoadCdrSym1(getBufferSub, "CDRgetBufferSub");
+ LoadCdrSym0(play, "CDRplay");
+ LoadCdrSym0(stop, "CDRstop");
+ LoadCdrSym0(getStatus, "CDRgetStatus");
+ LoadCdrSym0(getDriveLetter, "CDRgetDriveLetter");
+ LoadCdrSym0(configure, "CDRconfigure");
+ LoadCdrSym0(test, "CDRtest");
+ LoadCdrSym0(about, "CDRabout");
+ LoadCdrSym0(setfilename, "CDRsetfilename");
+ LoadCdrSymN(readCDDA, "CDRreadCDDA");
+ LoadCdrSymN(getTE, "CDRgetTE");
+
+ return 0;
+}
+
+void *hSPUDriver = NULL;
+
+long CALLBACK SPU__configure(void) { return 0; }
+void CALLBACK SPU__about(void) {}
+long CALLBACK SPU__test(void) { return 0; }
+void CALLBACK SPU__registerScheduleCb(void (CALLBACK *cb)(unsigned int)) {}
+
+#define LoadSpuSym1(dest, name) \
+ LoadSym(SPU_##dest, SPU##dest, name, TRUE);
+
+#define LoadSpuSym0(dest, name) \
+ LoadSym(SPU_##dest, SPU##dest, name, FALSE); \
+ if (SPU_##dest == NULL) SPU_##dest = (SPU##dest) SPU__##dest;
+
+#define LoadSpuSymN(dest, name) \
+ LoadSym(SPU_##dest, SPU##dest, name, FALSE);
+
+static int LoadSPUplugin(const char *SPUdll) {
+ void *drv;
+
+ hSPUDriver = SysLoadLibrary(SPUdll);
+ if (hSPUDriver == NULL) {
+ SPU_configure = NULL;
+ SysMessage (_("Could not load SPU plugin %s!"), SPUdll); return -1;
+ }
+ drv = hSPUDriver;
+ LoadSpuSym1(init, "SPUinit");
+ LoadSpuSym1(shutdown, "SPUshutdown");
+ LoadSpuSym1(open, "SPUopen");
+ LoadSpuSym1(close, "SPUclose");
+ LoadSpuSym0(configure, "SPUconfigure");
+ LoadSpuSym0(about, "SPUabout");
+ LoadSpuSym0(test, "SPUtest");
+ LoadSpuSym1(writeRegister, "SPUwriteRegister");
+ LoadSpuSym1(readRegister, "SPUreadRegister");
+ LoadSpuSym1(writeDMA, "SPUwriteDMA");
+ LoadSpuSym1(readDMA, "SPUreadDMA");
+ LoadSpuSym1(writeDMAMem, "SPUwriteDMAMem");
+ LoadSpuSym1(readDMAMem, "SPUreadDMAMem");
+ LoadSpuSym1(playADPCMchannel, "SPUplayADPCMchannel");
+ LoadSpuSym1(freeze, "SPUfreeze");
+ LoadSpuSym1(registerCallback, "SPUregisterCallback");
+ LoadSpuSym0(registerScheduleCb, "SPUregisterScheduleCb");
+ LoadSpuSymN(async, "SPUasync");
+ LoadSpuSymN(playCDDAchannel, "SPUplayCDDAchannel");
+
+ return 0;
+}
+
+void *hPAD1Driver = NULL;
+void *hPAD2Driver = NULL;
+
+static int multitap1 = -1;
+static int multitap2 = -1;
+//Pad information, keystate, mode, config mode, vibration
+static PadDataS pad[8];
+
+static int reqPos, respSize, req;
+static int ledStateReq44[8];
+
+static unsigned char buf[256];
+static unsigned char bufMulti[34] = { 0x80, 0x5a,
+ 0x41, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0x41, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0x41, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0x41, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff};
+
+unsigned char stdpar[8] = { 0x41, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff};
+unsigned char multitappar[34] = { 0x80, 0x5a,
+ 0x41, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0x41, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0x41, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0x41, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff};
+
+//response for request 44, 45, 46, 47, 4C, 4D
+static unsigned char resp45[8] = {0xF3, 0x5A, 0x01, 0x02, 0x00, 0x02, 0x01, 0x00};
+static unsigned char resp46_00[8] = {0xF3, 0x5A, 0x00, 0x00, 0x01, 0x02, 0x00, 0x0A};
+static unsigned char resp46_01[8] = {0xF3, 0x5A, 0x00, 0x00, 0x01, 0x01, 0x01, 0x14};
+static unsigned char resp47[8] = {0xF3, 0x5A, 0x00, 0x00, 0x02, 0x00, 0x01, 0x00};
+static unsigned char resp4C_00[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x04, 0x00, 0x00};
+static unsigned char resp4C_01[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x07, 0x00, 0x00};
+static unsigned char resp4D[8] = {0xF3, 0x5A, 0x00, 0x01, 0xFF, 0xFF, 0xFF, 0xFF};
+
+//fixed reponse of request number 41, 48, 49, 4A, 4B, 4E, 4F
+static unsigned char resp40[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00};
+static unsigned char resp41[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00};
+static unsigned char resp43[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00};
+static unsigned char resp44[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00};
+static unsigned char resp49[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00};
+static unsigned char resp4A[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00};
+static unsigned char resp4B[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00};
+static unsigned char resp4E[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00};
+static unsigned char resp4F[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00};
+
+// Resquest of psx core
+enum {
+ // REQUEST
+ // first call of this request for the pad, the pad is configured as an digital pad.
+ // 0x0X, 0x42, 0x0Y, 0xZZ, 0xAA, 0x00, 0x00, 0x00, 0x00
+ // X pad number (used for the multitap, first request response 0x00, 0x80, 0x5A, (8 bytes pad A), (8 bytes pad B), (8 bytes pad C), (8 bytes pad D)
+ // Y if 1 : psx request the full length response for the multitap, 3 bytes header and 4 block of 8 bytes per pad
+ // Y if 0 : psx request a pad key state
+ // ZZ rumble small motor 00-> OFF, 01 -> ON
+ // AA rumble large motor speed 0x00 -> 0xFF
+ // RESPONSE
+ // header 3 Bytes
+ // 0x00
+ // PadId -> 0x41 for digital pas, 0x73 for analog pad
+ // 0x5A mode has not change (no press on analog button on the center of pad), 0x00 the analog button have been pressed and the mode switch
+ // 6 Bytes for keystates
+ CMD_READ_DATA_AND_VIBRATE = 0x42,
+
+ // REQUEST
+ // Header
+ // 0x0N, 0x43, 0x00, XX, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00
+ // XX = 00 -> Normal mode : Seconde bytes of response = padId
+ // XX = 01 -> Configuration mode : Seconde bytes of response = 0xF3
+ // RESPONSE
+ // enter in config mode example :
+ // req : 01 43 00 01 00 00 00 00 00 00
+ // res : 00 41 5A buttons state, analog states
+ // exit config mode :
+ // req : 01 43 00 00 00 00 00 00 00 00
+ // res : 00 F3 5A buttons state, analog states
+ CMD_CONFIG_MODE = 0x43,
+
+ // Set led State
+ // REQUEST
+ // 0x0N, 0x44, 0x00, VAL, SEL, 0x00, 0x00, 0x00, 0x00
+ // If sel = 2 then
+ // VAL = 00 -> OFF
+ // VAL = 01 -> ON
+ // RESPONSE
+ // 0x00, 0xF3, 0x5A, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00
+ CMD_SET_MODE_AND_LOCK = 0x44,
+
+ // Get Analog Led state
+ // REQUEST
+ // 0x0N, 0x45, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00
+ // RESPONSE
+ // 0x00, 0xF3, 0x5A, 0x01, 0x02, VAL, 0x02, 0x01, 0x00
+ // VAL = 00 Led OFF
+ // VAL = 01 Led ON
+ CMD_QUERY_MODEL_AND_MODE = 0x45,
+
+ //Get Variable A
+ // REQUEST
+ // 0x0N, 0x46, 0x00, 0xXX, 0x00, 0x00, 0x00, 0x00, 0x00
+ // RESPONSE
+ // XX=00
+ // 0x00, 0xF3, 0x5A, 0x00, 0x00, 0x01, 0x02, 0x00, 0x0A
+ // XX=01
+ // 0x00, 0xF3, 0x5A, 0x00, 0x00, 0x01, 0x01, 0x01, 0x14
+ CMD_QUERY_ACT = 0x46,
+
+ // REQUEST
+ // 0x0N, 0x47, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00
+ // RESPONSE
+ // 0x00, 0xF3, 0x5A, 0x00, 0x00, 0x02, 0x00, 0x01, 0x00
+ CMD_QUERY_COMB = 0x47,
+
+ // REQUEST
+ // 0x0N, 0x4C, 0x00, 0xXX, 0x00, 0x00, 0x00, 0x00, 0x00
+ // RESPONSE
+ // XX = 0
+ // 0x00, 0xF3, 0x5A, 0x00, 0x00, 0x00, 0x04, 0x00, 0x00
+ // XX = 1
+ // 0x00, 0xF3, 0x5A, 0x00, 0x00, 0x00, 0x07, 0x00, 0x00
+ CMD_QUERY_MODE = 0x4C,
+
+ // REQUEST
+ // 0x0N, 0x4D, 0x00, 0xAA, 0xBB, 0xCC, 0xDD, 0xEE, 0xFF
+ // RESPONSE
+ // 0x00, 0xF3, 0x5A, old value or
+ // AA = 01 unlock large motor (and swap VAL1 and VAL2)
+ // BB = 01 unlock large motor (default)
+ // CC, DD, EE, FF = all FF -> unlock small motor
+ //
+ // default repsonse for analog pad with 2 motor : 0x00 0xF3 0x5A 0x00 0x01 0xFF 0xFF 0xFF 0xFF
+ //
+ CMD_VIBRATION_TOGGLE = 0x4D,
+ REQ40 = 0x40,
+ REQ41 = 0x41,
+ REQ49 = 0x49,
+ REQ4A = 0x4A,
+ REQ4B = 0x4B,
+ REQ4E = 0x4E,
+ REQ4F = 0x4F
+};
+
+
+
+
+//NO MULTITAP
+
+void initBufForRequest(int padIndex, char value){
+ switch (value){
+ //Pad keystate already in buffer
+ //case CMD_READ_DATA_AND_VIBRATE :
+ // break;
+ case CMD_CONFIG_MODE :
+ if (pad[padIndex].configMode == 1) {
+ memcpy(buf, resp43, 8);
+ break;
+ }
+ //else, not in config mode, pad keystate return (already in the buffer)
+ break;
+ case CMD_SET_MODE_AND_LOCK :
+ memcpy(buf, resp44, 8);
+ break;
+ case CMD_QUERY_MODEL_AND_MODE :
+ memcpy(buf, resp45, 8);
+ break;
+ case CMD_QUERY_ACT :
+ memcpy(buf, resp46_00, 8);
+ break;
+ case CMD_QUERY_COMB :
+ memcpy(buf, resp47, 8);
+ break;
+ case CMD_QUERY_MODE :
+ memcpy(buf, resp4C_00, 8);
+ break;
+ case CMD_VIBRATION_TOGGLE :
+ memcpy(buf, resp4D, 8);
+ break;
+ case REQ40 :
+ memcpy(buf, resp40, 8);
+ break;
+ case REQ41 :
+ memcpy(buf, resp41, 8);
+ break;
+ case REQ49 :
+ memcpy(buf, resp49, 8);
+ break;
+ case REQ4A :
+ memcpy(buf, resp4A, 8);
+ break;
+ case REQ4B :
+ memcpy(buf, resp4B, 8);
+ break;
+ case REQ4E :
+ memcpy(buf, resp4E, 8);
+ break;
+ case REQ4F :
+ memcpy(buf, resp4F, 8);
+ break;
+ }
+}
+
+
+
+
+void reqIndex2Treatment(int padIndex, char value){
+ switch (req){
+ case CMD_CONFIG_MODE :
+ //0x43
+ if (value == 0) {
+ pad[padIndex].configMode = 0;
+ } else {
+ pad[padIndex].configMode = 1;
+ }
+ break;
+ case CMD_SET_MODE_AND_LOCK :
+ //0x44 store the led state for change mode if the next value = 0x02
+ //0x01 analog ON
+ //0x00 analog OFF
+ ledStateReq44[padIndex] = value;
+ break;
+ case CMD_QUERY_ACT :
+ //0x46
+ if (value == 1) {
+ memcpy(buf, resp46_01, 8);
+ }
+ break;
+ case CMD_QUERY_MODE :
+ if (value == 1) {
+ memcpy(buf, resp4C_01, 8);
+ }
+ break;
+ case CMD_VIBRATION_TOGGLE :
+ //0x4D
+ memcpy(buf, resp4D, 8);
+ break;
+ case CMD_READ_DATA_AND_VIBRATE:
+ //mem the vibration value for small motor;
+ pad[padIndex].Vib[0] = value;
+ break;
+ }
+}
+
+void vibrate(int padIndex){
+ if (pad[padIndex].Vib[0] != pad[padIndex].VibF[0] || pad[padIndex].Vib[1] != pad[padIndex].VibF[1]) {
+ //value is different update Value and call libretro for vibration
+ pad[padIndex].VibF[0] = pad[padIndex].Vib[0];
+ pad[padIndex].VibF[1] = pad[padIndex].Vib[1];
+ plat_trigger_vibrate(padIndex, pad[padIndex].VibF[0], pad[padIndex].VibF[1]);
+ //printf("vibration pad %i", padIndex);
+ }
+}
+
+
+
+
+//Build response for 0x42 request Pad in port
+void _PADstartPoll(PadDataS *pad) {
+ switch (pad->controllerType) {
+ case PSE_PAD_TYPE_MOUSE:
+ stdpar[0] = 0x12;
+ stdpar[2] = pad->buttonStatus & 0xff;
+ stdpar[3] = pad->buttonStatus >> 8;
+ stdpar[4] = pad->moveX;
+ stdpar[5] = pad->moveY;
+ memcpy(buf, stdpar, 6);
+ respSize = 6;
+ break;
+ case PSE_PAD_TYPE_NEGCON: // npc101/npc104(slph00001/slph00069)
+ stdpar[0] = 0x23;
+ stdpar[2] = pad->buttonStatus & 0xff;
+ stdpar[3] = pad->buttonStatus >> 8;
+ stdpar[4] = pad->rightJoyX;
+ stdpar[5] = pad->rightJoyY;
+ stdpar[6] = pad->leftJoyX;
+ stdpar[7] = pad->leftJoyY;
+ memcpy(buf, stdpar, 8);
+ respSize = 8;
+ break;
+ case PSE_PAD_TYPE_ANALOGPAD: // scph1150
+ stdpar[0] = 0x73;
+ stdpar[2] = pad->buttonStatus & 0xff;
+ stdpar[3] = pad->buttonStatus >> 8;
+ stdpar[4] = pad->rightJoyX;
+ stdpar[5] = pad->rightJoyY;
+ stdpar[6] = pad->leftJoyX;
+ stdpar[7] = pad->leftJoyY;
+ memcpy(buf, stdpar, 8);
+ respSize = 8;
+ break;
+ case PSE_PAD_TYPE_ANALOGJOY: // scph1110
+ stdpar[0] = 0x53;
+ stdpar[2] = pad->buttonStatus & 0xff;
+ stdpar[3] = pad->buttonStatus >> 8;
+ stdpar[4] = pad->rightJoyX;
+ stdpar[5] = pad->rightJoyY;
+ stdpar[6] = pad->leftJoyX;
+ stdpar[7] = pad->leftJoyY;
+ memcpy(buf, stdpar, 8);
+ respSize = 8;
+ break;
+ case PSE_PAD_TYPE_STANDARD:
+ default:
+ stdpar[0] = 0x41;
+ stdpar[2] = pad->buttonStatus & 0xff;
+ stdpar[3] = pad->buttonStatus >> 8;
+ //avoid analog value in multitap mode if change pad type in game.
+ stdpar[4] = 0xff;
+ stdpar[5] = 0xff;
+ stdpar[6] = 0xff;
+ stdpar[7] = 0xff;
+ memcpy(buf, stdpar, 8);
+ respSize = 8;
+ }
+}
+
+
+//Build response for 0x42 request Multitap in port
+//Response header for multitap : 0x80, 0x5A, (Pad information port 1-2A), (Pad information port 1-2B), (Pad information port 1-2C), (Pad information port 1-2D)
+void _PADstartPollMultitap(PadDataS* padd) {
+ int i, offset;
+ for(i = 0; i < 4; i++) {
+ offset = 2 + (i * 8);
+ _PADstartPoll(&padd[i]);
+ memcpy(multitappar+offset, stdpar, 8);
+ }
+ memcpy(bufMulti, multitappar, 34);
+ respSize = 34;
+}
+
+
+unsigned char _PADpoll(int port, unsigned char value) {
+ if (reqPos == 0) {
+ //mem the request number
+ req = value;
+ //copy the default value of request response in buffer instead of the keystate
+ initBufForRequest(port, value);
+ }
+
+ //if no new request the pad return 0xff, for signaling connected
+ if (reqPos >= respSize) return 0xff;
+
+ switch(reqPos){
+ case 2:
+ reqIndex2Treatment(port, value);
+ break;
+ case 3:
+ switch(req) {
+ case CMD_SET_MODE_AND_LOCK :
+ //change mode on pad
+ break;
+ case CMD_READ_DATA_AND_VIBRATE:
+ //mem the vibration value for Large motor;
+ pad[port].Vib[1] = value;
+ //vibration
+ vibrate(port);
+ break;
+ }
+ break;
+ }
+ return buf[reqPos++];
+}
+
+
+unsigned char _PADpollMultitap(int port, unsigned char value) {
+ if (reqPos >= respSize) return 0xff;
+ return bufMulti[reqPos++];
+}
+
+
+// refresh the button state on port 1.
+// int pad is not needed.
+unsigned char CALLBACK PAD1__startPoll(int pad) {
+ reqPos = 0;
+ // first call the pad provide if a multitap is connected between the psx and himself
+ if (multitap1 == -1) {
+ PadDataS padd;
+ padd.requestPadIndex = 0;
+ PAD1_readPort1(&padd);
+ multitap1 = padd.portMultitap;
+ }
+ // just one pad is on port 1 : NO MULTITAP
+ if (multitap1 == 0) {
+ PadDataS padd;
+ padd.requestPadIndex = 0;
+ PAD1_readPort1(&padd);
+ _PADstartPoll(&padd);
+ } else {
+ // a multitap is plugged : refresh all pad.
+ int i;
+ PadDataS padd[4];
+ for(i = 0; i < 4; i++) {
+ padd[i].requestPadIndex = i;
+ PAD1_readPort1(&padd[i]);
+ }
+ _PADstartPollMultitap(padd);
+ }
+ //printf("\npad 1 : ");
+ return 0x00;
+}
+
+unsigned char CALLBACK PAD1__poll(unsigned char value) {
+ char tmp;
+ if (multitap1 == 1) {
+ tmp = _PADpollMultitap(0, value);
+ } else {
+ tmp = _PADpoll(0, value);
+ }
+ //printf("%2x:%2x, ",value,tmp);
+ return tmp;
+
+}
+
+
+long CALLBACK PAD1__configure(void) { return 0; }
+void CALLBACK PAD1__about(void) {}
+long CALLBACK PAD1__test(void) { return 0; }
+long CALLBACK PAD1__query(void) { return 3; }
+long CALLBACK PAD1__keypressed() { return 0; }
+
+#define LoadPad1Sym1(dest, name) \
+ LoadSym(PAD1_##dest, PAD##dest, name, TRUE);
+
+#define LoadPad1SymN(dest, name) \
+ LoadSym(PAD1_##dest, PAD##dest, name, FALSE);
+
+#define LoadPad1Sym0(dest, name) \
+ LoadSym(PAD1_##dest, PAD##dest, name, FALSE); \
+ if (PAD1_##dest == NULL) PAD1_##dest = (PAD##dest) PAD1__##dest;
+
+static int LoadPAD1plugin(const char *PAD1dll) {
+ void *drv;
+
+ hPAD1Driver = SysLoadLibrary(PAD1dll);
+ if (hPAD1Driver == NULL) {
+ PAD1_configure = NULL;
+ SysMessage (_("Could not load Controller 1 plugin %s!"), PAD1dll); return -1;
+ }
+ drv = hPAD1Driver;
+ LoadPad1Sym1(init, "PADinit");
+ LoadPad1Sym1(shutdown, "PADshutdown");
+ LoadPad1Sym1(open, "PADopen");
+ LoadPad1Sym1(close, "PADclose");
+ LoadPad1Sym0(query, "PADquery");
+ LoadPad1Sym1(readPort1, "PADreadPort1");
+ LoadPad1Sym0(configure, "PADconfigure");
+ LoadPad1Sym0(test, "PADtest");
+ LoadPad1Sym0(about, "PADabout");
+ LoadPad1Sym0(keypressed, "PADkeypressed");
+ LoadPad1Sym0(startPoll, "PADstartPoll");
+ LoadPad1Sym0(poll, "PADpoll");
+ LoadPad1SymN(setSensitive, "PADsetSensitive");
+
+ return 0;
+}
+
+unsigned char CALLBACK PAD2__startPoll(int pad) {
+ int pad_index;
+
+ reqPos = 0;
+ if (multitap1 == 0 && (multitap2 == 0 || multitap2 == 2)) {
+ pad_index = 1;
+ } else if(multitap1 == 1 && (multitap2 == 0 || multitap2 == 2)) {
+ pad_index = 4;
+ } else {
+ pad_index = 0;
+ }
+
+ //first call the pad provide if a multitap is connected between the psx and himself
+ if (multitap2 == -1) {
+ PadDataS padd;
+ padd.requestPadIndex = pad_index;
+ PAD2_readPort2(&padd);
+ multitap2 = padd.portMultitap;
+ }
+
+ // just one pad is on port 1 : NO MULTITAP
+ if (multitap2 == 0) {
+ PadDataS padd;
+ padd.requestPadIndex = pad_index;
+ PAD2_readPort2(&padd);
+ _PADstartPoll(&padd);
+ } else {
+ // a multitap is plugged : refresh all pad.
+ int i;
+ PadDataS padd[4];
+ for(i = 0; i < 4; i++) {
+ padd[i].requestPadIndex = i+pad_index;
+ PAD2_readPort2(&padd[i]);
+ }
+ _PADstartPollMultitap(padd);
+ }
+ //printf("\npad 2 : ");
+ return 0x00;
+}
+
+unsigned char CALLBACK PAD2__poll(unsigned char value) {
+ char tmp;
+ if (multitap2 == 2) {
+ tmp = _PADpollMultitap(1, value);
+ } else {
+ tmp = _PADpoll(1, value);
+ }
+ //printf("%2x:%2x, ",value,tmp);
+ return tmp;
+}
+
+long CALLBACK PAD2__configure(void) { return 0; }
+void CALLBACK PAD2__about(void) {}
+long CALLBACK PAD2__test(void) { return 0; }
+long CALLBACK PAD2__query(void) { return PSE_PAD_USE_PORT1 | PSE_PAD_USE_PORT2; }
+long CALLBACK PAD2__keypressed() { return 0; }
+
+#define LoadPad2Sym1(dest, name) \
+ LoadSym(PAD2_##dest, PAD##dest, name, TRUE);
+
+#define LoadPad2Sym0(dest, name) \
+ LoadSym(PAD2_##dest, PAD##dest, name, FALSE); \
+ if (PAD2_##dest == NULL) PAD2_##dest = (PAD##dest) PAD2__##dest;
+
+#define LoadPad2SymN(dest, name) \
+ LoadSym(PAD2_##dest, PAD##dest, name, FALSE);
+
+static int LoadPAD2plugin(const char *PAD2dll) {
+ void *drv;
+
+ hPAD2Driver = SysLoadLibrary(PAD2dll);
+ if (hPAD2Driver == NULL) {
+ PAD2_configure = NULL;
+ SysMessage (_("Could not load Controller 2 plugin %s!"), PAD2dll); return -1;
+ }
+ drv = hPAD2Driver;
+ LoadPad2Sym1(init, "PADinit");
+ LoadPad2Sym1(shutdown, "PADshutdown");
+ LoadPad2Sym1(open, "PADopen");
+ LoadPad2Sym1(close, "PADclose");
+ LoadPad2Sym0(query, "PADquery");
+ LoadPad2Sym1(readPort2, "PADreadPort2");
+ LoadPad2Sym0(configure, "PADconfigure");
+ LoadPad2Sym0(test, "PADtest");
+ LoadPad2Sym0(about, "PADabout");
+ LoadPad2Sym0(keypressed, "PADkeypressed");
+ LoadPad2Sym0(startPoll, "PADstartPoll");
+ LoadPad2Sym0(poll, "PADpoll");
+ LoadPad2SymN(setSensitive, "PADsetSensitive");
+
+ return 0;
+}
+
+void *hNETDriver = NULL;
+
+void CALLBACK NET__setInfo(netInfo *info) {}
+void CALLBACK NET__keypressed(int key) {}
+long CALLBACK NET__configure(void) { return 0; }
+long CALLBACK NET__test(void) { return 0; }
+void CALLBACK NET__about(void) {}
+
+#define LoadNetSym1(dest, name) \
+ LoadSym(NET_##dest, NET##dest, name, TRUE);
+
+#define LoadNetSymN(dest, name) \
+ LoadSym(NET_##dest, NET##dest, name, FALSE);
+
+#define LoadNetSym0(dest, name) \
+ LoadSym(NET_##dest, NET##dest, name, FALSE); \
+ if (NET_##dest == NULL) NET_##dest = (NET##dest) NET__##dest;
+
+static int LoadNETplugin(const char *NETdll) {
+ void *drv;
+
+ hNETDriver = SysLoadLibrary(NETdll);
+ if (hNETDriver == NULL) {
+ SysMessage (_("Could not load NetPlay plugin %s!"), NETdll); return -1;
+ }
+ drv = hNETDriver;
+ LoadNetSym1(init, "NETinit");
+ LoadNetSym1(shutdown, "NETshutdown");
+ LoadNetSym1(open, "NETopen");
+ LoadNetSym1(close, "NETclose");
+ LoadNetSymN(sendData, "NETsendData");
+ LoadNetSymN(recvData, "NETrecvData");
+ LoadNetSym1(sendPadData, "NETsendPadData");
+ LoadNetSym1(recvPadData, "NETrecvPadData");
+ LoadNetSym1(queryPlayer, "NETqueryPlayer");
+ LoadNetSym1(pause, "NETpause");
+ LoadNetSym1(resume, "NETresume");
+ LoadNetSym0(setInfo, "NETsetInfo");
+ LoadNetSym0(keypressed, "NETkeypressed");
+ LoadNetSym0(configure, "NETconfigure");
+ LoadNetSym0(test, "NETtest");
+ LoadNetSym0(about, "NETabout");
+
+ return 0;
+}
+
+#ifdef ENABLE_SIO1API
+
+void *hSIO1Driver = NULL;
+
+long CALLBACK SIO1__init(void) { return 0; }
+long CALLBACK SIO1__shutdown(void) { return 0; }
+long CALLBACK SIO1__open(void) { return 0; }
+long CALLBACK SIO1__close(void) { return 0; }
+long CALLBACK SIO1__configure(void) { return 0; }
+long CALLBACK SIO1__test(void) { return 0; }
+void CALLBACK SIO1__about(void) {}
+void CALLBACK SIO1__pause(void) {}
+void CALLBACK SIO1__resume(void) {}
+long CALLBACK SIO1__keypressed(int key) { return 0; }
+void CALLBACK SIO1__writeData8(unsigned char val) {}
+void CALLBACK SIO1__writeData16(unsigned short val) {}
+void CALLBACK SIO1__writeData32(unsigned long val) {}
+void CALLBACK SIO1__writeStat16(unsigned short val) {}
+void CALLBACK SIO1__writeStat32(unsigned long val) {}
+void CALLBACK SIO1__writeMode16(unsigned short val) {}
+void CALLBACK SIO1__writeMode32(unsigned long val) {}
+void CALLBACK SIO1__writeCtrl16(unsigned short val) {}
+void CALLBACK SIO1__writeCtrl32(unsigned long val) {}
+void CALLBACK SIO1__writeBaud16(unsigned short val) {}
+void CALLBACK SIO1__writeBaud32(unsigned long val) {}
+unsigned char CALLBACK SIO1__readData8(void) { return 0; }
+unsigned short CALLBACK SIO1__readData16(void) { return 0; }
+unsigned long CALLBACK SIO1__readData32(void) { return 0; }
+unsigned short CALLBACK SIO1__readStat16(void) { return 0; }
+unsigned long CALLBACK SIO1__readStat32(void) { return 0; }
+unsigned short CALLBACK SIO1__readMode16(void) { return 0; }
+unsigned long CALLBACK SIO1__readMode32(void) { return 0; }
+unsigned short CALLBACK SIO1__readCtrl16(void) { return 0; }
+unsigned long CALLBACK SIO1__readCtrl32(void) { return 0; }
+unsigned short CALLBACK SIO1__readBaud16(void) { return 0; }
+unsigned long CALLBACK SIO1__readBaud32(void) { return 0; }
+void CALLBACK SIO1__registerCallback(void (CALLBACK *callback)(void)) {};
+
+void CALLBACK SIO1irq(void) {
+ psxHu32ref(0x1070) |= SWAPu32(0x100);
+}
+
+#define LoadSio1Sym1(dest, name) \
+ LoadSym(SIO1_##dest, SIO1##dest, name, TRUE);
+
+#define LoadSio1SymN(dest, name) \
+ LoadSym(SIO1_##dest, SIO1##dest, name, FALSE);
+
+#define LoadSio1Sym0(dest, name) \
+ LoadSym(SIO1_##dest, SIO1##dest, name, FALSE); \
+ if (SIO1_##dest == NULL) SIO1_##dest = (SIO1##dest) SIO1__##dest;
+
+static int LoadSIO1plugin(const char *SIO1dll) {
+ void *drv;
+
+ hSIO1Driver = SysLoadLibrary(SIO1dll);
+ if (hSIO1Driver == NULL) {
+ SysMessage (_("Could not load SIO1 plugin %s!"), SIO1dll); return -1;
+ }
+ drv = hSIO1Driver;
+
+ LoadSio1Sym0(init, "SIO1init");
+ LoadSio1Sym0(shutdown, "SIO1shutdown");
+ LoadSio1Sym0(open, "SIO1open");
+ LoadSio1Sym0(close, "SIO1close");
+ LoadSio1Sym0(pause, "SIO1pause");
+ LoadSio1Sym0(resume, "SIO1resume");
+ LoadSio1Sym0(keypressed, "SIO1keypressed");
+ LoadSio1Sym0(configure, "SIO1configure");
+ LoadSio1Sym0(test, "SIO1test");
+ LoadSio1Sym0(about, "SIO1about");
+ LoadSio1Sym0(writeData8, "SIO1writeData8");
+ LoadSio1Sym0(writeData16, "SIO1writeData16");
+ LoadSio1Sym0(writeData32, "SIO1writeData32");
+ LoadSio1Sym0(writeStat16, "SIO1writeStat16");
+ LoadSio1Sym0(writeStat32, "SIO1writeStat32");
+ LoadSio1Sym0(writeMode16, "SIO1writeMode16");
+ LoadSio1Sym0(writeMode32, "SIO1writeMode32");
+ LoadSio1Sym0(writeCtrl16, "SIO1writeCtrl16");
+ LoadSio1Sym0(writeCtrl32, "SIO1writeCtrl32");
+ LoadSio1Sym0(writeBaud16, "SIO1writeBaud16");
+ LoadSio1Sym0(writeBaud32, "SIO1writeBaud32");
+ LoadSio1Sym0(readData16, "SIO1readData16");
+ LoadSio1Sym0(readData32, "SIO1readData32");
+ LoadSio1Sym0(readStat16, "SIO1readStat16");
+ LoadSio1Sym0(readStat32, "SIO1readStat32");
+ LoadSio1Sym0(readMode16, "SIO1readMode16");
+ LoadSio1Sym0(readMode32, "SIO1readMode32");
+ LoadSio1Sym0(readCtrl16, "SIO1readCtrl16");
+ LoadSio1Sym0(readCtrl32, "SIO1readCtrl32");
+ LoadSio1Sym0(readBaud16, "SIO1readBaud16");
+ LoadSio1Sym0(readBaud32, "SIO1readBaud32");
+ LoadSio1Sym0(registerCallback, "SIO1registerCallback");
+
+ return 0;
+}
+
+#endif
+
+void CALLBACK clearDynarec(void) {
+ psxCpu->Reset();
+}
+
+int LoadPlugins() {
+ int ret;
+ char Plugin[MAXPATHLEN];
+
+ ReleasePlugins();
+ SysLibError();
+
+ if (UsingIso()) {
+ LoadCDRplugin(NULL);
+ } else {
+ sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Cdr);
+ if (LoadCDRplugin(Plugin) == -1) return -1;
+ }
+
+ sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Gpu);
+ if (LoadGPUplugin(Plugin) == -1) return -1;
+
+ sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Spu);
+ if (LoadSPUplugin(Plugin) == -1) return -1;
+
+ sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Pad1);
+ if (LoadPAD1plugin(Plugin) == -1) return -1;
+
+ sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Pad2);
+ if (LoadPAD2plugin(Plugin) == -1) return -1;
+
+ if (strcmp("Disabled", Config.Net) == 0 || strcmp("", Config.Net) == 0)
+ Config.UseNet = FALSE;
+ else {
+ Config.UseNet = TRUE;
+ sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Net);
+ if (LoadNETplugin(Plugin) == -1) Config.UseNet = FALSE;
+ }
+
+#ifdef ENABLE_SIO1API
+ sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Sio1);
+ if (LoadSIO1plugin(Plugin) == -1) return -1;
+#endif
+
+ ret = CDR_init();
+ if (ret < 0) { SysMessage (_("Error initializing CD-ROM plugin: %d"), ret); return -1; }
+ ret = GPU_init();
+ if (ret < 0) { SysMessage (_("Error initializing GPU plugin: %d"), ret); return -1; }
+ ret = SPU_init();
+ if (ret < 0) { SysMessage (_("Error initializing SPU plugin: %d"), ret); return -1; }
+ ret = PAD1_init(1);
+ if (ret < 0) { SysMessage (_("Error initializing Controller 1 plugin: %d"), ret); return -1; }
+ ret = PAD2_init(2);
+ if (ret < 0) { SysMessage (_("Error initializing Controller 2 plugin: %d"), ret); return -1; }
+
+ if (Config.UseNet) {
+ ret = NET_init();
+ if (ret < 0) { SysMessage (_("Error initializing NetPlay plugin: %d"), ret); return -1; }
+ }
+
+#ifdef ENABLE_SIO1API
+ ret = SIO1_init();
+ if (ret < 0) { SysMessage (_("Error initializing SIO1 plugin: %d"), ret); return -1; }
+#endif
+
+ SysPrintf(_("Plugins loaded.\n"));
+ return 0;
+}
+
+void ReleasePlugins() {
+ if (Config.UseNet) {
+ int ret = NET_close();
+ if (ret < 0) Config.UseNet = FALSE;
+ }
+ NetOpened = FALSE;
+
+ if (hCDRDriver != NULL || cdrIsoActive()) CDR_shutdown();
+ if (hGPUDriver != NULL) GPU_shutdown();
+ if (hSPUDriver != NULL) SPU_shutdown();
+ if (hPAD1Driver != NULL) PAD1_shutdown();
+ if (hPAD2Driver != NULL) PAD2_shutdown();
+
+ if (Config.UseNet && hNETDriver != NULL) NET_shutdown();
+
+ if (hCDRDriver != NULL) SysCloseLibrary(hCDRDriver); hCDRDriver = NULL;
+ if (hGPUDriver != NULL) SysCloseLibrary(hGPUDriver); hGPUDriver = NULL;
+ if (hSPUDriver != NULL) SysCloseLibrary(hSPUDriver); hSPUDriver = NULL;
+ if (hPAD1Driver != NULL) SysCloseLibrary(hPAD1Driver); hPAD1Driver = NULL;
+ if (hPAD2Driver != NULL) SysCloseLibrary(hPAD2Driver); hPAD2Driver = NULL;
+
+ if (Config.UseNet && hNETDriver != NULL) {
+ SysCloseLibrary(hNETDriver); hNETDriver = NULL;
+ }
+
+#ifdef ENABLE_SIO1API
+ if (hSIO1Driver != NULL) {
+ SIO1_shutdown();
+ SysCloseLibrary(hSIO1Driver);
+ hSIO1Driver = NULL;
+ }
+#endif
+}
+
+// for CD swap
+int ReloadCdromPlugin()
+{
+ if (hCDRDriver != NULL || cdrIsoActive()) CDR_shutdown();
+ if (hCDRDriver != NULL) SysCloseLibrary(hCDRDriver); hCDRDriver = NULL;
+
+ if (UsingIso()) {
+ LoadCDRplugin(NULL);
+ } else {
+ char Plugin[MAXPATHLEN];
+ sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Cdr);
+ if (LoadCDRplugin(Plugin) == -1) return -1;
+ }
+
+ return CDR_init();
+}
+
+void SetIsoFile(const char *filename) {
+ if (filename == NULL) {
+ IsoFile[0] = '\0';
+ return;
+ }
+ strncpy(IsoFile, filename, MAXPATHLEN);
+}
+
+const char *GetIsoFile(void) {
+ return IsoFile;
+}
+
+boolean UsingIso(void) {
+ return (IsoFile[0] != '\0');
+}
+
+void SetCdOpenCaseTime(s64 time) {
+ cdOpenCaseTime = time;
+}
pc0 = ra;
}
+void psxBios__card_status() { // 5c
+#ifdef PSXBIOS_LOG
+ PSXBIOS_LOG("psxBios_%s: %x\n", biosB0n[0x5c], a0);
+#endif
+
+ v0 = 1;
+ pc0 = ra;
+}
+
/* System calls C0 */
/*
//biosB0[0x59] = psxBios_sys_b0_59;
//biosB0[0x5a] = psxBios_sys_b0_5a;
biosB0[0x5b] = psxBios_ChangeClearPad;
- //biosB0[0x5c] = psxBios__card_status;
+ biosB0[0x5c] = psxBios__card_status;
//biosB0[0x5d] = psxBios__card_wait;
//*******************C0 CALLS****************************
//biosC0[0x00] = psxBios_InitRCnt;
void psxReset() {
psxMemReset();
- memset(&psxRegs, 0, sizeof(psxRegs));
+ memset(&psxRegs, 0x00, sizeof(psxRegs));
psxRegs.pc = 0xbfc00000; // Start in bootstrap
break;
}
}
+ // NegCon - Wipeout 3
+ if( buf[parp] == 0x23 ) {
+ switch (value) {
+ // enter config mode
+ case 0x43:
+ buf[1] = 0x79;
+ break;
+
+ // get status
+ case 0x45:
+ buf[1] = 0xf3;
+ break;
+ }
+ }
}
else padst = 0;
return;
* along with this program; if not, see <http://www.gnu.org/licenses>.
*/
+#ifdef NO_SOCKET
+
+int StartServer() { return 0;}
+void StopServer() {}
+void GetClient() {}
+void CloseClient() {}
+int HasClient() { return 0;}
+int ReadSocket(char * buffer, int len) { return 0;}
+int RawReadSocket(char * buffer, int len) { return 0;}
+void WriteSocket(char * buffer, int len) {}
+
+void SetsBlock() {}
+void SetsNonblock() {}
+
+#else // NO_SOCKET
+
#ifdef _WIN32
#include <winsock2.h>
#endif
fcntl(server_socket, F_SETFL, flags | O_NONBLOCK);
#endif
}
+#endif // NO_SOCKET
+++ /dev/null
-#include <gtk/gtk.h>
-#include <glib.h>
-#include <stdlib.h>
-#include <stdint.h>
-#include <unistd.h>
-#include <hildon/hildon.h>
-#include <string.h>
-#include <pthread.h>
-
-#include "../frontend/plugin_lib.h"
-#include "../frontend/main.h"
-#include "../libpcsxcore/misc.h"
-#include "../include/psemu_plugin_defs.h"
-#include "../libpcsxcore/cdrom.h"
-#include "../libpcsxcore/cdriso.h"
-#include "../plugins/dfinput/main.h"
-#include "../frontend/libpicofe/readpng.h"
-#include "maemo_common.h"
-#include <libosso.h>
-#include <dbus/dbus.h>
-
-#define X_RES 800
-#define Y_RES 480
-#define D_WIDTH 640
-#define D_HEIGHT 480
-
-#define CALL_SIGNAL_IF "com.nokia.csd.Call"
-#define CALL_SIGNAL_PATH "/com/nokia/csd/call"
-#define CALL_INCOMING_SIG "Coming"
-
-#define DBUS_RULE_CALL_INCOMING "type='signal',interface='" CALL_SIGNAL_IF \
- "',path='" CALL_SIGNAL_PATH \
- "',member='" CALL_INCOMING_SIG "'"
-
-osso_context_t* osso = NULL;
-int bRunning = TRUE;
-extern int bKeepDisplayOn;
-extern int bAutosaveOnExit;
-extern int cornerActions[4];
-extern char keys_config_file[MAXPATHLEN];
-static pthread_t display_thread = (pthread_t)0;
-int g_layer_x = (X_RES - D_WIDTH) / 2;
-int g_layer_y = (Y_RES - D_HEIGHT) / 2;
-int g_layer_w = D_WIDTH, g_layer_h = D_HEIGHT;
-
-static GdkImage *image;
-static HildonAnimationActor *actor;
-static GtkWidget *window, *drawing = NULL;
-
-static int pl_buf_w, pl_buf_h;
-int keymap[65536];
-int direction_keys[4];
-
-// map psx4m compatible keymap to PSX keys
-static const unsigned char keymap2[14] = {
- DKEY_LEFT, // 0
- DKEY_RIGHT,
- DKEY_UP,
- DKEY_DOWN,
- DKEY_CIRCLE,
- DKEY_CROSS, // 5
- DKEY_TRIANGLE,
- DKEY_SQUARE,
- DKEY_SELECT,
- DKEY_START,
- DKEY_L1, // 10
- DKEY_R1,
- DKEY_L2,
- DKEY_R2,
-};
-
-void hildon_quit()
-{
- maemo_finish();
- gtk_main_quit();
- exit(0);
-}
-
-gdouble press_x = -1;
-gdouble press_y = -1;
-
-int maemo_x11_update_keys();
-void show_notification(char* text);
-
-void change_slot(int delta)
-{
- state_slot += delta;
- if (state_slot > 9)
- state_slot = 0;
- else if (state_slot < 0)
- state_slot = 9;
- char message[50];
- sprintf(message,"Savestate slot: %i",state_slot + 1);
- show_notification(message);
-}
-
-void save(int state_slot)
-{
- emu_save_state(state_slot);
- char buf[MAXPATHLEN];
- if (image && image->mem){
- sprintf (buf,"/opt/maemo/usr/games/screenshots%s.%3.3d",file_name,state_slot);
- writepng(buf, image->mem, pl_buf_w,pl_buf_h);
- }
- char message[50];
- sprintf(message,"Saved savestate slot: %i",state_slot + 1);
- show_notification(message);
-}
-
-void quit()
-{
- if (bAutosaveOnExit){
- show_notification("Autosaving");
- emu_save_state(99);
- char buf[MAXPATHLEN];
- if (image && image->mem){
- sprintf (buf,"/opt/maemo/usr/games/screenshots%s.%3.3d",file_name,99);
- writepng(buf, image->mem, pl_buf_w,pl_buf_h);
- }
- }
- hildon_quit();
-}
-
-int show_confirmbox(char* text)
-{
- if (!window)
- return TRUE;
-
- GtkWidget *dialog;
- dialog = gtk_message_dialog_new (GTK_WINDOW(window),
- GTK_DIALOG_DESTROY_WITH_PARENT,
- GTK_MESSAGE_QUESTION,
- GTK_BUTTONS_YES_NO,
- text);
- gint result = gtk_dialog_run (GTK_DIALOG (dialog));
- gtk_widget_destroy (dialog);
- if (result == GTK_RESPONSE_YES)
- return TRUE;
- return FALSE;
-}
-
-static void
-window_button_proxy(GtkWidget *widget,
- GdkEventButton *event,
- gpointer user_data)
-{
- int corner = -1;
- int sens = 100;
-
- switch (event->type){
- case GDK_BUTTON_PRESS:
- //printf("GDK_BUTTON_PRESS: x=%f y=%f\n", event->x, event->y);
- press_x = event->x;
- press_y = event->y;
- break;
- case GDK_BUTTON_RELEASE:
- //printf("GDK_BUTTON_RELEASE: x=%f y=%f\n", event->x, event->y);
- if (press_x < sens && press_y < sens && event->x < sens && event->y < sens)
- corner = 0;
- else if (press_x > 800 - sens && press_y < sens && event->x > 800 - sens && event->y < sens)
- corner = 1;
- else if (press_x > 800 - sens && press_y > 480 - sens && event->x > 800 - sens && event->y > 480 - sens)
- corner = 2;
- else if (press_x < sens && press_y > 480 - sens && event->x < sens && event->y > 480 - sens)
- corner = 3;
-
- press_x = -1;
- press_y = -1;
- break;
- default:
- break;
- }
-
- if (corner >= 0){
- switch (cornerActions[corner]){
- case 1:
- if (show_confirmbox("Save savestate?"))
- save(state_slot);
- break;
- case 2:
- if (show_confirmbox("Load savestate?"))
- emu_load_state(state_slot);
- break;
- case 3:
- change_slot(1);
- break;
- case 4:
- change_slot(-1);
- break;
- case 5:
- if (show_confirmbox("Quit?"))
- quit();
- break;
- }
- }
-}
-
-static void *displayThread(void *arg)
-{
- DBusConnection* system_bus = (DBusConnection*)osso_get_sys_dbus_connection(osso);
- DBusMessage* msg = dbus_message_new_method_call("com.nokia.mce",
- "/com/nokia/mce/request",
- "com.nokia.mce.request",
- "req_display_blanking_pause");
- if (msg && system_bus) {
- bRunning = TRUE;
- while (bRunning) {
- dbus_connection_send(system_bus, msg, NULL);
- dbus_connection_flush(system_bus);
- int i = 0;
- for (i=0; i<8; i++){
- usleep(500000);
- if (!bRunning)
- break;
- }
- }
- dbus_message_unref(msg);
- }
-
- pthread_exit(0);
- return NULL;
-}
-
-void show_notification(char* text)
-{
- if (window){
- GtkWidget* banner = hildon_banner_show_information(GTK_WIDGET(window), NULL, text);
- hildon_banner_set_timeout(HILDON_BANNER(banner), 3000);
- }else{
- DBusConnection* session_bus = (DBusConnection*)osso_get_dbus_connection(osso);
- DBusMessageIter args;
- DBusMessage*msg = dbus_message_new_method_call("org.freedesktop.Notifications",
- "/org/freedesktop/Notifications",
- "org.freedesktop.Notifications",
- "SystemNoteInfoprint");
- if (msg) {
- dbus_message_iter_init_append(msg, &args);
- char* param = text;
- if (dbus_message_iter_append_basic(&args, DBUS_TYPE_STRING, ¶m)) {
- dbus_connection_send(session_bus, msg, NULL);
- dbus_connection_flush(session_bus);
- }
- dbus_message_unref(msg);
- }
- }
-}
-
-void show_messagebox(char* text)
-{
- if (!window)
- return;
-
- GtkWidget *dialog;
- dialog = gtk_message_dialog_new (GTK_WINDOW(window),
- GTK_DIALOG_DESTROY_WITH_PARENT,
- GTK_MESSAGE_INFO,
- GTK_BUTTONS_OK,
- text);
- gtk_dialog_run (GTK_DIALOG (dialog));
- gtk_widget_destroy (dialog);
-}
-
-#include <hildon/hildon-file-chooser-dialog.h>
-void change_disc()
-{
- GtkWidget *dialog;
- dialog = hildon_file_chooser_dialog_new (GTK_WINDOW(window), GTK_FILE_CHOOSER_ACTION_OPEN);
- gtk_window_set_title (GTK_WINDOW (dialog), "Change disc");
-
- char currentFile[MAXPATHLEN];
- strcpy(currentFile, GetIsoFile());
- if (strlen(currentFile))
- gtk_file_chooser_set_filename (GTK_FILE_CHOOSER(dialog), currentFile);
- else
- gtk_file_chooser_set_current_folder (GTK_FILE_CHOOSER(dialog), "/home/user/MyDocs/");
-
- GtkFileFilter *filter=gtk_file_filter_new();
- gtk_file_filter_add_pattern (filter,"*.bin");
- gtk_file_filter_add_pattern (filter,"*.BIN");
- gtk_file_filter_add_pattern (filter,"*.iso");
- gtk_file_filter_add_pattern (filter,"*.ISO");
- gtk_file_filter_add_pattern (filter,"*.img");
- gtk_file_filter_add_pattern (filter,"*.IMG");
- gtk_file_filter_add_pattern (filter,"*.z");
- gtk_file_filter_add_pattern (filter,"*.Z");
- gtk_file_filter_add_pattern (filter,"*.znx");
- gtk_file_filter_add_pattern (filter,"*.ZNX");
- gtk_file_filter_add_pattern (filter,"*.pbp");
- gtk_file_filter_add_pattern (filter,"*.PBP");
- gtk_file_filter_add_pattern (filter,"*.mdf");
- gtk_file_filter_add_pattern (filter,"*.MDF");
- gtk_file_chooser_set_filter (GTK_FILE_CHOOSER (dialog),filter);
-
- if (gtk_dialog_run (GTK_DIALOG (dialog)) == GTK_RESPONSE_OK) {
- char *filename = gtk_file_chooser_get_filename (GTK_FILE_CHOOSER (dialog));
-
- //if (strcmp(filename, currentFile)) {
- CdromId[0] = '\0';
- CdromLabel[0] = '\0';
-
- set_cd_image(filename);
- if (ReloadCdromPlugin() < 0)
- printf("Failed to load cdr plugin\n");
-
- if (CDR_open() < 0)
- printf("Failed to open cdr plugin\n");
-
- strcpy(file_name, strrchr(filename,'/'));
-
- SetCdOpenCaseTime(time(NULL) + 3);
- LidInterrupt();
- //}
- g_free (filename);
- }
-
- gtk_widget_destroy (dialog);
-}
-
-void change_multi_disc()
-{
- HildonDialog* window = HILDON_DIALOG(hildon_dialog_new());
- gtk_window_set_title (GTK_WINDOW (window), "Change disc");
- gtk_window_set_default_size(GTK_WINDOW (window), 480, 300);
-
- GtkWidget* sw = hildon_pannable_area_new ();
- gtk_box_pack_start (GTK_BOX(GTK_DIALOG(window)->vbox), sw, TRUE, TRUE, 0);
-
- GtkWidget* tree_view = hildon_gtk_tree_view_new (HILDON_UI_MODE_EDIT);
- gtk_widget_set_name (tree_view, "fremantle-widget");
-
- gtk_tree_view_set_rules_hint (GTK_TREE_VIEW (tree_view), TRUE);
-
- int i;
- GtkListStore *store = gtk_list_store_new (1, G_TYPE_STRING);
- for (i = 0; i < cdrIsoMultidiskCount; i++) {
- gchar *str;
-
- str = g_strdup_printf ("Disc %d", i+1);
- gtk_list_store_insert_with_values (store, NULL, i, 0, str, -1);
- g_free (str);
- }
- GtkTreeModel* model = GTK_TREE_MODEL (store);
-
- gtk_tree_view_set_model (GTK_TREE_VIEW (tree_view), model);
- g_object_unref (model);
-
- GtkTreeSelection* selection = gtk_tree_view_get_selection (GTK_TREE_VIEW (tree_view));
- gtk_tree_selection_set_mode (selection, GTK_SELECTION_SINGLE);
-
- GtkCellRenderer* renderer = gtk_cell_renderer_text_new ();
- g_object_set (renderer,
- "xalign", 0.5,
- "weight", PANGO_WEIGHT_NORMAL,
- NULL);
-
- gtk_tree_view_insert_column_with_attributes (GTK_TREE_VIEW (tree_view),
- 0, "Column 0",
- renderer,
- "text", 0,
- NULL);
-
- char current[5];
- sprintf(current, "%i", cdrIsoMultidiskSelect);
- GtkTreePath* path = gtk_tree_path_new_from_string(current);
- gtk_tree_selection_select_path (selection, path);
- gtk_tree_path_free(path);
-
- gtk_widget_set_size_request (tree_view, 480, 800);
- gtk_container_add (GTK_CONTAINER (sw), tree_view);
-
- hildon_dialog_add_button (HILDON_DIALOG(window), GTK_STOCK_OK, GTK_RESPONSE_ACCEPT);
-
- gtk_widget_show_all (GTK_WIDGET(window));
- gint result = gtk_dialog_run (GTK_DIALOG (window));
- if (result == GTK_RESPONSE_ACCEPT) {
- GtkTreeModel* model;
- GtkTreeIter iter;
- GtkTreeSelection* selection = gtk_tree_view_get_selection(GTK_TREE_VIEW(tree_view));
- if (gtk_tree_selection_get_selected(selection, &model, &iter)){
- GtkTreePath* path = gtk_tree_model_get_path(model , &iter);
- int* i = gtk_tree_path_get_indices(path) ;
-
- cdrIsoMultidiskSelect = *i;
- CdromId[0] = '\0';
- CdromLabel[0] = '\0';
-
- CDR_close();
- if (CDR_open() < 0) {
- printf("Failed to load cdr plugin\n");
- return;
- }
-
- SetCdOpenCaseTime(time(NULL) + 3);
- LidInterrupt();
- }
- }
- gtk_widget_destroy(GTK_WIDGET(window));
-}
-
-static DBusHandlerResult on_msg_recieved(DBusConnection* connection G_GNUC_UNUSED, DBusMessage* message, void* data)
-{
- const char* path = dbus_message_get_path(message);
- if (path && g_str_equal(path, CALL_SIGNAL_PATH)){
- const char* mbr = dbus_message_get_member(message);
- if (mbr && g_str_equal(mbr, CALL_INCOMING_SIG))
- show_messagebox("Paused");
- }
-
- return DBUS_HANDLER_RESULT_NOT_YET_HANDLED;
-}
-
-static void
-window_key_proxy(GtkWidget *widget,
- GdkEventKey *event,
- gpointer user_data)
-{
- key_press_event(event->hardware_keycode, event->type == GDK_KEY_PRESS ? 1 : (event->type == GDK_KEY_RELEASE ? 2 : 0) );
-}
-
-int last_key_pressed = 0;
-inline void key_press_event(int key2,int type)
-{
- int psxkey1 = -1, psxkey2 = -1;
- int key=keymap[key2];
-
- if (key < 0)
- return;
-
- if (type == 1 && key2 == last_key_pressed)
- return;
- last_key_pressed = type == 1 ? key2 : 0;
-
- //printf("Key: %i %s\n", key2, type == 1 ? "Pressed" : (type == 2 ? "Released" : "Unknown"));
- if (key < ARRAY_SIZE(keymap2)){
- psxkey1 = keymap2[key];
- }else switch (key) {
- case 14:
- quit();
- break;
- case 15:
- psxkey1 = DKEY_UP;
- psxkey2 = DKEY_LEFT;
- break;
- case 16:
- psxkey1 = DKEY_UP;
- psxkey2 = DKEY_RIGHT;
- break;
- case 17:
- psxkey1 = DKEY_DOWN;
- psxkey2 = DKEY_LEFT;
- break;
- case 18:
- psxkey1 = DKEY_DOWN;
- psxkey2 = DKEY_RIGHT;
- break;
- case 19:
- if (type == 1)
- save(state_slot);
- return;
- case 20:
- if (type == 1)
- emu_load_state(state_slot);
- return;
- case 21:
- if (type == 1)
- change_slot(1);
- return;
- case 22:
- if (type == 1)
- change_slot(-1);
- return;
- case 23:
- if (type == 1){
- if (cdrIsoMultidiskCount > 1)
- change_multi_disc();
- else
- change_disc();
- }
- return;
- }
-
- if (in_type1 == PSE_PAD_TYPE_GUNCON){
- if (type == 1) {
- switch (psxkey1){
- case DKEY_CROSS:
- in_state_gun |= SACTION_GUN_A;
- break;
- case DKEY_CIRCLE:
- in_state_gun |= SACTION_GUN_B;
- break;
- case DKEY_TRIANGLE:
- in_state_gun |= SACTION_GUN_TRIGGER2;
- break;
- case DKEY_SQUARE:
- in_state_gun |= SACTION_GUN_TRIGGER;
- break;
- }
- }else if (type == 2) {
- switch (psxkey1){
- case DKEY_CROSS:
- in_state_gun &= ~SACTION_GUN_A;
- break;
- case DKEY_CIRCLE:
- in_state_gun &= ~SACTION_GUN_B;
- break;
- case DKEY_TRIANGLE:
- in_state_gun &= ~SACTION_GUN_TRIGGER2;
- break;
- case DKEY_SQUARE:
- in_state_gun &= ~SACTION_GUN_TRIGGER;
- break;
- }
- }
- }else{
- if (type == 1) {
- if (psxkey1 >= 0)
- in_keystate |= 1 << psxkey1;
- if (psxkey2 >= 0)
- in_keystate |= 1 << psxkey2;
-
- if (in_type1 == PSE_PAD_TYPE_ANALOGPAD){
- switch(psxkey1){
- case DKEY_LEFT:
- in_a1[0] = 0;
- break;
- case DKEY_RIGHT:
- in_a1[0] = 255;
- break;
- case DKEY_UP:
- in_a1[1] = 0;
- break;
- case DKEY_DOWN:
- in_a1[1] = 255;
- break;
- }
- }
- }
- else if (type == 2) {
- if (psxkey1 >= 0)
- in_keystate &= ~(1 << psxkey1);
- if (psxkey2 >= 0)
- in_keystate &= ~(1 << psxkey2);
-
- if (in_type1 == PSE_PAD_TYPE_ANALOGPAD){
- switch(psxkey1){
- case DKEY_LEFT:
- case DKEY_RIGHT:
- in_a1[0] = 127;
- break;
- case DKEY_UP:
- case DKEY_DOWN:
- in_a1[1] = 127;
- break;
- }
- }
- emu_set_action(SACTION_NONE);
- }
- }
-}
-
-void plat_finish()
-{
- hildon_quit();
-}
-
-void set_accel_multipliers()
-{
- accelOptions.xMultiplier = 255.0 / ( (accelOptions.maxValue - accelOptions.sens) * 2.0);
- accelOptions.yMultiplier = 255.0 / ( (accelOptions.maxValue - accelOptions.sens) * 2.0);
-}
-
-#include <gdk/gdkx.h>
-int maemo_init(int *argc, char ***argv)
-{
- osso = osso_initialize("pcsxrearmed", PACKAGE_VERSION, FALSE, NULL);
-
- DBusConnection* system_bus = (DBusConnection*)osso_get_sys_dbus_connection(osso);
- dbus_bus_add_match(system_bus, DBUS_RULE_CALL_INCOMING, NULL);
- dbus_connection_add_filter(system_bus, on_msg_recieved, NULL, NULL);
-
- FILE* pFile;
- pFile = fopen(keys_config_file, "r");
- if (pFile == NULL){
- fprintf(stderr, "Error opening keys config file %s\n", keys_config_file);
- return 1;
- }
- printf("Keys config read from %s\n", keys_config_file);
-
- int ch;
- int i=0;
- for (i=0;i<65536;i++)
- keymap[i]=-1;
- if (NULL != pFile) {
- for(i=0;i<24;i++){
- fscanf(pFile, "%i",&ch);
- keymap[ch]=i;
- if (i < 4)
- direction_keys[i] = ch;
- }
- fclose(pFile);
- }
-
- switch (in_type1){
- case PSE_PAD_TYPE_GUNCON:
- memset(cornerActions, 0, sizeof(cornerActions));
- printf("Controller set to GUNCON (SLPH-00034)\n");
- break;
- case PSE_PAD_TYPE_STANDARD:
- printf("Controller set to standard (SCPH-1080)\n");
- break;
- case PSE_PAD_TYPE_ANALOGPAD:
- printf("Controller set to analog (SCPH-1150)\n");
- break;
- }
-
- if (in_enable_vibration)
- printf("Vibration enabled\n");
-
- if (!(g_maemo_opts&8)){
- gtk_init (argc, argv);
-
- window = hildon_stackable_window_new ();
- gtk_widget_realize (window);
- gtk_window_fullscreen (GTK_WINDOW(window));
-
- if (cornerActions[0] + cornerActions[1] + cornerActions[2] + cornerActions[3] > 0){
- g_signal_connect (G_OBJECT (window), "button_release_event",
- G_CALLBACK (window_button_proxy), NULL);
- g_signal_connect (G_OBJECT (window), "button_press_event",
- G_CALLBACK (window_button_proxy), NULL);
- }
-
- g_signal_connect (G_OBJECT (window), "key-press-event",
- G_CALLBACK (window_key_proxy), NULL);
- g_signal_connect (G_OBJECT (window), "key-release-event",
- G_CALLBACK (window_key_proxy), NULL);
- g_signal_connect (G_OBJECT (window), "delete_event",
- G_CALLBACK (hildon_quit), NULL);
- gtk_widget_add_events (window,
- GDK_BUTTON_PRESS_MASK | GDK_BUTTON_RELEASE_MASK);
-
- actor = HILDON_ANIMATION_ACTOR (hildon_animation_actor_new());
- if (g_maemo_opts & 2)
- hildon_animation_actor_set_position (actor, 0, 0 );
- else
- hildon_animation_actor_set_position (actor, (X_RES - D_WIDTH)/2, (Y_RES - D_HEIGHT)/2 );
- hildon_animation_actor_set_parent (actor, GTK_WINDOW (window));
-
- drawing = gtk_image_new ();
-
- gtk_container_add (GTK_CONTAINER (actor), drawing);
-
- gtk_widget_show_all (GTK_WIDGET (actor));
- gtk_widget_show_all (GTK_WIDGET (window));
- }else{
- gtk_init (argc, argv);
- /*GdkScreen* scr = gdk_screen_get_default();
- window = GTK_WIDGET(gdk_screen_get_root_window(scr));
- if (!window)
- window = GTK_WIDGET(gdk_get_default_root_window());*/
- }
-
- set_accel_multipliers();
-
- if (bKeepDisplayOn){
- if (pthread_create(&display_thread, NULL, displayThread, NULL))
- printf("Failed to create display thread.\n");
- }
-
- pl_rearmed_cbs.only_16bpp = 1;
- return 0;
-}
-
-void maemo_finish()
-{
- if (display_thread > 0){
- bRunning = FALSE;
- pthread_join(display_thread, NULL);
- }
-
- if (osso){
- osso_deinitialize(osso);
- osso = NULL;
- }
- printf("Exiting\n");
-}
-
-void menu_loop(void)
-{
-}
-
-void *plat_gvideo_set_mode(int *w_, int *h_, int *bpp_)
-{
- int w = *w_, h = *h_;
-
- if (g_maemo_opts&8) return pl_vout_buf;
- //printf("Setting video mode %ix%i\n", w, h);
-
- if (w <= 0 || h <= 0)
- return pl_vout_buf;
-
- if (image) gdk_image_destroy(image);
- image = gdk_image_new( GDK_IMAGE_FASTEST, gdk_visual_get_system(), w, h );
-
- pl_vout_buf = (void *) image->mem;
-
- gtk_image_set_from_image (GTK_IMAGE(drawing), image, NULL);
-
- gtk_window_resize (GTK_WINDOW (actor), w, h);
- if (g_maemo_opts & 2)
- hildon_animation_actor_set_scale (actor,
- (gdouble)800 / (gdouble)w,
- (gdouble)480 / (gdouble)h
- );
- else
- hildon_animation_actor_set_scale (actor,
- (gdouble)D_WIDTH / (gdouble)w,
- (gdouble)D_HEIGHT / (gdouble)h
- );
- pl_buf_w=w;pl_buf_h=h;
- return pl_vout_buf;
-}
-
-void *plat_gvideo_flip(void)
-{
- if (!(g_maemo_opts&8))
- gtk_widget_queue_draw(drawing);
-
- // process accelometer
- if (g_maemo_opts & 4) {
- float x, y, z;
- FILE* f = fopen( "/sys/class/i2c-adapter/i2c-3/3-001d/coord", "r" );
- if( !f ) {printf ("err in accel"); exit(1);}
- fscanf( f, "%f %f %f", &x, &y, &z );
- fclose( f );
-
- if (in_type1 == PSE_PAD_TYPE_ANALOGPAD){
- if (x > accelOptions.maxValue) x = accelOptions.maxValue;
- else if (x < -accelOptions.maxValue) x = -accelOptions.maxValue;
-
- const int maxValue = accelOptions.maxValue - accelOptions.sens;
- if(x > accelOptions.sens){
- x -= accelOptions.sens;
- in_a1[0] = (-x + maxValue ) * accelOptions.xMultiplier;
- }else if (x < -accelOptions.sens){
- x += accelOptions.sens;
- in_a1[0] = (-x + maxValue ) * accelOptions.xMultiplier;
- }else in_a1[0] = 127;
-
- y += accelOptions.y_def;
- if (y > accelOptions.maxValue) y = accelOptions.maxValue;
- else if (y < -accelOptions.maxValue) y = -accelOptions.maxValue;
-
- if(y > accelOptions.sens){
- y -= accelOptions.sens;
- in_a1[1] = (-y + maxValue ) * accelOptions.yMultiplier;
- }else if (y < -accelOptions.sens){
- y += accelOptions.sens;
- in_a1[1] = (-y + maxValue ) * accelOptions.yMultiplier;
- }else in_a1[1] = 127;
-
- //printf("x: %i y: %i\n", in_a1[0], in_a1[1]);
- }else{
- if( x > accelOptions.sens ) in_keystate |= 1 << DKEY_LEFT;
- else if( x < -accelOptions.sens ) in_keystate |= 1 << DKEY_RIGHT;
- else {in_keystate &= ~(1 << DKEY_LEFT);in_keystate &= ~(1 << DKEY_RIGHT);}
-
- y += accelOptions.y_def;
- if( y > accelOptions.sens )in_keystate |= 1 << DKEY_UP;
- else if( y < -accelOptions.sens ) in_keystate |= 1 << DKEY_DOWN;
- else {in_keystate &= ~(1 << DKEY_DOWN);in_keystate &= ~(1 << DKEY_UP);}
- }
- }
-
- return pl_vout_buf;
-}
-
-// for frontend/plugin_lib.c
-void update_input(void)
-{
- if (g_maemo_opts & 8)
- maemo_x11_update_keys();
- else {
- /* process GTK+ events */
- while (gtk_events_pending())
- gtk_main_iteration();
- }
-}
-
-int omap_enable_layer(int enabled)
-{
- return 0;
-}
-
-void menu_notify_mode_change(int w, int h, int bpp)
-{
-}
-
-void *plat_prepare_screenshot(int *w, int *h, int *bpp)
-{
- return NULL;
-}
-
-void plat_step_volume(int is_up)
-{
-}
-
-void plat_trigger_vibrate(int pad, int low, int high)
-{
- const int vDuration = 10;
-
- DBusConnection* system_bus = (DBusConnection*)osso_get_sys_dbus_connection(osso);
- DBusMessageIter args;
- DBusMessage*msg = dbus_message_new_method_call("com.nokia.mce",
- "/com/nokia/mce/request",
- "com.nokia.mce.request",
- "req_start_manual_vibration");
- if (msg) {
- dbus_message_iter_init_append(msg, &args);
- // FIXME: somebody with hardware should tune this
- int speed = high; // is_strong ? 200 : 150;
- int duration = vDuration;
- if (dbus_message_iter_append_basic(&args, DBUS_TYPE_INT32, &speed)) {
- if (dbus_message_iter_append_basic(&args, DBUS_TYPE_INT32, &duration)) {
- dbus_connection_send(system_bus, msg, NULL);
- //dbus_connection_flush(system_bus);
- }
- }
- dbus_message_unref(msg);
- }
-}
-
-void plat_minimize(void)
-{
-}
-
-void plat_gvideo_close(void)
-{
-}
-
-void plat_gvideo_open(int is_pal)
-{
-}
+++ /dev/null
-int maemo_init(int *argc, char ***argv);
-void maemo_finish();
-
-extern char file_name[MAXPATHLEN];
-extern int g_maemo_opts;
-
-extern inline void key_press_event(int key,int type);
-
-typedef struct
-{
- int sens;
- int y_def;
- float maxValue;
- float xMultiplier;
- float yMultiplier;
-} accel_option;
-
-extern accel_option accelOptions;
+++ /dev/null
-/*
- * Copyright (c) 2009, Wei Mingzhi <whistler@openoffice.org>.
- * All Rights Reserved.
- *
- * This program is free software; you can redistribute it and/or modify
- * it under the terms of the GNU General Public License as published by
- * the Free Software Foundation; either version 2 of the License, or
- * (at your option) any later version.
- *
- * This program is distributed in the hope that it will be useful,
- * but WITHOUT ANY WARRANTY; without even the implied warranty of
- * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
- * GNU General Public License for more details.
- *
- * You should have received a copy of the GNU General Public License
- * along with this program; if not, see <http://www.gnu.org/licenses>.
- */
-
-#include <stdio.h>
-#include <stdlib.h>
-#include <stdint.h>
-#include <X11/Xlib.h>
-#include <X11/Xutil.h>
-#include <X11/keysym.h>
-#include <X11/XKBlib.h>
-
-#include "../frontend/main.h"
-#include "../frontend/plugin_lib.h"
-
-static Atom wmprotocols, wmdelwindow;
-static int initialized;
-
-
-
-static void InitKeyboard(void) {
- Display *disp = (Display *)gpuDisp;
- if (disp){
- wmprotocols = XInternAtom(disp, "WM_PROTOCOLS", 0);
- wmdelwindow = XInternAtom(disp, "WM_DELETE_WINDOW", 0);
- XkbSetDetectableAutoRepeat(disp, 1, NULL);
- }
-}
-
-static void DestroyKeyboard(void) {
- Display *disp = (Display *)gpuDisp;
- if (disp)
- XkbSetDetectableAutoRepeat(disp, 0, NULL);
-}
-#include "maemo_common.h"
-
-int maemo_x11_update_keys() {
-
- XEvent evt;
- XClientMessageEvent *xce;
- int leave = 0;
- Display *disp = (Display *)gpuDisp;
-
- if (!disp)
- return 0;
-
- if (!initialized) {
- initialized++;
- InitKeyboard();
- }
-
- while (XPending(disp)>0) {
- XNextEvent(disp, &evt);
- switch (evt.type) {
- case KeyPress:
- case KeyRelease:
- key_press_event(evt.xkey.keycode, evt.type==KeyPress ? 1 : (evt.type==KeyRelease ? 2 : 0) );
- break;
-
- case ClientMessage:
- xce = (XClientMessageEvent *)&evt;
- if (xce->message_type == wmprotocols && (Atom)xce->data.l[0] == wmdelwindow)
- leave = 1;
- break;
- }
- }
-
- if (leave) {
- DestroyKeyboard();
- exit(1);
- }
-
- return 0;
-}
+++ /dev/null
-/*
- * (C) notaz, 2010-2011
- *
- * This work is licensed under the terms of the GNU GPLv2 or later.
- * See the COPYING file in the top-level directory.
- */
-
-#include <stdio.h>
-#include <string.h>
-#include <stdint.h>
-#include <unistd.h>
-
-#include "../frontend/main.h"
-#include "../frontend/menu.h"
-#include "../frontend/plugin.h"
-#include "../frontend/plugin_lib.h"
-#include "../libpcsxcore/misc.h"
-#include "../libpcsxcore/cdriso.h"
-#include "../libpcsxcore/new_dynarec/new_dynarec.h"
-#include "../plugins/dfinput/main.h"
-#include "../plugins/dfsound/spu_config.h"
-#include "maemo_common.h"
-
-extern int in_enable_vibration;
-extern int cycle_multiplier;
-extern int in_type1, in_type2;
-
-accel_option accelOptions;
-int ready_to_go, g_emu_want_quit, g_emu_resetting;
-int g_menuscreen_w, g_menuscreen_h;
-int g_scaler, soft_filter;
-int g_opts = 0;
-int g_maemo_opts;
-int cornerActions[4] = {0,0,0,0};
-int bKeepDisplayOn = FALSE;
-int bAutosaveOnExit = FALSE;
-char file_name[MAXPATHLEN];
-char keys_config_file[MAXPATHLEN] = "/opt/psx4m/keys";
-
-enum sched_action emu_action;
-void do_emu_action(void);
-
-static void ChangeWorkingDirectory(char *exe)
-{
- char exepath[1024];
- char *s;
- snprintf(exepath, sizeof(exepath), "%s", exe);
- s = strrchr(exepath, '/');
- if (s != NULL) {
- *s = '\0';
- chdir(exepath);
- }
-}
-
-void PrintHelp()
-{
- printf("PCSX-ReARMed version %s for Maemo\n\n", PACKAGE_VERSION);
-
- printf("Usage:\n");
- printf(" pcsx [options] -cdfile FILE\n\n");
-
- printf("Options:\n");
- printf(" -help : This help\n");
- printf(" -disc VALUE : Disc number for multi discs images\n");
- printf(" -fullscreen : Run fullscreen\n");
- printf(" -frameskip : Frameskip\n");
- printf(" -1=Auto (Default)\n");
- printf(" 0=Disabled\n");
- printf(" 1=Set to 1\n");
- printf(" ...\n");
- printf(" -autosave : Enable auto save on exit\n");
- printf(" -accel : Enable accelerometer\n");
- printf(" -analog : Use analog pad for accel\n");
- printf(" -vibration : Activate vibration\n");
- printf(" -sens VALUE : Set accelerometer sens [0-1000]\n");
- printf(" (Default 150)\n");
- printf(" -ydef VALUE : Set accelerometer y zero [0-1000]\n");
- printf(" (Default 500)\n");
- printf(" -max VALUE : Set accelerometer max value[0-1000]\n");
- printf(" (Default 500)\n");
- printf(" -nosound : No sound output\n");
- printf(" -bdir PATH : Set the bios path\n");
- printf(" -pdir PATH : Set the plugins path\n");
- printf(" -bios : Set the bios\n");
- printf(" -cdda : Disable CD Audio for a performance boost\n");
- printf(" -xa : Disables XA sound, which can sometimes\n");
- printf(" improve performance\n");
- printf(" -sio : SIO IRQ Always Enabled\n");
- printf(" -spuirq : SPU IRQ Always Enabled\n");
- printf(" -fps : Show fps\n");
- printf(" -cpu : Show CPU load\n");
- printf(" -spu : Show SPU channels\n");
- printf(" -nofl : Disable Frame Limiter\n");
- printf(" -mcd1 FILE : Set memory card 1 file\n");
- printf(" -mcd2 FILE : Set memory card 2 file\n");
- printf(" -region VALUE : Set PSX region\n");
- printf(" -1=Auto (Default)\n");
- printf(" 0=NTSC\n");
- printf(" 1=PAL\n");
- printf(" -cpuclock VALUE: PSX CPU clock %% [1-500]\n");
- printf(" (Default 50)\n");
- printf(" -displayon : Prevent display from blanking\n");
- printf(" (Default disabled)\n");
- printf(" -keys FILE : File with keys configuration\n");
- printf(" (Default /opt/psx4m/keys)\n");
- printf(" -corners VALUE : Define actions for click on the\n");
- printf(" display corners\n");
- printf(" VALUE is a four digit number, each number\n");
- printf(" represent a corner (topleft, topright,\n");
- printf(" bottomright and bottomleft\n");
- printf(" Actions:\n");
- printf(" 0=No action\n");
- printf(" 1=Save\n");
- printf(" 2=Load\n");
- printf(" 3=Change slot (+1)\n");
- printf(" 4=Change slot (-1)\n");
- printf(" 5=Quit\n");
- printf(" -guncon : Set the controller to guncon\n");
- printf(" -gunnotrigger : Don't trigger (shoot) when touching screen\n");
- printf(" 0=Auto (Default)\n");
- printf(" 1=On\n");
- printf(" 2=Off\n");
-
-
- printf("\nGPU Options:\n");
- printf(" -gles : Use the GLES plugin (gpu_gles.so)\n");
- printf(" -oldgpu : Use the peops plugin (gpu_peops.so)\n");
- printf(" -unai : Use the unai plugin (gpu_unai.so)\n");
-
- printf("\nSound Options:\n");
- printf(" -spu_reverb VALUE : Enable/disable reverb [0/1]\n");
- printf(" (Default disabled)\n");
- printf(" -spu_interpolation VALUE : Set interpolation mode\n");
- printf(" 0=None (Default)\n");
- printf(" 1=Simple\n");
- printf(" 2=Gaussian\n");
- printf(" 3=Cubic\n");
-
- printf("\nNeon Options (default GPU):\n");
- printf(" -enhance : Enable graphic enhancement\n");
-
- printf("\nGles Options:\n");
- printf(" -gles_dithering VALUE : Enable/disable dithering [0/1]\n");
- printf(" (Default disabled)\n");
- printf(" -gles_mask VALUE : Enable/disable mask detect [0/1]\n");
- printf(" (Default disabled)\n");
- printf(" -gles_filtering VALUE : Texture Filtering\n");
- printf(" 0=None (Default)\n");
- printf(" 1=Standard\n");
- printf(" 2=Extended\n");
- printf(" 3=Standard-sprites\n");
- printf(" 4=Extended-sprites\n");
- printf(" 5=Standard+sprites\n");
- printf(" 6=Extended+sprites\n");
- printf(" -gles_fbtex VALUE : Framebuffer Textures\n");
- printf(" 0=Emulated VRam (Default)\n");
- printf(" 1=Black\n");
- printf(" 2=Card\n");
- printf(" 3=Card+soft\n");
- printf(" -gles_vram VALUE : Texture RAM size in MB [4-128]\n");
- printf(" (Default 64)\n");
- printf(" -gles_fastmdec VALUE : Enable/disable Fast Mdec [0/1]\n");
- printf(" (Default disabled)\n");
- printf(" -gles_advblend VALUE : Enable/disable Adv. Blend [0/1]\n");
- printf(" (Default disabled)\n");
- printf(" -gles_opaque VALUE : Enable/disable Opaque Pass [0/1]\n");
- printf(" (Default disabled)\n");
-}
-
-int main(int argc, char **argv)
-{
- if (argc == 1 || (argc == 2 && (!strcmp(argv[1], "--help") || !strcmp(argv[1], "-help") || !strcmp(argv[1], "-h")))) {
- PrintHelp();
- return 0;
- }
-
- emu_core_preinit();
- ChangeWorkingDirectory("c");
- char file[MAXPATHLEN] = "";
- char path[MAXPATHLEN];
- const char *cdfile = NULL;
- int loadst = 0;
- int i;
- int getst = -1;
- int discNumber = 0;
-
- g_menuscreen_w = 800;
- g_menuscreen_h = 480;
-
- strcpy(Config.Gpu, "builtin_gpu");
- strcpy(Config.Spu, "builtin_spu");
- strcpy(Config.BiosDir, "/home/user/MyDocs");
- strcpy(Config.PluginsDir, "/opt/maemo/usr/games/plugins");
- snprintf(Config.PatchesDir, sizeof(Config.PatchesDir), "/opt/maemo/usr/games" PATCHES_DIR);
- Config.PsxAuto = 1;
- pl_rearmed_cbs.frameskip = -1;
- strcpy(Config.Bios, "HLE");
- spu_config.iUseReverb = 1;
- spu_config.iUseInterpolation = 1;
-
- in_type1 = PSE_PAD_TYPE_STANDARD;
- in_type2 = PSE_PAD_TYPE_STANDARD;
-
- accelOptions.sens = 150;
- accelOptions.y_def = 500;
- accelOptions.maxValue = 500.0;
-
- // read command line options
- for (i = 1; i < argc; i++) {
- if (!strcmp(argv[i], "-psxout")) Config.PsxOut = 1;
- else if (!strcmp(argv[i], "-load")) loadst = atol(argv[++i]);
- else if (!strcmp(argv[i], "-cdfile")) {
- char isofilename[MAXPATHLEN];
- if (i+1 >= argc) break;
- strncpy(isofilename, argv[++i], MAXPATHLEN);
- if (isofilename[0] != '/') {
- getcwd(path, MAXPATHLEN);
- if (strlen(path) + strlen(isofilename) + 1 < MAXPATHLEN) {
- strcat(path, "/");
- strcat(path, isofilename);
- strcpy(isofilename, path);
- } else
- isofilename[0] = 0;
- }
- cdfile = isofilename;
- }
- else if (!strcmp(argv[i],"-frameskip")) {
- int tv_reg = atol(argv[++i]);
- if (tv_reg < -1)
- pl_rearmed_cbs.frameskip = -1;
- else
- pl_rearmed_cbs.frameskip = tv_reg;
- }
- else if (!strcmp(argv[i],"-region")) {
- int psx_reg = atol(argv[++i]);
- if (psx_reg == 0 || psx_reg == 1){
- Config.PsxAuto = 0;
- Config.PsxType = psx_reg;
- }
- }
-
- else if (!strcmp(argv[i],"-get_sstatename")) getst = atol(argv[++i]);
-
- else if (!strcmp(argv[i], "-fullscreen")) g_maemo_opts |= 2;
- else if (!strcmp(argv[i], "-accel")) g_maemo_opts |= 4;
- else if (!strcmp(argv[i], "-nosound")) strcpy(Config.Spu, "spunull.so");
- else if (!strcmp(argv[i], "-bdir")) sprintf(Config.BiosDir, "%s", argv[++i]);
- else if (!strcmp(argv[i], "-pdir")) sprintf(Config.PluginsDir, "%s", argv[++i]);
- else if (!strcmp(argv[i], "-bios")) sprintf(Config.Bios, "%s", argv[++i]);
- else if (!strcmp(argv[i], "-gles")) { strcpy(Config.Gpu, "gpu_gles.so"); g_maemo_opts |= 8 ;}
- else if (!strcmp(argv[i], "-oldgpu")) strcpy(Config.Gpu, "gpu_peops.so");
- else if (!strcmp(argv[i], "-unai")) strcpy(Config.Gpu, "gpu_unai.so");
- else if (!strcmp(argv[i], "-cdda")) Config.Cdda = 1;
- else if (!strcmp(argv[i], "-xa")) Config.Xa = 1;
- else if (!strcmp(argv[i], "-rcnt")) Config.RCntFix = 1 ;
- else if (!strcmp(argv[i], "-sio")) Config.Sio = 1;
- else if (!strcmp(argv[i], "-spuirq")) Config.SpuIrq = 1;
- else if (!strcmp(argv[i], "-vsync")) Config.VSyncWA = 1;
- else if (!strcmp(argv[i], "-fps")) g_opts |=OPT_SHOWFPS;
- else if (!strcmp(argv[i], "-cpu")) g_opts |=OPT_SHOWCPU;
- else if (!strcmp(argv[i], "-spu")) g_opts |=OPT_SHOWSPU;
- else if (!strcmp(argv[i], "-nofl")) g_opts |=OPT_NO_FRAMELIM;
- else if (!strcmp(argv[i], "-mcd1")) sprintf(Config.Mcd1, "%s", argv[++i]);
- else if (!strcmp(argv[i], "-mcd2")) sprintf(Config.Mcd2, "%s", argv[++i]);
-
- else if (!strcmp(argv[i], "-cpuclock")) cycle_multiplier = 10000 / atol(argv[++i]);
- else if (!strcmp(argv[i], "-guncon")) in_type1 = PSE_PAD_TYPE_GUNCON;
- else if (!strcmp(argv[i], "-gunnotrigger")) g_opts |= OPT_TSGUN_NOTRIGGER;
- else if (!strcmp(argv[i], "-analog")) in_type1 = PSE_PAD_TYPE_ANALOGPAD;
- else if (!strcmp(argv[i], "-vibration")) { in_type1 = PSE_PAD_TYPE_ANALOGPAD; in_enable_vibration = 1; }
- else if (!strcmp(argv[i], "-sens")) accelOptions.sens = atol(argv[++i]);
- else if (!strcmp(argv[i], "-ydef")) accelOptions.y_def = atol(argv[++i]);
- else if (!strcmp(argv[i], "-max")) accelOptions.maxValue = atol(argv[++i]);
- else if (!strcmp(argv[i], "-displayon")) bKeepDisplayOn = TRUE;
- else if (!strcmp(argv[i], "-keys")) sprintf(keys_config_file, "%s", argv[++i]);
- else if (!strcmp(argv[i], "-autosave")) bAutosaveOnExit = TRUE;
- else if (!strcmp(argv[i], "-disc")) discNumber = atol(argv[++i]);
- else if (!strcmp(argv[i], "-corners")){
- int j = 0;
- i++;
- char num[2];
- for (j=0; j<strlen(argv[i]); j++){
- strncpy(num, argv[i] + j, 1);
- cornerActions[j] = atoi(num);
- }
- }
-
- else if (!strcmp(argv[i], "-spu_reverb")) spu_config.iUseReverb = atol(argv[++i]);
- else if (!strcmp(argv[i], "-spu_interpolation")) spu_config.iUseInterpolation = atol(argv[++i]);
-
- else if (!strcmp(argv[i], "-enhance")) pl_rearmed_cbs.gpu_neon.enhancement_enable = 1;
- else if (!strcmp(argv[i], "-enhancehack")) pl_rearmed_cbs.gpu_neon.enhancement_no_main = 1;
-
- else if (!strcmp(argv[i], "-gles_dithering")) pl_rearmed_cbs.gpu_peopsgl.bDrawDither = atol(argv[++i]);
- else if (!strcmp(argv[i], "-gles_mask")) pl_rearmed_cbs.gpu_peopsgl.iUseMask = atol(argv[++i]);
- else if (!strcmp(argv[i], "-gles_filtering")) pl_rearmed_cbs.gpu_peopsgl.iFilterType = atol(argv[++i]);
- else if (!strcmp(argv[i], "-gles_fbtex")) pl_rearmed_cbs.gpu_peopsgl.iFrameTexType = atol(argv[++i]);
- else if (!strcmp(argv[i], "-gles_vram")) pl_rearmed_cbs.gpu_peopsgl.iVRamSize = atol(argv[++i]);
- else if (!strcmp(argv[i], "-gles_fastmdec")) pl_rearmed_cbs.gpu_peopsgl.bUseFastMdec = atol(argv[++i]);
- else if (!strcmp(argv[i], "-gles_advblend")) pl_rearmed_cbs.gpu_peopsgl.bAdvancedBlend = atol(argv[++i]);
- else if (!strcmp(argv[i], "-gles_opaque")) pl_rearmed_cbs.gpu_peopsgl.bOpaquePass = atol(argv[++i]);
-
- else {
- fprintf(stderr, "Unknown option: %s\n", argv[i]);
- return 1;
- }
- }
-
- pl_init();
- if (emu_core_init() == -1)
- return 1;
-
- if (cdfile) {
- set_cd_image(cdfile);
- strcpy(file_name, strrchr(cdfile,'/'));
- }
-
- if (LoadPlugins() == -1) {
- SysMessage("Failed loading plugins!");
- return 1;
- }
-
- if (discNumber > 0)
- cdrIsoMultidiskSelect = discNumber - 1;
-
- if (OpenPlugins() == -1) {
- return 1;
- }
- plugin_call_rearmed_cbs();
-
- CheckCdrom();
-
- if (getst >= 0){
- char fname[MAXPATHLEN];
-
- get_state_filename(fname, sizeof(fname), getst);
- printf("SAVESTATE: %s\n", fname);
- if (cdrIsoMultidiskCount > 1){
- int i = 0;
- for (i=1; i<cdrIsoMultidiskCount; i++){
- cdrIsoMultidiskSelect = i;
- CdromId[0] = '\0';
- CdromLabel[0] = '\0';
-
- CDR_close();
- if (CDR_open() == 0){
- CheckCdrom();
- get_state_filename(fname, sizeof(fname), getst);
- printf("SAVESTATE: %s\n", fname);
- }
- }
- }
- return 0;
- }
-
- SysReset();
-
- if (file[0] != '\0') {
- if (Load(file) != -1)
- ready_to_go = 1;
- } else {
- if (cdfile) {
- if (LoadCdrom() == -1) {
- ClosePlugins();
- printf(_("Could not load CD-ROM!\n"));
- return -1;
- }
- emu_on_new_cd(0);
- ready_to_go = 1;
- }
- }
-
- if (!ready_to_go) {
- printf ("something goes wrong, maybe you forgot -cdfile ? \n");
- return 1;
- }
-
- if (cdrIsoMultidiskCount > 1)
- printf ("Loaded a multidisc image: %i discs.\n", cdrIsoMultidiskCount);
-
- // If a state has been specified, then load that
- if (loadst) {
- int ret = emu_load_state(loadst - 1);
- printf("%s state %d\n", ret ? "Failed to load" : "Loaded", loadst);
- state_slot = loadst - 1;
- }
-
- if (maemo_init(&argc, &argv))
- return 1;
-
- if (GPU_open != NULL) {
- int ret = GPU_open(&gpuDisp, "PCSX", NULL);
- if (ret){
- fprintf(stderr, "Warning: GPU_open returned %d\n", ret);
- gpuDisp=ret;
- }
- }
-
- if (Config.HLE)
- printf("Note: running without BIOS, expect compatibility problems\n");
-
- dfinput_activate();
- pl_timing_prepare(Config.PsxType);
-
- while (1)
- {
- stop = 0;
- emu_action = SACTION_NONE;
-
- psxCpu->Execute();
- if (emu_action != SACTION_NONE)
- do_emu_action();
- }
-
- maemo_finish();
- return 0;
-}
-
#include <zlib.h>
#ifndef _WIN32
#define CALLBACK
+#ifndef NO_DYLIB
#include <dlfcn.h>
+#endif
#else
#define WIN32_LEAN_AND_MEAN
#include <windows.h>
return 0;
}
-int uncompress2(void *out, unsigned long *out_size, void *in, unsigned long in_size)
+int uncomp2(void *out, unsigned long *out_size, void *in, unsigned long in_size)
{
static z_stream z;
int ret = 0;
ret = uncompress(cdbuffer->raw[0], &cdbuffer_size, cdbuffer->compressed, size);
break;
case CDRC_ZLIB2:
- ret = uncompress2(cdbuffer->raw[0], &cdbuffer_size, cdbuffer->compressed, size);
+ ret = uncomp2(cdbuffer->raw[0], &cdbuffer_size, cdbuffer->compressed, size);
break;
case CDRC_BZ:
ret = pBZ2_bzBuffToBuffDecompress((char *)cdbuffer->raw, (unsigned int *)&cdbuffer_size,
return -1;
}
}
-#ifndef _WIN32
+#if !defined(_WIN32) && !defined(NO_DYLIB)
if (pBZ2_bzBuffToBuffDecompress == NULL) {
void *h = dlopen("/usr/lib/libbz2.so.1", RTLD_LAZY);
if (h == NULL)
PAD##n##_poll = PADpoll_guncon; \
guncon_init(); \
break; \
+ case PSE_PAD_TYPE_NEGCON: \
case PSE_PAD_TYPE_GUN: \
default: \
PAD##n##_startPoll = PAD##n##__startPoll; \
} \
}
+
void dfinput_activate(void)
{
+ #ifndef HAVE_LIBRETRO
PadDataS pad;
+ pad.portMultitap = -1;
+ pad.requestPadIndex = 0;
PAD1_readPort1(&pad);
select_pad(1);
+ pad.requestPadIndex = 1;
PAD2_readPort2(&pad);
select_pad(2);
+ #endif
}
#define PADpoll PADpoll_
#endif
+#ifndef HAVE_LIBRETRO
unsigned char PADpoll_pad(unsigned char value) {
if (CurByte == 0) {
CurCmd = value;
padstate[i].PadMode = padstate[i].pad.controllerType == PSE_PAD_TYPE_ANALOGPAD;
}
}
+#endif
extern const unsigned char cmd_lengths[256];
-int do_cmd_list(unsigned int *list, int list_len, int *last_cmd)
+int do_cmd_list(uint32_t *list, int list_len, int *last_cmd)
{
unsigned int cmd = 0, len;
- unsigned int *list_start = list;
- unsigned int *list_end = list + list_len;
+ uint32_t *list_start = list;
+ uint32_t *list_end = list + list_len;
for (; list < list_end; list += 1 + len)
{
notaz.gp2x.de / pcsx_rearmed.git / commitdiff
